module.exports = /******/ (function(modules, runtime) { // webpackBootstrap /******/ "use strict"; /******/ // The module cache /******/ var installedModules = {}; /******/ /******/ // The require function /******/ function __webpack_require__(moduleId) { /******/ /******/ // Check if module is in cache /******/ if(installedModules[moduleId]) { /******/ return installedModules[moduleId].exports; /******/ } /******/ // Create a new module (and put it into the cache) /******/ var module = installedModules[moduleId] = { /******/ i: moduleId, /******/ l: false, /******/ exports: {} /******/ }; /******/ /******/ // Execute the module function /******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__); /******/ /******/ // Flag the module as loaded /******/ module.l = true; /******/ /******/ // Return the exports of the module /******/ return module.exports; /******/ } /******/ /******/ /******/ __webpack_require__.ab = __dirname + "/"; /******/ /******/ // the startup function /******/ function startup() { /******/ // Load entry module and return exports /******/ return __webpack_require__(104); /******/ }; /******/ /******/ // run startup /******/ return startup(); /******/ }) /************************************************************************/ /******/ ({ /***/ 1: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } return new (P || (P = Promise))(function (resolve, reject) { function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } step((generator = generator.apply(thisArg, _arguments || [])).next()); }); }; Object.defineProperty(exports, "__esModule", { value: true }); const childProcess = __webpack_require__(129); const path = __webpack_require__(622); const util_1 = __webpack_require__(669); const ioUtil = __webpack_require__(672); const exec = util_1.promisify(childProcess.exec); /** * Copies a file or folder. * Based off of shelljs - https://github.com/shelljs/shelljs/blob/9237f66c52e5daa40458f94f9565e18e8132f5a6/src/cp.js * * @param source source path * @param dest destination path * @param options optional. See CopyOptions. */ function cp(source, dest, options = {}) { return __awaiter(this, void 0, void 0, function* () { const { force, recursive } = readCopyOptions(options); const destStat = (yield ioUtil.exists(dest)) ? yield ioUtil.stat(dest) : null; // Dest is an existing file, but not forcing if (destStat && destStat.isFile() && !force) { return; } // If dest is an existing directory, should copy inside. const newDest = destStat && destStat.isDirectory() ? path.join(dest, path.basename(source)) : dest; if (!(yield ioUtil.exists(source))) { throw new Error(`no such file or directory: ${source}`); } const sourceStat = yield ioUtil.stat(source); if (sourceStat.isDirectory()) { if (!recursive) { throw new Error(`Failed to copy. ${source} is a directory, but tried to copy without recursive flag.`); } else { yield cpDirRecursive(source, newDest, 0, force); } } else { if (path.relative(source, newDest) === '') { // a file cannot be copied to itself throw new Error(`'${newDest}' and '${source}' are the same file`); } yield copyFile(source, newDest, force); } }); } exports.cp = cp; /** * Moves a path. * * @param source source path * @param dest destination path * @param options optional. See MoveOptions. */ function mv(source, dest, options = {}) { return __awaiter(this, void 0, void 0, function* () { if (yield ioUtil.exists(dest)) { let destExists = true; if (yield ioUtil.isDirectory(dest)) { // If dest is directory copy src into dest dest = path.join(dest, path.basename(source)); destExists = yield ioUtil.exists(dest); } if (destExists) { if (options.force == null || options.force) { yield rmRF(dest); } else { throw new Error('Destination already exists'); } } } yield mkdirP(path.dirname(dest)); yield ioUtil.rename(source, dest); }); } exports.mv = mv; /** * Remove a path recursively with force * * @param inputPath path to remove */ function rmRF(inputPath) { return __awaiter(this, void 0, void 0, function* () { if (ioUtil.IS_WINDOWS) { // Node doesn't provide a delete operation, only an unlink function. This means that if the file is being used by another // program (e.g. antivirus), it won't be deleted. To address this, we shell out the work to rd/del. try { if (yield ioUtil.isDirectory(inputPath, true)) { yield exec(`rd /s /q "${inputPath}"`); } else { yield exec(`del /f /a "${inputPath}"`); } } catch (err) { // if you try to delete a file that doesn't exist, desired result is achieved // other errors are valid if (err.code !== 'ENOENT') throw err; } // Shelling out fails to remove a symlink folder with missing source, this unlink catches that try { yield ioUtil.unlink(inputPath); } catch (err) { // if you try to delete a file that doesn't exist, desired result is achieved // other errors are valid if (err.code !== 'ENOENT') throw err; } } else { let isDir = false; try { isDir = yield ioUtil.isDirectory(inputPath); } catch (err) { // if you try to delete a file that doesn't exist, desired result is achieved // other errors are valid if (err.code !== 'ENOENT') throw err; return; } if (isDir) { yield exec(`rm -rf "${inputPath}"`); } else { yield ioUtil.unlink(inputPath); } } }); } exports.rmRF = rmRF; /** * Make a directory. Creates the full path with folders in between * Will throw if it fails * * @param fsPath path to create * @returns Promise */ function mkdirP(fsPath) { return __awaiter(this, void 0, void 0, function* () { yield ioUtil.mkdirP(fsPath); }); } exports.mkdirP = mkdirP; /** * Returns path of a tool had the tool actually been invoked. Resolves via paths. * If you check and the tool does not exist, it will throw. * * @param tool name of the tool * @param check whether to check if tool exists * @returns Promise path to tool */ function which(tool, check) { return __awaiter(this, void 0, void 0, function* () { if (!tool) { throw new Error("parameter 'tool' is required"); } // recursive when check=true if (check) { const result = yield which(tool, false); if (!result) { if (ioUtil.IS_WINDOWS) { throw new Error(`Unable to locate executable file: ${tool}. Please verify either the file path exists or the file can be found within a directory specified by the PATH environment variable. Also verify the file has a valid extension for an executable file.`); } else { throw new Error(`Unable to locate executable file: ${tool}. Please verify either the file path exists or the file can be found within a directory specified by the PATH environment variable. Also check the file mode to verify the file is executable.`); } } } try { // build the list of extensions to try const extensions = []; if (ioUtil.IS_WINDOWS && process.env.PATHEXT) { for (const extension of process.env.PATHEXT.split(path.delimiter)) { if (extension) { extensions.push(extension); } } } // if it's rooted, return it if exists. otherwise return empty. if (ioUtil.isRooted(tool)) { const filePath = yield ioUtil.tryGetExecutablePath(tool, extensions); if (filePath) { return filePath; } return ''; } // if any path separators, return empty if (tool.includes('/') || (ioUtil.IS_WINDOWS && tool.includes('\\'))) { return ''; } // build the list of directories // // Note, technically "where" checks the current directory on Windows. From a toolkit perspective, // it feels like we should not do this. Checking the current directory seems like more of a use // case of a shell, and the which() function exposed by the toolkit should strive for consistency // across platforms. const directories = []; if (process.env.PATH) { for (const p of process.env.PATH.split(path.delimiter)) { if (p) { directories.push(p); } } } // return the first match for (const directory of directories) { const filePath = yield ioUtil.tryGetExecutablePath(directory + path.sep + tool, extensions); if (filePath) { return filePath; } } return ''; } catch (err) { throw new Error(`which failed with message ${err.message}`); } }); } exports.which = which; function readCopyOptions(options) { const force = options.force == null ? true : options.force; const recursive = Boolean(options.recursive); return { force, recursive }; } function cpDirRecursive(sourceDir, destDir, currentDepth, force) { return __awaiter(this, void 0, void 0, function* () { // Ensure there is not a run away recursive copy if (currentDepth >= 255) return; currentDepth++; yield mkdirP(destDir); const files = yield ioUtil.readdir(sourceDir); for (const fileName of files) { const srcFile = `${sourceDir}/${fileName}`; const destFile = `${destDir}/${fileName}`; const srcFileStat = yield ioUtil.lstat(srcFile); if (srcFileStat.isDirectory()) { // Recurse yield cpDirRecursive(srcFile, destFile, currentDepth, force); } else { yield copyFile(srcFile, destFile, force); } } // Change the mode for the newly created directory yield ioUtil.chmod(destDir, (yield ioUtil.stat(sourceDir)).mode); }); } // Buffered file copy function copyFile(srcFile, destFile, force) { return __awaiter(this, void 0, void 0, function* () { if ((yield ioUtil.lstat(srcFile)).isSymbolicLink()) { // unlink/re-link it try { yield ioUtil.lstat(destFile); yield ioUtil.unlink(destFile); } catch (e) { // Try to override file permission if (e.code === 'EPERM') { yield ioUtil.chmod(destFile, '0666'); yield ioUtil.unlink(destFile); } // other errors = it doesn't exist, no work to do } // Copy over symlink const symlinkFull = yield ioUtil.readlink(srcFile); yield ioUtil.symlink(symlinkFull, destFile, ioUtil.IS_WINDOWS ? 'junction' : null); } else if (!(yield ioUtil.exists(destFile)) || force) { yield ioUtil.copyFile(srcFile, destFile); } }); } //# sourceMappingURL=io.js.map /***/ }), /***/ 9: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } return new (P || (P = Promise))(function (resolve, reject) { function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } step((generator = generator.apply(thisArg, _arguments || [])).next()); }); }; Object.defineProperty(exports, "__esModule", { value: true }); const os = __webpack_require__(87); const events = __webpack_require__(614); const child = __webpack_require__(129); const path = __webpack_require__(622); const io = __webpack_require__(1); const ioUtil = __webpack_require__(672); /* eslint-disable @typescript-eslint/unbound-method */ const IS_WINDOWS = process.platform === 'win32'; /* * Class for running command line tools. Handles quoting and arg parsing in a platform agnostic way. */ class ToolRunner extends events.EventEmitter { constructor(toolPath, args, options) { super(); if (!toolPath) { throw new Error("Parameter 'toolPath' cannot be null or empty."); } this.toolPath = toolPath; this.args = args || []; this.options = options || {}; } _debug(message) { if (this.options.listeners && this.options.listeners.debug) { this.options.listeners.debug(message); } } _getCommandString(options, noPrefix) { const toolPath = this._getSpawnFileName(); const args = this._getSpawnArgs(options); let cmd = noPrefix ? '' : '[command]'; // omit prefix when piped to a second tool if (IS_WINDOWS) { // Windows + cmd file if (this._isCmdFile()) { cmd += toolPath; for (const a of args) { cmd += ` ${a}`; } } // Windows + verbatim else if (options.windowsVerbatimArguments) { cmd += `"${toolPath}"`; for (const a of args) { cmd += ` ${a}`; } } // Windows (regular) else { cmd += this._windowsQuoteCmdArg(toolPath); for (const a of args) { cmd += ` ${this._windowsQuoteCmdArg(a)}`; } } } else { // OSX/Linux - this can likely be improved with some form of quoting. // creating processes on Unix is fundamentally different than Windows. // on Unix, execvp() takes an arg array. cmd += toolPath; for (const a of args) { cmd += ` ${a}`; } } return cmd; } _processLineBuffer(data, strBuffer, onLine) { try { let s = strBuffer + data.toString(); let n = s.indexOf(os.EOL); while (n > -1) { const line = s.substring(0, n); onLine(line); // the rest of the string ... s = s.substring(n + os.EOL.length); n = s.indexOf(os.EOL); } strBuffer = s; } catch (err) { // streaming lines to console is best effort. Don't fail a build. this._debug(`error processing line. Failed with error ${err}`); } } _getSpawnFileName() { if (IS_WINDOWS) { if (this._isCmdFile()) { return process.env['COMSPEC'] || 'cmd.exe'; } } return this.toolPath; } _getSpawnArgs(options) { if (IS_WINDOWS) { if (this._isCmdFile()) { let argline = `/D /S /C "${this._windowsQuoteCmdArg(this.toolPath)}`; for (const a of this.args) { argline += ' '; argline += options.windowsVerbatimArguments ? a : this._windowsQuoteCmdArg(a); } argline += '"'; return [argline]; } } return this.args; } _endsWith(str, end) { return str.endsWith(end); } _isCmdFile() { const upperToolPath = this.toolPath.toUpperCase(); return (this._endsWith(upperToolPath, '.CMD') || this._endsWith(upperToolPath, '.BAT')); } _windowsQuoteCmdArg(arg) { // for .exe, apply the normal quoting rules that libuv applies if (!this._isCmdFile()) { return this._uvQuoteCmdArg(arg); } // otherwise apply quoting rules specific to the cmd.exe command line parser. // the libuv rules are generic and are not designed specifically for cmd.exe // command line parser. // // for a detailed description of the cmd.exe command line parser, refer to // http://stackoverflow.com/questions/4094699/how-does-the-windows-command-interpreter-cmd-exe-parse-scripts/7970912#7970912 // need quotes for empty arg if (!arg) { return '""'; } // determine whether the arg needs to be quoted const cmdSpecialChars = [ ' ', '\t', '&', '(', ')', '[', ']', '{', '}', '^', '=', ';', '!', "'", '+', ',', '`', '~', '|', '<', '>', '"' ]; let needsQuotes = false; for (const char of arg) { if (cmdSpecialChars.some(x => x === char)) { needsQuotes = true; break; } } // short-circuit if quotes not needed if (!needsQuotes) { return arg; } // the following quoting rules are very similar to the rules that by libuv applies. // // 1) wrap the string in quotes // // 2) double-up quotes - i.e. " => "" // // this is different from the libuv quoting rules. libuv replaces " with \", which unfortunately // doesn't work well with a cmd.exe command line. // // note, replacing " with "" also works well if the arg is passed to a downstream .NET console app. // for example, the command line: // foo.exe "myarg:""my val""" // is parsed by a .NET console app into an arg array: // [ "myarg:\"my val\"" ] // which is the same end result when applying libuv quoting rules. although the actual // command line from libuv quoting rules would look like: // foo.exe "myarg:\"my val\"" // // 3) double-up slashes that precede a quote, // e.g. hello \world => "hello \world" // hello\"world => "hello\\""world" // hello\\"world => "hello\\\\""world" // hello world\ => "hello world\\" // // technically this is not required for a cmd.exe command line, or the batch argument parser. // the reasons for including this as a .cmd quoting rule are: // // a) this is optimized for the scenario where the argument is passed from the .cmd file to an // external program. many programs (e.g. .NET console apps) rely on the slash-doubling rule. // // b) it's what we've been doing previously (by deferring to node default behavior) and we // haven't heard any complaints about that aspect. // // note, a weakness of the quoting rules chosen here, is that % is not escaped. in fact, % cannot be // escaped when used on the command line directly - even though within a .cmd file % can be escaped // by using %%. // // the saving grace is, on the command line, %var% is left as-is if var is not defined. this contrasts // the line parsing rules within a .cmd file, where if var is not defined it is replaced with nothing. // // one option that was explored was replacing % with ^% - i.e. %var% => ^%var^%. this hack would // often work, since it is unlikely that var^ would exist, and the ^ character is removed when the // variable is used. the problem, however, is that ^ is not removed when %* is used to pass the args // to an external program. // // an unexplored potential solution for the % escaping problem, is to create a wrapper .cmd file. // % can be escaped within a .cmd file. let reverse = '"'; let quoteHit = true; for (let i = arg.length; i > 0; i--) { // walk the string in reverse reverse += arg[i - 1]; if (quoteHit && arg[i - 1] === '\\') { reverse += '\\'; // double the slash } else if (arg[i - 1] === '"') { quoteHit = true; reverse += '"'; // double the quote } else { quoteHit = false; } } reverse += '"'; return reverse .split('') .reverse() .join(''); } _uvQuoteCmdArg(arg) { // Tool runner wraps child_process.spawn() and needs to apply the same quoting as // Node in certain cases where the undocumented spawn option windowsVerbatimArguments // is used. // // Since this function is a port of quote_cmd_arg from Node 4.x (technically, lib UV, // see https://github.com/nodejs/node/blob/v4.x/deps/uv/src/win/process.c for details), // pasting copyright notice from Node within this function: // // Copyright Joyent, Inc. and other Node contributors. All rights reserved. // // Permission is hereby granted, free of charge, to any person obtaining a copy // of this software and associated documentation files (the "Software"), to // deal in the Software without restriction, including without limitation the // rights to use, copy, modify, merge, publish, distribute, sublicense, and/or // sell copies of the Software, and to permit persons to whom the Software is // furnished to do so, subject to the following conditions: // // The above copyright notice and this permission notice shall be included in // all copies or substantial portions of the Software. // // THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR // IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, // FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE // AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER // LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING // FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS // IN THE SOFTWARE. if (!arg) { // Need double quotation for empty argument return '""'; } if (!arg.includes(' ') && !arg.includes('\t') && !arg.includes('"')) { // No quotation needed return arg; } if (!arg.includes('"') && !arg.includes('\\')) { // No embedded double quotes or backslashes, so I can just wrap // quote marks around the whole thing. return `"${arg}"`; } // Expected input/output: // input : hello"world // output: "hello\"world" // input : hello""world // output: "hello\"\"world" // input : hello\world // output: hello\world // input : hello\\world // output: hello\\world // input : hello\"world // output: "hello\\\"world" // input : hello\\"world // output: "hello\\\\\"world" // input : hello world\ // output: "hello world\\" - note the comment in libuv actually reads "hello world\" // but it appears the comment is wrong, it should be "hello world\\" let reverse = '"'; let quoteHit = true; for (let i = arg.length; i > 0; i--) { // walk the string in reverse reverse += arg[i - 1]; if (quoteHit && arg[i - 1] === '\\') { reverse += '\\'; } else if (arg[i - 1] === '"') { quoteHit = true; reverse += '\\'; } else { quoteHit = false; } } reverse += '"'; return reverse .split('') .reverse() .join(''); } _cloneExecOptions(options) { options = options || {}; const result = { cwd: options.cwd || process.cwd(), env: options.env || process.env, silent: options.silent || false, windowsVerbatimArguments: options.windowsVerbatimArguments || false, failOnStdErr: options.failOnStdErr || false, ignoreReturnCode: options.ignoreReturnCode || false, delay: options.delay || 10000 }; result.outStream = options.outStream || process.stdout; result.errStream = options.errStream || process.stderr; return result; } _getSpawnOptions(options, toolPath) { options = options || {}; const result = {}; result.cwd = options.cwd; result.env = options.env; result['windowsVerbatimArguments'] = options.windowsVerbatimArguments || this._isCmdFile(); if (options.windowsVerbatimArguments) { result.argv0 = `"${toolPath}"`; } return result; } /** * Exec a tool. * Output will be streamed to the live console. * Returns promise with return code * * @param tool path to tool to exec * @param options optional exec options. See ExecOptions * @returns number */ exec() { return __awaiter(this, void 0, void 0, function* () { // root the tool path if it is unrooted and contains relative pathing if (!ioUtil.isRooted(this.toolPath) && (this.toolPath.includes('/') || (IS_WINDOWS && this.toolPath.includes('\\')))) { // prefer options.cwd if it is specified, however options.cwd may also need to be rooted this.toolPath = path.resolve(process.cwd(), this.options.cwd || process.cwd(), this.toolPath); } // if the tool is only a file name, then resolve it from the PATH // otherwise verify it exists (add extension on Windows if necessary) this.toolPath = yield io.which(this.toolPath, true); return new Promise((resolve, reject) => { this._debug(`exec tool: ${this.toolPath}`); this._debug('arguments:'); for (const arg of this.args) { this._debug(` ${arg}`); } const optionsNonNull = this._cloneExecOptions(this.options); if (!optionsNonNull.silent && optionsNonNull.outStream) { optionsNonNull.outStream.write(this._getCommandString(optionsNonNull) + os.EOL); } const state = new ExecState(optionsNonNull, this.toolPath); state.on('debug', (message) => { this._debug(message); }); const fileName = this._getSpawnFileName(); const cp = child.spawn(fileName, this._getSpawnArgs(optionsNonNull), this._getSpawnOptions(this.options, fileName)); const stdbuffer = ''; if (cp.stdout) { cp.stdout.on('data', (data) => { if (this.options.listeners && this.options.listeners.stdout) { this.options.listeners.stdout(data); } if (!optionsNonNull.silent && optionsNonNull.outStream) { optionsNonNull.outStream.write(data); } this._processLineBuffer(data, stdbuffer, (line) => { if (this.options.listeners && this.options.listeners.stdline) { this.options.listeners.stdline(line); } }); }); } const errbuffer = ''; if (cp.stderr) { cp.stderr.on('data', (data) => { state.processStderr = true; if (this.options.listeners && this.options.listeners.stderr) { this.options.listeners.stderr(data); } if (!optionsNonNull.silent && optionsNonNull.errStream && optionsNonNull.outStream) { const s = optionsNonNull.failOnStdErr ? optionsNonNull.errStream : optionsNonNull.outStream; s.write(data); } this._processLineBuffer(data, errbuffer, (line) => { if (this.options.listeners && this.options.listeners.errline) { this.options.listeners.errline(line); } }); }); } cp.on('error', (err) => { state.processError = err.message; state.processExited = true; state.processClosed = true; state.CheckComplete(); }); cp.on('exit', (code) => { state.processExitCode = code; state.processExited = true; this._debug(`Exit code ${code} received from tool '${this.toolPath}'`); state.CheckComplete(); }); cp.on('close', (code) => { state.processExitCode = code; state.processExited = true; state.processClosed = true; this._debug(`STDIO streams have closed for tool '${this.toolPath}'`); state.CheckComplete(); }); state.on('done', (error, exitCode) => { if (stdbuffer.length > 0) { this.emit('stdline', stdbuffer); } if (errbuffer.length > 0) { this.emit('errline', errbuffer); } cp.removeAllListeners(); if (error) { reject(error); } else { resolve(exitCode); } }); }); }); } } exports.ToolRunner = ToolRunner; /** * Convert an arg string to an array of args. Handles escaping * * @param argString string of arguments * @returns string[] array of arguments */ function argStringToArray(argString) { const args = []; let inQuotes = false; let escaped = false; let arg = ''; function append(c) { // we only escape double quotes. if (escaped && c !== '"') { arg += '\\'; } arg += c; escaped = false; } for (let i = 0; i < argString.length; i++) { const c = argString.charAt(i); if (c === '"') { if (!escaped) { inQuotes = !inQuotes; } else { append(c); } continue; } if (c === '\\' && escaped) { append(c); continue; } if (c === '\\' && inQuotes) { escaped = true; continue; } if (c === ' ' && !inQuotes) { if (arg.length > 0) { args.push(arg); arg = ''; } continue; } append(c); } if (arg.length > 0) { args.push(arg.trim()); } return args; } exports.argStringToArray = argStringToArray; class ExecState extends events.EventEmitter { constructor(options, toolPath) { super(); this.processClosed = false; // tracks whether the process has exited and stdio is closed this.processError = ''; this.processExitCode = 0; this.processExited = false; // tracks whether the process has exited this.processStderr = false; // tracks whether stderr was written to this.delay = 10000; // 10 seconds this.done = false; this.timeout = null; if (!toolPath) { throw new Error('toolPath must not be empty'); } this.options = options; this.toolPath = toolPath; if (options.delay) { this.delay = options.delay; } } CheckComplete() { if (this.done) { return; } if (this.processClosed) { this._setResult(); } else if (this.processExited) { this.timeout = setTimeout(ExecState.HandleTimeout, this.delay, this); } } _debug(message) { this.emit('debug', message); } _setResult() { // determine whether there is an error let error; if (this.processExited) { if (this.processError) { error = new Error(`There was an error when attempting to execute the process '${this.toolPath}'. This may indicate the process failed to start. Error: ${this.processError}`); } else if (this.processExitCode !== 0 && !this.options.ignoreReturnCode) { error = new Error(`The process '${this.toolPath}' failed with exit code ${this.processExitCode}`); } else if (this.processStderr && this.options.failOnStdErr) { error = new Error(`The process '${this.toolPath}' failed because one or more lines were written to the STDERR stream`); } } // clear the timeout if (this.timeout) { clearTimeout(this.timeout); this.timeout = null; } this.done = true; this.emit('done', error, this.processExitCode); } static HandleTimeout(state) { if (state.done) { return; } if (!state.processClosed && state.processExited) { const message = `The STDIO streams did not close within ${state.delay / 1000} seconds of the exit event from process '${state.toolPath}'. This may indicate a child process inherited the STDIO streams and has not yet exited.`; state._debug(message); } state._setResult(); } } //# sourceMappingURL=toolrunner.js.map /***/ }), /***/ 13: /***/ (function(module) { "use strict"; var replace = String.prototype.replace; var percentTwenties = /%20/g; module.exports = { 'default': 'RFC3986', formatters: { RFC1738: function (value) { return replace.call(value, percentTwenties, '+'); }, RFC3986: function (value) { return value; } }, RFC1738: 'RFC1738', RFC3986: 'RFC3986' }; /***/ }), /***/ 16: /***/ (function(module) { module.exports = require("tls"); /***/ }), /***/ 28: /***/ (function(module) { "use strict"; module.exports = function generate_comment(it, $keyword, $ruleType) { var out = ' '; var $schema = it.schema[$keyword]; var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $comment = it.util.toQuotedString($schema); if (it.opts.$comment === true) { out += ' console.log(' + ($comment) + ');'; } else if (typeof it.opts.$comment == 'function') { out += ' self._opts.$comment(' + ($comment) + ', ' + (it.util.toQuotedString($errSchemaPath)) + ', validate.root.schema);'; } return out; } /***/ }), /***/ 35: /***/ (function(module) { "use strict"; module.exports = function generate_propertyNames(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $data = 'data' + ($dataLvl || ''); var $errs = 'errs__' + $lvl; var $it = it.util.copy(it); var $closingBraces = ''; $it.level++; var $nextValid = 'valid' + $it.level; out += 'var ' + ($errs) + ' = errors;'; if ((it.opts.strictKeywords ? typeof $schema == 'object' && Object.keys($schema).length > 0 : it.util.schemaHasRules($schema, it.RULES.all))) { $it.schema = $schema; $it.schemaPath = $schemaPath; $it.errSchemaPath = $errSchemaPath; var $key = 'key' + $lvl, $idx = 'idx' + $lvl, $i = 'i' + $lvl, $invalidName = '\' + ' + $key + ' + \'', $dataNxt = $it.dataLevel = it.dataLevel + 1, $nextData = 'data' + $dataNxt, $dataProperties = 'dataProperties' + $lvl, $ownProperties = it.opts.ownProperties, $currentBaseId = it.baseId; if ($ownProperties) { out += ' var ' + ($dataProperties) + ' = undefined; '; } if ($ownProperties) { out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; '; } else { out += ' for (var ' + ($key) + ' in ' + ($data) + ') { '; } out += ' var startErrs' + ($lvl) + ' = errors; '; var $passData = $key; var $wasComposite = it.compositeRule; it.compositeRule = $it.compositeRule = true; var $code = it.validate($it); $it.baseId = $currentBaseId; if (it.util.varOccurences($code, $nextData) < 2) { out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; } else { out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; } it.compositeRule = $it.compositeRule = $wasComposite; out += ' if (!' + ($nextValid) + ') { for (var ' + ($i) + '=startErrs' + ($lvl) + '; ' + ($i) + ' All rights reserved. // If you have no idea what ASN.1 or BER is, see this: // ftp://ftp.rsa.com/pub/pkcs/ascii/layman.asc var Ber = __webpack_require__(249); // --- Exported API module.exports = { Ber: Ber, BerReader: Ber.Reader, BerWriter: Ber.Writer }; /***/ }), /***/ 64: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2012 Joyent, Inc. All rights reserved. var assert = __webpack_require__(477); var crypto = __webpack_require__(417); var http = __webpack_require__(605); var util = __webpack_require__(669); var sshpk = __webpack_require__(650); var jsprim = __webpack_require__(348); var utils = __webpack_require__(909); var sprintf = __webpack_require__(669).format; var HASH_ALGOS = utils.HASH_ALGOS; var PK_ALGOS = utils.PK_ALGOS; var InvalidAlgorithmError = utils.InvalidAlgorithmError; var HttpSignatureError = utils.HttpSignatureError; var validateAlgorithm = utils.validateAlgorithm; ///--- Globals var AUTHZ_FMT = 'Signature keyId="%s",algorithm="%s",headers="%s",signature="%s"'; ///--- Specific Errors function MissingHeaderError(message) { HttpSignatureError.call(this, message, MissingHeaderError); } util.inherits(MissingHeaderError, HttpSignatureError); function StrictParsingError(message) { HttpSignatureError.call(this, message, StrictParsingError); } util.inherits(StrictParsingError, HttpSignatureError); /* See createSigner() */ function RequestSigner(options) { assert.object(options, 'options'); var alg = []; if (options.algorithm !== undefined) { assert.string(options.algorithm, 'options.algorithm'); alg = validateAlgorithm(options.algorithm); } this.rs_alg = alg; /* * RequestSigners come in two varieties: ones with an rs_signFunc, and ones * with an rs_signer. * * rs_signFunc-based RequestSigners have to build up their entire signing * string within the rs_lines array and give it to rs_signFunc as a single * concat'd blob. rs_signer-based RequestSigners can add a line at a time to * their signing state by using rs_signer.update(), thus only needing to * buffer the hash function state and one line at a time. */ if (options.sign !== undefined) { assert.func(options.sign, 'options.sign'); this.rs_signFunc = options.sign; } else if (alg[0] === 'hmac' && options.key !== undefined) { assert.string(options.keyId, 'options.keyId'); this.rs_keyId = options.keyId; if (typeof (options.key) !== 'string' && !Buffer.isBuffer(options.key)) throw (new TypeError('options.key for HMAC must be a string or Buffer')); /* * Make an rs_signer for HMACs, not a rs_signFunc -- HMACs digest their * data in chunks rather than requiring it all to be given in one go * at the end, so they are more similar to signers than signFuncs. */ this.rs_signer = crypto.createHmac(alg[1].toUpperCase(), options.key); this.rs_signer.sign = function () { var digest = this.digest('base64'); return ({ hashAlgorithm: alg[1], toString: function () { return (digest); } }); }; } else if (options.key !== undefined) { var key = options.key; if (typeof (key) === 'string' || Buffer.isBuffer(key)) key = sshpk.parsePrivateKey(key); assert.ok(sshpk.PrivateKey.isPrivateKey(key, [1, 2]), 'options.key must be a sshpk.PrivateKey'); this.rs_key = key; assert.string(options.keyId, 'options.keyId'); this.rs_keyId = options.keyId; if (!PK_ALGOS[key.type]) { throw (new InvalidAlgorithmError(key.type.toUpperCase() + ' type ' + 'keys are not supported')); } if (alg[0] !== undefined && key.type !== alg[0]) { throw (new InvalidAlgorithmError('options.key must be a ' + alg[0].toUpperCase() + ' key, was given a ' + key.type.toUpperCase() + ' key instead')); } this.rs_signer = key.createSign(alg[1]); } else { throw (new TypeError('options.sign (func) or options.key is required')); } this.rs_headers = []; this.rs_lines = []; } /** * Adds a header to be signed, with its value, into this signer. * * @param {String} header * @param {String} value * @return {String} value written */ RequestSigner.prototype.writeHeader = function (header, value) { assert.string(header, 'header'); header = header.toLowerCase(); assert.string(value, 'value'); this.rs_headers.push(header); if (this.rs_signFunc) { this.rs_lines.push(header + ': ' + value); } else { var line = header + ': ' + value; if (this.rs_headers.length > 0) line = '\n' + line; this.rs_signer.update(line); } return (value); }; /** * Adds a default Date header, returning its value. * * @return {String} */ RequestSigner.prototype.writeDateHeader = function () { return (this.writeHeader('date', jsprim.rfc1123(new Date()))); }; /** * Adds the request target line to be signed. * * @param {String} method, HTTP method (e.g. 'get', 'post', 'put') * @param {String} path */ RequestSigner.prototype.writeTarget = function (method, path) { assert.string(method, 'method'); assert.string(path, 'path'); method = method.toLowerCase(); this.writeHeader('(request-target)', method + ' ' + path); }; /** * Calculate the value for the Authorization header on this request * asynchronously. * * @param {Func} callback (err, authz) */ RequestSigner.prototype.sign = function (cb) { assert.func(cb, 'callback'); if (this.rs_headers.length < 1) throw (new Error('At least one header must be signed')); var alg, authz; if (this.rs_signFunc) { var data = this.rs_lines.join('\n'); var self = this; this.rs_signFunc(data, function (err, sig) { if (err) { cb(err); return; } try { assert.object(sig, 'signature'); assert.string(sig.keyId, 'signature.keyId'); assert.string(sig.algorithm, 'signature.algorithm'); assert.string(sig.signature, 'signature.signature'); alg = validateAlgorithm(sig.algorithm); authz = sprintf(AUTHZ_FMT, sig.keyId, sig.algorithm, self.rs_headers.join(' '), sig.signature); } catch (e) { cb(e); return; } cb(null, authz); }); } else { try { var sigObj = this.rs_signer.sign(); } catch (e) { cb(e); return; } alg = (this.rs_alg[0] || this.rs_key.type) + '-' + sigObj.hashAlgorithm; var signature = sigObj.toString(); authz = sprintf(AUTHZ_FMT, this.rs_keyId, alg, this.rs_headers.join(' '), signature); cb(null, authz); } }; ///--- Exported API module.exports = { /** * Identifies whether a given object is a request signer or not. * * @param {Object} object, the object to identify * @returns {Boolean} */ isSigner: function (obj) { if (typeof (obj) === 'object' && obj instanceof RequestSigner) return (true); return (false); }, /** * Creates a request signer, used to asynchronously build a signature * for a request (does not have to be an http.ClientRequest). * * @param {Object} options, either: * - {String} keyId * - {String|Buffer} key * - {String} algorithm (optional, required for HMAC) * or: * - {Func} sign (data, cb) * @return {RequestSigner} */ createSigner: function createSigner(options) { return (new RequestSigner(options)); }, /** * Adds an 'Authorization' header to an http.ClientRequest object. * * Note that this API will add a Date header if it's not already set. Any * other headers in the options.headers array MUST be present, or this * will throw. * * You shouldn't need to check the return type; it's just there if you want * to be pedantic. * * The optional flag indicates whether parsing should use strict enforcement * of the version draft-cavage-http-signatures-04 of the spec or beyond. * The default is to be loose and support * older versions for compatibility. * * @param {Object} request an instance of http.ClientRequest. * @param {Object} options signing parameters object: * - {String} keyId required. * - {String} key required (either a PEM or HMAC key). * - {Array} headers optional; defaults to ['date']. * - {String} algorithm optional (unless key is HMAC); * default is the same as the sshpk default * signing algorithm for the type of key given * - {String} httpVersion optional; defaults to '1.1'. * - {Boolean} strict optional; defaults to 'false'. * @return {Boolean} true if Authorization (and optionally Date) were added. * @throws {TypeError} on bad parameter types (input). * @throws {InvalidAlgorithmError} if algorithm was bad or incompatible with * the given key. * @throws {sshpk.KeyParseError} if key was bad. * @throws {MissingHeaderError} if a header to be signed was specified but * was not present. */ signRequest: function signRequest(request, options) { assert.object(request, 'request'); assert.object(options, 'options'); assert.optionalString(options.algorithm, 'options.algorithm'); assert.string(options.keyId, 'options.keyId'); assert.optionalArrayOfString(options.headers, 'options.headers'); assert.optionalString(options.httpVersion, 'options.httpVersion'); if (!request.getHeader('Date')) request.setHeader('Date', jsprim.rfc1123(new Date())); if (!options.headers) options.headers = ['date']; if (!options.httpVersion) options.httpVersion = '1.1'; var alg = []; if (options.algorithm) { options.algorithm = options.algorithm.toLowerCase(); alg = validateAlgorithm(options.algorithm); } var i; var stringToSign = ''; for (i = 0; i < options.headers.length; i++) { if (typeof (options.headers[i]) !== 'string') throw new TypeError('options.headers must be an array of Strings'); var h = options.headers[i].toLowerCase(); if (h === 'request-line') { if (!options.strict) { /** * We allow headers from the older spec drafts if strict parsing isn't * specified in options. */ stringToSign += request.method + ' ' + request.path + ' HTTP/' + options.httpVersion; } else { /* Strict parsing doesn't allow older draft headers. */ throw (new StrictParsingError('request-line is not a valid header ' + 'with strict parsing enabled.')); } } else if (h === '(request-target)') { stringToSign += '(request-target): ' + request.method.toLowerCase() + ' ' + request.path; } else { var value = request.getHeader(h); if (value === undefined || value === '') { throw new MissingHeaderError(h + ' was not in the request'); } stringToSign += h + ': ' + value; } if ((i + 1) < options.headers.length) stringToSign += '\n'; } /* This is just for unit tests. */ if (request.hasOwnProperty('_stringToSign')) { request._stringToSign = stringToSign; } var signature; if (alg[0] === 'hmac') { if (typeof (options.key) !== 'string' && !Buffer.isBuffer(options.key)) throw (new TypeError('options.key must be a string or Buffer')); var hmac = crypto.createHmac(alg[1].toUpperCase(), options.key); hmac.update(stringToSign); signature = hmac.digest('base64'); } else { var key = options.key; if (typeof (key) === 'string' || Buffer.isBuffer(key)) key = sshpk.parsePrivateKey(options.key); assert.ok(sshpk.PrivateKey.isPrivateKey(key, [1, 2]), 'options.key must be a sshpk.PrivateKey'); if (!PK_ALGOS[key.type]) { throw (new InvalidAlgorithmError(key.type.toUpperCase() + ' type ' + 'keys are not supported')); } if (alg[0] !== undefined && key.type !== alg[0]) { throw (new InvalidAlgorithmError('options.key must be a ' + alg[0].toUpperCase() + ' key, was given a ' + key.type.toUpperCase() + ' key instead')); } var signer = key.createSign(alg[1]); signer.update(stringToSign); var sigObj = signer.sign(); if (!HASH_ALGOS[sigObj.hashAlgorithm]) { throw (new InvalidAlgorithmError(sigObj.hashAlgorithm.toUpperCase() + ' is not a supported hash algorithm')); } options.algorithm = key.type + '-' + sigObj.hashAlgorithm; signature = sigObj.toString(); assert.notStrictEqual(signature, '', 'empty signature produced'); } var authzHeaderName = options.authorizationHeaderName || 'Authorization'; request.setHeader(authzHeaderName, sprintf(AUTHZ_FMT, options.keyId, options.algorithm, options.headers.join(' '), signature)); return true; } }; /***/ }), /***/ 69: /***/ (function(module) { // populates missing values module.exports = function(dst, src) { Object.keys(src).forEach(function(prop) { dst[prop] = dst[prop] || src[prop]; }); return dst; }; /***/ }), /***/ 78: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2015 Joyent, Inc. module.exports = { read: read, readSSHPrivate: readSSHPrivate, write: write }; var assert = __webpack_require__(477); var asn1 = __webpack_require__(62); var Buffer = __webpack_require__(215).Buffer; var algs = __webpack_require__(98); var utils = __webpack_require__(270); var crypto = __webpack_require__(417); var Key = __webpack_require__(852); var PrivateKey = __webpack_require__(502); var pem = __webpack_require__(268); var rfc4253 = __webpack_require__(538); var SSHBuffer = __webpack_require__(940); var errors = __webpack_require__(753); var bcrypt; function read(buf, options) { return (pem.read(buf, options)); } var MAGIC = 'openssh-key-v1'; function readSSHPrivate(type, buf, options) { buf = new SSHBuffer({buffer: buf}); var magic = buf.readCString(); assert.strictEqual(magic, MAGIC, 'bad magic string'); var cipher = buf.readString(); var kdf = buf.readString(); var kdfOpts = buf.readBuffer(); var nkeys = buf.readInt(); if (nkeys !== 1) { throw (new Error('OpenSSH-format key file contains ' + 'multiple keys: this is unsupported.')); } var pubKey = buf.readBuffer(); if (type === 'public') { assert.ok(buf.atEnd(), 'excess bytes left after key'); return (rfc4253.read(pubKey)); } var privKeyBlob = buf.readBuffer(); assert.ok(buf.atEnd(), 'excess bytes left after key'); var kdfOptsBuf = new SSHBuffer({ buffer: kdfOpts }); switch (kdf) { case 'none': if (cipher !== 'none') { throw (new Error('OpenSSH-format key uses KDF "none" ' + 'but specifies a cipher other than "none"')); } break; case 'bcrypt': var salt = kdfOptsBuf.readBuffer(); var rounds = kdfOptsBuf.readInt(); var cinf = utils.opensshCipherInfo(cipher); if (bcrypt === undefined) { bcrypt = __webpack_require__(641); } if (typeof (options.passphrase) === 'string') { options.passphrase = Buffer.from(options.passphrase, 'utf-8'); } if (!Buffer.isBuffer(options.passphrase)) { throw (new errors.KeyEncryptedError( options.filename, 'OpenSSH')); } var pass = new Uint8Array(options.passphrase); var salti = new Uint8Array(salt); /* Use the pbkdf to derive both the key and the IV. */ var out = new Uint8Array(cinf.keySize + cinf.blockSize); var res = bcrypt.pbkdf(pass, pass.length, salti, salti.length, out, out.length, rounds); if (res !== 0) { throw (new Error('bcrypt_pbkdf function returned ' + 'failure, parameters invalid')); } out = Buffer.from(out); var ckey = out.slice(0, cinf.keySize); var iv = out.slice(cinf.keySize, cinf.keySize + cinf.blockSize); var cipherStream = crypto.createDecipheriv(cinf.opensslName, ckey, iv); cipherStream.setAutoPadding(false); var chunk, chunks = []; cipherStream.once('error', function (e) { if (e.toString().indexOf('bad decrypt') !== -1) { throw (new Error('Incorrect passphrase ' + 'supplied, could not decrypt key')); } throw (e); }); cipherStream.write(privKeyBlob); cipherStream.end(); while ((chunk = cipherStream.read()) !== null) chunks.push(chunk); privKeyBlob = Buffer.concat(chunks); break; default: throw (new Error( 'OpenSSH-format key uses unknown KDF "' + kdf + '"')); } buf = new SSHBuffer({buffer: privKeyBlob}); var checkInt1 = buf.readInt(); var checkInt2 = buf.readInt(); if (checkInt1 !== checkInt2) { throw (new Error('Incorrect passphrase supplied, could not ' + 'decrypt key')); } var ret = {}; var key = rfc4253.readInternal(ret, 'private', buf.remainder()); buf.skip(ret.consumed); var comment = buf.readString(); key.comment = comment; return (key); } function write(key, options) { var pubKey; if (PrivateKey.isPrivateKey(key)) pubKey = key.toPublic(); else pubKey = key; var cipher = 'none'; var kdf = 'none'; var kdfopts = Buffer.alloc(0); var cinf = { blockSize: 8 }; var passphrase; if (options !== undefined) { passphrase = options.passphrase; if (typeof (passphrase) === 'string') passphrase = Buffer.from(passphrase, 'utf-8'); if (passphrase !== undefined) { assert.buffer(passphrase, 'options.passphrase'); assert.optionalString(options.cipher, 'options.cipher'); cipher = options.cipher; if (cipher === undefined) cipher = 'aes128-ctr'; cinf = utils.opensshCipherInfo(cipher); kdf = 'bcrypt'; } } var privBuf; if (PrivateKey.isPrivateKey(key)) { privBuf = new SSHBuffer({}); var checkInt = crypto.randomBytes(4).readUInt32BE(0); privBuf.writeInt(checkInt); privBuf.writeInt(checkInt); privBuf.write(key.toBuffer('rfc4253')); privBuf.writeString(key.comment || ''); var n = 1; while (privBuf._offset % cinf.blockSize !== 0) privBuf.writeChar(n++); privBuf = privBuf.toBuffer(); } switch (kdf) { case 'none': break; case 'bcrypt': var salt = crypto.randomBytes(16); var rounds = 16; var kdfssh = new SSHBuffer({}); kdfssh.writeBuffer(salt); kdfssh.writeInt(rounds); kdfopts = kdfssh.toBuffer(); if (bcrypt === undefined) { bcrypt = __webpack_require__(641); } var pass = new Uint8Array(passphrase); var salti = new Uint8Array(salt); /* Use the pbkdf to derive both the key and the IV. */ var out = new Uint8Array(cinf.keySize + cinf.blockSize); var res = bcrypt.pbkdf(pass, pass.length, salti, salti.length, out, out.length, rounds); if (res !== 0) { throw (new Error('bcrypt_pbkdf function returned ' + 'failure, parameters invalid')); } out = Buffer.from(out); var ckey = out.slice(0, cinf.keySize); var iv = out.slice(cinf.keySize, cinf.keySize + cinf.blockSize); var cipherStream = crypto.createCipheriv(cinf.opensslName, ckey, iv); cipherStream.setAutoPadding(false); var chunk, chunks = []; cipherStream.once('error', function (e) { throw (e); }); cipherStream.write(privBuf); cipherStream.end(); while ((chunk = cipherStream.read()) !== null) chunks.push(chunk); privBuf = Buffer.concat(chunks); break; default: throw (new Error('Unsupported kdf ' + kdf)); } var buf = new SSHBuffer({}); buf.writeCString(MAGIC); buf.writeString(cipher); /* cipher */ buf.writeString(kdf); /* kdf */ buf.writeBuffer(kdfopts); /* kdfoptions */ buf.writeInt(1); /* nkeys */ buf.writeBuffer(pubKey.toBuffer('rfc4253')); if (privBuf) buf.writeBuffer(privBuf); buf = buf.toBuffer(); var header; if (PrivateKey.isPrivateKey(key)) header = 'OPENSSH PRIVATE KEY'; else header = 'OPENSSH PUBLIC KEY'; var tmp = buf.toString('base64'); var len = tmp.length + (tmp.length / 70) + 18 + 16 + header.length*2 + 10; buf = Buffer.alloc(len); var o = 0; o += buf.write('-----BEGIN ' + header + '-----\n', o); for (var i = 0; i < tmp.length; ) { var limit = i + 70; if (limit > tmp.length) limit = tmp.length; o += buf.write(tmp.slice(i, limit), o); buf[o++] = 10; i = limit; } o += buf.write('-----END ' + header + '-----\n', o); return (buf.slice(0, o)); } /***/ }), /***/ 85: /***/ (function(module) { "use strict"; module.exports = function generate__limitItems(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $errorKeyword; var $data = 'data' + ($dataLvl || ''); var $isData = it.opts.$data && $schema && $schema.$data, $schemaValue; if ($isData) { out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; $schemaValue = 'schema' + $lvl; } else { $schemaValue = $schema; } var $op = $keyword == 'maxItems' ? '>' : '<'; out += 'if ( '; if ($isData) { out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; } out += ' ' + ($data) + '.length ' + ($op) + ' ' + ($schemaValue) + ') { '; var $errorKeyword = $keyword; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ($errorKeyword || '_limitItems') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schemaValue) + ' } '; if (it.opts.messages !== false) { out += ' , message: \'should NOT have '; if ($keyword == 'maxItems') { out += 'more'; } else { out += 'fewer'; } out += ' than '; if ($isData) { out += '\' + ' + ($schemaValue) + ' + \''; } else { out += '' + ($schema); } out += ' items\' '; } if (it.opts.verbose) { out += ' , schema: '; if ($isData) { out += 'validate.schema' + ($schemaPath); } else { out += '' + ($schema); } out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } out += '} '; if ($breakOnError) { out += ' else { '; } return out; } /***/ }), /***/ 87: /***/ (function(module) { module.exports = require("os"); /***/ }), /***/ 91: /***/ (function(module, __unusedexports, __webpack_require__) { var serialOrdered = __webpack_require__(892); // Public API module.exports = serial; /** * Runs iterator over provided array elements in series * * @param {array|object} list - array or object (named list) to iterate over * @param {function} iterator - iterator to run * @param {function} callback - invoked when all elements processed * @returns {function} - jobs terminator */ function serial(list, iterator, callback) { return serialOrdered(list, iterator, null, callback); } /***/ }), /***/ 98: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2015 Joyent, Inc. var Buffer = __webpack_require__(215).Buffer; var algInfo = { 'dsa': { parts: ['p', 'q', 'g', 'y'], sizePart: 'p' }, 'rsa': { parts: ['e', 'n'], sizePart: 'n' }, 'ecdsa': { parts: ['curve', 'Q'], sizePart: 'Q' }, 'ed25519': { parts: ['A'], sizePart: 'A' } }; algInfo['curve25519'] = algInfo['ed25519']; var algPrivInfo = { 'dsa': { parts: ['p', 'q', 'g', 'y', 'x'] }, 'rsa': { parts: ['n', 'e', 'd', 'iqmp', 'p', 'q'] }, 'ecdsa': { parts: ['curve', 'Q', 'd'] }, 'ed25519': { parts: ['A', 'k'] } }; algPrivInfo['curve25519'] = algPrivInfo['ed25519']; var hashAlgs = { 'md5': true, 'sha1': true, 'sha256': true, 'sha384': true, 'sha512': true }; /* * Taken from * http://csrc.nist.gov/groups/ST/toolkit/documents/dss/NISTReCur.pdf */ var curves = { 'nistp256': { size: 256, pkcs8oid: '1.2.840.10045.3.1.7', p: Buffer.from(('00' + 'ffffffff 00000001 00000000 00000000' + '00000000 ffffffff ffffffff ffffffff'). replace(/ /g, ''), 'hex'), a: Buffer.from(('00' + 'FFFFFFFF 00000001 00000000 00000000' + '00000000 FFFFFFFF FFFFFFFF FFFFFFFC'). replace(/ /g, ''), 'hex'), b: Buffer.from(( '5ac635d8 aa3a93e7 b3ebbd55 769886bc' + '651d06b0 cc53b0f6 3bce3c3e 27d2604b'). replace(/ /g, ''), 'hex'), s: Buffer.from(('00' + 'c49d3608 86e70493 6a6678e1 139d26b7' + '819f7e90'). replace(/ /g, ''), 'hex'), n: Buffer.from(('00' + 'ffffffff 00000000 ffffffff ffffffff' + 'bce6faad a7179e84 f3b9cac2 fc632551'). replace(/ /g, ''), 'hex'), G: Buffer.from(('04' + '6b17d1f2 e12c4247 f8bce6e5 63a440f2' + '77037d81 2deb33a0 f4a13945 d898c296' + '4fe342e2 fe1a7f9b 8ee7eb4a 7c0f9e16' + '2bce3357 6b315ece cbb64068 37bf51f5'). replace(/ /g, ''), 'hex') }, 'nistp384': { size: 384, pkcs8oid: '1.3.132.0.34', p: Buffer.from(('00' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff ffffffff fffffffe' + 'ffffffff 00000000 00000000 ffffffff'). replace(/ /g, ''), 'hex'), a: Buffer.from(('00' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFE' + 'FFFFFFFF 00000000 00000000 FFFFFFFC'). replace(/ /g, ''), 'hex'), b: Buffer.from(( 'b3312fa7 e23ee7e4 988e056b e3f82d19' + '181d9c6e fe814112 0314088f 5013875a' + 'c656398d 8a2ed19d 2a85c8ed d3ec2aef'). replace(/ /g, ''), 'hex'), s: Buffer.from(('00' + 'a335926a a319a27a 1d00896a 6773a482' + '7acdac73'). replace(/ /g, ''), 'hex'), n: Buffer.from(('00' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff c7634d81 f4372ddf' + '581a0db2 48b0a77a ecec196a ccc52973'). replace(/ /g, ''), 'hex'), G: Buffer.from(('04' + 'aa87ca22 be8b0537 8eb1c71e f320ad74' + '6e1d3b62 8ba79b98 59f741e0 82542a38' + '5502f25d bf55296c 3a545e38 72760ab7' + '3617de4a 96262c6f 5d9e98bf 9292dc29' + 'f8f41dbd 289a147c e9da3113 b5f0b8c0' + '0a60b1ce 1d7e819d 7a431d7c 90ea0e5f'). replace(/ /g, ''), 'hex') }, 'nistp521': { size: 521, pkcs8oid: '1.3.132.0.35', p: Buffer.from(( '01ffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffff').replace(/ /g, ''), 'hex'), a: Buffer.from(('01FF' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFC'). replace(/ /g, ''), 'hex'), b: Buffer.from(('51' + '953eb961 8e1c9a1f 929a21a0 b68540ee' + 'a2da725b 99b315f3 b8b48991 8ef109e1' + '56193951 ec7e937b 1652c0bd 3bb1bf07' + '3573df88 3d2c34f1 ef451fd4 6b503f00'). replace(/ /g, ''), 'hex'), s: Buffer.from(('00' + 'd09e8800 291cb853 96cc6717 393284aa' + 'a0da64ba').replace(/ /g, ''), 'hex'), n: Buffer.from(('01ff' + 'ffffffff ffffffff ffffffff ffffffff' + 'ffffffff ffffffff ffffffff fffffffa' + '51868783 bf2f966b 7fcc0148 f709a5d0' + '3bb5c9b8 899c47ae bb6fb71e 91386409'). replace(/ /g, ''), 'hex'), G: Buffer.from(('04' + '00c6 858e06b7 0404e9cd 9e3ecb66 2395b442' + '9c648139 053fb521 f828af60 6b4d3dba' + 'a14b5e77 efe75928 fe1dc127 a2ffa8de' + '3348b3c1 856a429b f97e7e31 c2e5bd66' + '0118 39296a78 9a3bc004 5c8a5fb4 2c7d1bd9' + '98f54449 579b4468 17afbd17 273e662c' + '97ee7299 5ef42640 c550b901 3fad0761' + '353c7086 a272c240 88be9476 9fd16650'). replace(/ /g, ''), 'hex') } }; module.exports = { info: algInfo, privInfo: algPrivInfo, hashAlgs: hashAlgs, curves: curves }; /***/ }), /***/ 104: /***/ (function(__unusedmodule, __unusedexports, __webpack_require__) { const core = __webpack_require__(470); const exec = __webpack_require__(986); const request = __webpack_require__(830); const fs = __webpack_require__(747); let fail_ci; try { const name = core.getInput("name"); const token = core.getInput("token"); const flags = core.getInput("flags"); const file = core.getInput("file"); let env_vars = core.getInput("env_vars"); fail_ci = core.getInput("fail_ci_if_error").toLowerCase(); if ( fail_ci === "yes" || fail_ci === "y" || fail_ci === "true" || fail_ci === "t" || fail_ci === "1" ) { fail_ci = true; } else { fail_ci = false; } request("https://codecov.io/bash", (error, response, body) => { if (error && fail_ci) { throw error; } else if (error) { core.warning(`Codecov warning: ${error.message}`); } fs.writeFile("codecov.sh", body, err => { if (err && fail_ci) { throw err; } else if (err) { core.warning(`Codecov warning: ${err.message}`); } let output = ""; let execError = ""; const options = {}; options.listeners = { stdout: data => { output += data.toString(); }, stderr: data => { execError += data.toString(); } }; options.env = { GITHUB_ACTION: process.env.GITHUB_ACTION, GITHUB_RUN_ID: process.env.GITHUB_RUN_ID, GITHUB_REF: process.env.GITHUB_REF, GITHUB_REPOSITORY: process.env.GITHUB_REPOSITORY, GITHUB_SHA: process.env.GITHUB_SHA, GITHUB_HEAD_REF: process.env.GITHUB_HEAD_REF || '' }; if(token){ options.env.CODECOV_TOKEN = token } const env_vars_arg = [] for (let env_var of env_vars.split(",")) { let env_var_clean = env_var.trim(); if (env_var_clean) { options.env[env_var_clean] = process.env[env_var_clean]; env_vars_arg.push(env_var_clean) } } const execArgs = ["codecov.sh"]; if (file) { execArgs.push( "-f", `${file}` ); } execArgs.push( "-n", `${name}`, "-F", `${flags}` ); if (fail_ci) { execArgs.push( "-Z" ); } if (env_vars_arg.length) { execArgs.push( "-e", env_vars_arg.join(",") ); } exec.exec("bash", execArgs, options) .catch(err => { if (fail_ci) { core.setFailed( `Codecov failed with the following error: ${err.message}` ); } else { core.warning(`Codecov warning: ${err.message}`); } }) .then(() => { unlinkFile(); }); const unlinkFile = () => { fs.unlink("codecov.sh", err => { if (err && fail_ci) { throw err; } else if (err) { core.warning(`Codecov warning: ${err.message}`); } }); }; }); }); } catch (error) { if (fail_ci) { core.setFailed(`Codecov failed with the following error: ${error.message}`); } else { core.warning(`Codecov warning: ${error.message}`); } } /***/ }), /***/ 107: /***/ (function(module) { "use strict"; module.exports = function generate_allOf(it, $keyword, $ruleType) { var out = ' '; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $it = it.util.copy(it); var $closingBraces = ''; $it.level++; var $nextValid = 'valid' + $it.level; var $currentBaseId = $it.baseId, $allSchemasEmpty = true; var arr1 = $schema; if (arr1) { var $sch, $i = -1, l1 = arr1.length - 1; while ($i < l1) { $sch = arr1[$i += 1]; if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { $allSchemasEmpty = false; $it.schema = $sch; $it.schemaPath = $schemaPath + '[' + $i + ']'; $it.errSchemaPath = $errSchemaPath + '/' + $i; out += ' ' + (it.validate($it)) + ' '; $it.baseId = $currentBaseId; if ($breakOnError) { out += ' if (' + ($nextValid) + ') { '; $closingBraces += '}'; } } } } if ($breakOnError) { if ($allSchemasEmpty) { out += ' if (true) { '; } else { out += ' ' + ($closingBraces.slice(0, -1)) + ' '; } } out = it.util.cleanUpCode(out); return out; } /***/ }), /***/ 113: /***/ (function(__unusedmodule, exports, __webpack_require__) { var crypto = __webpack_require__(417) function sha (key, body, algorithm) { return crypto.createHmac(algorithm, key).update(body).digest('base64') } function rsa (key, body) { return crypto.createSign('RSA-SHA1').update(body).sign(key, 'base64') } function rfc3986 (str) { return encodeURIComponent(str) .replace(/!/g,'%21') .replace(/\*/g,'%2A') .replace(/\(/g,'%28') .replace(/\)/g,'%29') .replace(/'/g,'%27') } // Maps object to bi-dimensional array // Converts { foo: 'A', bar: [ 'b', 'B' ]} to // [ ['foo', 'A'], ['bar', 'b'], ['bar', 'B'] ] function map (obj) { var key, val, arr = [] for (key in obj) { val = obj[key] if (Array.isArray(val)) for (var i = 0; i < val.length; i++) arr.push([key, val[i]]) else if (typeof val === 'object') for (var prop in val) arr.push([key + '[' + prop + ']', val[prop]]) else arr.push([key, val]) } return arr } // Compare function for sort function compare (a, b) { return a > b ? 1 : a < b ? -1 : 0 } function generateBase (httpMethod, base_uri, params) { // adapted from https://dev.twitter.com/docs/auth/oauth and // https://dev.twitter.com/docs/auth/creating-signature // Parameter normalization // http://tools.ietf.org/html/rfc5849#section-3.4.1.3.2 var normalized = map(params) // 1. First, the name and value of each parameter are encoded .map(function (p) { return [ rfc3986(p[0]), rfc3986(p[1] || '') ] }) // 2. The parameters are sorted by name, using ascending byte value // ordering. If two or more parameters share the same name, they // are sorted by their value. .sort(function (a, b) { return compare(a[0], b[0]) || compare(a[1], b[1]) }) // 3. The name of each parameter is concatenated to its corresponding // value using an "=" character (ASCII code 61) as a separator, even // if the value is empty. .map(function (p) { return p.join('=') }) // 4. The sorted name/value pairs are concatenated together into a // single string by using an "&" character (ASCII code 38) as // separator. .join('&') var base = [ rfc3986(httpMethod ? httpMethod.toUpperCase() : 'GET'), rfc3986(base_uri), rfc3986(normalized) ].join('&') return base } function hmacsign (httpMethod, base_uri, params, consumer_secret, token_secret) { var base = generateBase(httpMethod, base_uri, params) var key = [ consumer_secret || '', token_secret || '' ].map(rfc3986).join('&') return sha(key, base, 'sha1') } function hmacsign256 (httpMethod, base_uri, params, consumer_secret, token_secret) { var base = generateBase(httpMethod, base_uri, params) var key = [ consumer_secret || '', token_secret || '' ].map(rfc3986).join('&') return sha(key, base, 'sha256') } function rsasign (httpMethod, base_uri, params, private_key, token_secret) { var base = generateBase(httpMethod, base_uri, params) var key = private_key || '' return rsa(key, base) } function plaintext (consumer_secret, token_secret) { var key = [ consumer_secret || '', token_secret || '' ].map(rfc3986).join('&') return key } function sign (signMethod, httpMethod, base_uri, params, consumer_secret, token_secret) { var method var skipArgs = 1 switch (signMethod) { case 'RSA-SHA1': method = rsasign break case 'HMAC-SHA1': method = hmacsign break case 'HMAC-SHA256': method = hmacsign256 break case 'PLAINTEXT': method = plaintext skipArgs = 4 break default: throw new Error('Signature method not supported: ' + signMethod) } return method.apply(null, [].slice.call(arguments, skipArgs)) } exports.hmacsign = hmacsign exports.hmacsign256 = hmacsign256 exports.rsasign = rsasign exports.plaintext = plaintext exports.sign = sign exports.rfc3986 = rfc3986 exports.generateBase = generateBase /***/ }), /***/ 129: /***/ (function(module) { module.exports = require("child_process"); /***/ }), /***/ 139: /***/ (function(module, __unusedexports, __webpack_require__) { // Unique ID creation requires a high quality random # generator. In node.js // this is pretty straight-forward - we use the crypto API. var crypto = __webpack_require__(417); module.exports = function nodeRNG() { return crypto.randomBytes(16); }; /***/ }), /***/ 140: /***/ (function(module) { module.exports = {"$id":"afterRequest.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","optional":true,"required":["lastAccess","eTag","hitCount"],"properties":{"expires":{"type":"string","pattern":"^(\\d{4})(-)?(\\d\\d)(-)?(\\d\\d)(T)?(\\d\\d)(:)?(\\d\\d)(:)?(\\d\\d)(\\.\\d+)?(Z|([+-])(\\d\\d)(:)?(\\d\\d))?"},"lastAccess":{"type":"string","pattern":"^(\\d{4})(-)?(\\d\\d)(-)?(\\d\\d)(T)?(\\d\\d)(:)?(\\d\\d)(:)?(\\d\\d)(\\.\\d+)?(Z|([+-])(\\d\\d)(:)?(\\d\\d))?"},"eTag":{"type":"string"},"hitCount":{"type":"integer"},"comment":{"type":"string"}}}; /***/ }), /***/ 147: /***/ (function(module) { // API module.exports = state; /** * Creates initial state object * for iteration over list * * @param {array|object} list - list to iterate over * @param {function|null} sortMethod - function to use for keys sort, * or `null` to keep them as is * @returns {object} - initial state object */ function state(list, sortMethod) { var isNamedList = !Array.isArray(list) , initState = { index : 0, keyedList: isNamedList || sortMethod ? Object.keys(list) : null, jobs : {}, results : isNamedList ? {} : [], size : isNamedList ? Object.keys(list).length : list.length } ; if (sortMethod) { // sort array keys based on it's values // sort object's keys just on own merit initState.keyedList.sort(isNamedList ? sortMethod : function(a, b) { return sortMethod(list[a], list[b]); }); } return initState; } /***/ }), /***/ 149: /***/ (function(module, exports, __webpack_require__) { /* eslint-disable node/no-deprecated-api */ var buffer = __webpack_require__(293) var Buffer = buffer.Buffer // alternative to using Object.keys for old browsers function copyProps (src, dst) { for (var key in src) { dst[key] = src[key] } } if (Buffer.from && Buffer.alloc && Buffer.allocUnsafe && Buffer.allocUnsafeSlow) { module.exports = buffer } else { // Copy properties from require('buffer') copyProps(buffer, exports) exports.Buffer = SafeBuffer } function SafeBuffer (arg, encodingOrOffset, length) { return Buffer(arg, encodingOrOffset, length) } SafeBuffer.prototype = Object.create(Buffer.prototype) // Copy static methods from Buffer copyProps(Buffer, SafeBuffer) SafeBuffer.from = function (arg, encodingOrOffset, length) { if (typeof arg === 'number') { throw new TypeError('Argument must not be a number') } return Buffer(arg, encodingOrOffset, length) } SafeBuffer.alloc = function (size, fill, encoding) { if (typeof size !== 'number') { throw new TypeError('Argument must be a number') } var buf = Buffer(size) if (fill !== undefined) { if (typeof encoding === 'string') { buf.fill(fill, encoding) } else { buf.fill(fill) } } else { buf.fill(0) } return buf } SafeBuffer.allocUnsafe = function (size) { if (typeof size !== 'number') { throw new TypeError('Argument must be a number') } return Buffer(size) } SafeBuffer.allocUnsafeSlow = function (size) { if (typeof size !== 'number') { throw new TypeError('Argument must be a number') } return buffer.SlowBuffer(size) } /***/ }), /***/ 152: /***/ (function(module, __unusedexports, __webpack_require__) { var Stream = __webpack_require__(413).Stream; var util = __webpack_require__(669); module.exports = DelayedStream; function DelayedStream() { this.source = null; this.dataSize = 0; this.maxDataSize = 1024 * 1024; this.pauseStream = true; this._maxDataSizeExceeded = false; this._released = false; this._bufferedEvents = []; } util.inherits(DelayedStream, Stream); DelayedStream.create = function(source, options) { var delayedStream = new this(); options = options || {}; for (var option in options) { delayedStream[option] = options[option]; } delayedStream.source = source; var realEmit = source.emit; source.emit = function() { delayedStream._handleEmit(arguments); return realEmit.apply(source, arguments); }; source.on('error', function() {}); if (delayedStream.pauseStream) { source.pause(); } return delayedStream; }; Object.defineProperty(DelayedStream.prototype, 'readable', { configurable: true, enumerable: true, get: function() { return this.source.readable; } }); DelayedStream.prototype.setEncoding = function() { return this.source.setEncoding.apply(this.source, arguments); }; DelayedStream.prototype.resume = function() { if (!this._released) { this.release(); } this.source.resume(); }; DelayedStream.prototype.pause = function() { this.source.pause(); }; DelayedStream.prototype.release = function() { this._released = true; this._bufferedEvents.forEach(function(args) { this.emit.apply(this, args); }.bind(this)); this._bufferedEvents = []; }; DelayedStream.prototype.pipe = function() { var r = Stream.prototype.pipe.apply(this, arguments); this.resume(); return r; }; DelayedStream.prototype._handleEmit = function(args) { if (this._released) { this.emit.apply(this, args); return; } if (args[0] === 'data') { this.dataSize += args[1].length; this._checkIfMaxDataSizeExceeded(); } this._bufferedEvents.push(args); }; DelayedStream.prototype._checkIfMaxDataSizeExceeded = function() { if (this._maxDataSizeExceeded) { return; } if (this.dataSize <= this.maxDataSize) { return; } this._maxDataSizeExceeded = true; var message = 'DelayedStream#maxDataSize of ' + this.maxDataSize + ' bytes exceeded.' this.emit('error', new Error(message)); }; /***/ }), /***/ 154: /***/ (function(module) { "use strict"; module.exports = function generate_contains(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $data = 'data' + ($dataLvl || ''); var $valid = 'valid' + $lvl; var $errs = 'errs__' + $lvl; var $it = it.util.copy(it); var $closingBraces = ''; $it.level++; var $nextValid = 'valid' + $it.level; var $idx = 'i' + $lvl, $dataNxt = $it.dataLevel = it.dataLevel + 1, $nextData = 'data' + $dataNxt, $currentBaseId = it.baseId, $nonEmptySchema = (it.opts.strictKeywords ? typeof $schema == 'object' && Object.keys($schema).length > 0 : it.util.schemaHasRules($schema, it.RULES.all)); out += 'var ' + ($errs) + ' = errors;var ' + ($valid) + ';'; if ($nonEmptySchema) { var $wasComposite = it.compositeRule; it.compositeRule = $it.compositeRule = true; $it.schema = $schema; $it.schemaPath = $schemaPath; $it.errSchemaPath = $errSchemaPath; out += ' var ' + ($nextValid) + ' = false; for (var ' + ($idx) + ' = 0; ' + ($idx) + ' < ' + ($data) + '.length; ' + ($idx) + '++) { '; $it.errorPath = it.util.getPathExpr(it.errorPath, $idx, it.opts.jsonPointers, true); var $passData = $data + '[' + $idx + ']'; $it.dataPathArr[$dataNxt] = $idx; var $code = it.validate($it); $it.baseId = $currentBaseId; if (it.util.varOccurences($code, $nextData) < 2) { out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; } else { out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; } out += ' if (' + ($nextValid) + ') break; } '; it.compositeRule = $it.compositeRule = $wasComposite; out += ' ' + ($closingBraces) + ' if (!' + ($nextValid) + ') {'; } else { out += ' if (' + ($data) + '.length == 0) {'; } var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('contains') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; if (it.opts.messages !== false) { out += ' , message: \'should contain a valid item\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } out += ' } else { '; if ($nonEmptySchema) { out += ' errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } '; } if (it.opts.allErrors) { out += ' } '; } out = it.util.cleanUpCode(out); return out; } /***/ }), /***/ 157: /***/ (function(module, __unusedexports, __webpack_require__) { var async = __webpack_require__(751) , abort = __webpack_require__(566) ; // API module.exports = iterate; /** * Iterates over each job object * * @param {array|object} list - array or object (named list) to iterate over * @param {function} iterator - iterator to run * @param {object} state - current job status * @param {function} callback - invoked when all elements processed */ function iterate(list, iterator, state, callback) { // store current index var key = state['keyedList'] ? state['keyedList'][state.index] : state.index; state.jobs[key] = runJob(iterator, key, list[key], function(error, output) { // don't repeat yourself // skip secondary callbacks if (!(key in state.jobs)) { return; } // clean up jobs delete state.jobs[key]; if (error) { // don't process rest of the results // stop still active jobs // and reset the list abort(state); } else { state.results[key] = output; } // return salvaged results callback(error, state.results); }); } /** * Runs iterator over provided job element * * @param {function} iterator - iterator to invoke * @param {string|number} key - key/index of the element in the list of jobs * @param {mixed} item - job description * @param {function} callback - invoked after iterator is done with the job * @returns {function|mixed} - job abort function or something else */ function runJob(iterator, key, item, callback) { var aborter; // allow shortcut if iterator expects only two arguments if (iterator.length == 2) { aborter = iterator(item, async(callback)); } // otherwise go with full three arguments else { aborter = iterator(item, key, async(callback)); } return aborter; } /***/ }), /***/ 162: /***/ (function(module) { module.exports = {"$id":"content.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["size","mimeType"],"properties":{"size":{"type":"integer"},"compression":{"type":"integer"},"mimeType":{"type":"string"},"text":{"type":"string"},"encoding":{"type":"string"},"comment":{"type":"string"}}}; /***/ }), /***/ 181: /***/ (function(module) { module.exports = {"$id":"pageTimings.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","properties":{"onContentLoad":{"type":"number","min":-1},"onLoad":{"type":"number","min":-1},"comment":{"type":"string"}}}; /***/ }), /***/ 191: /***/ (function(module) { module.exports = require("querystring"); /***/ }), /***/ 196: /***/ (function(module, __unusedexports, __webpack_require__) { (function(nacl) { 'use strict'; // Ported in 2014 by Dmitry Chestnykh and Devi Mandiri. // Public domain. // // Implementation derived from TweetNaCl version 20140427. // See for details: http://tweetnacl.cr.yp.to/ var gf = function(init) { var i, r = new Float64Array(16); if (init) for (i = 0; i < init.length; i++) r[i] = init[i]; return r; }; // Pluggable, initialized in high-level API below. var randombytes = function(/* x, n */) { throw new Error('no PRNG'); }; var _0 = new Uint8Array(16); var _9 = new Uint8Array(32); _9[0] = 9; var gf0 = gf(), gf1 = gf([1]), _121665 = gf([0xdb41, 1]), D = gf([0x78a3, 0x1359, 0x4dca, 0x75eb, 0xd8ab, 0x4141, 0x0a4d, 0x0070, 0xe898, 0x7779, 0x4079, 0x8cc7, 0xfe73, 0x2b6f, 0x6cee, 0x5203]), D2 = gf([0xf159, 0x26b2, 0x9b94, 0xebd6, 0xb156, 0x8283, 0x149a, 0x00e0, 0xd130, 0xeef3, 0x80f2, 0x198e, 0xfce7, 0x56df, 0xd9dc, 0x2406]), X = gf([0xd51a, 0x8f25, 0x2d60, 0xc956, 0xa7b2, 0x9525, 0xc760, 0x692c, 0xdc5c, 0xfdd6, 0xe231, 0xc0a4, 0x53fe, 0xcd6e, 0x36d3, 0x2169]), Y = gf([0x6658, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666]), I = gf([0xa0b0, 0x4a0e, 0x1b27, 0xc4ee, 0xe478, 0xad2f, 0x1806, 0x2f43, 0xd7a7, 0x3dfb, 0x0099, 0x2b4d, 0xdf0b, 0x4fc1, 0x2480, 0x2b83]); function ts64(x, i, h, l) { x[i] = (h >> 24) & 0xff; x[i+1] = (h >> 16) & 0xff; x[i+2] = (h >> 8) & 0xff; x[i+3] = h & 0xff; x[i+4] = (l >> 24) & 0xff; x[i+5] = (l >> 16) & 0xff; x[i+6] = (l >> 8) & 0xff; x[i+7] = l & 0xff; } function vn(x, xi, y, yi, n) { var i,d = 0; for (i = 0; i < n; i++) d |= x[xi+i]^y[yi+i]; return (1 & ((d - 1) >>> 8)) - 1; } function crypto_verify_16(x, xi, y, yi) { return vn(x,xi,y,yi,16); } function crypto_verify_32(x, xi, y, yi) { return vn(x,xi,y,yi,32); } function core_salsa20(o, p, k, c) { var j0 = c[ 0] & 0xff | (c[ 1] & 0xff)<<8 | (c[ 2] & 0xff)<<16 | (c[ 3] & 0xff)<<24, j1 = k[ 0] & 0xff | (k[ 1] & 0xff)<<8 | (k[ 2] & 0xff)<<16 | (k[ 3] & 0xff)<<24, j2 = k[ 4] & 0xff | (k[ 5] & 0xff)<<8 | (k[ 6] & 0xff)<<16 | (k[ 7] & 0xff)<<24, j3 = k[ 8] & 0xff | (k[ 9] & 0xff)<<8 | (k[10] & 0xff)<<16 | (k[11] & 0xff)<<24, j4 = k[12] & 0xff | (k[13] & 0xff)<<8 | (k[14] & 0xff)<<16 | (k[15] & 0xff)<<24, j5 = c[ 4] & 0xff | (c[ 5] & 0xff)<<8 | (c[ 6] & 0xff)<<16 | (c[ 7] & 0xff)<<24, j6 = p[ 0] & 0xff | (p[ 1] & 0xff)<<8 | (p[ 2] & 0xff)<<16 | (p[ 3] & 0xff)<<24, j7 = p[ 4] & 0xff | (p[ 5] & 0xff)<<8 | (p[ 6] & 0xff)<<16 | (p[ 7] & 0xff)<<24, j8 = p[ 8] & 0xff | (p[ 9] & 0xff)<<8 | (p[10] & 0xff)<<16 | (p[11] & 0xff)<<24, j9 = p[12] & 0xff | (p[13] & 0xff)<<8 | (p[14] & 0xff)<<16 | (p[15] & 0xff)<<24, j10 = c[ 8] & 0xff | (c[ 9] & 0xff)<<8 | (c[10] & 0xff)<<16 | (c[11] & 0xff)<<24, j11 = k[16] & 0xff | (k[17] & 0xff)<<8 | (k[18] & 0xff)<<16 | (k[19] & 0xff)<<24, j12 = k[20] & 0xff | (k[21] & 0xff)<<8 | (k[22] & 0xff)<<16 | (k[23] & 0xff)<<24, j13 = k[24] & 0xff | (k[25] & 0xff)<<8 | (k[26] & 0xff)<<16 | (k[27] & 0xff)<<24, j14 = k[28] & 0xff | (k[29] & 0xff)<<8 | (k[30] & 0xff)<<16 | (k[31] & 0xff)<<24, j15 = c[12] & 0xff | (c[13] & 0xff)<<8 | (c[14] & 0xff)<<16 | (c[15] & 0xff)<<24; var x0 = j0, x1 = j1, x2 = j2, x3 = j3, x4 = j4, x5 = j5, x6 = j6, x7 = j7, x8 = j8, x9 = j9, x10 = j10, x11 = j11, x12 = j12, x13 = j13, x14 = j14, x15 = j15, u; for (var i = 0; i < 20; i += 2) { u = x0 + x12 | 0; x4 ^= u<<7 | u>>>(32-7); u = x4 + x0 | 0; x8 ^= u<<9 | u>>>(32-9); u = x8 + x4 | 0; x12 ^= u<<13 | u>>>(32-13); u = x12 + x8 | 0; x0 ^= u<<18 | u>>>(32-18); u = x5 + x1 | 0; x9 ^= u<<7 | u>>>(32-7); u = x9 + x5 | 0; x13 ^= u<<9 | u>>>(32-9); u = x13 + x9 | 0; x1 ^= u<<13 | u>>>(32-13); u = x1 + x13 | 0; x5 ^= u<<18 | u>>>(32-18); u = x10 + x6 | 0; x14 ^= u<<7 | u>>>(32-7); u = x14 + x10 | 0; x2 ^= u<<9 | u>>>(32-9); u = x2 + x14 | 0; x6 ^= u<<13 | u>>>(32-13); u = x6 + x2 | 0; x10 ^= u<<18 | u>>>(32-18); u = x15 + x11 | 0; x3 ^= u<<7 | u>>>(32-7); u = x3 + x15 | 0; x7 ^= u<<9 | u>>>(32-9); u = x7 + x3 | 0; x11 ^= u<<13 | u>>>(32-13); u = x11 + x7 | 0; x15 ^= u<<18 | u>>>(32-18); u = x0 + x3 | 0; x1 ^= u<<7 | u>>>(32-7); u = x1 + x0 | 0; x2 ^= u<<9 | u>>>(32-9); u = x2 + x1 | 0; x3 ^= u<<13 | u>>>(32-13); u = x3 + x2 | 0; x0 ^= u<<18 | u>>>(32-18); u = x5 + x4 | 0; x6 ^= u<<7 | u>>>(32-7); u = x6 + x5 | 0; x7 ^= u<<9 | u>>>(32-9); u = x7 + x6 | 0; x4 ^= u<<13 | u>>>(32-13); u = x4 + x7 | 0; x5 ^= u<<18 | u>>>(32-18); u = x10 + x9 | 0; x11 ^= u<<7 | u>>>(32-7); u = x11 + x10 | 0; x8 ^= u<<9 | u>>>(32-9); u = x8 + x11 | 0; x9 ^= u<<13 | u>>>(32-13); u = x9 + x8 | 0; x10 ^= u<<18 | u>>>(32-18); u = x15 + x14 | 0; x12 ^= u<<7 | u>>>(32-7); u = x12 + x15 | 0; x13 ^= u<<9 | u>>>(32-9); u = x13 + x12 | 0; x14 ^= u<<13 | u>>>(32-13); u = x14 + x13 | 0; x15 ^= u<<18 | u>>>(32-18); } x0 = x0 + j0 | 0; x1 = x1 + j1 | 0; x2 = x2 + j2 | 0; x3 = x3 + j3 | 0; x4 = x4 + j4 | 0; x5 = x5 + j5 | 0; x6 = x6 + j6 | 0; x7 = x7 + j7 | 0; x8 = x8 + j8 | 0; x9 = x9 + j9 | 0; x10 = x10 + j10 | 0; x11 = x11 + j11 | 0; x12 = x12 + j12 | 0; x13 = x13 + j13 | 0; x14 = x14 + j14 | 0; x15 = x15 + j15 | 0; o[ 0] = x0 >>> 0 & 0xff; o[ 1] = x0 >>> 8 & 0xff; o[ 2] = x0 >>> 16 & 0xff; o[ 3] = x0 >>> 24 & 0xff; o[ 4] = x1 >>> 0 & 0xff; o[ 5] = x1 >>> 8 & 0xff; o[ 6] = x1 >>> 16 & 0xff; o[ 7] = x1 >>> 24 & 0xff; o[ 8] = x2 >>> 0 & 0xff; o[ 9] = x2 >>> 8 & 0xff; o[10] = x2 >>> 16 & 0xff; o[11] = x2 >>> 24 & 0xff; o[12] = x3 >>> 0 & 0xff; o[13] = x3 >>> 8 & 0xff; o[14] = x3 >>> 16 & 0xff; o[15] = x3 >>> 24 & 0xff; o[16] = x4 >>> 0 & 0xff; o[17] = x4 >>> 8 & 0xff; o[18] = x4 >>> 16 & 0xff; o[19] = x4 >>> 24 & 0xff; o[20] = x5 >>> 0 & 0xff; o[21] = x5 >>> 8 & 0xff; o[22] = x5 >>> 16 & 0xff; o[23] = x5 >>> 24 & 0xff; o[24] = x6 >>> 0 & 0xff; o[25] = x6 >>> 8 & 0xff; o[26] = x6 >>> 16 & 0xff; o[27] = x6 >>> 24 & 0xff; o[28] = x7 >>> 0 & 0xff; o[29] = x7 >>> 8 & 0xff; o[30] = x7 >>> 16 & 0xff; o[31] = x7 >>> 24 & 0xff; o[32] = x8 >>> 0 & 0xff; o[33] = x8 >>> 8 & 0xff; o[34] = x8 >>> 16 & 0xff; o[35] = x8 >>> 24 & 0xff; o[36] = x9 >>> 0 & 0xff; o[37] = x9 >>> 8 & 0xff; o[38] = x9 >>> 16 & 0xff; o[39] = x9 >>> 24 & 0xff; o[40] = x10 >>> 0 & 0xff; o[41] = x10 >>> 8 & 0xff; o[42] = x10 >>> 16 & 0xff; o[43] = x10 >>> 24 & 0xff; o[44] = x11 >>> 0 & 0xff; o[45] = x11 >>> 8 & 0xff; o[46] = x11 >>> 16 & 0xff; o[47] = x11 >>> 24 & 0xff; o[48] = x12 >>> 0 & 0xff; o[49] = x12 >>> 8 & 0xff; o[50] = x12 >>> 16 & 0xff; o[51] = x12 >>> 24 & 0xff; o[52] = x13 >>> 0 & 0xff; o[53] = x13 >>> 8 & 0xff; o[54] = x13 >>> 16 & 0xff; o[55] = x13 >>> 24 & 0xff; o[56] = x14 >>> 0 & 0xff; o[57] = x14 >>> 8 & 0xff; o[58] = x14 >>> 16 & 0xff; o[59] = x14 >>> 24 & 0xff; o[60] = x15 >>> 0 & 0xff; o[61] = x15 >>> 8 & 0xff; o[62] = x15 >>> 16 & 0xff; o[63] = x15 >>> 24 & 0xff; } function core_hsalsa20(o,p,k,c) { var j0 = c[ 0] & 0xff | (c[ 1] & 0xff)<<8 | (c[ 2] & 0xff)<<16 | (c[ 3] & 0xff)<<24, j1 = k[ 0] & 0xff | (k[ 1] & 0xff)<<8 | (k[ 2] & 0xff)<<16 | (k[ 3] & 0xff)<<24, j2 = k[ 4] & 0xff | (k[ 5] & 0xff)<<8 | (k[ 6] & 0xff)<<16 | (k[ 7] & 0xff)<<24, j3 = k[ 8] & 0xff | (k[ 9] & 0xff)<<8 | (k[10] & 0xff)<<16 | (k[11] & 0xff)<<24, j4 = k[12] & 0xff | (k[13] & 0xff)<<8 | (k[14] & 0xff)<<16 | (k[15] & 0xff)<<24, j5 = c[ 4] & 0xff | (c[ 5] & 0xff)<<8 | (c[ 6] & 0xff)<<16 | (c[ 7] & 0xff)<<24, j6 = p[ 0] & 0xff | (p[ 1] & 0xff)<<8 | (p[ 2] & 0xff)<<16 | (p[ 3] & 0xff)<<24, j7 = p[ 4] & 0xff | (p[ 5] & 0xff)<<8 | (p[ 6] & 0xff)<<16 | (p[ 7] & 0xff)<<24, j8 = p[ 8] & 0xff | (p[ 9] & 0xff)<<8 | (p[10] & 0xff)<<16 | (p[11] & 0xff)<<24, j9 = p[12] & 0xff | (p[13] & 0xff)<<8 | (p[14] & 0xff)<<16 | (p[15] & 0xff)<<24, j10 = c[ 8] & 0xff | (c[ 9] & 0xff)<<8 | (c[10] & 0xff)<<16 | (c[11] & 0xff)<<24, j11 = k[16] & 0xff | (k[17] & 0xff)<<8 | (k[18] & 0xff)<<16 | (k[19] & 0xff)<<24, j12 = k[20] & 0xff | (k[21] & 0xff)<<8 | (k[22] & 0xff)<<16 | (k[23] & 0xff)<<24, j13 = k[24] & 0xff | (k[25] & 0xff)<<8 | (k[26] & 0xff)<<16 | (k[27] & 0xff)<<24, j14 = k[28] & 0xff | (k[29] & 0xff)<<8 | (k[30] & 0xff)<<16 | (k[31] & 0xff)<<24, j15 = c[12] & 0xff | (c[13] & 0xff)<<8 | (c[14] & 0xff)<<16 | (c[15] & 0xff)<<24; var x0 = j0, x1 = j1, x2 = j2, x3 = j3, x4 = j4, x5 = j5, x6 = j6, x7 = j7, x8 = j8, x9 = j9, x10 = j10, x11 = j11, x12 = j12, x13 = j13, x14 = j14, x15 = j15, u; for (var i = 0; i < 20; i += 2) { u = x0 + x12 | 0; x4 ^= u<<7 | u>>>(32-7); u = x4 + x0 | 0; x8 ^= u<<9 | u>>>(32-9); u = x8 + x4 | 0; x12 ^= u<<13 | u>>>(32-13); u = x12 + x8 | 0; x0 ^= u<<18 | u>>>(32-18); u = x5 + x1 | 0; x9 ^= u<<7 | u>>>(32-7); u = x9 + x5 | 0; x13 ^= u<<9 | u>>>(32-9); u = x13 + x9 | 0; x1 ^= u<<13 | u>>>(32-13); u = x1 + x13 | 0; x5 ^= u<<18 | u>>>(32-18); u = x10 + x6 | 0; x14 ^= u<<7 | u>>>(32-7); u = x14 + x10 | 0; x2 ^= u<<9 | u>>>(32-9); u = x2 + x14 | 0; x6 ^= u<<13 | u>>>(32-13); u = x6 + x2 | 0; x10 ^= u<<18 | u>>>(32-18); u = x15 + x11 | 0; x3 ^= u<<7 | u>>>(32-7); u = x3 + x15 | 0; x7 ^= u<<9 | u>>>(32-9); u = x7 + x3 | 0; x11 ^= u<<13 | u>>>(32-13); u = x11 + x7 | 0; x15 ^= u<<18 | u>>>(32-18); u = x0 + x3 | 0; x1 ^= u<<7 | u>>>(32-7); u = x1 + x0 | 0; x2 ^= u<<9 | u>>>(32-9); u = x2 + x1 | 0; x3 ^= u<<13 | u>>>(32-13); u = x3 + x2 | 0; x0 ^= u<<18 | u>>>(32-18); u = x5 + x4 | 0; x6 ^= u<<7 | u>>>(32-7); u = x6 + x5 | 0; x7 ^= u<<9 | u>>>(32-9); u = x7 + x6 | 0; x4 ^= u<<13 | u>>>(32-13); u = x4 + x7 | 0; x5 ^= u<<18 | u>>>(32-18); u = x10 + x9 | 0; x11 ^= u<<7 | u>>>(32-7); u = x11 + x10 | 0; x8 ^= u<<9 | u>>>(32-9); u = x8 + x11 | 0; x9 ^= u<<13 | u>>>(32-13); u = x9 + x8 | 0; x10 ^= u<<18 | u>>>(32-18); u = x15 + x14 | 0; x12 ^= u<<7 | u>>>(32-7); u = x12 + x15 | 0; x13 ^= u<<9 | u>>>(32-9); u = x13 + x12 | 0; x14 ^= u<<13 | u>>>(32-13); u = x14 + x13 | 0; x15 ^= u<<18 | u>>>(32-18); } o[ 0] = x0 >>> 0 & 0xff; o[ 1] = x0 >>> 8 & 0xff; o[ 2] = x0 >>> 16 & 0xff; o[ 3] = x0 >>> 24 & 0xff; o[ 4] = x5 >>> 0 & 0xff; o[ 5] = x5 >>> 8 & 0xff; o[ 6] = x5 >>> 16 & 0xff; o[ 7] = x5 >>> 24 & 0xff; o[ 8] = x10 >>> 0 & 0xff; o[ 9] = x10 >>> 8 & 0xff; o[10] = x10 >>> 16 & 0xff; o[11] = x10 >>> 24 & 0xff; o[12] = x15 >>> 0 & 0xff; o[13] = x15 >>> 8 & 0xff; o[14] = x15 >>> 16 & 0xff; o[15] = x15 >>> 24 & 0xff; o[16] = x6 >>> 0 & 0xff; o[17] = x6 >>> 8 & 0xff; o[18] = x6 >>> 16 & 0xff; o[19] = x6 >>> 24 & 0xff; o[20] = x7 >>> 0 & 0xff; o[21] = x7 >>> 8 & 0xff; o[22] = x7 >>> 16 & 0xff; o[23] = x7 >>> 24 & 0xff; o[24] = x8 >>> 0 & 0xff; o[25] = x8 >>> 8 & 0xff; o[26] = x8 >>> 16 & 0xff; o[27] = x8 >>> 24 & 0xff; o[28] = x9 >>> 0 & 0xff; o[29] = x9 >>> 8 & 0xff; o[30] = x9 >>> 16 & 0xff; o[31] = x9 >>> 24 & 0xff; } function crypto_core_salsa20(out,inp,k,c) { core_salsa20(out,inp,k,c); } function crypto_core_hsalsa20(out,inp,k,c) { core_hsalsa20(out,inp,k,c); } var sigma = new Uint8Array([101, 120, 112, 97, 110, 100, 32, 51, 50, 45, 98, 121, 116, 101, 32, 107]); // "expand 32-byte k" function crypto_stream_salsa20_xor(c,cpos,m,mpos,b,n,k) { var z = new Uint8Array(16), x = new Uint8Array(64); var u, i; for (i = 0; i < 16; i++) z[i] = 0; for (i = 0; i < 8; i++) z[i] = n[i]; while (b >= 64) { crypto_core_salsa20(x,z,k,sigma); for (i = 0; i < 64; i++) c[cpos+i] = m[mpos+i] ^ x[i]; u = 1; for (i = 8; i < 16; i++) { u = u + (z[i] & 0xff) | 0; z[i] = u & 0xff; u >>>= 8; } b -= 64; cpos += 64; mpos += 64; } if (b > 0) { crypto_core_salsa20(x,z,k,sigma); for (i = 0; i < b; i++) c[cpos+i] = m[mpos+i] ^ x[i]; } return 0; } function crypto_stream_salsa20(c,cpos,b,n,k) { var z = new Uint8Array(16), x = new Uint8Array(64); var u, i; for (i = 0; i < 16; i++) z[i] = 0; for (i = 0; i < 8; i++) z[i] = n[i]; while (b >= 64) { crypto_core_salsa20(x,z,k,sigma); for (i = 0; i < 64; i++) c[cpos+i] = x[i]; u = 1; for (i = 8; i < 16; i++) { u = u + (z[i] & 0xff) | 0; z[i] = u & 0xff; u >>>= 8; } b -= 64; cpos += 64; } if (b > 0) { crypto_core_salsa20(x,z,k,sigma); for (i = 0; i < b; i++) c[cpos+i] = x[i]; } return 0; } function crypto_stream(c,cpos,d,n,k) { var s = new Uint8Array(32); crypto_core_hsalsa20(s,n,k,sigma); var sn = new Uint8Array(8); for (var i = 0; i < 8; i++) sn[i] = n[i+16]; return crypto_stream_salsa20(c,cpos,d,sn,s); } function crypto_stream_xor(c,cpos,m,mpos,d,n,k) { var s = new Uint8Array(32); crypto_core_hsalsa20(s,n,k,sigma); var sn = new Uint8Array(8); for (var i = 0; i < 8; i++) sn[i] = n[i+16]; return crypto_stream_salsa20_xor(c,cpos,m,mpos,d,sn,s); } /* * Port of Andrew Moon's Poly1305-donna-16. Public domain. * https://github.com/floodyberry/poly1305-donna */ var poly1305 = function(key) { this.buffer = new Uint8Array(16); this.r = new Uint16Array(10); this.h = new Uint16Array(10); this.pad = new Uint16Array(8); this.leftover = 0; this.fin = 0; var t0, t1, t2, t3, t4, t5, t6, t7; t0 = key[ 0] & 0xff | (key[ 1] & 0xff) << 8; this.r[0] = ( t0 ) & 0x1fff; t1 = key[ 2] & 0xff | (key[ 3] & 0xff) << 8; this.r[1] = ((t0 >>> 13) | (t1 << 3)) & 0x1fff; t2 = key[ 4] & 0xff | (key[ 5] & 0xff) << 8; this.r[2] = ((t1 >>> 10) | (t2 << 6)) & 0x1f03; t3 = key[ 6] & 0xff | (key[ 7] & 0xff) << 8; this.r[3] = ((t2 >>> 7) | (t3 << 9)) & 0x1fff; t4 = key[ 8] & 0xff | (key[ 9] & 0xff) << 8; this.r[4] = ((t3 >>> 4) | (t4 << 12)) & 0x00ff; this.r[5] = ((t4 >>> 1)) & 0x1ffe; t5 = key[10] & 0xff | (key[11] & 0xff) << 8; this.r[6] = ((t4 >>> 14) | (t5 << 2)) & 0x1fff; t6 = key[12] & 0xff | (key[13] & 0xff) << 8; this.r[7] = ((t5 >>> 11) | (t6 << 5)) & 0x1f81; t7 = key[14] & 0xff | (key[15] & 0xff) << 8; this.r[8] = ((t6 >>> 8) | (t7 << 8)) & 0x1fff; this.r[9] = ((t7 >>> 5)) & 0x007f; this.pad[0] = key[16] & 0xff | (key[17] & 0xff) << 8; this.pad[1] = key[18] & 0xff | (key[19] & 0xff) << 8; this.pad[2] = key[20] & 0xff | (key[21] & 0xff) << 8; this.pad[3] = key[22] & 0xff | (key[23] & 0xff) << 8; this.pad[4] = key[24] & 0xff | (key[25] & 0xff) << 8; this.pad[5] = key[26] & 0xff | (key[27] & 0xff) << 8; this.pad[6] = key[28] & 0xff | (key[29] & 0xff) << 8; this.pad[7] = key[30] & 0xff | (key[31] & 0xff) << 8; }; poly1305.prototype.blocks = function(m, mpos, bytes) { var hibit = this.fin ? 0 : (1 << 11); var t0, t1, t2, t3, t4, t5, t6, t7, c; var d0, d1, d2, d3, d4, d5, d6, d7, d8, d9; var h0 = this.h[0], h1 = this.h[1], h2 = this.h[2], h3 = this.h[3], h4 = this.h[4], h5 = this.h[5], h6 = this.h[6], h7 = this.h[7], h8 = this.h[8], h9 = this.h[9]; var r0 = this.r[0], r1 = this.r[1], r2 = this.r[2], r3 = this.r[3], r4 = this.r[4], r5 = this.r[5], r6 = this.r[6], r7 = this.r[7], r8 = this.r[8], r9 = this.r[9]; while (bytes >= 16) { t0 = m[mpos+ 0] & 0xff | (m[mpos+ 1] & 0xff) << 8; h0 += ( t0 ) & 0x1fff; t1 = m[mpos+ 2] & 0xff | (m[mpos+ 3] & 0xff) << 8; h1 += ((t0 >>> 13) | (t1 << 3)) & 0x1fff; t2 = m[mpos+ 4] & 0xff | (m[mpos+ 5] & 0xff) << 8; h2 += ((t1 >>> 10) | (t2 << 6)) & 0x1fff; t3 = m[mpos+ 6] & 0xff | (m[mpos+ 7] & 0xff) << 8; h3 += ((t2 >>> 7) | (t3 << 9)) & 0x1fff; t4 = m[mpos+ 8] & 0xff | (m[mpos+ 9] & 0xff) << 8; h4 += ((t3 >>> 4) | (t4 << 12)) & 0x1fff; h5 += ((t4 >>> 1)) & 0x1fff; t5 = m[mpos+10] & 0xff | (m[mpos+11] & 0xff) << 8; h6 += ((t4 >>> 14) | (t5 << 2)) & 0x1fff; t6 = m[mpos+12] & 0xff | (m[mpos+13] & 0xff) << 8; h7 += ((t5 >>> 11) | (t6 << 5)) & 0x1fff; t7 = m[mpos+14] & 0xff | (m[mpos+15] & 0xff) << 8; h8 += ((t6 >>> 8) | (t7 << 8)) & 0x1fff; h9 += ((t7 >>> 5)) | hibit; c = 0; d0 = c; d0 += h0 * r0; d0 += h1 * (5 * r9); d0 += h2 * (5 * r8); d0 += h3 * (5 * r7); d0 += h4 * (5 * r6); c = (d0 >>> 13); d0 &= 0x1fff; d0 += h5 * (5 * r5); d0 += h6 * (5 * r4); d0 += h7 * (5 * r3); d0 += h8 * (5 * r2); d0 += h9 * (5 * r1); c += (d0 >>> 13); d0 &= 0x1fff; d1 = c; d1 += h0 * r1; d1 += h1 * r0; d1 += h2 * (5 * r9); d1 += h3 * (5 * r8); d1 += h4 * (5 * r7); c = (d1 >>> 13); d1 &= 0x1fff; d1 += h5 * (5 * r6); d1 += h6 * (5 * r5); d1 += h7 * (5 * r4); d1 += h8 * (5 * r3); d1 += h9 * (5 * r2); c += (d1 >>> 13); d1 &= 0x1fff; d2 = c; d2 += h0 * r2; d2 += h1 * r1; d2 += h2 * r0; d2 += h3 * (5 * r9); d2 += h4 * (5 * r8); c = (d2 >>> 13); d2 &= 0x1fff; d2 += h5 * (5 * r7); d2 += h6 * (5 * r6); d2 += h7 * (5 * r5); d2 += h8 * (5 * r4); d2 += h9 * (5 * r3); c += (d2 >>> 13); d2 &= 0x1fff; d3 = c; d3 += h0 * r3; d3 += h1 * r2; d3 += h2 * r1; d3 += h3 * r0; d3 += h4 * (5 * r9); c = (d3 >>> 13); d3 &= 0x1fff; d3 += h5 * (5 * r8); d3 += h6 * (5 * r7); d3 += h7 * (5 * r6); d3 += h8 * (5 * r5); d3 += h9 * (5 * r4); c += (d3 >>> 13); d3 &= 0x1fff; d4 = c; d4 += h0 * r4; d4 += h1 * r3; d4 += h2 * r2; d4 += h3 * r1; d4 += h4 * r0; c = (d4 >>> 13); d4 &= 0x1fff; d4 += h5 * (5 * r9); d4 += h6 * (5 * r8); d4 += h7 * (5 * r7); d4 += h8 * (5 * r6); d4 += h9 * (5 * r5); c += (d4 >>> 13); d4 &= 0x1fff; d5 = c; d5 += h0 * r5; d5 += h1 * r4; d5 += h2 * r3; d5 += h3 * r2; d5 += h4 * r1; c = (d5 >>> 13); d5 &= 0x1fff; d5 += h5 * r0; d5 += h6 * (5 * r9); d5 += h7 * (5 * r8); d5 += h8 * (5 * r7); d5 += h9 * (5 * r6); c += (d5 >>> 13); d5 &= 0x1fff; d6 = c; d6 += h0 * r6; d6 += h1 * r5; d6 += h2 * r4; d6 += h3 * r3; d6 += h4 * r2; c = (d6 >>> 13); d6 &= 0x1fff; d6 += h5 * r1; d6 += h6 * r0; d6 += h7 * (5 * r9); d6 += h8 * (5 * r8); d6 += h9 * (5 * r7); c += (d6 >>> 13); d6 &= 0x1fff; d7 = c; d7 += h0 * r7; d7 += h1 * r6; d7 += h2 * r5; d7 += h3 * r4; d7 += h4 * r3; c = (d7 >>> 13); d7 &= 0x1fff; d7 += h5 * r2; d7 += h6 * r1; d7 += h7 * r0; d7 += h8 * (5 * r9); d7 += h9 * (5 * r8); c += (d7 >>> 13); d7 &= 0x1fff; d8 = c; d8 += h0 * r8; d8 += h1 * r7; d8 += h2 * r6; d8 += h3 * r5; d8 += h4 * r4; c = (d8 >>> 13); d8 &= 0x1fff; d8 += h5 * r3; d8 += h6 * r2; d8 += h7 * r1; d8 += h8 * r0; d8 += h9 * (5 * r9); c += (d8 >>> 13); d8 &= 0x1fff; d9 = c; d9 += h0 * r9; d9 += h1 * r8; d9 += h2 * r7; d9 += h3 * r6; d9 += h4 * r5; c = (d9 >>> 13); d9 &= 0x1fff; d9 += h5 * r4; d9 += h6 * r3; d9 += h7 * r2; d9 += h8 * r1; d9 += h9 * r0; c += (d9 >>> 13); d9 &= 0x1fff; c = (((c << 2) + c)) | 0; c = (c + d0) | 0; d0 = c & 0x1fff; c = (c >>> 13); d1 += c; h0 = d0; h1 = d1; h2 = d2; h3 = d3; h4 = d4; h5 = d5; h6 = d6; h7 = d7; h8 = d8; h9 = d9; mpos += 16; bytes -= 16; } this.h[0] = h0; this.h[1] = h1; this.h[2] = h2; this.h[3] = h3; this.h[4] = h4; this.h[5] = h5; this.h[6] = h6; this.h[7] = h7; this.h[8] = h8; this.h[9] = h9; }; poly1305.prototype.finish = function(mac, macpos) { var g = new Uint16Array(10); var c, mask, f, i; if (this.leftover) { i = this.leftover; this.buffer[i++] = 1; for (; i < 16; i++) this.buffer[i] = 0; this.fin = 1; this.blocks(this.buffer, 0, 16); } c = this.h[1] >>> 13; this.h[1] &= 0x1fff; for (i = 2; i < 10; i++) { this.h[i] += c; c = this.h[i] >>> 13; this.h[i] &= 0x1fff; } this.h[0] += (c * 5); c = this.h[0] >>> 13; this.h[0] &= 0x1fff; this.h[1] += c; c = this.h[1] >>> 13; this.h[1] &= 0x1fff; this.h[2] += c; g[0] = this.h[0] + 5; c = g[0] >>> 13; g[0] &= 0x1fff; for (i = 1; i < 10; i++) { g[i] = this.h[i] + c; c = g[i] >>> 13; g[i] &= 0x1fff; } g[9] -= (1 << 13); mask = (c ^ 1) - 1; for (i = 0; i < 10; i++) g[i] &= mask; mask = ~mask; for (i = 0; i < 10; i++) this.h[i] = (this.h[i] & mask) | g[i]; this.h[0] = ((this.h[0] ) | (this.h[1] << 13) ) & 0xffff; this.h[1] = ((this.h[1] >>> 3) | (this.h[2] << 10) ) & 0xffff; this.h[2] = ((this.h[2] >>> 6) | (this.h[3] << 7) ) & 0xffff; this.h[3] = ((this.h[3] >>> 9) | (this.h[4] << 4) ) & 0xffff; this.h[4] = ((this.h[4] >>> 12) | (this.h[5] << 1) | (this.h[6] << 14)) & 0xffff; this.h[5] = ((this.h[6] >>> 2) | (this.h[7] << 11) ) & 0xffff; this.h[6] = ((this.h[7] >>> 5) | (this.h[8] << 8) ) & 0xffff; this.h[7] = ((this.h[8] >>> 8) | (this.h[9] << 5) ) & 0xffff; f = this.h[0] + this.pad[0]; this.h[0] = f & 0xffff; for (i = 1; i < 8; i++) { f = (((this.h[i] + this.pad[i]) | 0) + (f >>> 16)) | 0; this.h[i] = f & 0xffff; } mac[macpos+ 0] = (this.h[0] >>> 0) & 0xff; mac[macpos+ 1] = (this.h[0] >>> 8) & 0xff; mac[macpos+ 2] = (this.h[1] >>> 0) & 0xff; mac[macpos+ 3] = (this.h[1] >>> 8) & 0xff; mac[macpos+ 4] = (this.h[2] >>> 0) & 0xff; mac[macpos+ 5] = (this.h[2] >>> 8) & 0xff; mac[macpos+ 6] = (this.h[3] >>> 0) & 0xff; mac[macpos+ 7] = (this.h[3] >>> 8) & 0xff; mac[macpos+ 8] = (this.h[4] >>> 0) & 0xff; mac[macpos+ 9] = (this.h[4] >>> 8) & 0xff; mac[macpos+10] = (this.h[5] >>> 0) & 0xff; mac[macpos+11] = (this.h[5] >>> 8) & 0xff; mac[macpos+12] = (this.h[6] >>> 0) & 0xff; mac[macpos+13] = (this.h[6] >>> 8) & 0xff; mac[macpos+14] = (this.h[7] >>> 0) & 0xff; mac[macpos+15] = (this.h[7] >>> 8) & 0xff; }; poly1305.prototype.update = function(m, mpos, bytes) { var i, want; if (this.leftover) { want = (16 - this.leftover); if (want > bytes) want = bytes; for (i = 0; i < want; i++) this.buffer[this.leftover + i] = m[mpos+i]; bytes -= want; mpos += want; this.leftover += want; if (this.leftover < 16) return; this.blocks(this.buffer, 0, 16); this.leftover = 0; } if (bytes >= 16) { want = bytes - (bytes % 16); this.blocks(m, mpos, want); mpos += want; bytes -= want; } if (bytes) { for (i = 0; i < bytes; i++) this.buffer[this.leftover + i] = m[mpos+i]; this.leftover += bytes; } }; function crypto_onetimeauth(out, outpos, m, mpos, n, k) { var s = new poly1305(k); s.update(m, mpos, n); s.finish(out, outpos); return 0; } function crypto_onetimeauth_verify(h, hpos, m, mpos, n, k) { var x = new Uint8Array(16); crypto_onetimeauth(x,0,m,mpos,n,k); return crypto_verify_16(h,hpos,x,0); } function crypto_secretbox(c,m,d,n,k) { var i; if (d < 32) return -1; crypto_stream_xor(c,0,m,0,d,n,k); crypto_onetimeauth(c, 16, c, 32, d - 32, c); for (i = 0; i < 16; i++) c[i] = 0; return 0; } function crypto_secretbox_open(m,c,d,n,k) { var i; var x = new Uint8Array(32); if (d < 32) return -1; crypto_stream(x,0,32,n,k); if (crypto_onetimeauth_verify(c, 16,c, 32,d - 32,x) !== 0) return -1; crypto_stream_xor(m,0,c,0,d,n,k); for (i = 0; i < 32; i++) m[i] = 0; return 0; } function set25519(r, a) { var i; for (i = 0; i < 16; i++) r[i] = a[i]|0; } function car25519(o) { var i, v, c = 1; for (i = 0; i < 16; i++) { v = o[i] + c + 65535; c = Math.floor(v / 65536); o[i] = v - c * 65536; } o[0] += c-1 + 37 * (c-1); } function sel25519(p, q, b) { var t, c = ~(b-1); for (var i = 0; i < 16; i++) { t = c & (p[i] ^ q[i]); p[i] ^= t; q[i] ^= t; } } function pack25519(o, n) { var i, j, b; var m = gf(), t = gf(); for (i = 0; i < 16; i++) t[i] = n[i]; car25519(t); car25519(t); car25519(t); for (j = 0; j < 2; j++) { m[0] = t[0] - 0xffed; for (i = 1; i < 15; i++) { m[i] = t[i] - 0xffff - ((m[i-1]>>16) & 1); m[i-1] &= 0xffff; } m[15] = t[15] - 0x7fff - ((m[14]>>16) & 1); b = (m[15]>>16) & 1; m[14] &= 0xffff; sel25519(t, m, 1-b); } for (i = 0; i < 16; i++) { o[2*i] = t[i] & 0xff; o[2*i+1] = t[i]>>8; } } function neq25519(a, b) { var c = new Uint8Array(32), d = new Uint8Array(32); pack25519(c, a); pack25519(d, b); return crypto_verify_32(c, 0, d, 0); } function par25519(a) { var d = new Uint8Array(32); pack25519(d, a); return d[0] & 1; } function unpack25519(o, n) { var i; for (i = 0; i < 16; i++) o[i] = n[2*i] + (n[2*i+1] << 8); o[15] &= 0x7fff; } function A(o, a, b) { for (var i = 0; i < 16; i++) o[i] = a[i] + b[i]; } function Z(o, a, b) { for (var i = 0; i < 16; i++) o[i] = a[i] - b[i]; } function M(o, a, b) { var v, c, t0 = 0, t1 = 0, t2 = 0, t3 = 0, t4 = 0, t5 = 0, t6 = 0, t7 = 0, t8 = 0, t9 = 0, t10 = 0, t11 = 0, t12 = 0, t13 = 0, t14 = 0, t15 = 0, t16 = 0, t17 = 0, t18 = 0, t19 = 0, t20 = 0, t21 = 0, t22 = 0, t23 = 0, t24 = 0, t25 = 0, t26 = 0, t27 = 0, t28 = 0, t29 = 0, t30 = 0, b0 = b[0], b1 = b[1], b2 = b[2], b3 = b[3], b4 = b[4], b5 = b[5], b6 = b[6], b7 = b[7], b8 = b[8], b9 = b[9], b10 = b[10], b11 = b[11], b12 = b[12], b13 = b[13], b14 = b[14], b15 = b[15]; v = a[0]; t0 += v * b0; t1 += v * b1; t2 += v * b2; t3 += v * b3; t4 += v * b4; t5 += v * b5; t6 += v * b6; t7 += v * b7; t8 += v * b8; t9 += v * b9; t10 += v * b10; t11 += v * b11; t12 += v * b12; t13 += v * b13; t14 += v * b14; t15 += v * b15; v = a[1]; t1 += v * b0; t2 += v * b1; t3 += v * b2; t4 += v * b3; t5 += v * b4; t6 += v * b5; t7 += v * b6; t8 += v * b7; t9 += v * b8; t10 += v * b9; t11 += v * b10; t12 += v * b11; t13 += v * b12; t14 += v * b13; t15 += v * b14; t16 += v * b15; v = a[2]; t2 += v * b0; t3 += v * b1; t4 += v * b2; t5 += v * b3; t6 += v * b4; t7 += v * b5; t8 += v * b6; t9 += v * b7; t10 += v * b8; t11 += v * b9; t12 += v * b10; t13 += v * b11; t14 += v * b12; t15 += v * b13; t16 += v * b14; t17 += v * b15; v = a[3]; t3 += v * b0; t4 += v * b1; t5 += v * b2; t6 += v * b3; t7 += v * b4; t8 += v * b5; t9 += v * b6; t10 += v * b7; t11 += v * b8; t12 += v * b9; t13 += v * b10; t14 += v * b11; t15 += v * b12; t16 += v * b13; t17 += v * b14; t18 += v * b15; v = a[4]; t4 += v * b0; t5 += v * b1; t6 += v * b2; t7 += v * b3; t8 += v * b4; t9 += v * b5; t10 += v * b6; t11 += v * b7; t12 += v * b8; t13 += v * b9; t14 += v * b10; t15 += v * b11; t16 += v * b12; t17 += v * b13; t18 += v * b14; t19 += v * b15; v = a[5]; t5 += v * b0; t6 += v * b1; t7 += v * b2; t8 += v * b3; t9 += v * b4; t10 += v * b5; t11 += v * b6; t12 += v * b7; t13 += v * b8; t14 += v * b9; t15 += v * b10; t16 += v * b11; t17 += v * b12; t18 += v * b13; t19 += v * b14; t20 += v * b15; v = a[6]; t6 += v * b0; t7 += v * b1; t8 += v * b2; t9 += v * b3; t10 += v * b4; t11 += v * b5; t12 += v * b6; t13 += v * b7; t14 += v * b8; t15 += v * b9; t16 += v * b10; t17 += v * b11; t18 += v * b12; t19 += v * b13; t20 += v * b14; t21 += v * b15; v = a[7]; t7 += v * b0; t8 += v * b1; t9 += v * b2; t10 += v * b3; t11 += v * b4; t12 += v * b5; t13 += v * b6; t14 += v * b7; t15 += v * b8; t16 += v * b9; t17 += v * b10; t18 += v * b11; t19 += v * b12; t20 += v * b13; t21 += v * b14; t22 += v * b15; v = a[8]; t8 += v * b0; t9 += v * b1; t10 += v * b2; t11 += v * b3; t12 += v * b4; t13 += v * b5; t14 += v * b6; t15 += v * b7; t16 += v * b8; t17 += v * b9; t18 += v * b10; t19 += v * b11; t20 += v * b12; t21 += v * b13; t22 += v * b14; t23 += v * b15; v = a[9]; t9 += v * b0; t10 += v * b1; t11 += v * b2; t12 += v * b3; t13 += v * b4; t14 += v * b5; t15 += v * b6; t16 += v * b7; t17 += v * b8; t18 += v * b9; t19 += v * b10; t20 += v * b11; t21 += v * b12; t22 += v * b13; t23 += v * b14; t24 += v * b15; v = a[10]; t10 += v * b0; t11 += v * b1; t12 += v * b2; t13 += v * b3; t14 += v * b4; t15 += v * b5; t16 += v * b6; t17 += v * b7; t18 += v * b8; t19 += v * b9; t20 += v * b10; t21 += v * b11; t22 += v * b12; t23 += v * b13; t24 += v * b14; t25 += v * b15; v = a[11]; t11 += v * b0; t12 += v * b1; t13 += v * b2; t14 += v * b3; t15 += v * b4; t16 += v * b5; t17 += v * b6; t18 += v * b7; t19 += v * b8; t20 += v * b9; t21 += v * b10; t22 += v * b11; t23 += v * b12; t24 += v * b13; t25 += v * b14; t26 += v * b15; v = a[12]; t12 += v * b0; t13 += v * b1; t14 += v * b2; t15 += v * b3; t16 += v * b4; t17 += v * b5; t18 += v * b6; t19 += v * b7; t20 += v * b8; t21 += v * b9; t22 += v * b10; t23 += v * b11; t24 += v * b12; t25 += v * b13; t26 += v * b14; t27 += v * b15; v = a[13]; t13 += v * b0; t14 += v * b1; t15 += v * b2; t16 += v * b3; t17 += v * b4; t18 += v * b5; t19 += v * b6; t20 += v * b7; t21 += v * b8; t22 += v * b9; t23 += v * b10; t24 += v * b11; t25 += v * b12; t26 += v * b13; t27 += v * b14; t28 += v * b15; v = a[14]; t14 += v * b0; t15 += v * b1; t16 += v * b2; t17 += v * b3; t18 += v * b4; t19 += v * b5; t20 += v * b6; t21 += v * b7; t22 += v * b8; t23 += v * b9; t24 += v * b10; t25 += v * b11; t26 += v * b12; t27 += v * b13; t28 += v * b14; t29 += v * b15; v = a[15]; t15 += v * b0; t16 += v * b1; t17 += v * b2; t18 += v * b3; t19 += v * b4; t20 += v * b5; t21 += v * b6; t22 += v * b7; t23 += v * b8; t24 += v * b9; t25 += v * b10; t26 += v * b11; t27 += v * b12; t28 += v * b13; t29 += v * b14; t30 += v * b15; t0 += 38 * t16; t1 += 38 * t17; t2 += 38 * t18; t3 += 38 * t19; t4 += 38 * t20; t5 += 38 * t21; t6 += 38 * t22; t7 += 38 * t23; t8 += 38 * t24; t9 += 38 * t25; t10 += 38 * t26; t11 += 38 * t27; t12 += 38 * t28; t13 += 38 * t29; t14 += 38 * t30; // t15 left as is // first car c = 1; v = t0 + c + 65535; c = Math.floor(v / 65536); t0 = v - c * 65536; v = t1 + c + 65535; c = Math.floor(v / 65536); t1 = v - c * 65536; v = t2 + c + 65535; c = Math.floor(v / 65536); t2 = v - c * 65536; v = t3 + c + 65535; c = Math.floor(v / 65536); t3 = v - c * 65536; v = t4 + c + 65535; c = Math.floor(v / 65536); t4 = v - c * 65536; v = t5 + c + 65535; c = Math.floor(v / 65536); t5 = v - c * 65536; v = t6 + c + 65535; c = Math.floor(v / 65536); t6 = v - c * 65536; v = t7 + c + 65535; c = Math.floor(v / 65536); t7 = v - c * 65536; v = t8 + c + 65535; c = Math.floor(v / 65536); t8 = v - c * 65536; v = t9 + c + 65535; c = Math.floor(v / 65536); t9 = v - c * 65536; v = t10 + c + 65535; c = Math.floor(v / 65536); t10 = v - c * 65536; v = t11 + c + 65535; c = Math.floor(v / 65536); t11 = v - c * 65536; v = t12 + c + 65535; c = Math.floor(v / 65536); t12 = v - c * 65536; v = t13 + c + 65535; c = Math.floor(v / 65536); t13 = v - c * 65536; v = t14 + c + 65535; c = Math.floor(v / 65536); t14 = v - c * 65536; v = t15 + c + 65535; c = Math.floor(v / 65536); t15 = v - c * 65536; t0 += c-1 + 37 * (c-1); // second car c = 1; v = t0 + c + 65535; c = Math.floor(v / 65536); t0 = v - c * 65536; v = t1 + c + 65535; c = Math.floor(v / 65536); t1 = v - c * 65536; v = t2 + c + 65535; c = Math.floor(v / 65536); t2 = v - c * 65536; v = t3 + c + 65535; c = Math.floor(v / 65536); t3 = v - c * 65536; v = t4 + c + 65535; c = Math.floor(v / 65536); t4 = v - c * 65536; v = t5 + c + 65535; c = Math.floor(v / 65536); t5 = v - c * 65536; v = t6 + c + 65535; c = Math.floor(v / 65536); t6 = v - c * 65536; v = t7 + c + 65535; c = Math.floor(v / 65536); t7 = v - c * 65536; v = t8 + c + 65535; c = Math.floor(v / 65536); t8 = v - c * 65536; v = t9 + c + 65535; c = Math.floor(v / 65536); t9 = v - c * 65536; v = t10 + c + 65535; c = Math.floor(v / 65536); t10 = v - c * 65536; v = t11 + c + 65535; c = Math.floor(v / 65536); t11 = v - c * 65536; v = t12 + c + 65535; c = Math.floor(v / 65536); t12 = v - c * 65536; v = t13 + c + 65535; c = Math.floor(v / 65536); t13 = v - c * 65536; v = t14 + c + 65535; c = Math.floor(v / 65536); t14 = v - c * 65536; v = t15 + c + 65535; c = Math.floor(v / 65536); t15 = v - c * 65536; t0 += c-1 + 37 * (c-1); o[ 0] = t0; o[ 1] = t1; o[ 2] = t2; o[ 3] = t3; o[ 4] = t4; o[ 5] = t5; o[ 6] = t6; o[ 7] = t7; o[ 8] = t8; o[ 9] = t9; o[10] = t10; o[11] = t11; o[12] = t12; o[13] = t13; o[14] = t14; o[15] = t15; } function S(o, a) { M(o, a, a); } function inv25519(o, i) { var c = gf(); var a; for (a = 0; a < 16; a++) c[a] = i[a]; for (a = 253; a >= 0; a--) { S(c, c); if(a !== 2 && a !== 4) M(c, c, i); } for (a = 0; a < 16; a++) o[a] = c[a]; } function pow2523(o, i) { var c = gf(); var a; for (a = 0; a < 16; a++) c[a] = i[a]; for (a = 250; a >= 0; a--) { S(c, c); if(a !== 1) M(c, c, i); } for (a = 0; a < 16; a++) o[a] = c[a]; } function crypto_scalarmult(q, n, p) { var z = new Uint8Array(32); var x = new Float64Array(80), r, i; var a = gf(), b = gf(), c = gf(), d = gf(), e = gf(), f = gf(); for (i = 0; i < 31; i++) z[i] = n[i]; z[31]=(n[31]&127)|64; z[0]&=248; unpack25519(x,p); for (i = 0; i < 16; i++) { b[i]=x[i]; d[i]=a[i]=c[i]=0; } a[0]=d[0]=1; for (i=254; i>=0; --i) { r=(z[i>>>3]>>>(i&7))&1; sel25519(a,b,r); sel25519(c,d,r); A(e,a,c); Z(a,a,c); A(c,b,d); Z(b,b,d); S(d,e); S(f,a); M(a,c,a); M(c,b,e); A(e,a,c); Z(a,a,c); S(b,a); Z(c,d,f); M(a,c,_121665); A(a,a,d); M(c,c,a); M(a,d,f); M(d,b,x); S(b,e); sel25519(a,b,r); sel25519(c,d,r); } for (i = 0; i < 16; i++) { x[i+16]=a[i]; x[i+32]=c[i]; x[i+48]=b[i]; x[i+64]=d[i]; } var x32 = x.subarray(32); var x16 = x.subarray(16); inv25519(x32,x32); M(x16,x16,x32); pack25519(q,x16); return 0; } function crypto_scalarmult_base(q, n) { return crypto_scalarmult(q, n, _9); } function crypto_box_keypair(y, x) { randombytes(x, 32); return crypto_scalarmult_base(y, x); } function crypto_box_beforenm(k, y, x) { var s = new Uint8Array(32); crypto_scalarmult(s, x, y); return crypto_core_hsalsa20(k, _0, s, sigma); } var crypto_box_afternm = crypto_secretbox; var crypto_box_open_afternm = crypto_secretbox_open; function crypto_box(c, m, d, n, y, x) { var k = new Uint8Array(32); crypto_box_beforenm(k, y, x); return crypto_box_afternm(c, m, d, n, k); } function crypto_box_open(m, c, d, n, y, x) { var k = new Uint8Array(32); crypto_box_beforenm(k, y, x); return crypto_box_open_afternm(m, c, d, n, k); } var K = [ 0x428a2f98, 0xd728ae22, 0x71374491, 0x23ef65cd, 0xb5c0fbcf, 0xec4d3b2f, 0xe9b5dba5, 0x8189dbbc, 0x3956c25b, 0xf348b538, 0x59f111f1, 0xb605d019, 0x923f82a4, 0xaf194f9b, 0xab1c5ed5, 0xda6d8118, 0xd807aa98, 0xa3030242, 0x12835b01, 0x45706fbe, 0x243185be, 0x4ee4b28c, 0x550c7dc3, 0xd5ffb4e2, 0x72be5d74, 0xf27b896f, 0x80deb1fe, 0x3b1696b1, 0x9bdc06a7, 0x25c71235, 0xc19bf174, 0xcf692694, 0xe49b69c1, 0x9ef14ad2, 0xefbe4786, 0x384f25e3, 0x0fc19dc6, 0x8b8cd5b5, 0x240ca1cc, 0x77ac9c65, 0x2de92c6f, 0x592b0275, 0x4a7484aa, 0x6ea6e483, 0x5cb0a9dc, 0xbd41fbd4, 0x76f988da, 0x831153b5, 0x983e5152, 0xee66dfab, 0xa831c66d, 0x2db43210, 0xb00327c8, 0x98fb213f, 0xbf597fc7, 0xbeef0ee4, 0xc6e00bf3, 0x3da88fc2, 0xd5a79147, 0x930aa725, 0x06ca6351, 0xe003826f, 0x14292967, 0x0a0e6e70, 0x27b70a85, 0x46d22ffc, 0x2e1b2138, 0x5c26c926, 0x4d2c6dfc, 0x5ac42aed, 0x53380d13, 0x9d95b3df, 0x650a7354, 0x8baf63de, 0x766a0abb, 0x3c77b2a8, 0x81c2c92e, 0x47edaee6, 0x92722c85, 0x1482353b, 0xa2bfe8a1, 0x4cf10364, 0xa81a664b, 0xbc423001, 0xc24b8b70, 0xd0f89791, 0xc76c51a3, 0x0654be30, 0xd192e819, 0xd6ef5218, 0xd6990624, 0x5565a910, 0xf40e3585, 0x5771202a, 0x106aa070, 0x32bbd1b8, 0x19a4c116, 0xb8d2d0c8, 0x1e376c08, 0x5141ab53, 0x2748774c, 0xdf8eeb99, 0x34b0bcb5, 0xe19b48a8, 0x391c0cb3, 0xc5c95a63, 0x4ed8aa4a, 0xe3418acb, 0x5b9cca4f, 0x7763e373, 0x682e6ff3, 0xd6b2b8a3, 0x748f82ee, 0x5defb2fc, 0x78a5636f, 0x43172f60, 0x84c87814, 0xa1f0ab72, 0x8cc70208, 0x1a6439ec, 0x90befffa, 0x23631e28, 0xa4506ceb, 0xde82bde9, 0xbef9a3f7, 0xb2c67915, 0xc67178f2, 0xe372532b, 0xca273ece, 0xea26619c, 0xd186b8c7, 0x21c0c207, 0xeada7dd6, 0xcde0eb1e, 0xf57d4f7f, 0xee6ed178, 0x06f067aa, 0x72176fba, 0x0a637dc5, 0xa2c898a6, 0x113f9804, 0xbef90dae, 0x1b710b35, 0x131c471b, 0x28db77f5, 0x23047d84, 0x32caab7b, 0x40c72493, 0x3c9ebe0a, 0x15c9bebc, 0x431d67c4, 0x9c100d4c, 0x4cc5d4be, 0xcb3e42b6, 0x597f299c, 0xfc657e2a, 0x5fcb6fab, 0x3ad6faec, 0x6c44198c, 0x4a475817 ]; function crypto_hashblocks_hl(hh, hl, m, n) { var wh = new Int32Array(16), wl = new Int32Array(16), bh0, bh1, bh2, bh3, bh4, bh5, bh6, bh7, bl0, bl1, bl2, bl3, bl4, bl5, bl6, bl7, th, tl, i, j, h, l, a, b, c, d; var ah0 = hh[0], ah1 = hh[1], ah2 = hh[2], ah3 = hh[3], ah4 = hh[4], ah5 = hh[5], ah6 = hh[6], ah7 = hh[7], al0 = hl[0], al1 = hl[1], al2 = hl[2], al3 = hl[3], al4 = hl[4], al5 = hl[5], al6 = hl[6], al7 = hl[7]; var pos = 0; while (n >= 128) { for (i = 0; i < 16; i++) { j = 8 * i + pos; wh[i] = (m[j+0] << 24) | (m[j+1] << 16) | (m[j+2] << 8) | m[j+3]; wl[i] = (m[j+4] << 24) | (m[j+5] << 16) | (m[j+6] << 8) | m[j+7]; } for (i = 0; i < 80; i++) { bh0 = ah0; bh1 = ah1; bh2 = ah2; bh3 = ah3; bh4 = ah4; bh5 = ah5; bh6 = ah6; bh7 = ah7; bl0 = al0; bl1 = al1; bl2 = al2; bl3 = al3; bl4 = al4; bl5 = al5; bl6 = al6; bl7 = al7; // add h = ah7; l = al7; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; // Sigma1 h = ((ah4 >>> 14) | (al4 << (32-14))) ^ ((ah4 >>> 18) | (al4 << (32-18))) ^ ((al4 >>> (41-32)) | (ah4 << (32-(41-32)))); l = ((al4 >>> 14) | (ah4 << (32-14))) ^ ((al4 >>> 18) | (ah4 << (32-18))) ^ ((ah4 >>> (41-32)) | (al4 << (32-(41-32)))); a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; // Ch h = (ah4 & ah5) ^ (~ah4 & ah6); l = (al4 & al5) ^ (~al4 & al6); a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; // K h = K[i*2]; l = K[i*2+1]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; // w h = wh[i%16]; l = wl[i%16]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; th = c & 0xffff | d << 16; tl = a & 0xffff | b << 16; // add h = th; l = tl; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; // Sigma0 h = ((ah0 >>> 28) | (al0 << (32-28))) ^ ((al0 >>> (34-32)) | (ah0 << (32-(34-32)))) ^ ((al0 >>> (39-32)) | (ah0 << (32-(39-32)))); l = ((al0 >>> 28) | (ah0 << (32-28))) ^ ((ah0 >>> (34-32)) | (al0 << (32-(34-32)))) ^ ((ah0 >>> (39-32)) | (al0 << (32-(39-32)))); a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; // Maj h = (ah0 & ah1) ^ (ah0 & ah2) ^ (ah1 & ah2); l = (al0 & al1) ^ (al0 & al2) ^ (al1 & al2); a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; bh7 = (c & 0xffff) | (d << 16); bl7 = (a & 0xffff) | (b << 16); // add h = bh3; l = bl3; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = th; l = tl; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; bh3 = (c & 0xffff) | (d << 16); bl3 = (a & 0xffff) | (b << 16); ah1 = bh0; ah2 = bh1; ah3 = bh2; ah4 = bh3; ah5 = bh4; ah6 = bh5; ah7 = bh6; ah0 = bh7; al1 = bl0; al2 = bl1; al3 = bl2; al4 = bl3; al5 = bl4; al6 = bl5; al7 = bl6; al0 = bl7; if (i%16 === 15) { for (j = 0; j < 16; j++) { // add h = wh[j]; l = wl[j]; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = wh[(j+9)%16]; l = wl[(j+9)%16]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; // sigma0 th = wh[(j+1)%16]; tl = wl[(j+1)%16]; h = ((th >>> 1) | (tl << (32-1))) ^ ((th >>> 8) | (tl << (32-8))) ^ (th >>> 7); l = ((tl >>> 1) | (th << (32-1))) ^ ((tl >>> 8) | (th << (32-8))) ^ ((tl >>> 7) | (th << (32-7))); a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; // sigma1 th = wh[(j+14)%16]; tl = wl[(j+14)%16]; h = ((th >>> 19) | (tl << (32-19))) ^ ((tl >>> (61-32)) | (th << (32-(61-32)))) ^ (th >>> 6); l = ((tl >>> 19) | (th << (32-19))) ^ ((th >>> (61-32)) | (tl << (32-(61-32)))) ^ ((tl >>> 6) | (th << (32-6))); a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; wh[j] = (c & 0xffff) | (d << 16); wl[j] = (a & 0xffff) | (b << 16); } } } // add h = ah0; l = al0; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = hh[0]; l = hl[0]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; hh[0] = ah0 = (c & 0xffff) | (d << 16); hl[0] = al0 = (a & 0xffff) | (b << 16); h = ah1; l = al1; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = hh[1]; l = hl[1]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; hh[1] = ah1 = (c & 0xffff) | (d << 16); hl[1] = al1 = (a & 0xffff) | (b << 16); h = ah2; l = al2; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = hh[2]; l = hl[2]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; hh[2] = ah2 = (c & 0xffff) | (d << 16); hl[2] = al2 = (a & 0xffff) | (b << 16); h = ah3; l = al3; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = hh[3]; l = hl[3]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; hh[3] = ah3 = (c & 0xffff) | (d << 16); hl[3] = al3 = (a & 0xffff) | (b << 16); h = ah4; l = al4; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = hh[4]; l = hl[4]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; hh[4] = ah4 = (c & 0xffff) | (d << 16); hl[4] = al4 = (a & 0xffff) | (b << 16); h = ah5; l = al5; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = hh[5]; l = hl[5]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; hh[5] = ah5 = (c & 0xffff) | (d << 16); hl[5] = al5 = (a & 0xffff) | (b << 16); h = ah6; l = al6; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = hh[6]; l = hl[6]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; hh[6] = ah6 = (c & 0xffff) | (d << 16); hl[6] = al6 = (a & 0xffff) | (b << 16); h = ah7; l = al7; a = l & 0xffff; b = l >>> 16; c = h & 0xffff; d = h >>> 16; h = hh[7]; l = hl[7]; a += l & 0xffff; b += l >>> 16; c += h & 0xffff; d += h >>> 16; b += a >>> 16; c += b >>> 16; d += c >>> 16; hh[7] = ah7 = (c & 0xffff) | (d << 16); hl[7] = al7 = (a & 0xffff) | (b << 16); pos += 128; n -= 128; } return n; } function crypto_hash(out, m, n) { var hh = new Int32Array(8), hl = new Int32Array(8), x = new Uint8Array(256), i, b = n; hh[0] = 0x6a09e667; hh[1] = 0xbb67ae85; hh[2] = 0x3c6ef372; hh[3] = 0xa54ff53a; hh[4] = 0x510e527f; hh[5] = 0x9b05688c; hh[6] = 0x1f83d9ab; hh[7] = 0x5be0cd19; hl[0] = 0xf3bcc908; hl[1] = 0x84caa73b; hl[2] = 0xfe94f82b; hl[3] = 0x5f1d36f1; hl[4] = 0xade682d1; hl[5] = 0x2b3e6c1f; hl[6] = 0xfb41bd6b; hl[7] = 0x137e2179; crypto_hashblocks_hl(hh, hl, m, n); n %= 128; for (i = 0; i < n; i++) x[i] = m[b-n+i]; x[n] = 128; n = 256-128*(n<112?1:0); x[n-9] = 0; ts64(x, n-8, (b / 0x20000000) | 0, b << 3); crypto_hashblocks_hl(hh, hl, x, n); for (i = 0; i < 8; i++) ts64(out, 8*i, hh[i], hl[i]); return 0; } function add(p, q) { var a = gf(), b = gf(), c = gf(), d = gf(), e = gf(), f = gf(), g = gf(), h = gf(), t = gf(); Z(a, p[1], p[0]); Z(t, q[1], q[0]); M(a, a, t); A(b, p[0], p[1]); A(t, q[0], q[1]); M(b, b, t); M(c, p[3], q[3]); M(c, c, D2); M(d, p[2], q[2]); A(d, d, d); Z(e, b, a); Z(f, d, c); A(g, d, c); A(h, b, a); M(p[0], e, f); M(p[1], h, g); M(p[2], g, f); M(p[3], e, h); } function cswap(p, q, b) { var i; for (i = 0; i < 4; i++) { sel25519(p[i], q[i], b); } } function pack(r, p) { var tx = gf(), ty = gf(), zi = gf(); inv25519(zi, p[2]); M(tx, p[0], zi); M(ty, p[1], zi); pack25519(r, ty); r[31] ^= par25519(tx) << 7; } function scalarmult(p, q, s) { var b, i; set25519(p[0], gf0); set25519(p[1], gf1); set25519(p[2], gf1); set25519(p[3], gf0); for (i = 255; i >= 0; --i) { b = (s[(i/8)|0] >> (i&7)) & 1; cswap(p, q, b); add(q, p); add(p, p); cswap(p, q, b); } } function scalarbase(p, s) { var q = [gf(), gf(), gf(), gf()]; set25519(q[0], X); set25519(q[1], Y); set25519(q[2], gf1); M(q[3], X, Y); scalarmult(p, q, s); } function crypto_sign_keypair(pk, sk, seeded) { var d = new Uint8Array(64); var p = [gf(), gf(), gf(), gf()]; var i; if (!seeded) randombytes(sk, 32); crypto_hash(d, sk, 32); d[0] &= 248; d[31] &= 127; d[31] |= 64; scalarbase(p, d); pack(pk, p); for (i = 0; i < 32; i++) sk[i+32] = pk[i]; return 0; } var L = new Float64Array([0xed, 0xd3, 0xf5, 0x5c, 0x1a, 0x63, 0x12, 0x58, 0xd6, 0x9c, 0xf7, 0xa2, 0xde, 0xf9, 0xde, 0x14, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0x10]); function modL(r, x) { var carry, i, j, k; for (i = 63; i >= 32; --i) { carry = 0; for (j = i - 32, k = i - 12; j < k; ++j) { x[j] += carry - 16 * x[i] * L[j - (i - 32)]; carry = (x[j] + 128) >> 8; x[j] -= carry * 256; } x[j] += carry; x[i] = 0; } carry = 0; for (j = 0; j < 32; j++) { x[j] += carry - (x[31] >> 4) * L[j]; carry = x[j] >> 8; x[j] &= 255; } for (j = 0; j < 32; j++) x[j] -= carry * L[j]; for (i = 0; i < 32; i++) { x[i+1] += x[i] >> 8; r[i] = x[i] & 255; } } function reduce(r) { var x = new Float64Array(64), i; for (i = 0; i < 64; i++) x[i] = r[i]; for (i = 0; i < 64; i++) r[i] = 0; modL(r, x); } // Note: difference from C - smlen returned, not passed as argument. function crypto_sign(sm, m, n, sk) { var d = new Uint8Array(64), h = new Uint8Array(64), r = new Uint8Array(64); var i, j, x = new Float64Array(64); var p = [gf(), gf(), gf(), gf()]; crypto_hash(d, sk, 32); d[0] &= 248; d[31] &= 127; d[31] |= 64; var smlen = n + 64; for (i = 0; i < n; i++) sm[64 + i] = m[i]; for (i = 0; i < 32; i++) sm[32 + i] = d[32 + i]; crypto_hash(r, sm.subarray(32), n+32); reduce(r); scalarbase(p, r); pack(sm, p); for (i = 32; i < 64; i++) sm[i] = sk[i]; crypto_hash(h, sm, n + 64); reduce(h); for (i = 0; i < 64; i++) x[i] = 0; for (i = 0; i < 32; i++) x[i] = r[i]; for (i = 0; i < 32; i++) { for (j = 0; j < 32; j++) { x[i+j] += h[i] * d[j]; } } modL(sm.subarray(32), x); return smlen; } function unpackneg(r, p) { var t = gf(), chk = gf(), num = gf(), den = gf(), den2 = gf(), den4 = gf(), den6 = gf(); set25519(r[2], gf1); unpack25519(r[1], p); S(num, r[1]); M(den, num, D); Z(num, num, r[2]); A(den, r[2], den); S(den2, den); S(den4, den2); M(den6, den4, den2); M(t, den6, num); M(t, t, den); pow2523(t, t); M(t, t, num); M(t, t, den); M(t, t, den); M(r[0], t, den); S(chk, r[0]); M(chk, chk, den); if (neq25519(chk, num)) M(r[0], r[0], I); S(chk, r[0]); M(chk, chk, den); if (neq25519(chk, num)) return -1; if (par25519(r[0]) === (p[31]>>7)) Z(r[0], gf0, r[0]); M(r[3], r[0], r[1]); return 0; } function crypto_sign_open(m, sm, n, pk) { var i, mlen; var t = new Uint8Array(32), h = new Uint8Array(64); var p = [gf(), gf(), gf(), gf()], q = [gf(), gf(), gf(), gf()]; mlen = -1; if (n < 64) return -1; if (unpackneg(q, pk)) return -1; for (i = 0; i < n; i++) m[i] = sm[i]; for (i = 0; i < 32; i++) m[i+32] = pk[i]; crypto_hash(h, m, n); reduce(h); scalarmult(p, q, h); scalarbase(q, sm.subarray(32)); add(p, q); pack(t, p); n -= 64; if (crypto_verify_32(sm, 0, t, 0)) { for (i = 0; i < n; i++) m[i] = 0; return -1; } for (i = 0; i < n; i++) m[i] = sm[i + 64]; mlen = n; return mlen; } var crypto_secretbox_KEYBYTES = 32, crypto_secretbox_NONCEBYTES = 24, crypto_secretbox_ZEROBYTES = 32, crypto_secretbox_BOXZEROBYTES = 16, crypto_scalarmult_BYTES = 32, crypto_scalarmult_SCALARBYTES = 32, crypto_box_PUBLICKEYBYTES = 32, crypto_box_SECRETKEYBYTES = 32, crypto_box_BEFORENMBYTES = 32, crypto_box_NONCEBYTES = crypto_secretbox_NONCEBYTES, crypto_box_ZEROBYTES = crypto_secretbox_ZEROBYTES, crypto_box_BOXZEROBYTES = crypto_secretbox_BOXZEROBYTES, crypto_sign_BYTES = 64, crypto_sign_PUBLICKEYBYTES = 32, crypto_sign_SECRETKEYBYTES = 64, crypto_sign_SEEDBYTES = 32, crypto_hash_BYTES = 64; nacl.lowlevel = { crypto_core_hsalsa20: crypto_core_hsalsa20, crypto_stream_xor: crypto_stream_xor, crypto_stream: crypto_stream, crypto_stream_salsa20_xor: crypto_stream_salsa20_xor, crypto_stream_salsa20: crypto_stream_salsa20, crypto_onetimeauth: crypto_onetimeauth, crypto_onetimeauth_verify: crypto_onetimeauth_verify, crypto_verify_16: crypto_verify_16, crypto_verify_32: crypto_verify_32, crypto_secretbox: crypto_secretbox, crypto_secretbox_open: crypto_secretbox_open, crypto_scalarmult: crypto_scalarmult, crypto_scalarmult_base: crypto_scalarmult_base, crypto_box_beforenm: crypto_box_beforenm, crypto_box_afternm: crypto_box_afternm, crypto_box: crypto_box, crypto_box_open: crypto_box_open, crypto_box_keypair: crypto_box_keypair, crypto_hash: crypto_hash, crypto_sign: crypto_sign, crypto_sign_keypair: crypto_sign_keypair, crypto_sign_open: crypto_sign_open, crypto_secretbox_KEYBYTES: crypto_secretbox_KEYBYTES, crypto_secretbox_NONCEBYTES: crypto_secretbox_NONCEBYTES, crypto_secretbox_ZEROBYTES: crypto_secretbox_ZEROBYTES, crypto_secretbox_BOXZEROBYTES: crypto_secretbox_BOXZEROBYTES, crypto_scalarmult_BYTES: crypto_scalarmult_BYTES, crypto_scalarmult_SCALARBYTES: crypto_scalarmult_SCALARBYTES, crypto_box_PUBLICKEYBYTES: crypto_box_PUBLICKEYBYTES, crypto_box_SECRETKEYBYTES: crypto_box_SECRETKEYBYTES, crypto_box_BEFORENMBYTES: crypto_box_BEFORENMBYTES, crypto_box_NONCEBYTES: crypto_box_NONCEBYTES, crypto_box_ZEROBYTES: crypto_box_ZEROBYTES, crypto_box_BOXZEROBYTES: crypto_box_BOXZEROBYTES, crypto_sign_BYTES: crypto_sign_BYTES, crypto_sign_PUBLICKEYBYTES: crypto_sign_PUBLICKEYBYTES, crypto_sign_SECRETKEYBYTES: crypto_sign_SECRETKEYBYTES, crypto_sign_SEEDBYTES: crypto_sign_SEEDBYTES, crypto_hash_BYTES: crypto_hash_BYTES }; /* High-level API */ function checkLengths(k, n) { if (k.length !== crypto_secretbox_KEYBYTES) throw new Error('bad key size'); if (n.length !== crypto_secretbox_NONCEBYTES) throw new Error('bad nonce size'); } function checkBoxLengths(pk, sk) { if (pk.length !== crypto_box_PUBLICKEYBYTES) throw new Error('bad public key size'); if (sk.length !== crypto_box_SECRETKEYBYTES) throw new Error('bad secret key size'); } function checkArrayTypes() { var t, i; for (i = 0; i < arguments.length; i++) { if ((t = Object.prototype.toString.call(arguments[i])) !== '[object Uint8Array]') throw new TypeError('unexpected type ' + t + ', use Uint8Array'); } } function cleanup(arr) { for (var i = 0; i < arr.length; i++) arr[i] = 0; } // TODO: Completely remove this in v0.15. if (!nacl.util) { nacl.util = {}; nacl.util.decodeUTF8 = nacl.util.encodeUTF8 = nacl.util.encodeBase64 = nacl.util.decodeBase64 = function() { throw new Error('nacl.util moved into separate package: https://github.com/dchest/tweetnacl-util-js'); }; } nacl.randomBytes = function(n) { var b = new Uint8Array(n); randombytes(b, n); return b; }; nacl.secretbox = function(msg, nonce, key) { checkArrayTypes(msg, nonce, key); checkLengths(key, nonce); var m = new Uint8Array(crypto_secretbox_ZEROBYTES + msg.length); var c = new Uint8Array(m.length); for (var i = 0; i < msg.length; i++) m[i+crypto_secretbox_ZEROBYTES] = msg[i]; crypto_secretbox(c, m, m.length, nonce, key); return c.subarray(crypto_secretbox_BOXZEROBYTES); }; nacl.secretbox.open = function(box, nonce, key) { checkArrayTypes(box, nonce, key); checkLengths(key, nonce); var c = new Uint8Array(crypto_secretbox_BOXZEROBYTES + box.length); var m = new Uint8Array(c.length); for (var i = 0; i < box.length; i++) c[i+crypto_secretbox_BOXZEROBYTES] = box[i]; if (c.length < 32) return false; if (crypto_secretbox_open(m, c, c.length, nonce, key) !== 0) return false; return m.subarray(crypto_secretbox_ZEROBYTES); }; nacl.secretbox.keyLength = crypto_secretbox_KEYBYTES; nacl.secretbox.nonceLength = crypto_secretbox_NONCEBYTES; nacl.secretbox.overheadLength = crypto_secretbox_BOXZEROBYTES; nacl.scalarMult = function(n, p) { checkArrayTypes(n, p); if (n.length !== crypto_scalarmult_SCALARBYTES) throw new Error('bad n size'); if (p.length !== crypto_scalarmult_BYTES) throw new Error('bad p size'); var q = new Uint8Array(crypto_scalarmult_BYTES); crypto_scalarmult(q, n, p); return q; }; nacl.scalarMult.base = function(n) { checkArrayTypes(n); if (n.length !== crypto_scalarmult_SCALARBYTES) throw new Error('bad n size'); var q = new Uint8Array(crypto_scalarmult_BYTES); crypto_scalarmult_base(q, n); return q; }; nacl.scalarMult.scalarLength = crypto_scalarmult_SCALARBYTES; nacl.scalarMult.groupElementLength = crypto_scalarmult_BYTES; nacl.box = function(msg, nonce, publicKey, secretKey) { var k = nacl.box.before(publicKey, secretKey); return nacl.secretbox(msg, nonce, k); }; nacl.box.before = function(publicKey, secretKey) { checkArrayTypes(publicKey, secretKey); checkBoxLengths(publicKey, secretKey); var k = new Uint8Array(crypto_box_BEFORENMBYTES); crypto_box_beforenm(k, publicKey, secretKey); return k; }; nacl.box.after = nacl.secretbox; nacl.box.open = function(msg, nonce, publicKey, secretKey) { var k = nacl.box.before(publicKey, secretKey); return nacl.secretbox.open(msg, nonce, k); }; nacl.box.open.after = nacl.secretbox.open; nacl.box.keyPair = function() { var pk = new Uint8Array(crypto_box_PUBLICKEYBYTES); var sk = new Uint8Array(crypto_box_SECRETKEYBYTES); crypto_box_keypair(pk, sk); return {publicKey: pk, secretKey: sk}; }; nacl.box.keyPair.fromSecretKey = function(secretKey) { checkArrayTypes(secretKey); if (secretKey.length !== crypto_box_SECRETKEYBYTES) throw new Error('bad secret key size'); var pk = new Uint8Array(crypto_box_PUBLICKEYBYTES); crypto_scalarmult_base(pk, secretKey); return {publicKey: pk, secretKey: new Uint8Array(secretKey)}; }; nacl.box.publicKeyLength = crypto_box_PUBLICKEYBYTES; nacl.box.secretKeyLength = crypto_box_SECRETKEYBYTES; nacl.box.sharedKeyLength = crypto_box_BEFORENMBYTES; nacl.box.nonceLength = crypto_box_NONCEBYTES; nacl.box.overheadLength = nacl.secretbox.overheadLength; nacl.sign = function(msg, secretKey) { checkArrayTypes(msg, secretKey); if (secretKey.length !== crypto_sign_SECRETKEYBYTES) throw new Error('bad secret key size'); var signedMsg = new Uint8Array(crypto_sign_BYTES+msg.length); crypto_sign(signedMsg, msg, msg.length, secretKey); return signedMsg; }; nacl.sign.open = function(signedMsg, publicKey) { if (arguments.length !== 2) throw new Error('nacl.sign.open accepts 2 arguments; did you mean to use nacl.sign.detached.verify?'); checkArrayTypes(signedMsg, publicKey); if (publicKey.length !== crypto_sign_PUBLICKEYBYTES) throw new Error('bad public key size'); var tmp = new Uint8Array(signedMsg.length); var mlen = crypto_sign_open(tmp, signedMsg, signedMsg.length, publicKey); if (mlen < 0) return null; var m = new Uint8Array(mlen); for (var i = 0; i < m.length; i++) m[i] = tmp[i]; return m; }; nacl.sign.detached = function(msg, secretKey) { var signedMsg = nacl.sign(msg, secretKey); var sig = new Uint8Array(crypto_sign_BYTES); for (var i = 0; i < sig.length; i++) sig[i] = signedMsg[i]; return sig; }; nacl.sign.detached.verify = function(msg, sig, publicKey) { checkArrayTypes(msg, sig, publicKey); if (sig.length !== crypto_sign_BYTES) throw new Error('bad signature size'); if (publicKey.length !== crypto_sign_PUBLICKEYBYTES) throw new Error('bad public key size'); var sm = new Uint8Array(crypto_sign_BYTES + msg.length); var m = new Uint8Array(crypto_sign_BYTES + msg.length); var i; for (i = 0; i < crypto_sign_BYTES; i++) sm[i] = sig[i]; for (i = 0; i < msg.length; i++) sm[i+crypto_sign_BYTES] = msg[i]; return (crypto_sign_open(m, sm, sm.length, publicKey) >= 0); }; nacl.sign.keyPair = function() { var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES); var sk = new Uint8Array(crypto_sign_SECRETKEYBYTES); crypto_sign_keypair(pk, sk); return {publicKey: pk, secretKey: sk}; }; nacl.sign.keyPair.fromSecretKey = function(secretKey) { checkArrayTypes(secretKey); if (secretKey.length !== crypto_sign_SECRETKEYBYTES) throw new Error('bad secret key size'); var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES); for (var i = 0; i < pk.length; i++) pk[i] = secretKey[32+i]; return {publicKey: pk, secretKey: new Uint8Array(secretKey)}; }; nacl.sign.keyPair.fromSeed = function(seed) { checkArrayTypes(seed); if (seed.length !== crypto_sign_SEEDBYTES) throw new Error('bad seed size'); var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES); var sk = new Uint8Array(crypto_sign_SECRETKEYBYTES); for (var i = 0; i < 32; i++) sk[i] = seed[i]; crypto_sign_keypair(pk, sk, true); return {publicKey: pk, secretKey: sk}; }; nacl.sign.publicKeyLength = crypto_sign_PUBLICKEYBYTES; nacl.sign.secretKeyLength = crypto_sign_SECRETKEYBYTES; nacl.sign.seedLength = crypto_sign_SEEDBYTES; nacl.sign.signatureLength = crypto_sign_BYTES; nacl.hash = function(msg) { checkArrayTypes(msg); var h = new Uint8Array(crypto_hash_BYTES); crypto_hash(h, msg, msg.length); return h; }; nacl.hash.hashLength = crypto_hash_BYTES; nacl.verify = function(x, y) { checkArrayTypes(x, y); // Zero length arguments are considered not equal. if (x.length === 0 || y.length === 0) return false; if (x.length !== y.length) return false; return (vn(x, 0, y, 0, x.length) === 0) ? true : false; }; nacl.setPRNG = function(fn) { randombytes = fn; }; (function() { // Initialize PRNG if environment provides CSPRNG. // If not, methods calling randombytes will throw. var crypto = typeof self !== 'undefined' ? (self.crypto || self.msCrypto) : null; if (crypto && crypto.getRandomValues) { // Browsers. var QUOTA = 65536; nacl.setPRNG(function(x, n) { var i, v = new Uint8Array(n); for (i = 0; i < n; i += QUOTA) { crypto.getRandomValues(v.subarray(i, i + Math.min(n - i, QUOTA))); } for (i = 0; i < n; i++) x[i] = v[i]; cleanup(v); }); } else if (true) { // Node.js. crypto = __webpack_require__(417); if (crypto && crypto.randomBytes) { nacl.setPRNG(function(x, n) { var i, v = crypto.randomBytes(n); for (i = 0; i < n; i++) x[i] = v[i]; cleanup(v); }); } } })(); })( true && module.exports ? module.exports : (self.nacl = self.nacl || {})); /***/ }), /***/ 211: /***/ (function(module) { module.exports = require("https"); /***/ }), /***/ 213: /***/ (function(module) { module.exports = require("punycode"); /***/ }), /***/ 215: /***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; /* eslint-disable node/no-deprecated-api */ var buffer = __webpack_require__(293) var Buffer = buffer.Buffer var safer = {} var key for (key in buffer) { if (!buffer.hasOwnProperty(key)) continue if (key === 'SlowBuffer' || key === 'Buffer') continue safer[key] = buffer[key] } var Safer = safer.Buffer = {} for (key in Buffer) { if (!Buffer.hasOwnProperty(key)) continue if (key === 'allocUnsafe' || key === 'allocUnsafeSlow') continue Safer[key] = Buffer[key] } safer.Buffer.prototype = Buffer.prototype if (!Safer.from || Safer.from === Uint8Array.from) { Safer.from = function (value, encodingOrOffset, length) { if (typeof value === 'number') { throw new TypeError('The "value" argument must not be of type number. Received type ' + typeof value) } if (value && typeof value.length === 'undefined') { throw new TypeError('The first argument must be one of type string, Buffer, ArrayBuffer, Array, or Array-like Object. Received type ' + typeof value) } return Buffer(value, encodingOrOffset, length) } } if (!Safer.alloc) { Safer.alloc = function (size, fill, encoding) { if (typeof size !== 'number') { throw new TypeError('The "size" argument must be of type number. Received type ' + typeof size) } if (size < 0 || size >= 2 * (1 << 30)) { throw new RangeError('The value "' + size + '" is invalid for option "size"') } var buf = Buffer(size) if (!fill || fill.length === 0) { buf.fill(0) } else if (typeof encoding === 'string') { buf.fill(fill, encoding) } else { buf.fill(fill) } return buf } } if (!safer.kStringMaxLength) { try { safer.kStringMaxLength = process.binding('buffer').kStringMaxLength } catch (e) { // we can't determine kStringMaxLength in environments where process.binding // is unsupported, so let's not set it } } if (!safer.constants) { safer.constants = { MAX_LENGTH: safer.kMaxLength } if (safer.kStringMaxLength) { safer.constants.MAX_STRING_LENGTH = safer.kStringMaxLength } } module.exports = safer /***/ }), /***/ 222: /***/ (function(module) { module.exports = {"$id":"browser.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["name","version"],"properties":{"name":{"type":"string"},"version":{"type":"string"},"comment":{"type":"string"}}}; /***/ }), /***/ 226: /***/ (function(module) { module.exports = {"$id":"response.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["status","statusText","httpVersion","cookies","headers","content","redirectURL","headersSize","bodySize"],"properties":{"status":{"type":"integer"},"statusText":{"type":"string"},"httpVersion":{"type":"string"},"cookies":{"type":"array","items":{"$ref":"cookie.json#"}},"headers":{"type":"array","items":{"$ref":"header.json#"}},"content":{"$ref":"content.json#"},"redirectURL":{"type":"string"},"headersSize":{"type":"integer"},"bodySize":{"type":"integer"},"comment":{"type":"string"}}}; /***/ }), /***/ 233: /***/ (function(module) { "use strict"; module.exports = function generate_dependencies(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $data = 'data' + ($dataLvl || ''); var $errs = 'errs__' + $lvl; var $it = it.util.copy(it); var $closingBraces = ''; $it.level++; var $nextValid = 'valid' + $it.level; var $schemaDeps = {}, $propertyDeps = {}, $ownProperties = it.opts.ownProperties; for ($property in $schema) { var $sch = $schema[$property]; var $deps = Array.isArray($sch) ? $propertyDeps : $schemaDeps; $deps[$property] = $sch; } out += 'var ' + ($errs) + ' = errors;'; var $currentErrorPath = it.errorPath; out += 'var missing' + ($lvl) + ';'; for (var $property in $propertyDeps) { $deps = $propertyDeps[$property]; if ($deps.length) { out += ' if ( ' + ($data) + (it.util.getProperty($property)) + ' !== undefined '; if ($ownProperties) { out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($property)) + '\') '; } if ($breakOnError) { out += ' && ( '; var arr1 = $deps; if (arr1) { var $propertyKey, $i = -1, l1 = arr1.length - 1; while ($i < l1) { $propertyKey = arr1[$i += 1]; if ($i) { out += ' || '; } var $prop = it.util.getProperty($propertyKey), $useData = $data + $prop; out += ' ( ( ' + ($useData) + ' === undefined '; if ($ownProperties) { out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; } out += ') && (missing' + ($lvl) + ' = ' + (it.util.toQuotedString(it.opts.jsonPointers ? $propertyKey : $prop)) + ') ) '; } } out += ')) { '; var $propertyPath = 'missing' + $lvl, $missingProperty = '\' + ' + $propertyPath + ' + \''; if (it.opts._errorDataPathProperty) { it.errorPath = it.opts.jsonPointers ? it.util.getPathExpr($currentErrorPath, $propertyPath, true) : $currentErrorPath + ' + ' + $propertyPath; } var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('dependencies') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { property: \'' + (it.util.escapeQuotes($property)) + '\', missingProperty: \'' + ($missingProperty) + '\', depsCount: ' + ($deps.length) + ', deps: \'' + (it.util.escapeQuotes($deps.length == 1 ? $deps[0] : $deps.join(", "))) + '\' } '; if (it.opts.messages !== false) { out += ' , message: \'should have '; if ($deps.length == 1) { out += 'property ' + (it.util.escapeQuotes($deps[0])); } else { out += 'properties ' + (it.util.escapeQuotes($deps.join(", "))); } out += ' when property ' + (it.util.escapeQuotes($property)) + ' is present\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } } else { out += ' ) { '; var arr2 = $deps; if (arr2) { var $propertyKey, i2 = -1, l2 = arr2.length - 1; while (i2 < l2) { $propertyKey = arr2[i2 += 1]; var $prop = it.util.getProperty($propertyKey), $missingProperty = it.util.escapeQuotes($propertyKey), $useData = $data + $prop; if (it.opts._errorDataPathProperty) { it.errorPath = it.util.getPath($currentErrorPath, $propertyKey, it.opts.jsonPointers); } out += ' if ( ' + ($useData) + ' === undefined '; if ($ownProperties) { out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; } out += ') { var err = '; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('dependencies') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { property: \'' + (it.util.escapeQuotes($property)) + '\', missingProperty: \'' + ($missingProperty) + '\', depsCount: ' + ($deps.length) + ', deps: \'' + (it.util.escapeQuotes($deps.length == 1 ? $deps[0] : $deps.join(", "))) + '\' } '; if (it.opts.messages !== false) { out += ' , message: \'should have '; if ($deps.length == 1) { out += 'property ' + (it.util.escapeQuotes($deps[0])); } else { out += 'properties ' + (it.util.escapeQuotes($deps.join(", "))); } out += ' when property ' + (it.util.escapeQuotes($property)) + ' is present\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } '; } } } out += ' } '; if ($breakOnError) { $closingBraces += '}'; out += ' else { '; } } } it.errorPath = $currentErrorPath; var $currentBaseId = $it.baseId; for (var $property in $schemaDeps) { var $sch = $schemaDeps[$property]; if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { out += ' ' + ($nextValid) + ' = true; if ( ' + ($data) + (it.util.getProperty($property)) + ' !== undefined '; if ($ownProperties) { out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($property)) + '\') '; } out += ') { '; $it.schema = $sch; $it.schemaPath = $schemaPath + it.util.getProperty($property); $it.errSchemaPath = $errSchemaPath + '/' + it.util.escapeFragment($property); out += ' ' + (it.validate($it)) + ' '; $it.baseId = $currentBaseId; out += ' } '; if ($breakOnError) { out += ' if (' + ($nextValid) + ') { '; $closingBraces += '}'; } } } if ($breakOnError) { out += ' ' + ($closingBraces) + ' if (' + ($errs) + ' == errors) {'; } out = it.util.cleanUpCode(out); return out; } /***/ }), /***/ 241: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2018 Joyent, Inc. module.exports = { read: read, write: write }; var assert = __webpack_require__(477); var Buffer = __webpack_require__(215).Buffer; var utils = __webpack_require__(270); var Key = __webpack_require__(852); var PrivateKey = __webpack_require__(502); var pem = __webpack_require__(268); var ssh = __webpack_require__(603); var rfc4253 = __webpack_require__(538); var dnssec = __webpack_require__(982); var putty = __webpack_require__(624); var DNSSEC_PRIVKEY_HEADER_PREFIX = 'Private-key-format: v1'; function read(buf, options) { if (typeof (buf) === 'string') { if (buf.trim().match(/^[-]+[ ]*BEGIN/)) return (pem.read(buf, options)); if (buf.match(/^\s*ssh-[a-z]/)) return (ssh.read(buf, options)); if (buf.match(/^\s*ecdsa-/)) return (ssh.read(buf, options)); if (buf.match(/^putty-user-key-file-2:/i)) return (putty.read(buf, options)); if (findDNSSECHeader(buf)) return (dnssec.read(buf, options)); buf = Buffer.from(buf, 'binary'); } else { assert.buffer(buf); if (findPEMHeader(buf)) return (pem.read(buf, options)); if (findSSHHeader(buf)) return (ssh.read(buf, options)); if (findPuTTYHeader(buf)) return (putty.read(buf, options)); if (findDNSSECHeader(buf)) return (dnssec.read(buf, options)); } if (buf.readUInt32BE(0) < buf.length) return (rfc4253.read(buf, options)); throw (new Error('Failed to auto-detect format of key')); } function findPuTTYHeader(buf) { var offset = 0; while (offset < buf.length && (buf[offset] === 32 || buf[offset] === 10 || buf[offset] === 9)) ++offset; if (offset + 22 <= buf.length && buf.slice(offset, offset + 22).toString('ascii').toLowerCase() === 'putty-user-key-file-2:') return (true); return (false); } function findSSHHeader(buf) { var offset = 0; while (offset < buf.length && (buf[offset] === 32 || buf[offset] === 10 || buf[offset] === 9)) ++offset; if (offset + 4 <= buf.length && buf.slice(offset, offset + 4).toString('ascii') === 'ssh-') return (true); if (offset + 6 <= buf.length && buf.slice(offset, offset + 6).toString('ascii') === 'ecdsa-') return (true); return (false); } function findPEMHeader(buf) { var offset = 0; while (offset < buf.length && (buf[offset] === 32 || buf[offset] === 10)) ++offset; if (buf[offset] !== 45) return (false); while (offset < buf.length && (buf[offset] === 45)) ++offset; while (offset < buf.length && (buf[offset] === 32)) ++offset; if (offset + 5 > buf.length || buf.slice(offset, offset + 5).toString('ascii') !== 'BEGIN') return (false); return (true); } function findDNSSECHeader(buf) { // private case first if (buf.length <= DNSSEC_PRIVKEY_HEADER_PREFIX.length) return (false); var headerCheck = buf.slice(0, DNSSEC_PRIVKEY_HEADER_PREFIX.length); if (headerCheck.toString('ascii') === DNSSEC_PRIVKEY_HEADER_PREFIX) return (true); // public-key RFC3110 ? // 'domain.com. IN KEY ...' or 'domain.com. IN DNSKEY ...' // skip any comment-lines if (typeof (buf) !== 'string') { buf = buf.toString('ascii'); } var lines = buf.split('\n'); var line = 0; /* JSSTYLED */ while (lines[line].match(/^\;/)) line++; if (lines[line].toString('ascii').match(/\. IN KEY /)) return (true); if (lines[line].toString('ascii').match(/\. IN DNSKEY /)) return (true); return (false); } function write(key, options) { throw (new Error('"auto" format cannot be used for writing')); } /***/ }), /***/ 242: /***/ (function(module, exports) { (function(){ // Copyright (c) 2005 Tom Wu // All Rights Reserved. // See "LICENSE" for details. // Basic JavaScript BN library - subset useful for RSA encryption. // Bits per digit var dbits; // JavaScript engine analysis var canary = 0xdeadbeefcafe; var j_lm = ((canary&0xffffff)==0xefcafe); // (public) Constructor function BigInteger(a,b,c) { if(a != null) if("number" == typeof a) this.fromNumber(a,b,c); else if(b == null && "string" != typeof a) this.fromString(a,256); else this.fromString(a,b); } // return new, unset BigInteger function nbi() { return new BigInteger(null); } // am: Compute w_j += (x*this_i), propagate carries, // c is initial carry, returns final carry. // c < 3*dvalue, x < 2*dvalue, this_i < dvalue // We need to select the fastest one that works in this environment. // am1: use a single mult and divide to get the high bits, // max digit bits should be 26 because // max internal value = 2*dvalue^2-2*dvalue (< 2^53) function am1(i,x,w,j,c,n) { while(--n >= 0) { var v = x*this[i++]+w[j]+c; c = Math.floor(v/0x4000000); w[j++] = v&0x3ffffff; } return c; } // am2 avoids a big mult-and-extract completely. // Max digit bits should be <= 30 because we do bitwise ops // on values up to 2*hdvalue^2-hdvalue-1 (< 2^31) function am2(i,x,w,j,c,n) { var xl = x&0x7fff, xh = x>>15; while(--n >= 0) { var l = this[i]&0x7fff; var h = this[i++]>>15; var m = xh*l+h*xl; l = xl*l+((m&0x7fff)<<15)+w[j]+(c&0x3fffffff); c = (l>>>30)+(m>>>15)+xh*h+(c>>>30); w[j++] = l&0x3fffffff; } return c; } // Alternately, set max digit bits to 28 since some // browsers slow down when dealing with 32-bit numbers. function am3(i,x,w,j,c,n) { var xl = x&0x3fff, xh = x>>14; while(--n >= 0) { var l = this[i]&0x3fff; var h = this[i++]>>14; var m = xh*l+h*xl; l = xl*l+((m&0x3fff)<<14)+w[j]+c; c = (l>>28)+(m>>14)+xh*h; w[j++] = l&0xfffffff; } return c; } var inBrowser = typeof navigator !== "undefined"; if(inBrowser && j_lm && (navigator.appName == "Microsoft Internet Explorer")) { BigInteger.prototype.am = am2; dbits = 30; } else if(inBrowser && j_lm && (navigator.appName != "Netscape")) { BigInteger.prototype.am = am1; dbits = 26; } else { // Mozilla/Netscape seems to prefer am3 BigInteger.prototype.am = am3; dbits = 28; } BigInteger.prototype.DB = dbits; BigInteger.prototype.DM = ((1<= 0; --i) r[i] = this[i]; r.t = this.t; r.s = this.s; } // (protected) set from integer value x, -DV <= x < DV function bnpFromInt(x) { this.t = 1; this.s = (x<0)?-1:0; if(x > 0) this[0] = x; else if(x < -1) this[0] = x+this.DV; else this.t = 0; } // return bigint initialized to value function nbv(i) { var r = nbi(); r.fromInt(i); return r; } // (protected) set from string and radix function bnpFromString(s,b) { var k; if(b == 16) k = 4; else if(b == 8) k = 3; else if(b == 256) k = 8; // byte array else if(b == 2) k = 1; else if(b == 32) k = 5; else if(b == 4) k = 2; else { this.fromRadix(s,b); return; } this.t = 0; this.s = 0; var i = s.length, mi = false, sh = 0; while(--i >= 0) { var x = (k==8)?s[i]&0xff:intAt(s,i); if(x < 0) { if(s.charAt(i) == "-") mi = true; continue; } mi = false; if(sh == 0) this[this.t++] = x; else if(sh+k > this.DB) { this[this.t-1] |= (x&((1<<(this.DB-sh))-1))<>(this.DB-sh)); } else this[this.t-1] |= x<= this.DB) sh -= this.DB; } if(k == 8 && (s[0]&0x80) != 0) { this.s = -1; if(sh > 0) this[this.t-1] |= ((1<<(this.DB-sh))-1)< 0 && this[this.t-1] == c) --this.t; } // (public) return string representation in given radix function bnToString(b) { if(this.s < 0) return "-"+this.negate().toString(b); var k; if(b == 16) k = 4; else if(b == 8) k = 3; else if(b == 2) k = 1; else if(b == 32) k = 5; else if(b == 4) k = 2; else return this.toRadix(b); var km = (1< 0) { if(p < this.DB && (d = this[i]>>p) > 0) { m = true; r = int2char(d); } while(i >= 0) { if(p < k) { d = (this[i]&((1<>(p+=this.DB-k); } else { d = (this[i]>>(p-=k))&km; if(p <= 0) { p += this.DB; --i; } } if(d > 0) m = true; if(m) r += int2char(d); } } return m?r:"0"; } // (public) -this function bnNegate() { var r = nbi(); BigInteger.ZERO.subTo(this,r); return r; } // (public) |this| function bnAbs() { return (this.s<0)?this.negate():this; } // (public) return + if this > a, - if this < a, 0 if equal function bnCompareTo(a) { var r = this.s-a.s; if(r != 0) return r; var i = this.t; r = i-a.t; if(r != 0) return (this.s<0)?-r:r; while(--i >= 0) if((r=this[i]-a[i]) != 0) return r; return 0; } // returns bit length of the integer x function nbits(x) { var r = 1, t; if((t=x>>>16) != 0) { x = t; r += 16; } if((t=x>>8) != 0) { x = t; r += 8; } if((t=x>>4) != 0) { x = t; r += 4; } if((t=x>>2) != 0) { x = t; r += 2; } if((t=x>>1) != 0) { x = t; r += 1; } return r; } // (public) return the number of bits in "this" function bnBitLength() { if(this.t <= 0) return 0; return this.DB*(this.t-1)+nbits(this[this.t-1]^(this.s&this.DM)); } // (protected) r = this << n*DB function bnpDLShiftTo(n,r) { var i; for(i = this.t-1; i >= 0; --i) r[i+n] = this[i]; for(i = n-1; i >= 0; --i) r[i] = 0; r.t = this.t+n; r.s = this.s; } // (protected) r = this >> n*DB function bnpDRShiftTo(n,r) { for(var i = n; i < this.t; ++i) r[i-n] = this[i]; r.t = Math.max(this.t-n,0); r.s = this.s; } // (protected) r = this << n function bnpLShiftTo(n,r) { var bs = n%this.DB; var cbs = this.DB-bs; var bm = (1<= 0; --i) { r[i+ds+1] = (this[i]>>cbs)|c; c = (this[i]&bm)<= 0; --i) r[i] = 0; r[ds] = c; r.t = this.t+ds+1; r.s = this.s; r.clamp(); } // (protected) r = this >> n function bnpRShiftTo(n,r) { r.s = this.s; var ds = Math.floor(n/this.DB); if(ds >= this.t) { r.t = 0; return; } var bs = n%this.DB; var cbs = this.DB-bs; var bm = (1<>bs; for(var i = ds+1; i < this.t; ++i) { r[i-ds-1] |= (this[i]&bm)<>bs; } if(bs > 0) r[this.t-ds-1] |= (this.s&bm)<>= this.DB; } if(a.t < this.t) { c -= a.s; while(i < this.t) { c += this[i]; r[i++] = c&this.DM; c >>= this.DB; } c += this.s; } else { c += this.s; while(i < a.t) { c -= a[i]; r[i++] = c&this.DM; c >>= this.DB; } c -= a.s; } r.s = (c<0)?-1:0; if(c < -1) r[i++] = this.DV+c; else if(c > 0) r[i++] = c; r.t = i; r.clamp(); } // (protected) r = this * a, r != this,a (HAC 14.12) // "this" should be the larger one if appropriate. function bnpMultiplyTo(a,r) { var x = this.abs(), y = a.abs(); var i = x.t; r.t = i+y.t; while(--i >= 0) r[i] = 0; for(i = 0; i < y.t; ++i) r[i+x.t] = x.am(0,y[i],r,i,0,x.t); r.s = 0; r.clamp(); if(this.s != a.s) BigInteger.ZERO.subTo(r,r); } // (protected) r = this^2, r != this (HAC 14.16) function bnpSquareTo(r) { var x = this.abs(); var i = r.t = 2*x.t; while(--i >= 0) r[i] = 0; for(i = 0; i < x.t-1; ++i) { var c = x.am(i,x[i],r,2*i,0,1); if((r[i+x.t]+=x.am(i+1,2*x[i],r,2*i+1,c,x.t-i-1)) >= x.DV) { r[i+x.t] -= x.DV; r[i+x.t+1] = 1; } } if(r.t > 0) r[r.t-1] += x.am(i,x[i],r,2*i,0,1); r.s = 0; r.clamp(); } // (protected) divide this by m, quotient and remainder to q, r (HAC 14.20) // r != q, this != m. q or r may be null. function bnpDivRemTo(m,q,r) { var pm = m.abs(); if(pm.t <= 0) return; var pt = this.abs(); if(pt.t < pm.t) { if(q != null) q.fromInt(0); if(r != null) this.copyTo(r); return; } if(r == null) r = nbi(); var y = nbi(), ts = this.s, ms = m.s; var nsh = this.DB-nbits(pm[pm.t-1]); // normalize modulus if(nsh > 0) { pm.lShiftTo(nsh,y); pt.lShiftTo(nsh,r); } else { pm.copyTo(y); pt.copyTo(r); } var ys = y.t; var y0 = y[ys-1]; if(y0 == 0) return; var yt = y0*(1<1)?y[ys-2]>>this.F2:0); var d1 = this.FV/yt, d2 = (1<= 0) { r[r.t++] = 1; r.subTo(t,r); } BigInteger.ONE.dlShiftTo(ys,t); t.subTo(y,y); // "negative" y so we can replace sub with am later while(y.t < ys) y[y.t++] = 0; while(--j >= 0) { // Estimate quotient digit var qd = (r[--i]==y0)?this.DM:Math.floor(r[i]*d1+(r[i-1]+e)*d2); if((r[i]+=y.am(0,qd,r,j,0,ys)) < qd) { // Try it out y.dlShiftTo(j,t); r.subTo(t,r); while(r[i] < --qd) r.subTo(t,r); } } if(q != null) { r.drShiftTo(ys,q); if(ts != ms) BigInteger.ZERO.subTo(q,q); } r.t = ys; r.clamp(); if(nsh > 0) r.rShiftTo(nsh,r); // Denormalize remainder if(ts < 0) BigInteger.ZERO.subTo(r,r); } // (public) this mod a function bnMod(a) { var r = nbi(); this.abs().divRemTo(a,null,r); if(this.s < 0 && r.compareTo(BigInteger.ZERO) > 0) a.subTo(r,r); return r; } // Modular reduction using "classic" algorithm function Classic(m) { this.m = m; } function cConvert(x) { if(x.s < 0 || x.compareTo(this.m) >= 0) return x.mod(this.m); else return x; } function cRevert(x) { return x; } function cReduce(x) { x.divRemTo(this.m,null,x); } function cMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } function cSqrTo(x,r) { x.squareTo(r); this.reduce(r); } Classic.prototype.convert = cConvert; Classic.prototype.revert = cRevert; Classic.prototype.reduce = cReduce; Classic.prototype.mulTo = cMulTo; Classic.prototype.sqrTo = cSqrTo; // (protected) return "-1/this % 2^DB"; useful for Mont. reduction // justification: // xy == 1 (mod m) // xy = 1+km // xy(2-xy) = (1+km)(1-km) // x[y(2-xy)] = 1-k^2m^2 // x[y(2-xy)] == 1 (mod m^2) // if y is 1/x mod m, then y(2-xy) is 1/x mod m^2 // should reduce x and y(2-xy) by m^2 at each step to keep size bounded. // JS multiply "overflows" differently from C/C++, so care is needed here. function bnpInvDigit() { if(this.t < 1) return 0; var x = this[0]; if((x&1) == 0) return 0; var y = x&3; // y == 1/x mod 2^2 y = (y*(2-(x&0xf)*y))&0xf; // y == 1/x mod 2^4 y = (y*(2-(x&0xff)*y))&0xff; // y == 1/x mod 2^8 y = (y*(2-(((x&0xffff)*y)&0xffff)))&0xffff; // y == 1/x mod 2^16 // last step - calculate inverse mod DV directly; // assumes 16 < DB <= 32 and assumes ability to handle 48-bit ints y = (y*(2-x*y%this.DV))%this.DV; // y == 1/x mod 2^dbits // we really want the negative inverse, and -DV < y < DV return (y>0)?this.DV-y:-y; } // Montgomery reduction function Montgomery(m) { this.m = m; this.mp = m.invDigit(); this.mpl = this.mp&0x7fff; this.mph = this.mp>>15; this.um = (1<<(m.DB-15))-1; this.mt2 = 2*m.t; } // xR mod m function montConvert(x) { var r = nbi(); x.abs().dlShiftTo(this.m.t,r); r.divRemTo(this.m,null,r); if(x.s < 0 && r.compareTo(BigInteger.ZERO) > 0) this.m.subTo(r,r); return r; } // x/R mod m function montRevert(x) { var r = nbi(); x.copyTo(r); this.reduce(r); return r; } // x = x/R mod m (HAC 14.32) function montReduce(x) { while(x.t <= this.mt2) // pad x so am has enough room later x[x.t++] = 0; for(var i = 0; i < this.m.t; ++i) { // faster way of calculating u0 = x[i]*mp mod DV var j = x[i]&0x7fff; var u0 = (j*this.mpl+(((j*this.mph+(x[i]>>15)*this.mpl)&this.um)<<15))&x.DM; // use am to combine the multiply-shift-add into one call j = i+this.m.t; x[j] += this.m.am(0,u0,x,i,0,this.m.t); // propagate carry while(x[j] >= x.DV) { x[j] -= x.DV; x[++j]++; } } x.clamp(); x.drShiftTo(this.m.t,x); if(x.compareTo(this.m) >= 0) x.subTo(this.m,x); } // r = "x^2/R mod m"; x != r function montSqrTo(x,r) { x.squareTo(r); this.reduce(r); } // r = "xy/R mod m"; x,y != r function montMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } Montgomery.prototype.convert = montConvert; Montgomery.prototype.revert = montRevert; Montgomery.prototype.reduce = montReduce; Montgomery.prototype.mulTo = montMulTo; Montgomery.prototype.sqrTo = montSqrTo; // (protected) true iff this is even function bnpIsEven() { return ((this.t>0)?(this[0]&1):this.s) == 0; } // (protected) this^e, e < 2^32, doing sqr and mul with "r" (HAC 14.79) function bnpExp(e,z) { if(e > 0xffffffff || e < 1) return BigInteger.ONE; var r = nbi(), r2 = nbi(), g = z.convert(this), i = nbits(e)-1; g.copyTo(r); while(--i >= 0) { z.sqrTo(r,r2); if((e&(1< 0) z.mulTo(r2,g,r); else { var t = r; r = r2; r2 = t; } } return z.revert(r); } // (public) this^e % m, 0 <= e < 2^32 function bnModPowInt(e,m) { var z; if(e < 256 || m.isEven()) z = new Classic(m); else z = new Montgomery(m); return this.exp(e,z); } // protected BigInteger.prototype.copyTo = bnpCopyTo; BigInteger.prototype.fromInt = bnpFromInt; BigInteger.prototype.fromString = bnpFromString; BigInteger.prototype.clamp = bnpClamp; BigInteger.prototype.dlShiftTo = bnpDLShiftTo; BigInteger.prototype.drShiftTo = bnpDRShiftTo; BigInteger.prototype.lShiftTo = bnpLShiftTo; BigInteger.prototype.rShiftTo = bnpRShiftTo; BigInteger.prototype.subTo = bnpSubTo; BigInteger.prototype.multiplyTo = bnpMultiplyTo; BigInteger.prototype.squareTo = bnpSquareTo; BigInteger.prototype.divRemTo = bnpDivRemTo; BigInteger.prototype.invDigit = bnpInvDigit; BigInteger.prototype.isEven = bnpIsEven; BigInteger.prototype.exp = bnpExp; // public BigInteger.prototype.toString = bnToString; BigInteger.prototype.negate = bnNegate; BigInteger.prototype.abs = bnAbs; BigInteger.prototype.compareTo = bnCompareTo; BigInteger.prototype.bitLength = bnBitLength; BigInteger.prototype.mod = bnMod; BigInteger.prototype.modPowInt = bnModPowInt; // "constants" BigInteger.ZERO = nbv(0); BigInteger.ONE = nbv(1); // Copyright (c) 2005-2009 Tom Wu // All Rights Reserved. // See "LICENSE" for details. // Extended JavaScript BN functions, required for RSA private ops. // Version 1.1: new BigInteger("0", 10) returns "proper" zero // Version 1.2: square() API, isProbablePrime fix // (public) function bnClone() { var r = nbi(); this.copyTo(r); return r; } // (public) return value as integer function bnIntValue() { if(this.s < 0) { if(this.t == 1) return this[0]-this.DV; else if(this.t == 0) return -1; } else if(this.t == 1) return this[0]; else if(this.t == 0) return 0; // assumes 16 < DB < 32 return ((this[1]&((1<<(32-this.DB))-1))<>24; } // (public) return value as short (assumes DB>=16) function bnShortValue() { return (this.t==0)?this.s:(this[0]<<16)>>16; } // (protected) return x s.t. r^x < DV function bnpChunkSize(r) { return Math.floor(Math.LN2*this.DB/Math.log(r)); } // (public) 0 if this == 0, 1 if this > 0 function bnSigNum() { if(this.s < 0) return -1; else if(this.t <= 0 || (this.t == 1 && this[0] <= 0)) return 0; else return 1; } // (protected) convert to radix string function bnpToRadix(b) { if(b == null) b = 10; if(this.signum() == 0 || b < 2 || b > 36) return "0"; var cs = this.chunkSize(b); var a = Math.pow(b,cs); var d = nbv(a), y = nbi(), z = nbi(), r = ""; this.divRemTo(d,y,z); while(y.signum() > 0) { r = (a+z.intValue()).toString(b).substr(1) + r; y.divRemTo(d,y,z); } return z.intValue().toString(b) + r; } // (protected) convert from radix string function bnpFromRadix(s,b) { this.fromInt(0); if(b == null) b = 10; var cs = this.chunkSize(b); var d = Math.pow(b,cs), mi = false, j = 0, w = 0; for(var i = 0; i < s.length; ++i) { var x = intAt(s,i); if(x < 0) { if(s.charAt(i) == "-" && this.signum() == 0) mi = true; continue; } w = b*w+x; if(++j >= cs) { this.dMultiply(d); this.dAddOffset(w,0); j = 0; w = 0; } } if(j > 0) { this.dMultiply(Math.pow(b,j)); this.dAddOffset(w,0); } if(mi) BigInteger.ZERO.subTo(this,this); } // (protected) alternate constructor function bnpFromNumber(a,b,c) { if("number" == typeof b) { // new BigInteger(int,int,RNG) if(a < 2) this.fromInt(1); else { this.fromNumber(a,c); if(!this.testBit(a-1)) // force MSB set this.bitwiseTo(BigInteger.ONE.shiftLeft(a-1),op_or,this); if(this.isEven()) this.dAddOffset(1,0); // force odd while(!this.isProbablePrime(b)) { this.dAddOffset(2,0); if(this.bitLength() > a) this.subTo(BigInteger.ONE.shiftLeft(a-1),this); } } } else { // new BigInteger(int,RNG) var x = new Array(), t = a&7; x.length = (a>>3)+1; b.nextBytes(x); if(t > 0) x[0] &= ((1< 0) { if(p < this.DB && (d = this[i]>>p) != (this.s&this.DM)>>p) r[k++] = d|(this.s<<(this.DB-p)); while(i >= 0) { if(p < 8) { d = (this[i]&((1<>(p+=this.DB-8); } else { d = (this[i]>>(p-=8))&0xff; if(p <= 0) { p += this.DB; --i; } } if((d&0x80) != 0) d |= -256; if(k == 0 && (this.s&0x80) != (d&0x80)) ++k; if(k > 0 || d != this.s) r[k++] = d; } } return r; } function bnEquals(a) { return(this.compareTo(a)==0); } function bnMin(a) { return(this.compareTo(a)<0)?this:a; } function bnMax(a) { return(this.compareTo(a)>0)?this:a; } // (protected) r = this op a (bitwise) function bnpBitwiseTo(a,op,r) { var i, f, m = Math.min(a.t,this.t); for(i = 0; i < m; ++i) r[i] = op(this[i],a[i]); if(a.t < this.t) { f = a.s&this.DM; for(i = m; i < this.t; ++i) r[i] = op(this[i],f); r.t = this.t; } else { f = this.s&this.DM; for(i = m; i < a.t; ++i) r[i] = op(f,a[i]); r.t = a.t; } r.s = op(this.s,a.s); r.clamp(); } // (public) this & a function op_and(x,y) { return x&y; } function bnAnd(a) { var r = nbi(); this.bitwiseTo(a,op_and,r); return r; } // (public) this | a function op_or(x,y) { return x|y; } function bnOr(a) { var r = nbi(); this.bitwiseTo(a,op_or,r); return r; } // (public) this ^ a function op_xor(x,y) { return x^y; } function bnXor(a) { var r = nbi(); this.bitwiseTo(a,op_xor,r); return r; } // (public) this & ~a function op_andnot(x,y) { return x&~y; } function bnAndNot(a) { var r = nbi(); this.bitwiseTo(a,op_andnot,r); return r; } // (public) ~this function bnNot() { var r = nbi(); for(var i = 0; i < this.t; ++i) r[i] = this.DM&~this[i]; r.t = this.t; r.s = ~this.s; return r; } // (public) this << n function bnShiftLeft(n) { var r = nbi(); if(n < 0) this.rShiftTo(-n,r); else this.lShiftTo(n,r); return r; } // (public) this >> n function bnShiftRight(n) { var r = nbi(); if(n < 0) this.lShiftTo(-n,r); else this.rShiftTo(n,r); return r; } // return index of lowest 1-bit in x, x < 2^31 function lbit(x) { if(x == 0) return -1; var r = 0; if((x&0xffff) == 0) { x >>= 16; r += 16; } if((x&0xff) == 0) { x >>= 8; r += 8; } if((x&0xf) == 0) { x >>= 4; r += 4; } if((x&3) == 0) { x >>= 2; r += 2; } if((x&1) == 0) ++r; return r; } // (public) returns index of lowest 1-bit (or -1 if none) function bnGetLowestSetBit() { for(var i = 0; i < this.t; ++i) if(this[i] != 0) return i*this.DB+lbit(this[i]); if(this.s < 0) return this.t*this.DB; return -1; } // return number of 1 bits in x function cbit(x) { var r = 0; while(x != 0) { x &= x-1; ++r; } return r; } // (public) return number of set bits function bnBitCount() { var r = 0, x = this.s&this.DM; for(var i = 0; i < this.t; ++i) r += cbit(this[i]^x); return r; } // (public) true iff nth bit is set function bnTestBit(n) { var j = Math.floor(n/this.DB); if(j >= this.t) return(this.s!=0); return((this[j]&(1<<(n%this.DB)))!=0); } // (protected) this op (1<>= this.DB; } if(a.t < this.t) { c += a.s; while(i < this.t) { c += this[i]; r[i++] = c&this.DM; c >>= this.DB; } c += this.s; } else { c += this.s; while(i < a.t) { c += a[i]; r[i++] = c&this.DM; c >>= this.DB; } c += a.s; } r.s = (c<0)?-1:0; if(c > 0) r[i++] = c; else if(c < -1) r[i++] = this.DV+c; r.t = i; r.clamp(); } // (public) this + a function bnAdd(a) { var r = nbi(); this.addTo(a,r); return r; } // (public) this - a function bnSubtract(a) { var r = nbi(); this.subTo(a,r); return r; } // (public) this * a function bnMultiply(a) { var r = nbi(); this.multiplyTo(a,r); return r; } // (public) this^2 function bnSquare() { var r = nbi(); this.squareTo(r); return r; } // (public) this / a function bnDivide(a) { var r = nbi(); this.divRemTo(a,r,null); return r; } // (public) this % a function bnRemainder(a) { var r = nbi(); this.divRemTo(a,null,r); return r; } // (public) [this/a,this%a] function bnDivideAndRemainder(a) { var q = nbi(), r = nbi(); this.divRemTo(a,q,r); return new Array(q,r); } // (protected) this *= n, this >= 0, 1 < n < DV function bnpDMultiply(n) { this[this.t] = this.am(0,n-1,this,0,0,this.t); ++this.t; this.clamp(); } // (protected) this += n << w words, this >= 0 function bnpDAddOffset(n,w) { if(n == 0) return; while(this.t <= w) this[this.t++] = 0; this[w] += n; while(this[w] >= this.DV) { this[w] -= this.DV; if(++w >= this.t) this[this.t++] = 0; ++this[w]; } } // A "null" reducer function NullExp() {} function nNop(x) { return x; } function nMulTo(x,y,r) { x.multiplyTo(y,r); } function nSqrTo(x,r) { x.squareTo(r); } NullExp.prototype.convert = nNop; NullExp.prototype.revert = nNop; NullExp.prototype.mulTo = nMulTo; NullExp.prototype.sqrTo = nSqrTo; // (public) this^e function bnPow(e) { return this.exp(e,new NullExp()); } // (protected) r = lower n words of "this * a", a.t <= n // "this" should be the larger one if appropriate. function bnpMultiplyLowerTo(a,n,r) { var i = Math.min(this.t+a.t,n); r.s = 0; // assumes a,this >= 0 r.t = i; while(i > 0) r[--i] = 0; var j; for(j = r.t-this.t; i < j; ++i) r[i+this.t] = this.am(0,a[i],r,i,0,this.t); for(j = Math.min(a.t,n); i < j; ++i) this.am(0,a[i],r,i,0,n-i); r.clamp(); } // (protected) r = "this * a" without lower n words, n > 0 // "this" should be the larger one if appropriate. function bnpMultiplyUpperTo(a,n,r) { --n; var i = r.t = this.t+a.t-n; r.s = 0; // assumes a,this >= 0 while(--i >= 0) r[i] = 0; for(i = Math.max(n-this.t,0); i < a.t; ++i) r[this.t+i-n] = this.am(n-i,a[i],r,0,0,this.t+i-n); r.clamp(); r.drShiftTo(1,r); } // Barrett modular reduction function Barrett(m) { // setup Barrett this.r2 = nbi(); this.q3 = nbi(); BigInteger.ONE.dlShiftTo(2*m.t,this.r2); this.mu = this.r2.divide(m); this.m = m; } function barrettConvert(x) { if(x.s < 0 || x.t > 2*this.m.t) return x.mod(this.m); else if(x.compareTo(this.m) < 0) return x; else { var r = nbi(); x.copyTo(r); this.reduce(r); return r; } } function barrettRevert(x) { return x; } // x = x mod m (HAC 14.42) function barrettReduce(x) { x.drShiftTo(this.m.t-1,this.r2); if(x.t > this.m.t+1) { x.t = this.m.t+1; x.clamp(); } this.mu.multiplyUpperTo(this.r2,this.m.t+1,this.q3); this.m.multiplyLowerTo(this.q3,this.m.t+1,this.r2); while(x.compareTo(this.r2) < 0) x.dAddOffset(1,this.m.t+1); x.subTo(this.r2,x); while(x.compareTo(this.m) >= 0) x.subTo(this.m,x); } // r = x^2 mod m; x != r function barrettSqrTo(x,r) { x.squareTo(r); this.reduce(r); } // r = x*y mod m; x,y != r function barrettMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } Barrett.prototype.convert = barrettConvert; Barrett.prototype.revert = barrettRevert; Barrett.prototype.reduce = barrettReduce; Barrett.prototype.mulTo = barrettMulTo; Barrett.prototype.sqrTo = barrettSqrTo; // (public) this^e % m (HAC 14.85) function bnModPow(e,m) { var i = e.bitLength(), k, r = nbv(1), z; if(i <= 0) return r; else if(i < 18) k = 1; else if(i < 48) k = 3; else if(i < 144) k = 4; else if(i < 768) k = 5; else k = 6; if(i < 8) z = new Classic(m); else if(m.isEven()) z = new Barrett(m); else z = new Montgomery(m); // precomputation var g = new Array(), n = 3, k1 = k-1, km = (1< 1) { var g2 = nbi(); z.sqrTo(g[1],g2); while(n <= km) { g[n] = nbi(); z.mulTo(g2,g[n-2],g[n]); n += 2; } } var j = e.t-1, w, is1 = true, r2 = nbi(), t; i = nbits(e[j])-1; while(j >= 0) { if(i >= k1) w = (e[j]>>(i-k1))&km; else { w = (e[j]&((1<<(i+1))-1))<<(k1-i); if(j > 0) w |= e[j-1]>>(this.DB+i-k1); } n = k; while((w&1) == 0) { w >>= 1; --n; } if((i -= n) < 0) { i += this.DB; --j; } if(is1) { // ret == 1, don't bother squaring or multiplying it g[w].copyTo(r); is1 = false; } else { while(n > 1) { z.sqrTo(r,r2); z.sqrTo(r2,r); n -= 2; } if(n > 0) z.sqrTo(r,r2); else { t = r; r = r2; r2 = t; } z.mulTo(r2,g[w],r); } while(j >= 0 && (e[j]&(1< 0) { x.rShiftTo(g,x); y.rShiftTo(g,y); } while(x.signum() > 0) { if((i = x.getLowestSetBit()) > 0) x.rShiftTo(i,x); if((i = y.getLowestSetBit()) > 0) y.rShiftTo(i,y); if(x.compareTo(y) >= 0) { x.subTo(y,x); x.rShiftTo(1,x); } else { y.subTo(x,y); y.rShiftTo(1,y); } } if(g > 0) y.lShiftTo(g,y); return y; } // (protected) this % n, n < 2^26 function bnpModInt(n) { if(n <= 0) return 0; var d = this.DV%n, r = (this.s<0)?n-1:0; if(this.t > 0) if(d == 0) r = this[0]%n; else for(var i = this.t-1; i >= 0; --i) r = (d*r+this[i])%n; return r; } // (public) 1/this % m (HAC 14.61) function bnModInverse(m) { var ac = m.isEven(); if((this.isEven() && ac) || m.signum() == 0) return BigInteger.ZERO; var u = m.clone(), v = this.clone(); var a = nbv(1), b = nbv(0), c = nbv(0), d = nbv(1); while(u.signum() != 0) { while(u.isEven()) { u.rShiftTo(1,u); if(ac) { if(!a.isEven() || !b.isEven()) { a.addTo(this,a); b.subTo(m,b); } a.rShiftTo(1,a); } else if(!b.isEven()) b.subTo(m,b); b.rShiftTo(1,b); } while(v.isEven()) { v.rShiftTo(1,v); if(ac) { if(!c.isEven() || !d.isEven()) { c.addTo(this,c); d.subTo(m,d); } c.rShiftTo(1,c); } else if(!d.isEven()) d.subTo(m,d); d.rShiftTo(1,d); } if(u.compareTo(v) >= 0) { u.subTo(v,u); if(ac) a.subTo(c,a); b.subTo(d,b); } else { v.subTo(u,v); if(ac) c.subTo(a,c); d.subTo(b,d); } } if(v.compareTo(BigInteger.ONE) != 0) return BigInteger.ZERO; if(d.compareTo(m) >= 0) return d.subtract(m); if(d.signum() < 0) d.addTo(m,d); else return d; if(d.signum() < 0) return d.add(m); else return d; } var lowprimes = [2,3,5,7,11,13,17,19,23,29,31,37,41,43,47,53,59,61,67,71,73,79,83,89,97,101,103,107,109,113,127,131,137,139,149,151,157,163,167,173,179,181,191,193,197,199,211,223,227,229,233,239,241,251,257,263,269,271,277,281,283,293,307,311,313,317,331,337,347,349,353,359,367,373,379,383,389,397,401,409,419,421,431,433,439,443,449,457,461,463,467,479,487,491,499,503,509,521,523,541,547,557,563,569,571,577,587,593,599,601,607,613,617,619,631,641,643,647,653,659,661,673,677,683,691,701,709,719,727,733,739,743,751,757,761,769,773,787,797,809,811,821,823,827,829,839,853,857,859,863,877,881,883,887,907,911,919,929,937,941,947,953,967,971,977,983,991,997]; var lplim = (1<<26)/lowprimes[lowprimes.length-1]; // (public) test primality with certainty >= 1-.5^t function bnIsProbablePrime(t) { var i, x = this.abs(); if(x.t == 1 && x[0] <= lowprimes[lowprimes.length-1]) { for(i = 0; i < lowprimes.length; ++i) if(x[0] == lowprimes[i]) return true; return false; } if(x.isEven()) return false; i = 1; while(i < lowprimes.length) { var m = lowprimes[i], j = i+1; while(j < lowprimes.length && m < lplim) m *= lowprimes[j++]; m = x.modInt(m); while(i < j) if(m%lowprimes[i++] == 0) return false; } return x.millerRabin(t); } // (protected) true if probably prime (HAC 4.24, Miller-Rabin) function bnpMillerRabin(t) { var n1 = this.subtract(BigInteger.ONE); var k = n1.getLowestSetBit(); if(k <= 0) return false; var r = n1.shiftRight(k); t = (t+1)>>1; if(t > lowprimes.length) t = lowprimes.length; var a = nbi(); for(var i = 0; i < t; ++i) { //Pick bases at random, instead of starting at 2 a.fromInt(lowprimes[Math.floor(Math.random()*lowprimes.length)]); var y = a.modPow(r,this); if(y.compareTo(BigInteger.ONE) != 0 && y.compareTo(n1) != 0) { var j = 1; while(j++ < k && y.compareTo(n1) != 0) { y = y.modPowInt(2,this); if(y.compareTo(BigInteger.ONE) == 0) return false; } if(y.compareTo(n1) != 0) return false; } } return true; } // protected BigInteger.prototype.chunkSize = bnpChunkSize; BigInteger.prototype.toRadix = bnpToRadix; BigInteger.prototype.fromRadix = bnpFromRadix; BigInteger.prototype.fromNumber = bnpFromNumber; BigInteger.prototype.bitwiseTo = bnpBitwiseTo; BigInteger.prototype.changeBit = bnpChangeBit; BigInteger.prototype.addTo = bnpAddTo; BigInteger.prototype.dMultiply = bnpDMultiply; BigInteger.prototype.dAddOffset = bnpDAddOffset; BigInteger.prototype.multiplyLowerTo = bnpMultiplyLowerTo; BigInteger.prototype.multiplyUpperTo = bnpMultiplyUpperTo; BigInteger.prototype.modInt = bnpModInt; BigInteger.prototype.millerRabin = bnpMillerRabin; // public BigInteger.prototype.clone = bnClone; BigInteger.prototype.intValue = bnIntValue; BigInteger.prototype.byteValue = bnByteValue; BigInteger.prototype.shortValue = bnShortValue; BigInteger.prototype.signum = bnSigNum; BigInteger.prototype.toByteArray = bnToByteArray; BigInteger.prototype.equals = bnEquals; BigInteger.prototype.min = bnMin; BigInteger.prototype.max = bnMax; BigInteger.prototype.and = bnAnd; BigInteger.prototype.or = bnOr; BigInteger.prototype.xor = bnXor; BigInteger.prototype.andNot = bnAndNot; BigInteger.prototype.not = bnNot; BigInteger.prototype.shiftLeft = bnShiftLeft; BigInteger.prototype.shiftRight = bnShiftRight; BigInteger.prototype.getLowestSetBit = bnGetLowestSetBit; BigInteger.prototype.bitCount = bnBitCount; BigInteger.prototype.testBit = bnTestBit; BigInteger.prototype.setBit = bnSetBit; BigInteger.prototype.clearBit = bnClearBit; BigInteger.prototype.flipBit = bnFlipBit; BigInteger.prototype.add = bnAdd; BigInteger.prototype.subtract = bnSubtract; BigInteger.prototype.multiply = bnMultiply; BigInteger.prototype.divide = bnDivide; BigInteger.prototype.remainder = bnRemainder; BigInteger.prototype.divideAndRemainder = bnDivideAndRemainder; BigInteger.prototype.modPow = bnModPow; BigInteger.prototype.modInverse = bnModInverse; BigInteger.prototype.pow = bnPow; BigInteger.prototype.gcd = bnGCD; BigInteger.prototype.isProbablePrime = bnIsProbablePrime; // JSBN-specific extension BigInteger.prototype.square = bnSquare; // Expose the Barrett function BigInteger.prototype.Barrett = Barrett // BigInteger interfaces not implemented in jsbn: // BigInteger(int signum, byte[] magnitude) // double doubleValue() // float floatValue() // int hashCode() // long longValue() // static BigInteger valueOf(long val) // Random number generator - requires a PRNG backend, e.g. prng4.js // For best results, put code like // // in your main HTML document. var rng_state; var rng_pool; var rng_pptr; // Mix in a 32-bit integer into the pool function rng_seed_int(x) { rng_pool[rng_pptr++] ^= x & 255; rng_pool[rng_pptr++] ^= (x >> 8) & 255; rng_pool[rng_pptr++] ^= (x >> 16) & 255; rng_pool[rng_pptr++] ^= (x >> 24) & 255; if(rng_pptr >= rng_psize) rng_pptr -= rng_psize; } // Mix in the current time (w/milliseconds) into the pool function rng_seed_time() { rng_seed_int(new Date().getTime()); } // Initialize the pool with junk if needed. if(rng_pool == null) { rng_pool = new Array(); rng_pptr = 0; var t; if(typeof window !== "undefined" && window.crypto) { if (window.crypto.getRandomValues) { // Use webcrypto if available var ua = new Uint8Array(32); window.crypto.getRandomValues(ua); for(t = 0; t < 32; ++t) rng_pool[rng_pptr++] = ua[t]; } else if(navigator.appName == "Netscape" && navigator.appVersion < "5") { // Extract entropy (256 bits) from NS4 RNG if available var z = window.crypto.random(32); for(t = 0; t < z.length; ++t) rng_pool[rng_pptr++] = z.charCodeAt(t) & 255; } } while(rng_pptr < rng_psize) { // extract some randomness from Math.random() t = Math.floor(65536 * Math.random()); rng_pool[rng_pptr++] = t >>> 8; rng_pool[rng_pptr++] = t & 255; } rng_pptr = 0; rng_seed_time(); //rng_seed_int(window.screenX); //rng_seed_int(window.screenY); } function rng_get_byte() { if(rng_state == null) { rng_seed_time(); rng_state = prng_newstate(); rng_state.init(rng_pool); for(rng_pptr = 0; rng_pptr < rng_pool.length; ++rng_pptr) rng_pool[rng_pptr] = 0; rng_pptr = 0; //rng_pool = null; } // TODO: allow reseeding after first request return rng_state.next(); } function rng_get_bytes(ba) { var i; for(i = 0; i < ba.length; ++i) ba[i] = rng_get_byte(); } function SecureRandom() {} SecureRandom.prototype.nextBytes = rng_get_bytes; // prng4.js - uses Arcfour as a PRNG function Arcfour() { this.i = 0; this.j = 0; this.S = new Array(); } // Initialize arcfour context from key, an array of ints, each from [0..255] function ARC4init(key) { var i, j, t; for(i = 0; i < 256; ++i) this.S[i] = i; j = 0; for(i = 0; i < 256; ++i) { j = (j + this.S[i] + key[i % key.length]) & 255; t = this.S[i]; this.S[i] = this.S[j]; this.S[j] = t; } this.i = 0; this.j = 0; } function ARC4next() { var t; this.i = (this.i + 1) & 255; this.j = (this.j + this.S[this.i]) & 255; t = this.S[this.i]; this.S[this.i] = this.S[this.j]; this.S[this.j] = t; return this.S[(t + this.S[this.i]) & 255]; } Arcfour.prototype.init = ARC4init; Arcfour.prototype.next = ARC4next; // Plug in your RNG constructor here function prng_newstate() { return new Arcfour(); } // Pool size must be a multiple of 4 and greater than 32. // An array of bytes the size of the pool will be passed to init() var rng_psize = 256; BigInteger.SecureRandom = SecureRandom; BigInteger.BigInteger = BigInteger; if (true) { exports = module.exports = BigInteger; } else {} }).call(this); /***/ }), /***/ 243: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; var net = __webpack_require__(631) , tls = __webpack_require__(16) , http = __webpack_require__(605) , https = __webpack_require__(211) , events = __webpack_require__(614) , assert = __webpack_require__(357) , util = __webpack_require__(669) , Buffer = __webpack_require__(149).Buffer ; exports.httpOverHttp = httpOverHttp exports.httpsOverHttp = httpsOverHttp exports.httpOverHttps = httpOverHttps exports.httpsOverHttps = httpsOverHttps function httpOverHttp(options) { var agent = new TunnelingAgent(options) agent.request = http.request return agent } function httpsOverHttp(options) { var agent = new TunnelingAgent(options) agent.request = http.request agent.createSocket = createSecureSocket agent.defaultPort = 443 return agent } function httpOverHttps(options) { var agent = new TunnelingAgent(options) agent.request = https.request return agent } function httpsOverHttps(options) { var agent = new TunnelingAgent(options) agent.request = https.request agent.createSocket = createSecureSocket agent.defaultPort = 443 return agent } function TunnelingAgent(options) { var self = this self.options = options || {} self.proxyOptions = self.options.proxy || {} self.maxSockets = self.options.maxSockets || http.Agent.defaultMaxSockets self.requests = [] self.sockets = [] self.on('free', function onFree(socket, host, port) { for (var i = 0, len = self.requests.length; i < len; ++i) { var pending = self.requests[i] if (pending.host === host && pending.port === port) { // Detect the request to connect same origin server, // reuse the connection. self.requests.splice(i, 1) pending.request.onSocket(socket) return } } socket.destroy() self.removeSocket(socket) }) } util.inherits(TunnelingAgent, events.EventEmitter) TunnelingAgent.prototype.addRequest = function addRequest(req, options) { var self = this // Legacy API: addRequest(req, host, port, path) if (typeof options === 'string') { options = { host: options, port: arguments[2], path: arguments[3] }; } if (self.sockets.length >= this.maxSockets) { // We are over limit so we'll add it to the queue. self.requests.push({host: options.host, port: options.port, request: req}) return } // If we are under maxSockets create a new one. self.createConnection({host: options.host, port: options.port, request: req}) } TunnelingAgent.prototype.createConnection = function createConnection(pending) { var self = this self.createSocket(pending, function(socket) { socket.on('free', onFree) socket.on('close', onCloseOrRemove) socket.on('agentRemove', onCloseOrRemove) pending.request.onSocket(socket) function onFree() { self.emit('free', socket, pending.host, pending.port) } function onCloseOrRemove(err) { self.removeSocket(socket) socket.removeListener('free', onFree) socket.removeListener('close', onCloseOrRemove) socket.removeListener('agentRemove', onCloseOrRemove) } }) } TunnelingAgent.prototype.createSocket = function createSocket(options, cb) { var self = this var placeholder = {} self.sockets.push(placeholder) var connectOptions = mergeOptions({}, self.proxyOptions, { method: 'CONNECT' , path: options.host + ':' + options.port , agent: false } ) if (connectOptions.proxyAuth) { connectOptions.headers = connectOptions.headers || {} connectOptions.headers['Proxy-Authorization'] = 'Basic ' + Buffer.from(connectOptions.proxyAuth).toString('base64') } debug('making CONNECT request') var connectReq = self.request(connectOptions) connectReq.useChunkedEncodingByDefault = false // for v0.6 connectReq.once('response', onResponse) // for v0.6 connectReq.once('upgrade', onUpgrade) // for v0.6 connectReq.once('connect', onConnect) // for v0.7 or later connectReq.once('error', onError) connectReq.end() function onResponse(res) { // Very hacky. This is necessary to avoid http-parser leaks. res.upgrade = true } function onUpgrade(res, socket, head) { // Hacky. process.nextTick(function() { onConnect(res, socket, head) }) } function onConnect(res, socket, head) { connectReq.removeAllListeners() socket.removeAllListeners() if (res.statusCode === 200) { assert.equal(head.length, 0) debug('tunneling connection has established') self.sockets[self.sockets.indexOf(placeholder)] = socket cb(socket) } else { debug('tunneling socket could not be established, statusCode=%d', res.statusCode) var error = new Error('tunneling socket could not be established, ' + 'statusCode=' + res.statusCode) error.code = 'ECONNRESET' options.request.emit('error', error) self.removeSocket(placeholder) } } function onError(cause) { connectReq.removeAllListeners() debug('tunneling socket could not be established, cause=%s\n', cause.message, cause.stack) var error = new Error('tunneling socket could not be established, ' + 'cause=' + cause.message) error.code = 'ECONNRESET' options.request.emit('error', error) self.removeSocket(placeholder) } } TunnelingAgent.prototype.removeSocket = function removeSocket(socket) { var pos = this.sockets.indexOf(socket) if (pos === -1) return this.sockets.splice(pos, 1) var pending = this.requests.shift() if (pending) { // If we have pending requests and a socket gets closed a new one // needs to be created to take over in the pool for the one that closed. this.createConnection(pending) } } function createSecureSocket(options, cb) { var self = this TunnelingAgent.prototype.createSocket.call(self, options, function(socket) { // 0 is dummy port for v0.6 var secureSocket = tls.connect(0, mergeOptions({}, self.options, { servername: options.host , socket: socket } )) self.sockets[self.sockets.indexOf(socket)] = secureSocket cb(secureSocket) }) } function mergeOptions(target) { for (var i = 1, len = arguments.length; i < len; ++i) { var overrides = arguments[i] if (typeof overrides === 'object') { var keys = Object.keys(overrides) for (var j = 0, keyLen = keys.length; j < keyLen; ++j) { var k = keys[j] if (overrides[k] !== undefined) { target[k] = overrides[k] } } } } return target } var debug if (process.env.NODE_DEBUG && /\btunnel\b/.test(process.env.NODE_DEBUG)) { debug = function() { var args = Array.prototype.slice.call(arguments) if (typeof args[0] === 'string') { args[0] = 'TUNNEL: ' + args[0] } else { args.unshift('TUNNEL:') } console.error.apply(console, args) } } else { debug = function() {} } exports.debug = debug // for test /***/ }), /***/ 249: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2011 Mark Cavage All rights reserved. var errors = __webpack_require__(584); var types = __webpack_require__(362); var Reader = __webpack_require__(733); var Writer = __webpack_require__(998); // --- Exports module.exports = { Reader: Reader, Writer: Writer }; for (var t in types) { if (types.hasOwnProperty(t)) module.exports[t] = types[t]; } for (var e in errors) { if (errors.hasOwnProperty(e)) module.exports[e] = errors[e]; } /***/ }), /***/ 254: /***/ (function(module) { function Caseless (dict) { this.dict = dict || {} } Caseless.prototype.set = function (name, value, clobber) { if (typeof name === 'object') { for (var i in name) { this.set(i, name[i], value) } } else { if (typeof clobber === 'undefined') clobber = true var has = this.has(name) if (!clobber && has) this.dict[has] = this.dict[has] + ',' + value else this.dict[has || name] = value return has } } Caseless.prototype.has = function (name) { var keys = Object.keys(this.dict) , name = name.toLowerCase() ; for (var i=0;i 0) { m2 = lines[--ei].match(/*JSSTYLED*/ /[-]+[ ]*END ([A-Z0-9][A-Za-z0-9]+ )?(PUBLIC|PRIVATE) KEY[ ]*[-]+/); } assert.ok(m2, 'invalid PEM footer'); /* Begin and end banners must match key type */ assert.equal(m[2], m2[2]); var type = m[2].toLowerCase(); var alg; if (m[1]) { /* They also must match algorithms, if given */ assert.equal(m[1], m2[1], 'PEM header and footer mismatch'); alg = m[1].trim(); } lines = lines.slice(si, ei + 1); var headers = {}; while (true) { lines = lines.slice(1); m = lines[0].match(/*JSSTYLED*/ /^([A-Za-z0-9-]+): (.+)$/); if (!m) break; headers[m[1].toLowerCase()] = m[2]; } /* Chop off the first and last lines */ lines = lines.slice(0, -1).join(''); buf = Buffer.from(lines, 'base64'); var cipher, key, iv; if (headers['proc-type']) { var parts = headers['proc-type'].split(','); if (parts[0] === '4' && parts[1] === 'ENCRYPTED') { if (typeof (options.passphrase) === 'string') { options.passphrase = Buffer.from( options.passphrase, 'utf-8'); } if (!Buffer.isBuffer(options.passphrase)) { throw (new errors.KeyEncryptedError( options.filename, 'PEM')); } else { parts = headers['dek-info'].split(','); assert.ok(parts.length === 2); cipher = parts[0].toLowerCase(); iv = Buffer.from(parts[1], 'hex'); key = utils.opensslKeyDeriv(cipher, iv, options.passphrase, 1).key; } } } if (alg && alg.toLowerCase() === 'encrypted') { var eder = new asn1.BerReader(buf); var pbesEnd; eder.readSequence(); eder.readSequence(); pbesEnd = eder.offset + eder.length; var method = eder.readOID(); if (method !== OID_PBES2) { throw (new Error('Unsupported PEM/PKCS8 encryption ' + 'scheme: ' + method)); } eder.readSequence(); /* PBES2-params */ eder.readSequence(); /* keyDerivationFunc */ var kdfEnd = eder.offset + eder.length; var kdfOid = eder.readOID(); if (kdfOid !== OID_PBKDF2) throw (new Error('Unsupported PBES2 KDF: ' + kdfOid)); eder.readSequence(); var salt = eder.readString(asn1.Ber.OctetString, true); var iterations = eder.readInt(); var hashAlg = 'sha1'; if (eder.offset < kdfEnd) { eder.readSequence(); var hashAlgOid = eder.readOID(); hashAlg = OID_TO_HASH[hashAlgOid]; if (hashAlg === undefined) { throw (new Error('Unsupported PBKDF2 hash: ' + hashAlgOid)); } } eder._offset = kdfEnd; eder.readSequence(); /* encryptionScheme */ var cipherOid = eder.readOID(); cipher = OID_TO_CIPHER[cipherOid]; if (cipher === undefined) { throw (new Error('Unsupported PBES2 cipher: ' + cipherOid)); } iv = eder.readString(asn1.Ber.OctetString, true); eder._offset = pbesEnd; buf = eder.readString(asn1.Ber.OctetString, true); if (typeof (options.passphrase) === 'string') { options.passphrase = Buffer.from( options.passphrase, 'utf-8'); } if (!Buffer.isBuffer(options.passphrase)) { throw (new errors.KeyEncryptedError( options.filename, 'PEM')); } var cinfo = utils.opensshCipherInfo(cipher); cipher = cinfo.opensslName; key = utils.pbkdf2(hashAlg, salt, iterations, cinfo.keySize, options.passphrase); alg = undefined; } if (cipher && key && iv) { var cipherStream = crypto.createDecipheriv(cipher, key, iv); var chunk, chunks = []; cipherStream.once('error', function (e) { if (e.toString().indexOf('bad decrypt') !== -1) { throw (new Error('Incorrect passphrase ' + 'supplied, could not decrypt key')); } throw (e); }); cipherStream.write(buf); cipherStream.end(); while ((chunk = cipherStream.read()) !== null) chunks.push(chunk); buf = Buffer.concat(chunks); } /* The new OpenSSH internal format abuses PEM headers */ if (alg && alg.toLowerCase() === 'openssh') return (sshpriv.readSSHPrivate(type, buf, options)); if (alg && alg.toLowerCase() === 'ssh2') return (rfc4253.readType(type, buf, options)); var der = new asn1.BerReader(buf); der.originalInput = input; /* * All of the PEM file types start with a sequence tag, so chop it * off here */ der.readSequence(); /* PKCS#1 type keys name an algorithm in the banner explicitly */ if (alg) { if (forceType) assert.strictEqual(forceType, 'pkcs1'); return (pkcs1.readPkcs1(alg, type, der)); } else { if (forceType) assert.strictEqual(forceType, 'pkcs8'); return (pkcs8.readPkcs8(alg, type, der)); } } function write(key, options, type) { assert.object(key); var alg = { 'ecdsa': 'EC', 'rsa': 'RSA', 'dsa': 'DSA', 'ed25519': 'EdDSA' }[key.type]; var header; var der = new asn1.BerWriter(); if (PrivateKey.isPrivateKey(key)) { if (type && type === 'pkcs8') { header = 'PRIVATE KEY'; pkcs8.writePkcs8(der, key); } else { if (type) assert.strictEqual(type, 'pkcs1'); header = alg + ' PRIVATE KEY'; pkcs1.writePkcs1(der, key); } } else if (Key.isKey(key)) { if (type && type === 'pkcs1') { header = alg + ' PUBLIC KEY'; pkcs1.writePkcs1(der, key); } else { if (type) assert.strictEqual(type, 'pkcs8'); header = 'PUBLIC KEY'; pkcs8.writePkcs8(der, key); } } else { throw (new Error('key is not a Key or PrivateKey')); } var tmp = der.buffer.toString('base64'); var len = tmp.length + (tmp.length / 64) + 18 + 16 + header.length*2 + 10; var buf = Buffer.alloc(len); var o = 0; o += buf.write('-----BEGIN ' + header + '-----\n', o); for (var i = 0; i < tmp.length; ) { var limit = i + 64; if (limit > tmp.length) limit = tmp.length; o += buf.write(tmp.slice(i, limit), o); buf[o++] = 10; i = limit; } o += buf.write('-----END ' + header + '-----\n', o); return (buf.slice(0, o)); } /***/ }), /***/ 270: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2015 Joyent, Inc. module.exports = { bufferSplit: bufferSplit, addRSAMissing: addRSAMissing, calculateDSAPublic: calculateDSAPublic, calculateED25519Public: calculateED25519Public, calculateX25519Public: calculateX25519Public, mpNormalize: mpNormalize, mpDenormalize: mpDenormalize, ecNormalize: ecNormalize, countZeros: countZeros, assertCompatible: assertCompatible, isCompatible: isCompatible, opensslKeyDeriv: opensslKeyDeriv, opensshCipherInfo: opensshCipherInfo, publicFromPrivateECDSA: publicFromPrivateECDSA, zeroPadToLength: zeroPadToLength, writeBitString: writeBitString, readBitString: readBitString, pbkdf2: pbkdf2 }; var assert = __webpack_require__(477); var Buffer = __webpack_require__(215).Buffer; var PrivateKey = __webpack_require__(502); var Key = __webpack_require__(852); var crypto = __webpack_require__(417); var algs = __webpack_require__(98); var asn1 = __webpack_require__(62); var ec = __webpack_require__(729); var jsbn = __webpack_require__(242).BigInteger; var nacl = __webpack_require__(196); var MAX_CLASS_DEPTH = 3; function isCompatible(obj, klass, needVer) { if (obj === null || typeof (obj) !== 'object') return (false); if (needVer === undefined) needVer = klass.prototype._sshpkApiVersion; if (obj instanceof klass && klass.prototype._sshpkApiVersion[0] == needVer[0]) return (true); var proto = Object.getPrototypeOf(obj); var depth = 0; while (proto.constructor.name !== klass.name) { proto = Object.getPrototypeOf(proto); if (!proto || ++depth > MAX_CLASS_DEPTH) return (false); } if (proto.constructor.name !== klass.name) return (false); var ver = proto._sshpkApiVersion; if (ver === undefined) ver = klass._oldVersionDetect(obj); if (ver[0] != needVer[0] || ver[1] < needVer[1]) return (false); return (true); } function assertCompatible(obj, klass, needVer, name) { if (name === undefined) name = 'object'; assert.ok(obj, name + ' must not be null'); assert.object(obj, name + ' must be an object'); if (needVer === undefined) needVer = klass.prototype._sshpkApiVersion; if (obj instanceof klass && klass.prototype._sshpkApiVersion[0] == needVer[0]) return; var proto = Object.getPrototypeOf(obj); var depth = 0; while (proto.constructor.name !== klass.name) { proto = Object.getPrototypeOf(proto); assert.ok(proto && ++depth <= MAX_CLASS_DEPTH, name + ' must be a ' + klass.name + ' instance'); } assert.strictEqual(proto.constructor.name, klass.name, name + ' must be a ' + klass.name + ' instance'); var ver = proto._sshpkApiVersion; if (ver === undefined) ver = klass._oldVersionDetect(obj); assert.ok(ver[0] == needVer[0] && ver[1] >= needVer[1], name + ' must be compatible with ' + klass.name + ' klass ' + 'version ' + needVer[0] + '.' + needVer[1]); } var CIPHER_LEN = { 'des-ede3-cbc': { key: 24, iv: 8 }, 'aes-128-cbc': { key: 16, iv: 16 }, 'aes-256-cbc': { key: 32, iv: 16 } }; var PKCS5_SALT_LEN = 8; function opensslKeyDeriv(cipher, salt, passphrase, count) { assert.buffer(salt, 'salt'); assert.buffer(passphrase, 'passphrase'); assert.number(count, 'iteration count'); var clen = CIPHER_LEN[cipher]; assert.object(clen, 'supported cipher'); salt = salt.slice(0, PKCS5_SALT_LEN); var D, D_prev, bufs; var material = Buffer.alloc(0); while (material.length < clen.key + clen.iv) { bufs = []; if (D_prev) bufs.push(D_prev); bufs.push(passphrase); bufs.push(salt); D = Buffer.concat(bufs); for (var j = 0; j < count; ++j) D = crypto.createHash('md5').update(D).digest(); material = Buffer.concat([material, D]); D_prev = D; } return ({ key: material.slice(0, clen.key), iv: material.slice(clen.key, clen.key + clen.iv) }); } /* See: RFC2898 */ function pbkdf2(hashAlg, salt, iterations, size, passphrase) { var hkey = Buffer.alloc(salt.length + 4); salt.copy(hkey); var gen = 0, ts = []; var i = 1; while (gen < size) { var t = T(i++); gen += t.length; ts.push(t); } return (Buffer.concat(ts).slice(0, size)); function T(I) { hkey.writeUInt32BE(I, hkey.length - 4); var hmac = crypto.createHmac(hashAlg, passphrase); hmac.update(hkey); var Ti = hmac.digest(); var Uc = Ti; var c = 1; while (c++ < iterations) { hmac = crypto.createHmac(hashAlg, passphrase); hmac.update(Uc); Uc = hmac.digest(); for (var x = 0; x < Ti.length; ++x) Ti[x] ^= Uc[x]; } return (Ti); } } /* Count leading zero bits on a buffer */ function countZeros(buf) { var o = 0, obit = 8; while (o < buf.length) { var mask = (1 << obit); if ((buf[o] & mask) === mask) break; obit--; if (obit < 0) { o++; obit = 8; } } return (o*8 + (8 - obit) - 1); } function bufferSplit(buf, chr) { assert.buffer(buf); assert.string(chr); var parts = []; var lastPart = 0; var matches = 0; for (var i = 0; i < buf.length; ++i) { if (buf[i] === chr.charCodeAt(matches)) ++matches; else if (buf[i] === chr.charCodeAt(0)) matches = 1; else matches = 0; if (matches >= chr.length) { var newPart = i + 1; parts.push(buf.slice(lastPart, newPart - matches)); lastPart = newPart; matches = 0; } } if (lastPart <= buf.length) parts.push(buf.slice(lastPart, buf.length)); return (parts); } function ecNormalize(buf, addZero) { assert.buffer(buf); if (buf[0] === 0x00 && buf[1] === 0x04) { if (addZero) return (buf); return (buf.slice(1)); } else if (buf[0] === 0x04) { if (!addZero) return (buf); } else { while (buf[0] === 0x00) buf = buf.slice(1); if (buf[0] === 0x02 || buf[0] === 0x03) throw (new Error('Compressed elliptic curve points ' + 'are not supported')); if (buf[0] !== 0x04) throw (new Error('Not a valid elliptic curve point')); if (!addZero) return (buf); } var b = Buffer.alloc(buf.length + 1); b[0] = 0x0; buf.copy(b, 1); return (b); } function readBitString(der, tag) { if (tag === undefined) tag = asn1.Ber.BitString; var buf = der.readString(tag, true); assert.strictEqual(buf[0], 0x00, 'bit strings with unused bits are ' + 'not supported (0x' + buf[0].toString(16) + ')'); return (buf.slice(1)); } function writeBitString(der, buf, tag) { if (tag === undefined) tag = asn1.Ber.BitString; var b = Buffer.alloc(buf.length + 1); b[0] = 0x00; buf.copy(b, 1); der.writeBuffer(b, tag); } function mpNormalize(buf) { assert.buffer(buf); while (buf.length > 1 && buf[0] === 0x00 && (buf[1] & 0x80) === 0x00) buf = buf.slice(1); if ((buf[0] & 0x80) === 0x80) { var b = Buffer.alloc(buf.length + 1); b[0] = 0x00; buf.copy(b, 1); buf = b; } return (buf); } function mpDenormalize(buf) { assert.buffer(buf); while (buf.length > 1 && buf[0] === 0x00) buf = buf.slice(1); return (buf); } function zeroPadToLength(buf, len) { assert.buffer(buf); assert.number(len); while (buf.length > len) { assert.equal(buf[0], 0x00); buf = buf.slice(1); } while (buf.length < len) { var b = Buffer.alloc(buf.length + 1); b[0] = 0x00; buf.copy(b, 1); buf = b; } return (buf); } function bigintToMpBuf(bigint) { var buf = Buffer.from(bigint.toByteArray()); buf = mpNormalize(buf); return (buf); } function calculateDSAPublic(g, p, x) { assert.buffer(g); assert.buffer(p); assert.buffer(x); g = new jsbn(g); p = new jsbn(p); x = new jsbn(x); var y = g.modPow(x, p); var ybuf = bigintToMpBuf(y); return (ybuf); } function calculateED25519Public(k) { assert.buffer(k); var kp = nacl.sign.keyPair.fromSeed(new Uint8Array(k)); return (Buffer.from(kp.publicKey)); } function calculateX25519Public(k) { assert.buffer(k); var kp = nacl.box.keyPair.fromSeed(new Uint8Array(k)); return (Buffer.from(kp.publicKey)); } function addRSAMissing(key) { assert.object(key); assertCompatible(key, PrivateKey, [1, 1]); var d = new jsbn(key.part.d.data); var buf; if (!key.part.dmodp) { var p = new jsbn(key.part.p.data); var dmodp = d.mod(p.subtract(1)); buf = bigintToMpBuf(dmodp); key.part.dmodp = {name: 'dmodp', data: buf}; key.parts.push(key.part.dmodp); } if (!key.part.dmodq) { var q = new jsbn(key.part.q.data); var dmodq = d.mod(q.subtract(1)); buf = bigintToMpBuf(dmodq); key.part.dmodq = {name: 'dmodq', data: buf}; key.parts.push(key.part.dmodq); } } function publicFromPrivateECDSA(curveName, priv) { assert.string(curveName, 'curveName'); assert.buffer(priv); var params = algs.curves[curveName]; var p = new jsbn(params.p); var a = new jsbn(params.a); var b = new jsbn(params.b); var curve = new ec.ECCurveFp(p, a, b); var G = curve.decodePointHex(params.G.toString('hex')); var d = new jsbn(mpNormalize(priv)); var pub = G.multiply(d); pub = Buffer.from(curve.encodePointHex(pub), 'hex'); var parts = []; parts.push({name: 'curve', data: Buffer.from(curveName)}); parts.push({name: 'Q', data: pub}); var key = new Key({type: 'ecdsa', curve: curve, parts: parts}); return (key); } function opensshCipherInfo(cipher) { var inf = {}; switch (cipher) { case '3des-cbc': inf.keySize = 24; inf.blockSize = 8; inf.opensslName = 'des-ede3-cbc'; break; case 'blowfish-cbc': inf.keySize = 16; inf.blockSize = 8; inf.opensslName = 'bf-cbc'; break; case 'aes128-cbc': case 'aes128-ctr': case 'aes128-gcm@openssh.com': inf.keySize = 16; inf.blockSize = 16; inf.opensslName = 'aes-128-' + cipher.slice(7, 10); break; case 'aes192-cbc': case 'aes192-ctr': case 'aes192-gcm@openssh.com': inf.keySize = 24; inf.blockSize = 16; inf.opensslName = 'aes-192-' + cipher.slice(7, 10); break; case 'aes256-cbc': case 'aes256-ctr': case 'aes256-gcm@openssh.com': inf.keySize = 32; inf.blockSize = 16; inf.opensslName = 'aes-256-' + cipher.slice(7, 10); break; default: throw (new Error( 'Unsupported openssl cipher "' + cipher + '"')); } return (inf); } /***/ }), /***/ 281: /***/ (function(module) { "use strict"; module.exports = function generate_enum(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $data = 'data' + ($dataLvl || ''); var $valid = 'valid' + $lvl; var $isData = it.opts.$data && $schema && $schema.$data, $schemaValue; if ($isData) { out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; $schemaValue = 'schema' + $lvl; } else { $schemaValue = $schema; } var $i = 'i' + $lvl, $vSchema = 'schema' + $lvl; if (!$isData) { out += ' var ' + ($vSchema) + ' = validate.schema' + ($schemaPath) + ';'; } out += 'var ' + ($valid) + ';'; if ($isData) { out += ' if (schema' + ($lvl) + ' === undefined) ' + ($valid) + ' = true; else if (!Array.isArray(schema' + ($lvl) + ')) ' + ($valid) + ' = false; else {'; } out += '' + ($valid) + ' = false;for (var ' + ($i) + '=0; ' + ($i) + '<' + ($vSchema) + '.length; ' + ($i) + '++) if (equal(' + ($data) + ', ' + ($vSchema) + '[' + ($i) + '])) { ' + ($valid) + ' = true; break; }'; if ($isData) { out += ' } '; } out += ' if (!' + ($valid) + ') { '; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('enum') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { allowedValues: schema' + ($lvl) + ' } '; if (it.opts.messages !== false) { out += ' , message: \'should be equal to one of the allowed values\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } out += ' }'; if ($breakOnError) { out += ' else { '; } return out; } /***/ }), /***/ 286: /***/ (function(__unusedmodule, exports) { // Copyright Joyent, Inc. and other Node contributors. // // Permission is hereby granted, free of charge, to any person obtaining a // copy of this software and associated documentation files (the // "Software"), to deal in the Software without restriction, including // without limitation the rights to use, copy, modify, merge, publish, // distribute, sublicense, and/or sell copies of the Software, and to permit // persons to whom the Software is furnished to do so, subject to the // following conditions: // // The above copyright notice and this permission notice shall be included // in all copies or substantial portions of the Software. // // THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS // OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF // MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN // NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, // DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR // OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE // USE OR OTHER DEALINGS IN THE SOFTWARE. // NOTE: These type checking functions intentionally don't use `instanceof` // because it is fragile and can be easily faked with `Object.create()`. function isArray(arg) { if (Array.isArray) { return Array.isArray(arg); } return objectToString(arg) === '[object Array]'; } exports.isArray = isArray; function isBoolean(arg) { return typeof arg === 'boolean'; } exports.isBoolean = isBoolean; function isNull(arg) { return arg === null; } exports.isNull = isNull; function isNullOrUndefined(arg) { return arg == null; } exports.isNullOrUndefined = isNullOrUndefined; function isNumber(arg) { return typeof arg === 'number'; } exports.isNumber = isNumber; function isString(arg) { return typeof arg === 'string'; } exports.isString = isString; function isSymbol(arg) { return typeof arg === 'symbol'; } exports.isSymbol = isSymbol; function isUndefined(arg) { return arg === void 0; } exports.isUndefined = isUndefined; function isRegExp(re) { return objectToString(re) === '[object RegExp]'; } exports.isRegExp = isRegExp; function isObject(arg) { return typeof arg === 'object' && arg !== null; } exports.isObject = isObject; function isDate(d) { return objectToString(d) === '[object Date]'; } exports.isDate = isDate; function isError(e) { return (objectToString(e) === '[object Error]' || e instanceof Error); } exports.isError = isError; function isFunction(arg) { return typeof arg === 'function'; } exports.isFunction = isFunction; function isPrimitive(arg) { return arg === null || typeof arg === 'boolean' || typeof arg === 'number' || typeof arg === 'string' || typeof arg === 'symbol' || // ES6 symbol typeof arg === 'undefined'; } exports.isPrimitive = isPrimitive; exports.isBuffer = Buffer.isBuffer; function objectToString(o) { return Object.prototype.toString.call(o); } /***/ }), /***/ 287: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; var url = __webpack_require__(835) var qs = __webpack_require__(386) var caseless = __webpack_require__(254) var uuid = __webpack_require__(826) var oauth = __webpack_require__(113) var crypto = __webpack_require__(417) var Buffer = __webpack_require__(149).Buffer function OAuth (request) { this.request = request this.params = null } OAuth.prototype.buildParams = function (_oauth, uri, method, query, form, qsLib) { var oa = {} for (var i in _oauth) { oa['oauth_' + i] = _oauth[i] } if (!oa.oauth_version) { oa.oauth_version = '1.0' } if (!oa.oauth_timestamp) { oa.oauth_timestamp = Math.floor(Date.now() / 1000).toString() } if (!oa.oauth_nonce) { oa.oauth_nonce = uuid().replace(/-/g, '') } if (!oa.oauth_signature_method) { oa.oauth_signature_method = 'HMAC-SHA1' } var consumer_secret_or_private_key = oa.oauth_consumer_secret || oa.oauth_private_key // eslint-disable-line camelcase delete oa.oauth_consumer_secret delete oa.oauth_private_key var token_secret = oa.oauth_token_secret // eslint-disable-line camelcase delete oa.oauth_token_secret var realm = oa.oauth_realm delete oa.oauth_realm delete oa.oauth_transport_method var baseurl = uri.protocol + '//' + uri.host + uri.pathname var params = qsLib.parse([].concat(query, form, qsLib.stringify(oa)).join('&')) oa.oauth_signature = oauth.sign( oa.oauth_signature_method, method, baseurl, params, consumer_secret_or_private_key, // eslint-disable-line camelcase token_secret // eslint-disable-line camelcase ) if (realm) { oa.realm = realm } return oa } OAuth.prototype.buildBodyHash = function (_oauth, body) { if (['HMAC-SHA1', 'RSA-SHA1'].indexOf(_oauth.signature_method || 'HMAC-SHA1') < 0) { this.request.emit('error', new Error('oauth: ' + _oauth.signature_method + ' signature_method not supported with body_hash signing.')) } var shasum = crypto.createHash('sha1') shasum.update(body || '') var sha1 = shasum.digest('hex') return Buffer.from(sha1, 'hex').toString('base64') } OAuth.prototype.concatParams = function (oa, sep, wrap) { wrap = wrap || '' var params = Object.keys(oa).filter(function (i) { return i !== 'realm' && i !== 'oauth_signature' }).sort() if (oa.realm) { params.splice(0, 0, 'realm') } params.push('oauth_signature') return params.map(function (i) { return i + '=' + wrap + oauth.rfc3986(oa[i]) + wrap }).join(sep) } OAuth.prototype.onRequest = function (_oauth) { var self = this self.params = _oauth var uri = self.request.uri || {} var method = self.request.method || '' var headers = caseless(self.request.headers) var body = self.request.body || '' var qsLib = self.request.qsLib || qs var form var query var contentType = headers.get('content-type') || '' var formContentType = 'application/x-www-form-urlencoded' var transport = _oauth.transport_method || 'header' if (contentType.slice(0, formContentType.length) === formContentType) { contentType = formContentType form = body } if (uri.query) { query = uri.query } if (transport === 'body' && (method !== 'POST' || contentType !== formContentType)) { self.request.emit('error', new Error('oauth: transport_method of body requires POST ' + 'and content-type ' + formContentType)) } if (!form && typeof _oauth.body_hash === 'boolean') { _oauth.body_hash = self.buildBodyHash(_oauth, self.request.body.toString()) } var oa = self.buildParams(_oauth, uri, method, query, form, qsLib) switch (transport) { case 'header': self.request.setHeader('Authorization', 'OAuth ' + self.concatParams(oa, ',', '"')) break case 'query': var href = self.request.uri.href += (query ? '&' : '?') + self.concatParams(oa, '&') self.request.uri = url.parse(href) self.request.path = self.request.uri.path break case 'body': self.request.body = (form ? form + '&' : '') + self.concatParams(oa, '&') break default: self.request.emit('error', new Error('oauth: transport_method invalid')) } } exports.OAuth = OAuth /***/ }), /***/ 290: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2017 Joyent, Inc. module.exports = { DiffieHellman: DiffieHellman, generateECDSA: generateECDSA, generateED25519: generateED25519 }; var assert = __webpack_require__(477); var crypto = __webpack_require__(417); var Buffer = __webpack_require__(215).Buffer; var algs = __webpack_require__(98); var utils = __webpack_require__(270); var nacl = __webpack_require__(196); var Key = __webpack_require__(852); var PrivateKey = __webpack_require__(502); var CRYPTO_HAVE_ECDH = (crypto.createECDH !== undefined); var ecdh = __webpack_require__(886); var ec = __webpack_require__(729); var jsbn = __webpack_require__(242).BigInteger; function DiffieHellman(key) { utils.assertCompatible(key, Key, [1, 4], 'key'); this._isPriv = PrivateKey.isPrivateKey(key, [1, 3]); this._algo = key.type; this._curve = key.curve; this._key = key; if (key.type === 'dsa') { if (!CRYPTO_HAVE_ECDH) { throw (new Error('Due to bugs in the node 0.10 ' + 'crypto API, node 0.12.x or later is required ' + 'to use DH')); } this._dh = crypto.createDiffieHellman( key.part.p.data, undefined, key.part.g.data, undefined); this._p = key.part.p; this._g = key.part.g; if (this._isPriv) this._dh.setPrivateKey(key.part.x.data); this._dh.setPublicKey(key.part.y.data); } else if (key.type === 'ecdsa') { if (!CRYPTO_HAVE_ECDH) { this._ecParams = new X9ECParameters(this._curve); if (this._isPriv) { this._priv = new ECPrivate( this._ecParams, key.part.d.data); } return; } var curve = { 'nistp256': 'prime256v1', 'nistp384': 'secp384r1', 'nistp521': 'secp521r1' }[key.curve]; this._dh = crypto.createECDH(curve); if (typeof (this._dh) !== 'object' || typeof (this._dh.setPrivateKey) !== 'function') { CRYPTO_HAVE_ECDH = false; DiffieHellman.call(this, key); return; } if (this._isPriv) this._dh.setPrivateKey(key.part.d.data); this._dh.setPublicKey(key.part.Q.data); } else if (key.type === 'curve25519') { if (this._isPriv) { utils.assertCompatible(key, PrivateKey, [1, 5], 'key'); this._priv = key.part.k.data; } } else { throw (new Error('DH not supported for ' + key.type + ' keys')); } } DiffieHellman.prototype.getPublicKey = function () { if (this._isPriv) return (this._key.toPublic()); return (this._key); }; DiffieHellman.prototype.getPrivateKey = function () { if (this._isPriv) return (this._key); else return (undefined); }; DiffieHellman.prototype.getKey = DiffieHellman.prototype.getPrivateKey; DiffieHellman.prototype._keyCheck = function (pk, isPub) { assert.object(pk, 'key'); if (!isPub) utils.assertCompatible(pk, PrivateKey, [1, 3], 'key'); utils.assertCompatible(pk, Key, [1, 4], 'key'); if (pk.type !== this._algo) { throw (new Error('A ' + pk.type + ' key cannot be used in ' + this._algo + ' Diffie-Hellman')); } if (pk.curve !== this._curve) { throw (new Error('A key from the ' + pk.curve + ' curve ' + 'cannot be used with a ' + this._curve + ' Diffie-Hellman')); } if (pk.type === 'dsa') { assert.deepEqual(pk.part.p, this._p, 'DSA key prime does not match'); assert.deepEqual(pk.part.g, this._g, 'DSA key generator does not match'); } }; DiffieHellman.prototype.setKey = function (pk) { this._keyCheck(pk); if (pk.type === 'dsa') { this._dh.setPrivateKey(pk.part.x.data); this._dh.setPublicKey(pk.part.y.data); } else if (pk.type === 'ecdsa') { if (CRYPTO_HAVE_ECDH) { this._dh.setPrivateKey(pk.part.d.data); this._dh.setPublicKey(pk.part.Q.data); } else { this._priv = new ECPrivate( this._ecParams, pk.part.d.data); } } else if (pk.type === 'curve25519') { var k = pk.part.k; if (!pk.part.k) k = pk.part.r; this._priv = k.data; if (this._priv[0] === 0x00) this._priv = this._priv.slice(1); this._priv = this._priv.slice(0, 32); } this._key = pk; this._isPriv = true; }; DiffieHellman.prototype.setPrivateKey = DiffieHellman.prototype.setKey; DiffieHellman.prototype.computeSecret = function (otherpk) { this._keyCheck(otherpk, true); if (!this._isPriv) throw (new Error('DH exchange has not been initialized with ' + 'a private key yet')); var pub; if (this._algo === 'dsa') { return (this._dh.computeSecret( otherpk.part.y.data)); } else if (this._algo === 'ecdsa') { if (CRYPTO_HAVE_ECDH) { return (this._dh.computeSecret( otherpk.part.Q.data)); } else { pub = new ECPublic( this._ecParams, otherpk.part.Q.data); return (this._priv.deriveSharedSecret(pub)); } } else if (this._algo === 'curve25519') { pub = otherpk.part.A.data; while (pub[0] === 0x00 && pub.length > 32) pub = pub.slice(1); var priv = this._priv; assert.strictEqual(pub.length, 32); assert.strictEqual(priv.length, 32); var secret = nacl.box.before(new Uint8Array(pub), new Uint8Array(priv)); return (Buffer.from(secret)); } throw (new Error('Invalid algorithm: ' + this._algo)); }; DiffieHellman.prototype.generateKey = function () { var parts = []; var priv, pub; if (this._algo === 'dsa') { this._dh.generateKeys(); parts.push({name: 'p', data: this._p.data}); parts.push({name: 'q', data: this._key.part.q.data}); parts.push({name: 'g', data: this._g.data}); parts.push({name: 'y', data: this._dh.getPublicKey()}); parts.push({name: 'x', data: this._dh.getPrivateKey()}); this._key = new PrivateKey({ type: 'dsa', parts: parts }); this._isPriv = true; return (this._key); } else if (this._algo === 'ecdsa') { if (CRYPTO_HAVE_ECDH) { this._dh.generateKeys(); parts.push({name: 'curve', data: Buffer.from(this._curve)}); parts.push({name: 'Q', data: this._dh.getPublicKey()}); parts.push({name: 'd', data: this._dh.getPrivateKey()}); this._key = new PrivateKey({ type: 'ecdsa', curve: this._curve, parts: parts }); this._isPriv = true; return (this._key); } else { var n = this._ecParams.getN(); var r = new jsbn(crypto.randomBytes(n.bitLength())); var n1 = n.subtract(jsbn.ONE); priv = r.mod(n1).add(jsbn.ONE); pub = this._ecParams.getG().multiply(priv); priv = Buffer.from(priv.toByteArray()); pub = Buffer.from(this._ecParams.getCurve(). encodePointHex(pub), 'hex'); this._priv = new ECPrivate(this._ecParams, priv); parts.push({name: 'curve', data: Buffer.from(this._curve)}); parts.push({name: 'Q', data: pub}); parts.push({name: 'd', data: priv}); this._key = new PrivateKey({ type: 'ecdsa', curve: this._curve, parts: parts }); this._isPriv = true; return (this._key); } } else if (this._algo === 'curve25519') { var pair = nacl.box.keyPair(); priv = Buffer.from(pair.secretKey); pub = Buffer.from(pair.publicKey); priv = Buffer.concat([priv, pub]); assert.strictEqual(priv.length, 64); assert.strictEqual(pub.length, 32); parts.push({name: 'A', data: pub}); parts.push({name: 'k', data: priv}); this._key = new PrivateKey({ type: 'curve25519', parts: parts }); this._isPriv = true; return (this._key); } throw (new Error('Invalid algorithm: ' + this._algo)); }; DiffieHellman.prototype.generateKeys = DiffieHellman.prototype.generateKey; /* These are helpers for using ecc-jsbn (for node 0.10 compatibility). */ function X9ECParameters(name) { var params = algs.curves[name]; assert.object(params); var p = new jsbn(params.p); var a = new jsbn(params.a); var b = new jsbn(params.b); var n = new jsbn(params.n); var h = jsbn.ONE; var curve = new ec.ECCurveFp(p, a, b); var G = curve.decodePointHex(params.G.toString('hex')); this.curve = curve; this.g = G; this.n = n; this.h = h; } X9ECParameters.prototype.getCurve = function () { return (this.curve); }; X9ECParameters.prototype.getG = function () { return (this.g); }; X9ECParameters.prototype.getN = function () { return (this.n); }; X9ECParameters.prototype.getH = function () { return (this.h); }; function ECPublic(params, buffer) { this._params = params; if (buffer[0] === 0x00) buffer = buffer.slice(1); this._pub = params.getCurve().decodePointHex(buffer.toString('hex')); } function ECPrivate(params, buffer) { this._params = params; this._priv = new jsbn(utils.mpNormalize(buffer)); } ECPrivate.prototype.deriveSharedSecret = function (pubKey) { assert.ok(pubKey instanceof ECPublic); var S = pubKey._pub.multiply(this._priv); return (Buffer.from(S.getX().toBigInteger().toByteArray())); }; function generateED25519() { var pair = nacl.sign.keyPair(); var priv = Buffer.from(pair.secretKey); var pub = Buffer.from(pair.publicKey); assert.strictEqual(priv.length, 64); assert.strictEqual(pub.length, 32); var parts = []; parts.push({name: 'A', data: pub}); parts.push({name: 'k', data: priv.slice(0, 32)}); var key = new PrivateKey({ type: 'ed25519', parts: parts }); return (key); } /* Generates a new ECDSA private key on a given curve. */ function generateECDSA(curve) { var parts = []; var key; if (CRYPTO_HAVE_ECDH) { /* * Node crypto doesn't expose key generation directly, but the * ECDH instances can generate keys. It turns out this just * calls into the OpenSSL generic key generator, and we can * read its output happily without doing an actual DH. So we * use that here. */ var osCurve = { 'nistp256': 'prime256v1', 'nistp384': 'secp384r1', 'nistp521': 'secp521r1' }[curve]; var dh = crypto.createECDH(osCurve); dh.generateKeys(); parts.push({name: 'curve', data: Buffer.from(curve)}); parts.push({name: 'Q', data: dh.getPublicKey()}); parts.push({name: 'd', data: dh.getPrivateKey()}); key = new PrivateKey({ type: 'ecdsa', curve: curve, parts: parts }); return (key); } else { var ecParams = new X9ECParameters(curve); /* This algorithm taken from FIPS PUB 186-4 (section B.4.1) */ var n = ecParams.getN(); /* * The crypto.randomBytes() function can only give us whole * bytes, so taking a nod from X9.62, we round up. */ var cByteLen = Math.ceil((n.bitLength() + 64) / 8); var c = new jsbn(crypto.randomBytes(cByteLen)); var n1 = n.subtract(jsbn.ONE); var priv = c.mod(n1).add(jsbn.ONE); var pub = ecParams.getG().multiply(priv); priv = Buffer.from(priv.toByteArray()); pub = Buffer.from(ecParams.getCurve(). encodePointHex(pub), 'hex'); parts.push({name: 'curve', data: Buffer.from(curve)}); parts.push({name: 'Q', data: pub}); parts.push({name: 'd', data: priv}); key = new PrivateKey({ type: 'ecdsa', curve: curve, parts: parts }); return (key); } } /***/ }), /***/ 293: /***/ (function(module) { module.exports = require("buffer"); /***/ }), /***/ 314: /***/ (function(module) { "use strict"; module.exports = function generate_custom(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $errorKeyword; var $data = 'data' + ($dataLvl || ''); var $valid = 'valid' + $lvl; var $errs = 'errs__' + $lvl; var $isData = it.opts.$data && $schema && $schema.$data, $schemaValue; if ($isData) { out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; $schemaValue = 'schema' + $lvl; } else { $schemaValue = $schema; } var $rule = this, $definition = 'definition' + $lvl, $rDef = $rule.definition, $closingBraces = ''; var $compile, $inline, $macro, $ruleValidate, $validateCode; if ($isData && $rDef.$data) { $validateCode = 'keywordValidate' + $lvl; var $validateSchema = $rDef.validateSchema; out += ' var ' + ($definition) + ' = RULES.custom[\'' + ($keyword) + '\'].definition; var ' + ($validateCode) + ' = ' + ($definition) + '.validate;'; } else { $ruleValidate = it.useCustomRule($rule, $schema, it.schema, it); if (!$ruleValidate) return; $schemaValue = 'validate.schema' + $schemaPath; $validateCode = $ruleValidate.code; $compile = $rDef.compile; $inline = $rDef.inline; $macro = $rDef.macro; } var $ruleErrs = $validateCode + '.errors', $i = 'i' + $lvl, $ruleErr = 'ruleErr' + $lvl, $asyncKeyword = $rDef.async; if ($asyncKeyword && !it.async) throw new Error('async keyword in sync schema'); if (!($inline || $macro)) { out += '' + ($ruleErrs) + ' = null;'; } out += 'var ' + ($errs) + ' = errors;var ' + ($valid) + ';'; if ($isData && $rDef.$data) { $closingBraces += '}'; out += ' if (' + ($schemaValue) + ' === undefined) { ' + ($valid) + ' = true; } else { '; if ($validateSchema) { $closingBraces += '}'; out += ' ' + ($valid) + ' = ' + ($definition) + '.validateSchema(' + ($schemaValue) + '); if (' + ($valid) + ') { '; } } if ($inline) { if ($rDef.statements) { out += ' ' + ($ruleValidate.validate) + ' '; } else { out += ' ' + ($valid) + ' = ' + ($ruleValidate.validate) + '; '; } } else if ($macro) { var $it = it.util.copy(it); var $closingBraces = ''; $it.level++; var $nextValid = 'valid' + $it.level; $it.schema = $ruleValidate.validate; $it.schemaPath = ''; var $wasComposite = it.compositeRule; it.compositeRule = $it.compositeRule = true; var $code = it.validate($it).replace(/validate\.schema/g, $validateCode); it.compositeRule = $it.compositeRule = $wasComposite; out += ' ' + ($code); } else { var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; out += ' ' + ($validateCode) + '.call( '; if (it.opts.passContext) { out += 'this'; } else { out += 'self'; } if ($compile || $rDef.schema === false) { out += ' , ' + ($data) + ' '; } else { out += ' , ' + ($schemaValue) + ' , ' + ($data) + ' , validate.schema' + (it.schemaPath) + ' '; } out += ' , (dataPath || \'\')'; if (it.errorPath != '""') { out += ' + ' + (it.errorPath); } var $parentData = $dataLvl ? 'data' + (($dataLvl - 1) || '') : 'parentData', $parentDataProperty = $dataLvl ? it.dataPathArr[$dataLvl] : 'parentDataProperty'; out += ' , ' + ($parentData) + ' , ' + ($parentDataProperty) + ' , rootData ) '; var def_callRuleValidate = out; out = $$outStack.pop(); if ($rDef.errors === false) { out += ' ' + ($valid) + ' = '; if ($asyncKeyword) { out += 'await '; } out += '' + (def_callRuleValidate) + '; '; } else { if ($asyncKeyword) { $ruleErrs = 'customErrors' + $lvl; out += ' var ' + ($ruleErrs) + ' = null; try { ' + ($valid) + ' = await ' + (def_callRuleValidate) + '; } catch (e) { ' + ($valid) + ' = false; if (e instanceof ValidationError) ' + ($ruleErrs) + ' = e.errors; else throw e; } '; } else { out += ' ' + ($ruleErrs) + ' = null; ' + ($valid) + ' = ' + (def_callRuleValidate) + '; '; } } } if ($rDef.modifying) { out += ' if (' + ($parentData) + ') ' + ($data) + ' = ' + ($parentData) + '[' + ($parentDataProperty) + '];'; } out += '' + ($closingBraces); if ($rDef.valid) { if ($breakOnError) { out += ' if (true) { '; } } else { out += ' if ( '; if ($rDef.valid === undefined) { out += ' !'; if ($macro) { out += '' + ($nextValid); } else { out += '' + ($valid); } } else { out += ' ' + (!$rDef.valid) + ' '; } out += ') { '; $errorKeyword = $rule.keyword; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ($errorKeyword || 'custom') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { keyword: \'' + ($rule.keyword) + '\' } '; if (it.opts.messages !== false) { out += ' , message: \'should pass "' + ($rule.keyword) + '" keyword validation\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } var def_customError = out; out = $$outStack.pop(); if ($inline) { if ($rDef.errors) { if ($rDef.errors != 'full') { out += ' for (var ' + ($i) + '=' + ($errs) + '; ' + ($i) + '', $notOp = $isMax ? '>' : '<', $errorKeyword = undefined; if ($isDataExcl) { var $schemaValueExcl = it.util.getData($schemaExcl.$data, $dataLvl, it.dataPathArr), $exclusive = 'exclusive' + $lvl, $exclType = 'exclType' + $lvl, $exclIsNumber = 'exclIsNumber' + $lvl, $opExpr = 'op' + $lvl, $opStr = '\' + ' + $opExpr + ' + \''; out += ' var schemaExcl' + ($lvl) + ' = ' + ($schemaValueExcl) + '; '; $schemaValueExcl = 'schemaExcl' + $lvl; out += ' var ' + ($exclusive) + '; var ' + ($exclType) + ' = typeof ' + ($schemaValueExcl) + '; if (' + ($exclType) + ' != \'boolean\' && ' + ($exclType) + ' != \'undefined\' && ' + ($exclType) + ' != \'number\') { '; var $errorKeyword = $exclusiveKeyword; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ($errorKeyword || '_exclusiveLimit') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; if (it.opts.messages !== false) { out += ' , message: \'' + ($exclusiveKeyword) + ' should be boolean\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } out += ' } else if ( '; if ($isData) { out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; } out += ' ' + ($exclType) + ' == \'number\' ? ( (' + ($exclusive) + ' = ' + ($schemaValue) + ' === undefined || ' + ($schemaValueExcl) + ' ' + ($op) + '= ' + ($schemaValue) + ') ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaValueExcl) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) : ( (' + ($exclusive) + ' = ' + ($schemaValueExcl) + ' === true) ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaValue) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) || ' + ($data) + ' !== ' + ($data) + ') { var op' + ($lvl) + ' = ' + ($exclusive) + ' ? \'' + ($op) + '\' : \'' + ($op) + '=\'; '; if ($schema === undefined) { $errorKeyword = $exclusiveKeyword; $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword; $schemaValue = $schemaValueExcl; $isData = $isDataExcl; } } else { var $exclIsNumber = typeof $schemaExcl == 'number', $opStr = $op; if ($exclIsNumber && $isData) { var $opExpr = '\'' + $opStr + '\''; out += ' if ( '; if ($isData) { out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; } out += ' ( ' + ($schemaValue) + ' === undefined || ' + ($schemaExcl) + ' ' + ($op) + '= ' + ($schemaValue) + ' ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaExcl) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) || ' + ($data) + ' !== ' + ($data) + ') { '; } else { if ($exclIsNumber && $schema === undefined) { $exclusive = true; $errorKeyword = $exclusiveKeyword; $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword; $schemaValue = $schemaExcl; $notOp += '='; } else { if ($exclIsNumber) $schemaValue = Math[$isMax ? 'min' : 'max']($schemaExcl, $schema); if ($schemaExcl === ($exclIsNumber ? $schemaValue : true)) { $exclusive = true; $errorKeyword = $exclusiveKeyword; $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword; $notOp += '='; } else { $exclusive = false; $opStr += '='; } } var $opExpr = '\'' + $opStr + '\''; out += ' if ( '; if ($isData) { out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; } out += ' ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' || ' + ($data) + ' !== ' + ($data) + ') { '; } } $errorKeyword = $errorKeyword || $keyword; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ($errorKeyword || '_limit') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { comparison: ' + ($opExpr) + ', limit: ' + ($schemaValue) + ', exclusive: ' + ($exclusive) + ' } '; if (it.opts.messages !== false) { out += ' , message: \'should be ' + ($opStr) + ' '; if ($isData) { out += '\' + ' + ($schemaValue); } else { out += '' + ($schemaValue) + '\''; } } if (it.opts.verbose) { out += ' , schema: '; if ($isData) { out += 'validate.schema' + ($schemaPath); } else { out += '' + ($schema); } out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } out += ' } '; if ($breakOnError) { out += ' else { '; } return out; } /***/ }), /***/ 342: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2012 Joyent, Inc. All rights reserved. var assert = __webpack_require__(477); var util = __webpack_require__(669); var utils = __webpack_require__(909); ///--- Globals var HASH_ALGOS = utils.HASH_ALGOS; var PK_ALGOS = utils.PK_ALGOS; var HttpSignatureError = utils.HttpSignatureError; var InvalidAlgorithmError = utils.InvalidAlgorithmError; var validateAlgorithm = utils.validateAlgorithm; var State = { New: 0, Params: 1 }; var ParamsState = { Name: 0, Quote: 1, Value: 2, Comma: 3 }; ///--- Specific Errors function ExpiredRequestError(message) { HttpSignatureError.call(this, message, ExpiredRequestError); } util.inherits(ExpiredRequestError, HttpSignatureError); function InvalidHeaderError(message) { HttpSignatureError.call(this, message, InvalidHeaderError); } util.inherits(InvalidHeaderError, HttpSignatureError); function InvalidParamsError(message) { HttpSignatureError.call(this, message, InvalidParamsError); } util.inherits(InvalidParamsError, HttpSignatureError); function MissingHeaderError(message) { HttpSignatureError.call(this, message, MissingHeaderError); } util.inherits(MissingHeaderError, HttpSignatureError); function StrictParsingError(message) { HttpSignatureError.call(this, message, StrictParsingError); } util.inherits(StrictParsingError, HttpSignatureError); ///--- Exported API module.exports = { /** * Parses the 'Authorization' header out of an http.ServerRequest object. * * Note that this API will fully validate the Authorization header, and throw * on any error. It will not however check the signature, or the keyId format * as those are specific to your environment. You can use the options object * to pass in extra constraints. * * As a response object you can expect this: * * { * "scheme": "Signature", * "params": { * "keyId": "foo", * "algorithm": "rsa-sha256", * "headers": [ * "date" or "x-date", * "digest" * ], * "signature": "base64" * }, * "signingString": "ready to be passed to crypto.verify()" * } * * @param {Object} request an http.ServerRequest. * @param {Object} options an optional options object with: * - clockSkew: allowed clock skew in seconds (default 300). * - headers: required header names (def: date or x-date) * - algorithms: algorithms to support (default: all). * - strict: should enforce latest spec parsing * (default: false). * @return {Object} parsed out object (see above). * @throws {TypeError} on invalid input. * @throws {InvalidHeaderError} on an invalid Authorization header error. * @throws {InvalidParamsError} if the params in the scheme are invalid. * @throws {MissingHeaderError} if the params indicate a header not present, * either in the request headers from the params, * or not in the params from a required header * in options. * @throws {StrictParsingError} if old attributes are used in strict parsing * mode. * @throws {ExpiredRequestError} if the value of date or x-date exceeds skew. */ parseRequest: function parseRequest(request, options) { assert.object(request, 'request'); assert.object(request.headers, 'request.headers'); if (options === undefined) { options = {}; } if (options.headers === undefined) { options.headers = [request.headers['x-date'] ? 'x-date' : 'date']; } assert.object(options, 'options'); assert.arrayOfString(options.headers, 'options.headers'); assert.optionalFinite(options.clockSkew, 'options.clockSkew'); var authzHeaderName = options.authorizationHeaderName || 'authorization'; if (!request.headers[authzHeaderName]) { throw new MissingHeaderError('no ' + authzHeaderName + ' header ' + 'present in the request'); } options.clockSkew = options.clockSkew || 300; var i = 0; var state = State.New; var substate = ParamsState.Name; var tmpName = ''; var tmpValue = ''; var parsed = { scheme: '', params: {}, signingString: '' }; var authz = request.headers[authzHeaderName]; for (i = 0; i < authz.length; i++) { var c = authz.charAt(i); switch (Number(state)) { case State.New: if (c !== ' ') parsed.scheme += c; else state = State.Params; break; case State.Params: switch (Number(substate)) { case ParamsState.Name: var code = c.charCodeAt(0); // restricted name of A-Z / a-z if ((code >= 0x41 && code <= 0x5a) || // A-Z (code >= 0x61 && code <= 0x7a)) { // a-z tmpName += c; } else if (c === '=') { if (tmpName.length === 0) throw new InvalidHeaderError('bad param format'); substate = ParamsState.Quote; } else { throw new InvalidHeaderError('bad param format'); } break; case ParamsState.Quote: if (c === '"') { tmpValue = ''; substate = ParamsState.Value; } else { throw new InvalidHeaderError('bad param format'); } break; case ParamsState.Value: if (c === '"') { parsed.params[tmpName] = tmpValue; substate = ParamsState.Comma; } else { tmpValue += c; } break; case ParamsState.Comma: if (c === ',') { tmpName = ''; substate = ParamsState.Name; } else { throw new InvalidHeaderError('bad param format'); } break; default: throw new Error('Invalid substate'); } break; default: throw new Error('Invalid substate'); } } if (!parsed.params.headers || parsed.params.headers === '') { if (request.headers['x-date']) { parsed.params.headers = ['x-date']; } else { parsed.params.headers = ['date']; } } else { parsed.params.headers = parsed.params.headers.split(' '); } // Minimally validate the parsed object if (!parsed.scheme || parsed.scheme !== 'Signature') throw new InvalidHeaderError('scheme was not "Signature"'); if (!parsed.params.keyId) throw new InvalidHeaderError('keyId was not specified'); if (!parsed.params.algorithm) throw new InvalidHeaderError('algorithm was not specified'); if (!parsed.params.signature) throw new InvalidHeaderError('signature was not specified'); // Check the algorithm against the official list parsed.params.algorithm = parsed.params.algorithm.toLowerCase(); try { validateAlgorithm(parsed.params.algorithm); } catch (e) { if (e instanceof InvalidAlgorithmError) throw (new InvalidParamsError(parsed.params.algorithm + ' is not ' + 'supported')); else throw (e); } // Build the signingString for (i = 0; i < parsed.params.headers.length; i++) { var h = parsed.params.headers[i].toLowerCase(); parsed.params.headers[i] = h; if (h === 'request-line') { if (!options.strict) { /* * We allow headers from the older spec drafts if strict parsing isn't * specified in options. */ parsed.signingString += request.method + ' ' + request.url + ' HTTP/' + request.httpVersion; } else { /* Strict parsing doesn't allow older draft headers. */ throw (new StrictParsingError('request-line is not a valid header ' + 'with strict parsing enabled.')); } } else if (h === '(request-target)') { parsed.signingString += '(request-target): ' + request.method.toLowerCase() + ' ' + request.url; } else { var value = request.headers[h]; if (value === undefined) throw new MissingHeaderError(h + ' was not in the request'); parsed.signingString += h + ': ' + value; } if ((i + 1) < parsed.params.headers.length) parsed.signingString += '\n'; } // Check against the constraints var date; if (request.headers.date || request.headers['x-date']) { if (request.headers['x-date']) { date = new Date(request.headers['x-date']); } else { date = new Date(request.headers.date); } var now = new Date(); var skew = Math.abs(now.getTime() - date.getTime()); if (skew > options.clockSkew * 1000) { throw new ExpiredRequestError('clock skew of ' + (skew / 1000) + 's was greater than ' + options.clockSkew + 's'); } } options.headers.forEach(function (hdr) { // Remember that we already checked any headers in the params // were in the request, so if this passes we're good. if (parsed.params.headers.indexOf(hdr.toLowerCase()) < 0) throw new MissingHeaderError(hdr + ' was not a signed header'); }); if (options.algorithms) { if (options.algorithms.indexOf(parsed.params.algorithm) === -1) throw new InvalidParamsError(parsed.params.algorithm + ' is not a supported algorithm'); } parsed.algorithm = parsed.params.algorithm.toUpperCase(); parsed.keyId = parsed.params.keyId; return parsed; } }; /***/ }), /***/ 343: /***/ (function(module) { "use strict"; module.exports = function generate_properties(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $data = 'data' + ($dataLvl || ''); var $errs = 'errs__' + $lvl; var $it = it.util.copy(it); var $closingBraces = ''; $it.level++; var $nextValid = 'valid' + $it.level; var $key = 'key' + $lvl, $idx = 'idx' + $lvl, $dataNxt = $it.dataLevel = it.dataLevel + 1, $nextData = 'data' + $dataNxt, $dataProperties = 'dataProperties' + $lvl; var $schemaKeys = Object.keys($schema || {}), $pProperties = it.schema.patternProperties || {}, $pPropertyKeys = Object.keys($pProperties), $aProperties = it.schema.additionalProperties, $someProperties = $schemaKeys.length || $pPropertyKeys.length, $noAdditional = $aProperties === false, $additionalIsSchema = typeof $aProperties == 'object' && Object.keys($aProperties).length, $removeAdditional = it.opts.removeAdditional, $checkAdditional = $noAdditional || $additionalIsSchema || $removeAdditional, $ownProperties = it.opts.ownProperties, $currentBaseId = it.baseId; var $required = it.schema.required; if ($required && !(it.opts.$data && $required.$data) && $required.length < it.opts.loopRequired) var $requiredHash = it.util.toHash($required); out += 'var ' + ($errs) + ' = errors;var ' + ($nextValid) + ' = true;'; if ($ownProperties) { out += ' var ' + ($dataProperties) + ' = undefined;'; } if ($checkAdditional) { if ($ownProperties) { out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; '; } else { out += ' for (var ' + ($key) + ' in ' + ($data) + ') { '; } if ($someProperties) { out += ' var isAdditional' + ($lvl) + ' = !(false '; if ($schemaKeys.length) { if ($schemaKeys.length > 8) { out += ' || validate.schema' + ($schemaPath) + '.hasOwnProperty(' + ($key) + ') '; } else { var arr1 = $schemaKeys; if (arr1) { var $propertyKey, i1 = -1, l1 = arr1.length - 1; while (i1 < l1) { $propertyKey = arr1[i1 += 1]; out += ' || ' + ($key) + ' == ' + (it.util.toQuotedString($propertyKey)) + ' '; } } } } if ($pPropertyKeys.length) { var arr2 = $pPropertyKeys; if (arr2) { var $pProperty, $i = -1, l2 = arr2.length - 1; while ($i < l2) { $pProperty = arr2[$i += 1]; out += ' || ' + (it.usePattern($pProperty)) + '.test(' + ($key) + ') '; } } } out += ' ); if (isAdditional' + ($lvl) + ') { '; } if ($removeAdditional == 'all') { out += ' delete ' + ($data) + '[' + ($key) + ']; '; } else { var $currentErrorPath = it.errorPath; var $additionalProperty = '\' + ' + $key + ' + \''; if (it.opts._errorDataPathProperty) { it.errorPath = it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); } if ($noAdditional) { if ($removeAdditional) { out += ' delete ' + ($data) + '[' + ($key) + ']; '; } else { out += ' ' + ($nextValid) + ' = false; '; var $currErrSchemaPath = $errSchemaPath; $errSchemaPath = it.errSchemaPath + '/additionalProperties'; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('additionalProperties') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { additionalProperty: \'' + ($additionalProperty) + '\' } '; if (it.opts.messages !== false) { out += ' , message: \''; if (it.opts._errorDataPathProperty) { out += 'is an invalid additional property'; } else { out += 'should NOT have additional properties'; } out += '\' '; } if (it.opts.verbose) { out += ' , schema: false , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } $errSchemaPath = $currErrSchemaPath; if ($breakOnError) { out += ' break; '; } } } else if ($additionalIsSchema) { if ($removeAdditional == 'failing') { out += ' var ' + ($errs) + ' = errors; '; var $wasComposite = it.compositeRule; it.compositeRule = $it.compositeRule = true; $it.schema = $aProperties; $it.schemaPath = it.schemaPath + '.additionalProperties'; $it.errSchemaPath = it.errSchemaPath + '/additionalProperties'; $it.errorPath = it.opts._errorDataPathProperty ? it.errorPath : it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); var $passData = $data + '[' + $key + ']'; $it.dataPathArr[$dataNxt] = $key; var $code = it.validate($it); $it.baseId = $currentBaseId; if (it.util.varOccurences($code, $nextData) < 2) { out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; } else { out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; } out += ' if (!' + ($nextValid) + ') { errors = ' + ($errs) + '; if (validate.errors !== null) { if (errors) validate.errors.length = errors; else validate.errors = null; } delete ' + ($data) + '[' + ($key) + ']; } '; it.compositeRule = $it.compositeRule = $wasComposite; } else { $it.schema = $aProperties; $it.schemaPath = it.schemaPath + '.additionalProperties'; $it.errSchemaPath = it.errSchemaPath + '/additionalProperties'; $it.errorPath = it.opts._errorDataPathProperty ? it.errorPath : it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); var $passData = $data + '[' + $key + ']'; $it.dataPathArr[$dataNxt] = $key; var $code = it.validate($it); $it.baseId = $currentBaseId; if (it.util.varOccurences($code, $nextData) < 2) { out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; } else { out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; } if ($breakOnError) { out += ' if (!' + ($nextValid) + ') break; '; } } } it.errorPath = $currentErrorPath; } if ($someProperties) { out += ' } '; } out += ' } '; if ($breakOnError) { out += ' if (' + ($nextValid) + ') { '; $closingBraces += '}'; } } var $useDefaults = it.opts.useDefaults && !it.compositeRule; if ($schemaKeys.length) { var arr3 = $schemaKeys; if (arr3) { var $propertyKey, i3 = -1, l3 = arr3.length - 1; while (i3 < l3) { $propertyKey = arr3[i3 += 1]; var $sch = $schema[$propertyKey]; if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { var $prop = it.util.getProperty($propertyKey), $passData = $data + $prop, $hasDefault = $useDefaults && $sch.default !== undefined; $it.schema = $sch; $it.schemaPath = $schemaPath + $prop; $it.errSchemaPath = $errSchemaPath + '/' + it.util.escapeFragment($propertyKey); $it.errorPath = it.util.getPath(it.errorPath, $propertyKey, it.opts.jsonPointers); $it.dataPathArr[$dataNxt] = it.util.toQuotedString($propertyKey); var $code = it.validate($it); $it.baseId = $currentBaseId; if (it.util.varOccurences($code, $nextData) < 2) { $code = it.util.varReplace($code, $nextData, $passData); var $useData = $passData; } else { var $useData = $nextData; out += ' var ' + ($nextData) + ' = ' + ($passData) + '; '; } if ($hasDefault) { out += ' ' + ($code) + ' '; } else { if ($requiredHash && $requiredHash[$propertyKey]) { out += ' if ( ' + ($useData) + ' === undefined '; if ($ownProperties) { out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; } out += ') { ' + ($nextValid) + ' = false; '; var $currentErrorPath = it.errorPath, $currErrSchemaPath = $errSchemaPath, $missingProperty = it.util.escapeQuotes($propertyKey); if (it.opts._errorDataPathProperty) { it.errorPath = it.util.getPath($currentErrorPath, $propertyKey, it.opts.jsonPointers); } $errSchemaPath = it.errSchemaPath + '/required'; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; if (it.opts.messages !== false) { out += ' , message: \''; if (it.opts._errorDataPathProperty) { out += 'is a required property'; } else { out += 'should have required property \\\'' + ($missingProperty) + '\\\''; } out += '\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } $errSchemaPath = $currErrSchemaPath; it.errorPath = $currentErrorPath; out += ' } else { '; } else { if ($breakOnError) { out += ' if ( ' + ($useData) + ' === undefined '; if ($ownProperties) { out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; } out += ') { ' + ($nextValid) + ' = true; } else { '; } else { out += ' if (' + ($useData) + ' !== undefined '; if ($ownProperties) { out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; } out += ' ) { '; } } out += ' ' + ($code) + ' } '; } } if ($breakOnError) { out += ' if (' + ($nextValid) + ') { '; $closingBraces += '}'; } } } } if ($pPropertyKeys.length) { var arr4 = $pPropertyKeys; if (arr4) { var $pProperty, i4 = -1, l4 = arr4.length - 1; while (i4 < l4) { $pProperty = arr4[i4 += 1]; var $sch = $pProperties[$pProperty]; if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { $it.schema = $sch; $it.schemaPath = it.schemaPath + '.patternProperties' + it.util.getProperty($pProperty); $it.errSchemaPath = it.errSchemaPath + '/patternProperties/' + it.util.escapeFragment($pProperty); if ($ownProperties) { out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; '; } else { out += ' for (var ' + ($key) + ' in ' + ($data) + ') { '; } out += ' if (' + (it.usePattern($pProperty)) + '.test(' + ($key) + ')) { '; $it.errorPath = it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); var $passData = $data + '[' + $key + ']'; $it.dataPathArr[$dataNxt] = $key; var $code = it.validate($it); $it.baseId = $currentBaseId; if (it.util.varOccurences($code, $nextData) < 2) { out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; } else { out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; } if ($breakOnError) { out += ' if (!' + ($nextValid) + ') break; '; } out += ' } '; if ($breakOnError) { out += ' else ' + ($nextValid) + ' = true; '; } out += ' } '; if ($breakOnError) { out += ' if (' + ($nextValid) + ') { '; $closingBraces += '}'; } } } } } if ($breakOnError) { out += ' ' + ($closingBraces) + ' if (' + ($errs) + ' == errors) {'; } out = it.util.cleanUpCode(out); return out; } /***/ }), /***/ 348: /***/ (function(__unusedmodule, exports, __webpack_require__) { /* * lib/jsprim.js: utilities for primitive JavaScript types */ var mod_assert = __webpack_require__(477); var mod_util = __webpack_require__(669); var mod_extsprintf = __webpack_require__(697); var mod_verror = __webpack_require__(956); var mod_jsonschema = __webpack_require__(703); /* * Public interface */ exports.deepCopy = deepCopy; exports.deepEqual = deepEqual; exports.isEmpty = isEmpty; exports.hasKey = hasKey; exports.forEachKey = forEachKey; exports.pluck = pluck; exports.flattenObject = flattenObject; exports.flattenIter = flattenIter; exports.validateJsonObject = validateJsonObjectJS; exports.validateJsonObjectJS = validateJsonObjectJS; exports.randElt = randElt; exports.extraProperties = extraProperties; exports.mergeObjects = mergeObjects; exports.startsWith = startsWith; exports.endsWith = endsWith; exports.parseInteger = parseInteger; exports.iso8601 = iso8601; exports.rfc1123 = rfc1123; exports.parseDateTime = parseDateTime; exports.hrtimediff = hrtimeDiff; exports.hrtimeDiff = hrtimeDiff; exports.hrtimeAccum = hrtimeAccum; exports.hrtimeAdd = hrtimeAdd; exports.hrtimeNanosec = hrtimeNanosec; exports.hrtimeMicrosec = hrtimeMicrosec; exports.hrtimeMillisec = hrtimeMillisec; /* * Deep copy an acyclic *basic* Javascript object. This only handles basic * scalars (strings, numbers, booleans) and arbitrarily deep arrays and objects * containing these. This does *not* handle instances of other classes. */ function deepCopy(obj) { var ret, key; var marker = '__deepCopy'; if (obj && obj[marker]) throw (new Error('attempted deep copy of cyclic object')); if (obj && obj.constructor == Object) { ret = {}; obj[marker] = true; for (key in obj) { if (key == marker) continue; ret[key] = deepCopy(obj[key]); } delete (obj[marker]); return (ret); } if (obj && obj.constructor == Array) { ret = []; obj[marker] = true; for (key = 0; key < obj.length; key++) ret.push(deepCopy(obj[key])); delete (obj[marker]); return (ret); } /* * It must be a primitive type -- just return it. */ return (obj); } function deepEqual(obj1, obj2) { if (typeof (obj1) != typeof (obj2)) return (false); if (obj1 === null || obj2 === null || typeof (obj1) != 'object') return (obj1 === obj2); if (obj1.constructor != obj2.constructor) return (false); var k; for (k in obj1) { if (!obj2.hasOwnProperty(k)) return (false); if (!deepEqual(obj1[k], obj2[k])) return (false); } for (k in obj2) { if (!obj1.hasOwnProperty(k)) return (false); } return (true); } function isEmpty(obj) { var key; for (key in obj) return (false); return (true); } function hasKey(obj, key) { mod_assert.equal(typeof (key), 'string'); return (Object.prototype.hasOwnProperty.call(obj, key)); } function forEachKey(obj, callback) { for (var key in obj) { if (hasKey(obj, key)) { callback(key, obj[key]); } } } function pluck(obj, key) { mod_assert.equal(typeof (key), 'string'); return (pluckv(obj, key)); } function pluckv(obj, key) { if (obj === null || typeof (obj) !== 'object') return (undefined); if (obj.hasOwnProperty(key)) return (obj[key]); var i = key.indexOf('.'); if (i == -1) return (undefined); var key1 = key.substr(0, i); if (!obj.hasOwnProperty(key1)) return (undefined); return (pluckv(obj[key1], key.substr(i + 1))); } /* * Invoke callback(row) for each entry in the array that would be returned by * flattenObject(data, depth). This is just like flattenObject(data, * depth).forEach(callback), except that the intermediate array is never * created. */ function flattenIter(data, depth, callback) { doFlattenIter(data, depth, [], callback); } function doFlattenIter(data, depth, accum, callback) { var each; var key; if (depth === 0) { each = accum.slice(0); each.push(data); callback(each); return; } mod_assert.ok(data !== null); mod_assert.equal(typeof (data), 'object'); mod_assert.equal(typeof (depth), 'number'); mod_assert.ok(depth >= 0); for (key in data) { each = accum.slice(0); each.push(key); doFlattenIter(data[key], depth - 1, each, callback); } } function flattenObject(data, depth) { if (depth === 0) return ([ data ]); mod_assert.ok(data !== null); mod_assert.equal(typeof (data), 'object'); mod_assert.equal(typeof (depth), 'number'); mod_assert.ok(depth >= 0); var rv = []; var key; for (key in data) { flattenObject(data[key], depth - 1).forEach(function (p) { rv.push([ key ].concat(p)); }); } return (rv); } function startsWith(str, prefix) { return (str.substr(0, prefix.length) == prefix); } function endsWith(str, suffix) { return (str.substr( str.length - suffix.length, suffix.length) == suffix); } function iso8601(d) { if (typeof (d) == 'number') d = new Date(d); mod_assert.ok(d.constructor === Date); return (mod_extsprintf.sprintf('%4d-%02d-%02dT%02d:%02d:%02d.%03dZ', d.getUTCFullYear(), d.getUTCMonth() + 1, d.getUTCDate(), d.getUTCHours(), d.getUTCMinutes(), d.getUTCSeconds(), d.getUTCMilliseconds())); } var RFC1123_MONTHS = [ 'Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec']; var RFC1123_DAYS = [ 'Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat']; function rfc1123(date) { return (mod_extsprintf.sprintf('%s, %02d %s %04d %02d:%02d:%02d GMT', RFC1123_DAYS[date.getUTCDay()], date.getUTCDate(), RFC1123_MONTHS[date.getUTCMonth()], date.getUTCFullYear(), date.getUTCHours(), date.getUTCMinutes(), date.getUTCSeconds())); } /* * Parses a date expressed as a string, as either a number of milliseconds since * the epoch or any string format that Date accepts, giving preference to the * former where these two sets overlap (e.g., small numbers). */ function parseDateTime(str) { /* * This is irritatingly implicit, but significantly more concise than * alternatives. The "+str" will convert a string containing only a * number directly to a Number, or NaN for other strings. Thus, if the * conversion succeeds, we use it (this is the milliseconds-since-epoch * case). Otherwise, we pass the string directly to the Date * constructor to parse. */ var numeric = +str; if (!isNaN(numeric)) { return (new Date(numeric)); } else { return (new Date(str)); } } /* * Number.*_SAFE_INTEGER isn't present before node v0.12, so we hardcode * the ES6 definitions here, while allowing for them to someday be higher. */ var MAX_SAFE_INTEGER = Number.MAX_SAFE_INTEGER || 9007199254740991; var MIN_SAFE_INTEGER = Number.MIN_SAFE_INTEGER || -9007199254740991; /* * Default options for parseInteger(). */ var PI_DEFAULTS = { base: 10, allowSign: true, allowPrefix: false, allowTrailing: false, allowImprecise: false, trimWhitespace: false, leadingZeroIsOctal: false }; var CP_0 = 0x30; var CP_9 = 0x39; var CP_A = 0x41; var CP_B = 0x42; var CP_O = 0x4f; var CP_T = 0x54; var CP_X = 0x58; var CP_Z = 0x5a; var CP_a = 0x61; var CP_b = 0x62; var CP_o = 0x6f; var CP_t = 0x74; var CP_x = 0x78; var CP_z = 0x7a; var PI_CONV_DEC = 0x30; var PI_CONV_UC = 0x37; var PI_CONV_LC = 0x57; /* * A stricter version of parseInt() that provides options for changing what * is an acceptable string (for example, disallowing trailing characters). */ function parseInteger(str, uopts) { mod_assert.string(str, 'str'); mod_assert.optionalObject(uopts, 'options'); var baseOverride = false; var options = PI_DEFAULTS; if (uopts) { baseOverride = hasKey(uopts, 'base'); options = mergeObjects(options, uopts); mod_assert.number(options.base, 'options.base'); mod_assert.ok(options.base >= 2, 'options.base >= 2'); mod_assert.ok(options.base <= 36, 'options.base <= 36'); mod_assert.bool(options.allowSign, 'options.allowSign'); mod_assert.bool(options.allowPrefix, 'options.allowPrefix'); mod_assert.bool(options.allowTrailing, 'options.allowTrailing'); mod_assert.bool(options.allowImprecise, 'options.allowImprecise'); mod_assert.bool(options.trimWhitespace, 'options.trimWhitespace'); mod_assert.bool(options.leadingZeroIsOctal, 'options.leadingZeroIsOctal'); if (options.leadingZeroIsOctal) { mod_assert.ok(!baseOverride, '"base" and "leadingZeroIsOctal" are ' + 'mutually exclusive'); } } var c; var pbase = -1; var base = options.base; var start; var mult = 1; var value = 0; var idx = 0; var len = str.length; /* Trim any whitespace on the left side. */ if (options.trimWhitespace) { while (idx < len && isSpace(str.charCodeAt(idx))) { ++idx; } } /* Check the number for a leading sign. */ if (options.allowSign) { if (str[idx] === '-') { idx += 1; mult = -1; } else if (str[idx] === '+') { idx += 1; } } /* Parse the base-indicating prefix if there is one. */ if (str[idx] === '0') { if (options.allowPrefix) { pbase = prefixToBase(str.charCodeAt(idx + 1)); if (pbase !== -1 && (!baseOverride || pbase === base)) { base = pbase; idx += 2; } } if (pbase === -1 && options.leadingZeroIsOctal) { base = 8; } } /* Parse the actual digits. */ for (start = idx; idx < len; ++idx) { c = translateDigit(str.charCodeAt(idx)); if (c !== -1 && c < base) { value *= base; value += c; } else { break; } } /* If we didn't parse any digits, we have an invalid number. */ if (start === idx) { return (new Error('invalid number: ' + JSON.stringify(str))); } /* Trim any whitespace on the right side. */ if (options.trimWhitespace) { while (idx < len && isSpace(str.charCodeAt(idx))) { ++idx; } } /* Check for trailing characters. */ if (idx < len && !options.allowTrailing) { return (new Error('trailing characters after number: ' + JSON.stringify(str.slice(idx)))); } /* If our value is 0, we return now, to avoid returning -0. */ if (value === 0) { return (0); } /* Calculate our final value. */ var result = value * mult; /* * If the string represents a value that cannot be precisely represented * by JavaScript, then we want to check that: * * - We never increased the value past MAX_SAFE_INTEGER * - We don't make the result negative and below MIN_SAFE_INTEGER * * Because we only ever increment the value during parsing, there's no * chance of moving past MAX_SAFE_INTEGER and then dropping below it * again, losing precision in the process. This means that we only need * to do our checks here, at the end. */ if (!options.allowImprecise && (value > MAX_SAFE_INTEGER || result < MIN_SAFE_INTEGER)) { return (new Error('number is outside of the supported range: ' + JSON.stringify(str.slice(start, idx)))); } return (result); } /* * Interpret a character code as a base-36 digit. */ function translateDigit(d) { if (d >= CP_0 && d <= CP_9) { /* '0' to '9' -> 0 to 9 */ return (d - PI_CONV_DEC); } else if (d >= CP_A && d <= CP_Z) { /* 'A' - 'Z' -> 10 to 35 */ return (d - PI_CONV_UC); } else if (d >= CP_a && d <= CP_z) { /* 'a' - 'z' -> 10 to 35 */ return (d - PI_CONV_LC); } else { /* Invalid character code */ return (-1); } } /* * Test if a value matches the ECMAScript definition of trimmable whitespace. */ function isSpace(c) { return (c === 0x20) || (c >= 0x0009 && c <= 0x000d) || (c === 0x00a0) || (c === 0x1680) || (c === 0x180e) || (c >= 0x2000 && c <= 0x200a) || (c === 0x2028) || (c === 0x2029) || (c === 0x202f) || (c === 0x205f) || (c === 0x3000) || (c === 0xfeff); } /* * Determine which base a character indicates (e.g., 'x' indicates hex). */ function prefixToBase(c) { if (c === CP_b || c === CP_B) { /* 0b/0B (binary) */ return (2); } else if (c === CP_o || c === CP_O) { /* 0o/0O (octal) */ return (8); } else if (c === CP_t || c === CP_T) { /* 0t/0T (decimal) */ return (10); } else if (c === CP_x || c === CP_X) { /* 0x/0X (hexadecimal) */ return (16); } else { /* Not a meaningful character */ return (-1); } } function validateJsonObjectJS(schema, input) { var report = mod_jsonschema.validate(input, schema); if (report.errors.length === 0) return (null); /* Currently, we only do anything useful with the first error. */ var error = report.errors[0]; /* The failed property is given by a URI with an irrelevant prefix. */ var propname = error['property']; var reason = error['message'].toLowerCase(); var i, j; /* * There's at least one case where the property error message is * confusing at best. We work around this here. */ if ((i = reason.indexOf('the property ')) != -1 && (j = reason.indexOf(' is not defined in the schema and the ' + 'schema does not allow additional properties')) != -1) { i += 'the property '.length; if (propname === '') propname = reason.substr(i, j - i); else propname = propname + '.' + reason.substr(i, j - i); reason = 'unsupported property'; } var rv = new mod_verror.VError('property "%s": %s', propname, reason); rv.jsv_details = error; return (rv); } function randElt(arr) { mod_assert.ok(Array.isArray(arr) && arr.length > 0, 'randElt argument must be a non-empty array'); return (arr[Math.floor(Math.random() * arr.length)]); } function assertHrtime(a) { mod_assert.ok(a[0] >= 0 && a[1] >= 0, 'negative numbers not allowed in hrtimes'); mod_assert.ok(a[1] < 1e9, 'nanoseconds column overflow'); } /* * Compute the time elapsed between hrtime readings A and B, where A is later * than B. hrtime readings come from Node's process.hrtime(). There is no * defined way to represent negative deltas, so it's illegal to diff B from A * where the time denoted by B is later than the time denoted by A. If this * becomes valuable, we can define a representation and extend the * implementation to support it. */ function hrtimeDiff(a, b) { assertHrtime(a); assertHrtime(b); mod_assert.ok(a[0] > b[0] || (a[0] == b[0] && a[1] >= b[1]), 'negative differences not allowed'); var rv = [ a[0] - b[0], 0 ]; if (a[1] >= b[1]) { rv[1] = a[1] - b[1]; } else { rv[0]--; rv[1] = 1e9 - (b[1] - a[1]); } return (rv); } /* * Convert a hrtime reading from the array format returned by Node's * process.hrtime() into a scalar number of nanoseconds. */ function hrtimeNanosec(a) { assertHrtime(a); return (Math.floor(a[0] * 1e9 + a[1])); } /* * Convert a hrtime reading from the array format returned by Node's * process.hrtime() into a scalar number of microseconds. */ function hrtimeMicrosec(a) { assertHrtime(a); return (Math.floor(a[0] * 1e6 + a[1] / 1e3)); } /* * Convert a hrtime reading from the array format returned by Node's * process.hrtime() into a scalar number of milliseconds. */ function hrtimeMillisec(a) { assertHrtime(a); return (Math.floor(a[0] * 1e3 + a[1] / 1e6)); } /* * Add two hrtime readings A and B, overwriting A with the result of the * addition. This function is useful for accumulating several hrtime intervals * into a counter. Returns A. */ function hrtimeAccum(a, b) { assertHrtime(a); assertHrtime(b); /* * Accumulate the nanosecond component. */ a[1] += b[1]; if (a[1] >= 1e9) { /* * The nanosecond component overflowed, so carry to the seconds * field. */ a[0]++; a[1] -= 1e9; } /* * Accumulate the seconds component. */ a[0] += b[0]; return (a); } /* * Add two hrtime readings A and B, returning the result as a new hrtime array. * Does not modify either input argument. */ function hrtimeAdd(a, b) { assertHrtime(a); var rv = [ a[0], a[1] ]; return (hrtimeAccum(rv, b)); } /* * Check an object for unexpected properties. Accepts the object to check, and * an array of allowed property names (strings). Returns an array of key names * that were found on the object, but did not appear in the list of allowed * properties. If no properties were found, the returned array will be of * zero length. */ function extraProperties(obj, allowed) { mod_assert.ok(typeof (obj) === 'object' && obj !== null, 'obj argument must be a non-null object'); mod_assert.ok(Array.isArray(allowed), 'allowed argument must be an array of strings'); for (var i = 0; i < allowed.length; i++) { mod_assert.ok(typeof (allowed[i]) === 'string', 'allowed argument must be an array of strings'); } return (Object.keys(obj).filter(function (key) { return (allowed.indexOf(key) === -1); })); } /* * Given three sets of properties "provided" (may be undefined), "overrides" * (required), and "defaults" (may be undefined), construct an object containing * the union of these sets with "overrides" overriding "provided", and * "provided" overriding "defaults". None of the input objects are modified. */ function mergeObjects(provided, overrides, defaults) { var rv, k; rv = {}; if (defaults) { for (k in defaults) rv[k] = defaults[k]; } if (provided) { for (k in provided) rv[k] = provided[k]; } if (overrides) { for (k in overrides) rv[k] = overrides[k]; } return (rv); } /***/ }), /***/ 349: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; /*! * Copyright (c) 2015, Salesforce.com, Inc. * All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions are met: * * 1. Redistributions of source code must retain the above copyright notice, * this list of conditions and the following disclaimer. * * 2. Redistributions in binary form must reproduce the above copyright notice, * this list of conditions and the following disclaimer in the documentation * and/or other materials provided with the distribution. * * 3. Neither the name of Salesforce.com nor the names of its contributors may * be used to endorse or promote products derived from this software without * specific prior written permission. * * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE * POSSIBILITY OF SUCH DAMAGE. */ var Store = __webpack_require__(627).Store; var permuteDomain = __webpack_require__(383).permuteDomain; var pathMatch = __webpack_require__(54).pathMatch; var util = __webpack_require__(669); function MemoryCookieStore() { Store.call(this); this.idx = {}; } util.inherits(MemoryCookieStore, Store); exports.MemoryCookieStore = MemoryCookieStore; MemoryCookieStore.prototype.idx = null; // Since it's just a struct in RAM, this Store is synchronous MemoryCookieStore.prototype.synchronous = true; // force a default depth: MemoryCookieStore.prototype.inspect = function() { return "{ idx: "+util.inspect(this.idx, false, 2)+' }'; }; // Use the new custom inspection symbol to add the custom inspect function if // available. if (util.inspect.custom) { MemoryCookieStore.prototype[util.inspect.custom] = MemoryCookieStore.prototype.inspect; } MemoryCookieStore.prototype.findCookie = function(domain, path, key, cb) { if (!this.idx[domain]) { return cb(null,undefined); } if (!this.idx[domain][path]) { return cb(null,undefined); } return cb(null,this.idx[domain][path][key]||null); }; MemoryCookieStore.prototype.findCookies = function(domain, path, cb) { var results = []; if (!domain) { return cb(null,[]); } var pathMatcher; if (!path) { // null means "all paths" pathMatcher = function matchAll(domainIndex) { for (var curPath in domainIndex) { var pathIndex = domainIndex[curPath]; for (var key in pathIndex) { results.push(pathIndex[key]); } } }; } else { pathMatcher = function matchRFC(domainIndex) { //NOTE: we should use path-match algorithm from S5.1.4 here //(see : https://github.com/ChromiumWebApps/chromium/blob/b3d3b4da8bb94c1b2e061600df106d590fda3620/net/cookies/canonical_cookie.cc#L299) Object.keys(domainIndex).forEach(function (cookiePath) { if (pathMatch(path, cookiePath)) { var pathIndex = domainIndex[cookiePath]; for (var key in pathIndex) { results.push(pathIndex[key]); } } }); }; } var domains = permuteDomain(domain) || [domain]; var idx = this.idx; domains.forEach(function(curDomain) { var domainIndex = idx[curDomain]; if (!domainIndex) { return; } pathMatcher(domainIndex); }); cb(null,results); }; MemoryCookieStore.prototype.putCookie = function(cookie, cb) { if (!this.idx[cookie.domain]) { this.idx[cookie.domain] = {}; } if (!this.idx[cookie.domain][cookie.path]) { this.idx[cookie.domain][cookie.path] = {}; } this.idx[cookie.domain][cookie.path][cookie.key] = cookie; cb(null); }; MemoryCookieStore.prototype.updateCookie = function(oldCookie, newCookie, cb) { // updateCookie() may avoid updating cookies that are identical. For example, // lastAccessed may not be important to some stores and an equality // comparison could exclude that field. this.putCookie(newCookie,cb); }; MemoryCookieStore.prototype.removeCookie = function(domain, path, key, cb) { if (this.idx[domain] && this.idx[domain][path] && this.idx[domain][path][key]) { delete this.idx[domain][path][key]; } cb(null); }; MemoryCookieStore.prototype.removeCookies = function(domain, path, cb) { if (this.idx[domain]) { if (path) { delete this.idx[domain][path]; } else { delete this.idx[domain]; } } return cb(null); }; MemoryCookieStore.prototype.removeAllCookies = function(cb) { this.idx = {}; return cb(null); } MemoryCookieStore.prototype.getAllCookies = function(cb) { var cookies = []; var idx = this.idx; var domains = Object.keys(idx); domains.forEach(function(domain) { var paths = Object.keys(idx[domain]); paths.forEach(function(path) { var keys = Object.keys(idx[domain][path]); keys.forEach(function(key) { if (key !== null) { cookies.push(idx[domain][path][key]); } }); }); }); // Sort by creationIndex so deserializing retains the creation order. // When implementing your own store, this SHOULD retain the order too cookies.sort(function(a,b) { return (a.creationIndex||0) - (b.creationIndex||0); }); cb(null, cookies); }; /***/ }), /***/ 357: /***/ (function(module) { module.exports = require("assert"); /***/ }), /***/ 362: /***/ (function(module) { // Copyright 2011 Mark Cavage All rights reserved. module.exports = { EOC: 0, Boolean: 1, Integer: 2, BitString: 3, OctetString: 4, Null: 5, OID: 6, ObjectDescriptor: 7, External: 8, Real: 9, // float Enumeration: 10, PDV: 11, Utf8String: 12, RelativeOID: 13, Sequence: 16, Set: 17, NumericString: 18, PrintableString: 19, T61String: 20, VideotexString: 21, IA5String: 22, UTCTime: 23, GeneralizedTime: 24, GraphicString: 25, VisibleString: 26, GeneralString: 28, UniversalString: 29, CharacterString: 30, BMPString: 31, Constructor: 32, Context: 128 }; /***/ }), /***/ 363: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2015 Joyent, Inc. module.exports = { Verifier: Verifier, Signer: Signer }; var nacl = __webpack_require__(196); var stream = __webpack_require__(413); var util = __webpack_require__(669); var assert = __webpack_require__(477); var Buffer = __webpack_require__(215).Buffer; var Signature = __webpack_require__(575); function Verifier(key, hashAlgo) { if (hashAlgo.toLowerCase() !== 'sha512') throw (new Error('ED25519 only supports the use of ' + 'SHA-512 hashes')); this.key = key; this.chunks = []; stream.Writable.call(this, {}); } util.inherits(Verifier, stream.Writable); Verifier.prototype._write = function (chunk, enc, cb) { this.chunks.push(chunk); cb(); }; Verifier.prototype.update = function (chunk) { if (typeof (chunk) === 'string') chunk = Buffer.from(chunk, 'binary'); this.chunks.push(chunk); }; Verifier.prototype.verify = function (signature, fmt) { var sig; if (Signature.isSignature(signature, [2, 0])) { if (signature.type !== 'ed25519') return (false); sig = signature.toBuffer('raw'); } else if (typeof (signature) === 'string') { sig = Buffer.from(signature, 'base64'); } else if (Signature.isSignature(signature, [1, 0])) { throw (new Error('signature was created by too old ' + 'a version of sshpk and cannot be verified')); } assert.buffer(sig); return (nacl.sign.detached.verify( new Uint8Array(Buffer.concat(this.chunks)), new Uint8Array(sig), new Uint8Array(this.key.part.A.data))); }; function Signer(key, hashAlgo) { if (hashAlgo.toLowerCase() !== 'sha512') throw (new Error('ED25519 only supports the use of ' + 'SHA-512 hashes')); this.key = key; this.chunks = []; stream.Writable.call(this, {}); } util.inherits(Signer, stream.Writable); Signer.prototype._write = function (chunk, enc, cb) { this.chunks.push(chunk); cb(); }; Signer.prototype.update = function (chunk) { if (typeof (chunk) === 'string') chunk = Buffer.from(chunk, 'binary'); this.chunks.push(chunk); }; Signer.prototype.sign = function () { var sig = nacl.sign.detached( new Uint8Array(Buffer.concat(this.chunks)), new Uint8Array(Buffer.concat([ this.key.part.k.data, this.key.part.A.data]))); var sigBuf = Buffer.from(sig); var sigObj = Signature.parse(sigBuf, 'ed25519', 'raw'); sigObj.hashAlgorithm = 'sha512'; return (sigObj); }; /***/ }), /***/ 374: /***/ (function(module) { "use strict"; var hasOwn = Object.prototype.hasOwnProperty; var toStr = Object.prototype.toString; var defineProperty = Object.defineProperty; var gOPD = Object.getOwnPropertyDescriptor; var isArray = function isArray(arr) { if (typeof Array.isArray === 'function') { return Array.isArray(arr); } return toStr.call(arr) === '[object Array]'; }; var isPlainObject = function isPlainObject(obj) { if (!obj || toStr.call(obj) !== '[object Object]') { return false; } var hasOwnConstructor = hasOwn.call(obj, 'constructor'); var hasIsPrototypeOf = obj.constructor && obj.constructor.prototype && hasOwn.call(obj.constructor.prototype, 'isPrototypeOf'); // Not own constructor property must be Object if (obj.constructor && !hasOwnConstructor && !hasIsPrototypeOf) { return false; } // Own properties are enumerated firstly, so to speed up, // if last one is own, then all properties are own. var key; for (key in obj) { /**/ } return typeof key === 'undefined' || hasOwn.call(obj, key); }; // If name is '__proto__', and Object.defineProperty is available, define __proto__ as an own property on target var setProperty = function setProperty(target, options) { if (defineProperty && options.name === '__proto__') { defineProperty(target, options.name, { enumerable: true, configurable: true, value: options.newValue, writable: true }); } else { target[options.name] = options.newValue; } }; // Return undefined instead of __proto__ if '__proto__' is not an own property var getProperty = function getProperty(obj, name) { if (name === '__proto__') { if (!hasOwn.call(obj, name)) { return void 0; } else if (gOPD) { // In early versions of node, obj['__proto__'] is buggy when obj has // __proto__ as an own property. Object.getOwnPropertyDescriptor() works. return gOPD(obj, name).value; } } return obj[name]; }; module.exports = function extend() { var options, name, src, copy, copyIsArray, clone; var target = arguments[0]; var i = 1; var length = arguments.length; var deep = false; // Handle a deep copy situation if (typeof target === 'boolean') { deep = target; target = arguments[1] || {}; // skip the boolean and the target i = 2; } if (target == null || (typeof target !== 'object' && typeof target !== 'function')) { target = {}; } for (; i < length; ++i) { options = arguments[i]; // Only deal with non-null/undefined values if (options != null) { // Extend the base object for (name in options) { src = getProperty(target, name); copy = getProperty(options, name); // Prevent never-ending loop if (target !== copy) { // Recurse if we're merging plain objects or arrays if (deep && copy && (isPlainObject(copy) || (copyIsArray = isArray(copy)))) { if (copyIsArray) { copyIsArray = false; clone = src && isArray(src) ? src : []; } else { clone = src && isPlainObject(src) ? src : {}; } // Never move original objects, clone them setProperty(target, { name: name, newValue: extend(deep, clone, copy) }); // Don't bring in undefined values } else if (typeof copy !== 'undefined') { setProperty(target, { name: name, newValue: copy }); } } } } } // Return the modified object return target; }; /***/ }), /***/ 378: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2017 Joyent, Inc. module.exports = Identity; var assert = __webpack_require__(477); var algs = __webpack_require__(98); var crypto = __webpack_require__(417); var Fingerprint = __webpack_require__(400); var Signature = __webpack_require__(575); var errs = __webpack_require__(753); var util = __webpack_require__(669); var utils = __webpack_require__(270); var asn1 = __webpack_require__(62); var Buffer = __webpack_require__(215).Buffer; /*JSSTYLED*/ var DNS_NAME_RE = /^([*]|[a-z0-9][a-z0-9\-]{0,62})(?:\.([*]|[a-z0-9][a-z0-9\-]{0,62}))*$/i; var oids = {}; oids.cn = '2.5.4.3'; oids.o = '2.5.4.10'; oids.ou = '2.5.4.11'; oids.l = '2.5.4.7'; oids.s = '2.5.4.8'; oids.c = '2.5.4.6'; oids.sn = '2.5.4.4'; oids.postalCode = '2.5.4.17'; oids.serialNumber = '2.5.4.5'; oids.street = '2.5.4.9'; oids.x500UniqueIdentifier = '2.5.4.45'; oids.role = '2.5.4.72'; oids.telephoneNumber = '2.5.4.20'; oids.description = '2.5.4.13'; oids.dc = '0.9.2342.19200300.100.1.25'; oids.uid = '0.9.2342.19200300.100.1.1'; oids.mail = '0.9.2342.19200300.100.1.3'; oids.title = '2.5.4.12'; oids.gn = '2.5.4.42'; oids.initials = '2.5.4.43'; oids.pseudonym = '2.5.4.65'; oids.emailAddress = '1.2.840.113549.1.9.1'; var unoids = {}; Object.keys(oids).forEach(function (k) { unoids[oids[k]] = k; }); function Identity(opts) { var self = this; assert.object(opts, 'options'); assert.arrayOfObject(opts.components, 'options.components'); this.components = opts.components; this.componentLookup = {}; this.components.forEach(function (c) { if (c.name && !c.oid) c.oid = oids[c.name]; if (c.oid && !c.name) c.name = unoids[c.oid]; if (self.componentLookup[c.name] === undefined) self.componentLookup[c.name] = []; self.componentLookup[c.name].push(c); }); if (this.componentLookup.cn && this.componentLookup.cn.length > 0) { this.cn = this.componentLookup.cn[0].value; } assert.optionalString(opts.type, 'options.type'); if (opts.type === undefined) { if (this.components.length === 1 && this.componentLookup.cn && this.componentLookup.cn.length === 1 && this.componentLookup.cn[0].value.match(DNS_NAME_RE)) { this.type = 'host'; this.hostname = this.componentLookup.cn[0].value; } else if (this.componentLookup.dc && this.components.length === this.componentLookup.dc.length) { this.type = 'host'; this.hostname = this.componentLookup.dc.map( function (c) { return (c.value); }).join('.'); } else if (this.componentLookup.uid && this.components.length === this.componentLookup.uid.length) { this.type = 'user'; this.uid = this.componentLookup.uid[0].value; } else if (this.componentLookup.cn && this.componentLookup.cn.length === 1 && this.componentLookup.cn[0].value.match(DNS_NAME_RE)) { this.type = 'host'; this.hostname = this.componentLookup.cn[0].value; } else if (this.componentLookup.uid && this.componentLookup.uid.length === 1) { this.type = 'user'; this.uid = this.componentLookup.uid[0].value; } else if (this.componentLookup.mail && this.componentLookup.mail.length === 1) { this.type = 'email'; this.email = this.componentLookup.mail[0].value; } else if (this.componentLookup.cn && this.componentLookup.cn.length === 1) { this.type = 'user'; this.uid = this.componentLookup.cn[0].value; } else { this.type = 'unknown'; } } else { this.type = opts.type; if (this.type === 'host') this.hostname = opts.hostname; else if (this.type === 'user') this.uid = opts.uid; else if (this.type === 'email') this.email = opts.email; else throw (new Error('Unknown type ' + this.type)); } } Identity.prototype.toString = function () { return (this.components.map(function (c) { var n = c.name.toUpperCase(); /*JSSTYLED*/ n = n.replace(/=/g, '\\='); var v = c.value; /*JSSTYLED*/ v = v.replace(/,/g, '\\,'); return (n + '=' + v); }).join(', ')); }; Identity.prototype.get = function (name, asArray) { assert.string(name, 'name'); var arr = this.componentLookup[name]; if (arr === undefined || arr.length === 0) return (undefined); if (!asArray && arr.length > 1) throw (new Error('Multiple values for attribute ' + name)); if (!asArray) return (arr[0].value); return (arr.map(function (c) { return (c.value); })); }; Identity.prototype.toArray = function (idx) { return (this.components.map(function (c) { return ({ name: c.name, value: c.value }); })); }; /* * These are from X.680 -- PrintableString allowed chars are in section 37.4 * table 8. Spec for IA5Strings is "1,6 + SPACE + DEL" where 1 refers to * ISO IR #001 (standard ASCII control characters) and 6 refers to ISO IR #006 * (the basic ASCII character set). */ /* JSSTYLED */ var NOT_PRINTABLE = /[^a-zA-Z0-9 '(),+.\/:=?-]/; /* JSSTYLED */ var NOT_IA5 = /[^\x00-\x7f]/; Identity.prototype.toAsn1 = function (der, tag) { der.startSequence(tag); this.components.forEach(function (c) { der.startSequence(asn1.Ber.Constructor | asn1.Ber.Set); der.startSequence(); der.writeOID(c.oid); /* * If we fit in a PrintableString, use that. Otherwise use an * IA5String or UTF8String. * * If this identity was parsed from a DN, use the ASN.1 types * from the original representation (otherwise this might not * be a full match for the original in some validators). */ if (c.asn1type === asn1.Ber.Utf8String || c.value.match(NOT_IA5)) { var v = Buffer.from(c.value, 'utf8'); der.writeBuffer(v, asn1.Ber.Utf8String); } else if (c.asn1type === asn1.Ber.IA5String || c.value.match(NOT_PRINTABLE)) { der.writeString(c.value, asn1.Ber.IA5String); } else { var type = asn1.Ber.PrintableString; if (c.asn1type !== undefined) type = c.asn1type; der.writeString(c.value, type); } der.endSequence(); der.endSequence(); }); der.endSequence(); }; function globMatch(a, b) { if (a === '**' || b === '**') return (true); var aParts = a.split('.'); var bParts = b.split('.'); if (aParts.length !== bParts.length) return (false); for (var i = 0; i < aParts.length; ++i) { if (aParts[i] === '*' || bParts[i] === '*') continue; if (aParts[i] !== bParts[i]) return (false); } return (true); } Identity.prototype.equals = function (other) { if (!Identity.isIdentity(other, [1, 0])) return (false); if (other.components.length !== this.components.length) return (false); for (var i = 0; i < this.components.length; ++i) { if (this.components[i].oid !== other.components[i].oid) return (false); if (!globMatch(this.components[i].value, other.components[i].value)) { return (false); } } return (true); }; Identity.forHost = function (hostname) { assert.string(hostname, 'hostname'); return (new Identity({ type: 'host', hostname: hostname, components: [ { name: 'cn', value: hostname } ] })); }; Identity.forUser = function (uid) { assert.string(uid, 'uid'); return (new Identity({ type: 'user', uid: uid, components: [ { name: 'uid', value: uid } ] })); }; Identity.forEmail = function (email) { assert.string(email, 'email'); return (new Identity({ type: 'email', email: email, components: [ { name: 'mail', value: email } ] })); }; Identity.parseDN = function (dn) { assert.string(dn, 'dn'); var parts = ['']; var idx = 0; var rem = dn; while (rem.length > 0) { var m; /*JSSTYLED*/ if ((m = /^,/.exec(rem)) !== null) { parts[++idx] = ''; rem = rem.slice(m[0].length); /*JSSTYLED*/ } else if ((m = /^\\,/.exec(rem)) !== null) { parts[idx] += ','; rem = rem.slice(m[0].length); /*JSSTYLED*/ } else if ((m = /^\\./.exec(rem)) !== null) { parts[idx] += m[0]; rem = rem.slice(m[0].length); /*JSSTYLED*/ } else if ((m = /^[^\\,]+/.exec(rem)) !== null) { parts[idx] += m[0]; rem = rem.slice(m[0].length); } else { throw (new Error('Failed to parse DN')); } } var cmps = parts.map(function (c) { c = c.trim(); var eqPos = c.indexOf('='); while (eqPos > 0 && c.charAt(eqPos - 1) === '\\') eqPos = c.indexOf('=', eqPos + 1); if (eqPos === -1) { throw (new Error('Failed to parse DN')); } /*JSSTYLED*/ var name = c.slice(0, eqPos).toLowerCase().replace(/\\=/g, '='); var value = c.slice(eqPos + 1); return ({ name: name, value: value }); }); return (new Identity({ components: cmps })); }; Identity.fromArray = function (components) { assert.arrayOfObject(components, 'components'); components.forEach(function (cmp) { assert.object(cmp, 'component'); assert.string(cmp.name, 'component.name'); if (!Buffer.isBuffer(cmp.value) && !(typeof (cmp.value) === 'string')) { throw (new Error('Invalid component value')); } }); return (new Identity({ components: components })); }; Identity.parseAsn1 = function (der, top) { var components = []; der.readSequence(top); var end = der.offset + der.length; while (der.offset < end) { der.readSequence(asn1.Ber.Constructor | asn1.Ber.Set); var after = der.offset + der.length; der.readSequence(); var oid = der.readOID(); var type = der.peek(); var value; switch (type) { case asn1.Ber.PrintableString: case asn1.Ber.IA5String: case asn1.Ber.OctetString: case asn1.Ber.T61String: value = der.readString(type); break; case asn1.Ber.Utf8String: value = der.readString(type, true); value = value.toString('utf8'); break; case asn1.Ber.CharacterString: case asn1.Ber.BMPString: value = der.readString(type, true); value = value.toString('utf16le'); break; default: throw (new Error('Unknown asn1 type ' + type)); } components.push({ oid: oid, asn1type: type, value: value }); der._offset = after; } der._offset = end; return (new Identity({ components: components })); }; Identity.isIdentity = function (obj, ver) { return (utils.isCompatible(obj, Identity, ver)); }; /* * API versions for Identity: * [1,0] -- initial ver */ Identity.prototype._sshpkApiVersion = [1, 0]; Identity._oldVersionDetect = function (obj) { return ([1, 0]); }; /***/ }), /***/ 380: /***/ (function(module) { module.exports = {"$id":"request.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["method","url","httpVersion","cookies","headers","queryString","headersSize","bodySize"],"properties":{"method":{"type":"string"},"url":{"type":"string","format":"uri"},"httpVersion":{"type":"string"},"cookies":{"type":"array","items":{"$ref":"cookie.json#"}},"headers":{"type":"array","items":{"$ref":"header.json#"}},"queryString":{"type":"array","items":{"$ref":"query.json#"}},"postData":{"$ref":"postData.json#"},"headersSize":{"type":"integer"},"bodySize":{"type":"integer"},"comment":{"type":"string"}}}; /***/ }), /***/ 382: /***/ (function(module, __unusedexports, __webpack_require__) { var stream = __webpack_require__(413) function isStream (obj) { return obj instanceof stream.Stream } function isReadable (obj) { return isStream(obj) && typeof obj._read == 'function' && typeof obj._readableState == 'object' } function isWritable (obj) { return isStream(obj) && typeof obj._write == 'function' && typeof obj._writableState == 'object' } function isDuplex (obj) { return isReadable(obj) && isWritable(obj) } module.exports = isStream module.exports.isReadable = isReadable module.exports.isWritable = isWritable module.exports.isDuplex = isDuplex /***/ }), /***/ 383: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; /*! * Copyright (c) 2015, Salesforce.com, Inc. * All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions are met: * * 1. Redistributions of source code must retain the above copyright notice, * this list of conditions and the following disclaimer. * * 2. Redistributions in binary form must reproduce the above copyright notice, * this list of conditions and the following disclaimer in the documentation * and/or other materials provided with the distribution. * * 3. Neither the name of Salesforce.com nor the names of its contributors may * be used to endorse or promote products derived from this software without * specific prior written permission. * * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE * POSSIBILITY OF SUCH DAMAGE. */ var pubsuffix = __webpack_require__(519); // Gives the permutation of all possible domainMatch()es of a given domain. The // array is in shortest-to-longest order. Handy for indexing. function permuteDomain (domain) { var pubSuf = pubsuffix.getPublicSuffix(domain); if (!pubSuf) { return null; } if (pubSuf == domain) { return [domain]; } var prefix = domain.slice(0, -(pubSuf.length + 1)); // ".example.com" var parts = prefix.split('.').reverse(); var cur = pubSuf; var permutations = [cur]; while (parts.length) { cur = parts.shift() + '.' + cur; permutations.push(cur); } return permutations; } exports.permuteDomain = permuteDomain; /***/ }), /***/ 386: /***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; var stringify = __webpack_require__(897); var parse = __webpack_require__(755); var formats = __webpack_require__(13); module.exports = { formats: formats, parse: parse, stringify: stringify }; /***/ }), /***/ 397: /***/ (function(module) { "use strict"; module.exports = function generate_multipleOf(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $data = 'data' + ($dataLvl || ''); var $isData = it.opts.$data && $schema && $schema.$data, $schemaValue; if ($isData) { out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; $schemaValue = 'schema' + $lvl; } else { $schemaValue = $schema; } out += 'var division' + ($lvl) + ';if ('; if ($isData) { out += ' ' + ($schemaValue) + ' !== undefined && ( typeof ' + ($schemaValue) + ' != \'number\' || '; } out += ' (division' + ($lvl) + ' = ' + ($data) + ' / ' + ($schemaValue) + ', '; if (it.opts.multipleOfPrecision) { out += ' Math.abs(Math.round(division' + ($lvl) + ') - division' + ($lvl) + ') > 1e-' + (it.opts.multipleOfPrecision) + ' '; } else { out += ' division' + ($lvl) + ' !== parseInt(division' + ($lvl) + ') '; } out += ' ) '; if ($isData) { out += ' ) '; } out += ' ) { '; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('multipleOf') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { multipleOf: ' + ($schemaValue) + ' } '; if (it.opts.messages !== false) { out += ' , message: \'should be multiple of '; if ($isData) { out += '\' + ' + ($schemaValue); } else { out += '' + ($schemaValue) + '\''; } } if (it.opts.verbose) { out += ' , schema: '; if ($isData) { out += 'validate.schema' + ($schemaPath); } else { out += '' + ($schema); } out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } out += '} '; if ($breakOnError) { out += ' else { '; } return out; } /***/ }), /***/ 400: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2018 Joyent, Inc. module.exports = Fingerprint; var assert = __webpack_require__(477); var Buffer = __webpack_require__(215).Buffer; var algs = __webpack_require__(98); var crypto = __webpack_require__(417); var errs = __webpack_require__(753); var Key = __webpack_require__(852); var PrivateKey = __webpack_require__(502); var Certificate = __webpack_require__(752); var utils = __webpack_require__(270); var FingerprintFormatError = errs.FingerprintFormatError; var InvalidAlgorithmError = errs.InvalidAlgorithmError; function Fingerprint(opts) { assert.object(opts, 'options'); assert.string(opts.type, 'options.type'); assert.buffer(opts.hash, 'options.hash'); assert.string(opts.algorithm, 'options.algorithm'); this.algorithm = opts.algorithm.toLowerCase(); if (algs.hashAlgs[this.algorithm] !== true) throw (new InvalidAlgorithmError(this.algorithm)); this.hash = opts.hash; this.type = opts.type; this.hashType = opts.hashType; } Fingerprint.prototype.toString = function (format) { if (format === undefined) { if (this.algorithm === 'md5' || this.hashType === 'spki') format = 'hex'; else format = 'base64'; } assert.string(format); switch (format) { case 'hex': if (this.hashType === 'spki') return (this.hash.toString('hex')); return (addColons(this.hash.toString('hex'))); case 'base64': if (this.hashType === 'spki') return (this.hash.toString('base64')); return (sshBase64Format(this.algorithm, this.hash.toString('base64'))); default: throw (new FingerprintFormatError(undefined, format)); } }; Fingerprint.prototype.matches = function (other) { assert.object(other, 'key or certificate'); if (this.type === 'key' && this.hashType !== 'ssh') { utils.assertCompatible(other, Key, [1, 7], 'key with spki'); if (PrivateKey.isPrivateKey(other)) { utils.assertCompatible(other, PrivateKey, [1, 6], 'privatekey with spki support'); } } else if (this.type === 'key') { utils.assertCompatible(other, Key, [1, 0], 'key'); } else { utils.assertCompatible(other, Certificate, [1, 0], 'certificate'); } var theirHash = other.hash(this.algorithm, this.hashType); var theirHash2 = crypto.createHash(this.algorithm). update(theirHash).digest('base64'); if (this.hash2 === undefined) this.hash2 = crypto.createHash(this.algorithm). update(this.hash).digest('base64'); return (this.hash2 === theirHash2); }; /*JSSTYLED*/ var base64RE = /^[A-Za-z0-9+\/=]+$/; /*JSSTYLED*/ var hexRE = /^[a-fA-F0-9]+$/; Fingerprint.parse = function (fp, options) { assert.string(fp, 'fingerprint'); var alg, hash, enAlgs; if (Array.isArray(options)) { enAlgs = options; options = {}; } assert.optionalObject(options, 'options'); if (options === undefined) options = {}; if (options.enAlgs !== undefined) enAlgs = options.enAlgs; if (options.algorithms !== undefined) enAlgs = options.algorithms; assert.optionalArrayOfString(enAlgs, 'algorithms'); var hashType = 'ssh'; if (options.hashType !== undefined) hashType = options.hashType; assert.string(hashType, 'options.hashType'); var parts = fp.split(':'); if (parts.length == 2) { alg = parts[0].toLowerCase(); if (!base64RE.test(parts[1])) throw (new FingerprintFormatError(fp)); try { hash = Buffer.from(parts[1], 'base64'); } catch (e) { throw (new FingerprintFormatError(fp)); } } else if (parts.length > 2) { alg = 'md5'; if (parts[0].toLowerCase() === 'md5') parts = parts.slice(1); parts = parts.map(function (p) { while (p.length < 2) p = '0' + p; if (p.length > 2) throw (new FingerprintFormatError(fp)); return (p); }); parts = parts.join(''); if (!hexRE.test(parts) || parts.length % 2 !== 0) throw (new FingerprintFormatError(fp)); try { hash = Buffer.from(parts, 'hex'); } catch (e) { throw (new FingerprintFormatError(fp)); } } else { if (hexRE.test(fp)) { hash = Buffer.from(fp, 'hex'); } else if (base64RE.test(fp)) { hash = Buffer.from(fp, 'base64'); } else { throw (new FingerprintFormatError(fp)); } switch (hash.length) { case 32: alg = 'sha256'; break; case 16: alg = 'md5'; break; case 20: alg = 'sha1'; break; case 64: alg = 'sha512'; break; default: throw (new FingerprintFormatError(fp)); } /* Plain hex/base64: guess it's probably SPKI unless told. */ if (options.hashType === undefined) hashType = 'spki'; } if (alg === undefined) throw (new FingerprintFormatError(fp)); if (algs.hashAlgs[alg] === undefined) throw (new InvalidAlgorithmError(alg)); if (enAlgs !== undefined) { enAlgs = enAlgs.map(function (a) { return a.toLowerCase(); }); if (enAlgs.indexOf(alg) === -1) throw (new InvalidAlgorithmError(alg)); } return (new Fingerprint({ algorithm: alg, hash: hash, type: options.type || 'key', hashType: hashType })); }; function addColons(s) { /*JSSTYLED*/ return (s.replace(/(.{2})(?=.)/g, '$1:')); } function base64Strip(s) { /*JSSTYLED*/ return (s.replace(/=*$/, '')); } function sshBase64Format(alg, h) { return (alg.toUpperCase() + ':' + base64Strip(h)); } Fingerprint.isFingerprint = function (obj, ver) { return (utils.isCompatible(obj, Fingerprint, ver)); }; /* * API versions for Fingerprint: * [1,0] -- initial ver * [1,1] -- first tagged ver * [1,2] -- hashType and spki support */ Fingerprint.prototype._sshpkApiVersion = [1, 2]; Fingerprint._oldVersionDetect = function (obj) { assert.func(obj.toString); assert.func(obj.matches); return ([1, 0]); }; /***/ }), /***/ 413: /***/ (function(module) { module.exports = require("stream"); /***/ }), /***/ 416: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; var fs = __webpack_require__(747) var qs = __webpack_require__(191) var validate = __webpack_require__(846) var extend = __webpack_require__(374) function Har (request) { this.request = request } Har.prototype.reducer = function (obj, pair) { // new property ? if (obj[pair.name] === undefined) { obj[pair.name] = pair.value return obj } // existing? convert to array var arr = [ obj[pair.name], pair.value ] obj[pair.name] = arr return obj } Har.prototype.prep = function (data) { // construct utility properties data.queryObj = {} data.headersObj = {} data.postData.jsonObj = false data.postData.paramsObj = false // construct query objects if (data.queryString && data.queryString.length) { data.queryObj = data.queryString.reduce(this.reducer, {}) } // construct headers objects if (data.headers && data.headers.length) { // loweCase header keys data.headersObj = data.headers.reduceRight(function (headers, header) { headers[header.name] = header.value return headers }, {}) } // construct Cookie header if (data.cookies && data.cookies.length) { var cookies = data.cookies.map(function (cookie) { return cookie.name + '=' + cookie.value }) if (cookies.length) { data.headersObj.cookie = cookies.join('; ') } } // prep body function some (arr) { return arr.some(function (type) { return data.postData.mimeType.indexOf(type) === 0 }) } if (some([ 'multipart/mixed', 'multipart/related', 'multipart/form-data', 'multipart/alternative'])) { // reset values data.postData.mimeType = 'multipart/form-data' } else if (some([ 'application/x-www-form-urlencoded'])) { if (!data.postData.params) { data.postData.text = '' } else { data.postData.paramsObj = data.postData.params.reduce(this.reducer, {}) // always overwrite data.postData.text = qs.stringify(data.postData.paramsObj) } } else if (some([ 'text/json', 'text/x-json', 'application/json', 'application/x-json'])) { data.postData.mimeType = 'application/json' if (data.postData.text) { try { data.postData.jsonObj = JSON.parse(data.postData.text) } catch (e) { this.request.debug(e) // force back to text/plain data.postData.mimeType = 'text/plain' } } } return data } Har.prototype.options = function (options) { // skip if no har property defined if (!options.har) { return options } var har = {} extend(har, options.har) // only process the first entry if (har.log && har.log.entries) { har = har.log.entries[0] } // add optional properties to make validation successful har.url = har.url || options.url || options.uri || options.baseUrl || '/' har.httpVersion = har.httpVersion || 'HTTP/1.1' har.queryString = har.queryString || [] har.headers = har.headers || [] har.cookies = har.cookies || [] har.postData = har.postData || {} har.postData.mimeType = har.postData.mimeType || 'application/octet-stream' har.bodySize = 0 har.headersSize = 0 har.postData.size = 0 if (!validate.request(har)) { return options } // clean up and get some utility properties var req = this.prep(har) // construct new options if (req.url) { options.url = req.url } if (req.method) { options.method = req.method } if (Object.keys(req.queryObj).length) { options.qs = req.queryObj } if (Object.keys(req.headersObj).length) { options.headers = req.headersObj } function test (type) { return req.postData.mimeType.indexOf(type) === 0 } if (test('application/x-www-form-urlencoded')) { options.form = req.postData.paramsObj } else if (test('application/json')) { if (req.postData.jsonObj) { options.body = req.postData.jsonObj options.json = true } } else if (test('multipart/form-data')) { options.formData = {} req.postData.params.forEach(function (param) { var attachment = {} if (!param.fileName && !param.contentType) { options.formData[param.name] = param.value return } // attempt to read from disk! if (param.fileName && !param.value) { attachment.value = fs.createReadStream(param.fileName) } else if (param.value) { attachment.value = param.value } if (param.fileName) { attachment.options = { filename: param.fileName, contentType: param.contentType ? param.contentType : null } } options.formData[param.name] = attachment }) } else { if (req.postData.text) { options.body = req.postData.text } } return options } exports.Har = Har /***/ }), /***/ 417: /***/ (function(module) { module.exports = require("crypto"); /***/ }), /***/ 424: /***/ (function(module, __unusedexports, __webpack_require__) { var iterate = __webpack_require__(157) , initState = __webpack_require__(147) , terminator = __webpack_require__(939) ; // Public API module.exports = parallel; /** * Runs iterator over provided array elements in parallel * * @param {array|object} list - array or object (named list) to iterate over * @param {function} iterator - iterator to run * @param {function} callback - invoked when all elements processed * @returns {function} - jobs terminator */ function parallel(list, iterator, callback) { var state = initState(list); while (state.index < (state['keyedList'] || list).length) { iterate(list, iterator, state, function(error, result) { if (error) { callback(error, result); return; } // looks like it's the last one if (Object.keys(state.jobs).length === 0) { callback(null, state.results); return; } }); state.index++; } return terminator.bind(state, callback); } /***/ }), /***/ 428: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2015 Joyent, Inc. var assert = __webpack_require__(477); var crypto = __webpack_require__(417); var sshpk = __webpack_require__(650); var utils = __webpack_require__(909); var HASH_ALGOS = utils.HASH_ALGOS; var PK_ALGOS = utils.PK_ALGOS; var InvalidAlgorithmError = utils.InvalidAlgorithmError; var HttpSignatureError = utils.HttpSignatureError; var validateAlgorithm = utils.validateAlgorithm; ///--- Exported API module.exports = { /** * Verify RSA/DSA signature against public key. You are expected to pass in * an object that was returned from `parse()`. * * @param {Object} parsedSignature the object you got from `parse`. * @param {String} pubkey RSA/DSA private key PEM. * @return {Boolean} true if valid, false otherwise. * @throws {TypeError} if you pass in bad arguments. * @throws {InvalidAlgorithmError} */ verifySignature: function verifySignature(parsedSignature, pubkey) { assert.object(parsedSignature, 'parsedSignature'); if (typeof (pubkey) === 'string' || Buffer.isBuffer(pubkey)) pubkey = sshpk.parseKey(pubkey); assert.ok(sshpk.Key.isKey(pubkey, [1, 1]), 'pubkey must be a sshpk.Key'); var alg = validateAlgorithm(parsedSignature.algorithm); if (alg[0] === 'hmac' || alg[0] !== pubkey.type) return (false); var v = pubkey.createVerify(alg[1]); v.update(parsedSignature.signingString); return (v.verify(parsedSignature.params.signature, 'base64')); }, /** * Verify HMAC against shared secret. You are expected to pass in an object * that was returned from `parse()`. * * @param {Object} parsedSignature the object you got from `parse`. * @param {String} secret HMAC shared secret. * @return {Boolean} true if valid, false otherwise. * @throws {TypeError} if you pass in bad arguments. * @throws {InvalidAlgorithmError} */ verifyHMAC: function verifyHMAC(parsedSignature, secret) { assert.object(parsedSignature, 'parsedHMAC'); assert.string(secret, 'secret'); var alg = validateAlgorithm(parsedSignature.algorithm); if (alg[0] !== 'hmac') return (false); var hashAlg = alg[1].toUpperCase(); var hmac = crypto.createHmac(hashAlg, secret); hmac.update(parsedSignature.signingString); /* * Now double-hash to avoid leaking timing information - there's * no easy constant-time compare in JS, so we use this approach * instead. See for more info: * https://www.isecpartners.com/blog/2011/february/double-hmac- * verification.aspx */ var h1 = crypto.createHmac(hashAlg, secret); h1.update(hmac.digest()); h1 = h1.digest(); var h2 = crypto.createHmac(hashAlg, secret); h2.update(new Buffer(parsedSignature.params.signature, 'base64')); h2 = h2.digest(); /* Node 0.8 returns strings from .digest(). */ if (typeof (h1) === 'string') return (h1 === h2); /* And node 0.10 lacks the .equals() method on Buffers. */ if (Buffer.isBuffer(h1) && !h1.equals) return (h1.toString('binary') === h2.toString('binary')); return (h1.equals(h2)); } }; /***/ }), /***/ 431: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; var __importStar = (this && this.__importStar) || function (mod) { if (mod && mod.__esModule) return mod; var result = {}; if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k]; result["default"] = mod; return result; }; Object.defineProperty(exports, "__esModule", { value: true }); const os = __importStar(__webpack_require__(87)); /** * Commands * * Command Format: * ::name key=value,key=value::message * * Examples: * ::warning::This is the message * ::set-env name=MY_VAR::some value */ function issueCommand(command, properties, message) { const cmd = new Command(command, properties, message); process.stdout.write(cmd.toString() + os.EOL); } exports.issueCommand = issueCommand; function issue(name, message = '') { issueCommand(name, {}, message); } exports.issue = issue; const CMD_STRING = '::'; class Command { constructor(command, properties, message) { if (!command) { command = 'missing.command'; } this.command = command; this.properties = properties; this.message = message; } toString() { let cmdStr = CMD_STRING + this.command; if (this.properties && Object.keys(this.properties).length > 0) { cmdStr += ' '; let first = true; for (const key in this.properties) { if (this.properties.hasOwnProperty(key)) { const val = this.properties[key]; if (val) { if (first) { first = false; } else { cmdStr += ','; } cmdStr += `${key}=${escapeProperty(val)}`; } } } } cmdStr += `${CMD_STRING}${escapeData(this.message)}`; return cmdStr; } } function escapeData(s) { return (s || '') .replace(/%/g, '%25') .replace(/\r/g, '%0D') .replace(/\n/g, '%0A'); } function escapeProperty(s) { return (s || '') .replace(/%/g, '%25') .replace(/\r/g, '%0D') .replace(/\n/g, '%0A') .replace(/:/g, '%3A') .replace(/,/g, '%2C'); } //# sourceMappingURL=command.js.map /***/ }), /***/ 449: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2015 Joyent, Inc. module.exports = { read: read, readPkcs1: readPkcs1, write: write, writePkcs1: writePkcs1 }; var assert = __webpack_require__(477); var asn1 = __webpack_require__(62); var Buffer = __webpack_require__(215).Buffer; var algs = __webpack_require__(98); var utils = __webpack_require__(270); var Key = __webpack_require__(852); var PrivateKey = __webpack_require__(502); var pem = __webpack_require__(268); var pkcs8 = __webpack_require__(707); var readECDSACurve = pkcs8.readECDSACurve; function read(buf, options) { return (pem.read(buf, options, 'pkcs1')); } function write(key, options) { return (pem.write(key, options, 'pkcs1')); } /* Helper to read in a single mpint */ function readMPInt(der, nm) { assert.strictEqual(der.peek(), asn1.Ber.Integer, nm + ' is not an Integer'); return (utils.mpNormalize(der.readString(asn1.Ber.Integer, true))); } function readPkcs1(alg, type, der) { switch (alg) { case 'RSA': if (type === 'public') return (readPkcs1RSAPublic(der)); else if (type === 'private') return (readPkcs1RSAPrivate(der)); throw (new Error('Unknown key type: ' + type)); case 'DSA': if (type === 'public') return (readPkcs1DSAPublic(der)); else if (type === 'private') return (readPkcs1DSAPrivate(der)); throw (new Error('Unknown key type: ' + type)); case 'EC': case 'ECDSA': if (type === 'private') return (readPkcs1ECDSAPrivate(der)); else if (type === 'public') return (readPkcs1ECDSAPublic(der)); throw (new Error('Unknown key type: ' + type)); case 'EDDSA': case 'EdDSA': if (type === 'private') return (readPkcs1EdDSAPrivate(der)); throw (new Error(type + ' keys not supported with EdDSA')); default: throw (new Error('Unknown key algo: ' + alg)); } } function readPkcs1RSAPublic(der) { // modulus and exponent var n = readMPInt(der, 'modulus'); var e = readMPInt(der, 'exponent'); // now, make the key var key = { type: 'rsa', parts: [ { name: 'e', data: e }, { name: 'n', data: n } ] }; return (new Key(key)); } function readPkcs1RSAPrivate(der) { var version = readMPInt(der, 'version'); assert.strictEqual(version[0], 0); // modulus then public exponent var n = readMPInt(der, 'modulus'); var e = readMPInt(der, 'public exponent'); var d = readMPInt(der, 'private exponent'); var p = readMPInt(der, 'prime1'); var q = readMPInt(der, 'prime2'); var dmodp = readMPInt(der, 'exponent1'); var dmodq = readMPInt(der, 'exponent2'); var iqmp = readMPInt(der, 'iqmp'); // now, make the key var key = { type: 'rsa', parts: [ { name: 'n', data: n }, { name: 'e', data: e }, { name: 'd', data: d }, { name: 'iqmp', data: iqmp }, { name: 'p', data: p }, { name: 'q', data: q }, { name: 'dmodp', data: dmodp }, { name: 'dmodq', data: dmodq } ] }; return (new PrivateKey(key)); } function readPkcs1DSAPrivate(der) { var version = readMPInt(der, 'version'); assert.strictEqual(version.readUInt8(0), 0); var p = readMPInt(der, 'p'); var q = readMPInt(der, 'q'); var g = readMPInt(der, 'g'); var y = readMPInt(der, 'y'); var x = readMPInt(der, 'x'); // now, make the key var key = { type: 'dsa', parts: [ { name: 'p', data: p }, { name: 'q', data: q }, { name: 'g', data: g }, { name: 'y', data: y }, { name: 'x', data: x } ] }; return (new PrivateKey(key)); } function readPkcs1EdDSAPrivate(der) { var version = readMPInt(der, 'version'); assert.strictEqual(version.readUInt8(0), 1); // private key var k = der.readString(asn1.Ber.OctetString, true); der.readSequence(0xa0); var oid = der.readOID(); assert.strictEqual(oid, '1.3.101.112', 'the ed25519 curve identifier'); der.readSequence(0xa1); var A = utils.readBitString(der); var key = { type: 'ed25519', parts: [ { name: 'A', data: utils.zeroPadToLength(A, 32) }, { name: 'k', data: k } ] }; return (new PrivateKey(key)); } function readPkcs1DSAPublic(der) { var y = readMPInt(der, 'y'); var p = readMPInt(der, 'p'); var q = readMPInt(der, 'q'); var g = readMPInt(der, 'g'); var key = { type: 'dsa', parts: [ { name: 'y', data: y }, { name: 'p', data: p }, { name: 'q', data: q }, { name: 'g', data: g } ] }; return (new Key(key)); } function readPkcs1ECDSAPublic(der) { der.readSequence(); var oid = der.readOID(); assert.strictEqual(oid, '1.2.840.10045.2.1', 'must be ecPublicKey'); var curveOid = der.readOID(); var curve; var curves = Object.keys(algs.curves); for (var j = 0; j < curves.length; ++j) { var c = curves[j]; var cd = algs.curves[c]; if (cd.pkcs8oid === curveOid) { curve = c; break; } } assert.string(curve, 'a known ECDSA named curve'); var Q = der.readString(asn1.Ber.BitString, true); Q = utils.ecNormalize(Q); var key = { type: 'ecdsa', parts: [ { name: 'curve', data: Buffer.from(curve) }, { name: 'Q', data: Q } ] }; return (new Key(key)); } function readPkcs1ECDSAPrivate(der) { var version = readMPInt(der, 'version'); assert.strictEqual(version.readUInt8(0), 1); // private key var d = der.readString(asn1.Ber.OctetString, true); der.readSequence(0xa0); var curve = readECDSACurve(der); assert.string(curve, 'a known elliptic curve'); der.readSequence(0xa1); var Q = der.readString(asn1.Ber.BitString, true); Q = utils.ecNormalize(Q); var key = { type: 'ecdsa', parts: [ { name: 'curve', data: Buffer.from(curve) }, { name: 'Q', data: Q }, { name: 'd', data: d } ] }; return (new PrivateKey(key)); } function writePkcs1(der, key) { der.startSequence(); switch (key.type) { case 'rsa': if (PrivateKey.isPrivateKey(key)) writePkcs1RSAPrivate(der, key); else writePkcs1RSAPublic(der, key); break; case 'dsa': if (PrivateKey.isPrivateKey(key)) writePkcs1DSAPrivate(der, key); else writePkcs1DSAPublic(der, key); break; case 'ecdsa': if (PrivateKey.isPrivateKey(key)) writePkcs1ECDSAPrivate(der, key); else writePkcs1ECDSAPublic(der, key); break; case 'ed25519': if (PrivateKey.isPrivateKey(key)) writePkcs1EdDSAPrivate(der, key); else writePkcs1EdDSAPublic(der, key); break; default: throw (new Error('Unknown key algo: ' + key.type)); } der.endSequence(); } function writePkcs1RSAPublic(der, key) { der.writeBuffer(key.part.n.data, asn1.Ber.Integer); der.writeBuffer(key.part.e.data, asn1.Ber.Integer); } function writePkcs1RSAPrivate(der, key) { var ver = Buffer.from([0]); der.writeBuffer(ver, asn1.Ber.Integer); der.writeBuffer(key.part.n.data, asn1.Ber.Integer); der.writeBuffer(key.part.e.data, asn1.Ber.Integer); der.writeBuffer(key.part.d.data, asn1.Ber.Integer); der.writeBuffer(key.part.p.data, asn1.Ber.Integer); der.writeBuffer(key.part.q.data, asn1.Ber.Integer); if (!key.part.dmodp || !key.part.dmodq) utils.addRSAMissing(key); der.writeBuffer(key.part.dmodp.data, asn1.Ber.Integer); der.writeBuffer(key.part.dmodq.data, asn1.Ber.Integer); der.writeBuffer(key.part.iqmp.data, asn1.Ber.Integer); } function writePkcs1DSAPrivate(der, key) { var ver = Buffer.from([0]); der.writeBuffer(ver, asn1.Ber.Integer); der.writeBuffer(key.part.p.data, asn1.Ber.Integer); der.writeBuffer(key.part.q.data, asn1.Ber.Integer); der.writeBuffer(key.part.g.data, asn1.Ber.Integer); der.writeBuffer(key.part.y.data, asn1.Ber.Integer); der.writeBuffer(key.part.x.data, asn1.Ber.Integer); } function writePkcs1DSAPublic(der, key) { der.writeBuffer(key.part.y.data, asn1.Ber.Integer); der.writeBuffer(key.part.p.data, asn1.Ber.Integer); der.writeBuffer(key.part.q.data, asn1.Ber.Integer); der.writeBuffer(key.part.g.data, asn1.Ber.Integer); } function writePkcs1ECDSAPublic(der, key) { der.startSequence(); der.writeOID('1.2.840.10045.2.1'); /* ecPublicKey */ var curve = key.part.curve.data.toString(); var curveOid = algs.curves[curve].pkcs8oid; assert.string(curveOid, 'a known ECDSA named curve'); der.writeOID(curveOid); der.endSequence(); var Q = utils.ecNormalize(key.part.Q.data, true); der.writeBuffer(Q, asn1.Ber.BitString); } function writePkcs1ECDSAPrivate(der, key) { var ver = Buffer.from([1]); der.writeBuffer(ver, asn1.Ber.Integer); der.writeBuffer(key.part.d.data, asn1.Ber.OctetString); der.startSequence(0xa0); var curve = key.part.curve.data.toString(); var curveOid = algs.curves[curve].pkcs8oid; assert.string(curveOid, 'a known ECDSA named curve'); der.writeOID(curveOid); der.endSequence(); der.startSequence(0xa1); var Q = utils.ecNormalize(key.part.Q.data, true); der.writeBuffer(Q, asn1.Ber.BitString); der.endSequence(); } function writePkcs1EdDSAPrivate(der, key) { var ver = Buffer.from([1]); der.writeBuffer(ver, asn1.Ber.Integer); der.writeBuffer(key.part.k.data, asn1.Ber.OctetString); der.startSequence(0xa0); der.writeOID('1.3.101.112'); der.endSequence(); der.startSequence(0xa1); utils.writeBitString(der, key.part.A.data); der.endSequence(); } function writePkcs1EdDSAPublic(der, key) { throw (new Error('Public keys are not supported for EdDSA PKCS#1')); } /***/ }), /***/ 455: /***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; var http = __webpack_require__(605) var https = __webpack_require__(211) var url = __webpack_require__(835) var util = __webpack_require__(669) var stream = __webpack_require__(413) var zlib = __webpack_require__(761) var aws2 = __webpack_require__(942) var aws4 = __webpack_require__(658) var httpSignature = __webpack_require__(789) var mime = __webpack_require__(779) var caseless = __webpack_require__(254) var ForeverAgent = __webpack_require__(792) var FormData = __webpack_require__(928) var extend = __webpack_require__(374) var isstream = __webpack_require__(382) var isTypedArray = __webpack_require__(944).strict var helpers = __webpack_require__(810) var cookies = __webpack_require__(602) var getProxyFromURI = __webpack_require__(721) var Querystring = __webpack_require__(629).Querystring var Har = __webpack_require__(416).Har var Auth = __webpack_require__(554).Auth var OAuth = __webpack_require__(287).OAuth var hawk = __webpack_require__(964) var Multipart = __webpack_require__(469).Multipart var Redirect = __webpack_require__(552).Redirect var Tunnel = __webpack_require__(461).Tunnel var now = __webpack_require__(742) var Buffer = __webpack_require__(149).Buffer var safeStringify = helpers.safeStringify var isReadStream = helpers.isReadStream var toBase64 = helpers.toBase64 var defer = helpers.defer var copy = helpers.copy var version = helpers.version var globalCookieJar = cookies.jar() var globalPool = {} function filterForNonReserved (reserved, options) { // Filter out properties that are not reserved. // Reserved values are passed in at call site. var object = {} for (var i in options) { var notReserved = (reserved.indexOf(i) === -1) if (notReserved) { object[i] = options[i] } } return object } function filterOutReservedFunctions (reserved, options) { // Filter out properties that are functions and are reserved. // Reserved values are passed in at call site. var object = {} for (var i in options) { var isReserved = !(reserved.indexOf(i) === -1) var isFunction = (typeof options[i] === 'function') if (!(isReserved && isFunction)) { object[i] = options[i] } } return object } // Return a simpler request object to allow serialization function requestToJSON () { var self = this return { uri: self.uri, method: self.method, headers: self.headers } } // Return a simpler response object to allow serialization function responseToJSON () { var self = this return { statusCode: self.statusCode, body: self.body, headers: self.headers, request: requestToJSON.call(self.request) } } function Request (options) { // if given the method property in options, set property explicitMethod to true // extend the Request instance with any non-reserved properties // remove any reserved functions from the options object // set Request instance to be readable and writable // call init var self = this // start with HAR, then override with additional options if (options.har) { self._har = new Har(self) options = self._har.options(options) } stream.Stream.call(self) var reserved = Object.keys(Request.prototype) var nonReserved = filterForNonReserved(reserved, options) extend(self, nonReserved) options = filterOutReservedFunctions(reserved, options) self.readable = true self.writable = true if (options.method) { self.explicitMethod = true } self._qs = new Querystring(self) self._auth = new Auth(self) self._oauth = new OAuth(self) self._multipart = new Multipart(self) self._redirect = new Redirect(self) self._tunnel = new Tunnel(self) self.init(options) } util.inherits(Request, stream.Stream) // Debugging Request.debug = process.env.NODE_DEBUG && /\brequest\b/.test(process.env.NODE_DEBUG) function debug () { if (Request.debug) { console.error('REQUEST %s', util.format.apply(util, arguments)) } } Request.prototype.debug = debug Request.prototype.init = function (options) { // init() contains all the code to setup the request object. // the actual outgoing request is not started until start() is called // this function is called from both the constructor and on redirect. var self = this if (!options) { options = {} } self.headers = self.headers ? copy(self.headers) : {} // Delete headers with value undefined since they break // ClientRequest.OutgoingMessage.setHeader in node 0.12 for (var headerName in self.headers) { if (typeof self.headers[headerName] === 'undefined') { delete self.headers[headerName] } } caseless.httpify(self, self.headers) if (!self.method) { self.method = options.method || 'GET' } if (!self.localAddress) { self.localAddress = options.localAddress } self._qs.init(options) debug(options) if (!self.pool && self.pool !== false) { self.pool = globalPool } self.dests = self.dests || [] self.__isRequestRequest = true // Protect against double callback if (!self._callback && self.callback) { self._callback = self.callback self.callback = function () { if (self._callbackCalled) { return // Print a warning maybe? } self._callbackCalled = true self._callback.apply(self, arguments) } self.on('error', self.callback.bind()) self.on('complete', self.callback.bind(self, null)) } // People use this property instead all the time, so support it if (!self.uri && self.url) { self.uri = self.url delete self.url } // If there's a baseUrl, then use it as the base URL (i.e. uri must be // specified as a relative path and is appended to baseUrl). if (self.baseUrl) { if (typeof self.baseUrl !== 'string') { return self.emit('error', new Error('options.baseUrl must be a string')) } if (typeof self.uri !== 'string') { return self.emit('error', new Error('options.uri must be a string when using options.baseUrl')) } if (self.uri.indexOf('//') === 0 || self.uri.indexOf('://') !== -1) { return self.emit('error', new Error('options.uri must be a path when using options.baseUrl')) } // Handle all cases to make sure that there's only one slash between // baseUrl and uri. var baseUrlEndsWithSlash = self.baseUrl.lastIndexOf('/') === self.baseUrl.length - 1 var uriStartsWithSlash = self.uri.indexOf('/') === 0 if (baseUrlEndsWithSlash && uriStartsWithSlash) { self.uri = self.baseUrl + self.uri.slice(1) } else if (baseUrlEndsWithSlash || uriStartsWithSlash) { self.uri = self.baseUrl + self.uri } else if (self.uri === '') { self.uri = self.baseUrl } else { self.uri = self.baseUrl + '/' + self.uri } delete self.baseUrl } // A URI is needed by this point, emit error if we haven't been able to get one if (!self.uri) { return self.emit('error', new Error('options.uri is a required argument')) } // If a string URI/URL was given, parse it into a URL object if (typeof self.uri === 'string') { self.uri = url.parse(self.uri) } // Some URL objects are not from a URL parsed string and need href added if (!self.uri.href) { self.uri.href = url.format(self.uri) } // DEPRECATED: Warning for users of the old Unix Sockets URL Scheme if (self.uri.protocol === 'unix:') { return self.emit('error', new Error('`unix://` URL scheme is no longer supported. Please use the format `http://unix:SOCKET:PATH`')) } // Support Unix Sockets if (self.uri.host === 'unix') { self.enableUnixSocket() } if (self.strictSSL === false) { self.rejectUnauthorized = false } if (!self.uri.pathname) { self.uri.pathname = '/' } if (!(self.uri.host || (self.uri.hostname && self.uri.port)) && !self.uri.isUnix) { // Invalid URI: it may generate lot of bad errors, like 'TypeError: Cannot call method `indexOf` of undefined' in CookieJar // Detect and reject it as soon as possible var faultyUri = url.format(self.uri) var message = 'Invalid URI "' + faultyUri + '"' if (Object.keys(options).length === 0) { // No option ? This can be the sign of a redirect // As this is a case where the user cannot do anything (they didn't call request directly with this URL) // they should be warned that it can be caused by a redirection (can save some hair) message += '. This can be caused by a crappy redirection.' } // This error was fatal self.abort() return self.emit('error', new Error(message)) } if (!self.hasOwnProperty('proxy')) { self.proxy = getProxyFromURI(self.uri) } self.tunnel = self._tunnel.isEnabled() if (self.proxy) { self._tunnel.setup(options) } self._redirect.onRequest(options) self.setHost = false if (!self.hasHeader('host')) { var hostHeaderName = self.originalHostHeaderName || 'host' self.setHeader(hostHeaderName, self.uri.host) // Drop :port suffix from Host header if known protocol. if (self.uri.port) { if ((self.uri.port === '80' && self.uri.protocol === 'http:') || (self.uri.port === '443' && self.uri.protocol === 'https:')) { self.setHeader(hostHeaderName, self.uri.hostname) } } self.setHost = true } self.jar(self._jar || options.jar) if (!self.uri.port) { if (self.uri.protocol === 'http:') { self.uri.port = 80 } else if (self.uri.protocol === 'https:') { self.uri.port = 443 } } if (self.proxy && !self.tunnel) { self.port = self.proxy.port self.host = self.proxy.hostname } else { self.port = self.uri.port self.host = self.uri.hostname } if (options.form) { self.form(options.form) } if (options.formData) { var formData = options.formData var requestForm = self.form() var appendFormValue = function (key, value) { if (value && value.hasOwnProperty('value') && value.hasOwnProperty('options')) { requestForm.append(key, value.value, value.options) } else { requestForm.append(key, value) } } for (var formKey in formData) { if (formData.hasOwnProperty(formKey)) { var formValue = formData[formKey] if (formValue instanceof Array) { for (var j = 0; j < formValue.length; j++) { appendFormValue(formKey, formValue[j]) } } else { appendFormValue(formKey, formValue) } } } } if (options.qs) { self.qs(options.qs) } if (self.uri.path) { self.path = self.uri.path } else { self.path = self.uri.pathname + (self.uri.search || '') } if (self.path.length === 0) { self.path = '/' } // Auth must happen last in case signing is dependent on other headers if (options.aws) { self.aws(options.aws) } if (options.hawk) { self.hawk(options.hawk) } if (options.httpSignature) { self.httpSignature(options.httpSignature) } if (options.auth) { if (Object.prototype.hasOwnProperty.call(options.auth, 'username')) { options.auth.user = options.auth.username } if (Object.prototype.hasOwnProperty.call(options.auth, 'password')) { options.auth.pass = options.auth.password } self.auth( options.auth.user, options.auth.pass, options.auth.sendImmediately, options.auth.bearer ) } if (self.gzip && !self.hasHeader('accept-encoding')) { self.setHeader('accept-encoding', 'gzip, deflate') } if (self.uri.auth && !self.hasHeader('authorization')) { var uriAuthPieces = self.uri.auth.split(':').map(function (item) { return self._qs.unescape(item) }) self.auth(uriAuthPieces[0], uriAuthPieces.slice(1).join(':'), true) } if (!self.tunnel && self.proxy && self.proxy.auth && !self.hasHeader('proxy-authorization')) { var proxyAuthPieces = self.proxy.auth.split(':').map(function (item) { return self._qs.unescape(item) }) var authHeader = 'Basic ' + toBase64(proxyAuthPieces.join(':')) self.setHeader('proxy-authorization', authHeader) } if (self.proxy && !self.tunnel) { self.path = (self.uri.protocol + '//' + self.uri.host + self.path) } if (options.json) { self.json(options.json) } if (options.multipart) { self.multipart(options.multipart) } if (options.time) { self.timing = true // NOTE: elapsedTime is deprecated in favor of .timings self.elapsedTime = self.elapsedTime || 0 } function setContentLength () { if (isTypedArray(self.body)) { self.body = Buffer.from(self.body) } if (!self.hasHeader('content-length')) { var length if (typeof self.body === 'string') { length = Buffer.byteLength(self.body) } else if (Array.isArray(self.body)) { length = self.body.reduce(function (a, b) { return a + b.length }, 0) } else { length = self.body.length } if (length) { self.setHeader('content-length', length) } else { self.emit('error', new Error('Argument error, options.body.')) } } } if (self.body && !isstream(self.body)) { setContentLength() } if (options.oauth) { self.oauth(options.oauth) } else if (self._oauth.params && self.hasHeader('authorization')) { self.oauth(self._oauth.params) } var protocol = self.proxy && !self.tunnel ? self.proxy.protocol : self.uri.protocol var defaultModules = {'http:': http, 'https:': https} var httpModules = self.httpModules || {} self.httpModule = httpModules[protocol] || defaultModules[protocol] if (!self.httpModule) { return self.emit('error', new Error('Invalid protocol: ' + protocol)) } if (options.ca) { self.ca = options.ca } if (!self.agent) { if (options.agentOptions) { self.agentOptions = options.agentOptions } if (options.agentClass) { self.agentClass = options.agentClass } else if (options.forever) { var v = version() // use ForeverAgent in node 0.10- only if (v.major === 0 && v.minor <= 10) { self.agentClass = protocol === 'http:' ? ForeverAgent : ForeverAgent.SSL } else { self.agentClass = self.httpModule.Agent self.agentOptions = self.agentOptions || {} self.agentOptions.keepAlive = true } } else { self.agentClass = self.httpModule.Agent } } if (self.pool === false) { self.agent = false } else { self.agent = self.agent || self.getNewAgent() } self.on('pipe', function (src) { if (self.ntick && self._started) { self.emit('error', new Error('You cannot pipe to this stream after the outbound request has started.')) } self.src = src if (isReadStream(src)) { if (!self.hasHeader('content-type')) { self.setHeader('content-type', mime.lookup(src.path)) } } else { if (src.headers) { for (var i in src.headers) { if (!self.hasHeader(i)) { self.setHeader(i, src.headers[i]) } } } if (self._json && !self.hasHeader('content-type')) { self.setHeader('content-type', 'application/json') } if (src.method && !self.explicitMethod) { self.method = src.method } } // self.on('pipe', function () { // console.error('You have already piped to this stream. Pipeing twice is likely to break the request.') // }) }) defer(function () { if (self._aborted) { return } var end = function () { if (self._form) { if (!self._auth.hasAuth) { self._form.pipe(self) } else if (self._auth.hasAuth && self._auth.sentAuth) { self._form.pipe(self) } } if (self._multipart && self._multipart.chunked) { self._multipart.body.pipe(self) } if (self.body) { if (isstream(self.body)) { self.body.pipe(self) } else { setContentLength() if (Array.isArray(self.body)) { self.body.forEach(function (part) { self.write(part) }) } else { self.write(self.body) } self.end() } } else if (self.requestBodyStream) { console.warn('options.requestBodyStream is deprecated, please pass the request object to stream.pipe.') self.requestBodyStream.pipe(self) } else if (!self.src) { if (self._auth.hasAuth && !self._auth.sentAuth) { self.end() return } if (self.method !== 'GET' && typeof self.method !== 'undefined') { self.setHeader('content-length', 0) } self.end() } } if (self._form && !self.hasHeader('content-length')) { // Before ending the request, we had to compute the length of the whole form, asyncly self.setHeader(self._form.getHeaders(), true) self._form.getLength(function (err, length) { if (!err && !isNaN(length)) { self.setHeader('content-length', length) } end() }) } else { end() } self.ntick = true }) } Request.prototype.getNewAgent = function () { var self = this var Agent = self.agentClass var options = {} if (self.agentOptions) { for (var i in self.agentOptions) { options[i] = self.agentOptions[i] } } if (self.ca) { options.ca = self.ca } if (self.ciphers) { options.ciphers = self.ciphers } if (self.secureProtocol) { options.secureProtocol = self.secureProtocol } if (self.secureOptions) { options.secureOptions = self.secureOptions } if (typeof self.rejectUnauthorized !== 'undefined') { options.rejectUnauthorized = self.rejectUnauthorized } if (self.cert && self.key) { options.key = self.key options.cert = self.cert } if (self.pfx) { options.pfx = self.pfx } if (self.passphrase) { options.passphrase = self.passphrase } var poolKey = '' // different types of agents are in different pools if (Agent !== self.httpModule.Agent) { poolKey += Agent.name } // ca option is only relevant if proxy or destination are https var proxy = self.proxy if (typeof proxy === 'string') { proxy = url.parse(proxy) } var isHttps = (proxy && proxy.protocol === 'https:') || this.uri.protocol === 'https:' if (isHttps) { if (options.ca) { if (poolKey) { poolKey += ':' } poolKey += options.ca } if (typeof options.rejectUnauthorized !== 'undefined') { if (poolKey) { poolKey += ':' } poolKey += options.rejectUnauthorized } if (options.cert) { if (poolKey) { poolKey += ':' } poolKey += options.cert.toString('ascii') + options.key.toString('ascii') } if (options.pfx) { if (poolKey) { poolKey += ':' } poolKey += options.pfx.toString('ascii') } if (options.ciphers) { if (poolKey) { poolKey += ':' } poolKey += options.ciphers } if (options.secureProtocol) { if (poolKey) { poolKey += ':' } poolKey += options.secureProtocol } if (options.secureOptions) { if (poolKey) { poolKey += ':' } poolKey += options.secureOptions } } if (self.pool === globalPool && !poolKey && Object.keys(options).length === 0 && self.httpModule.globalAgent) { // not doing anything special. Use the globalAgent return self.httpModule.globalAgent } // we're using a stored agent. Make sure it's protocol-specific poolKey = self.uri.protocol + poolKey // generate a new agent for this setting if none yet exists if (!self.pool[poolKey]) { self.pool[poolKey] = new Agent(options) // properly set maxSockets on new agents if (self.pool.maxSockets) { self.pool[poolKey].maxSockets = self.pool.maxSockets } } return self.pool[poolKey] } Request.prototype.start = function () { // start() is called once we are ready to send the outgoing HTTP request. // this is usually called on the first write(), end() or on nextTick() var self = this if (self.timing) { // All timings will be relative to this request's startTime. In order to do this, // we need to capture the wall-clock start time (via Date), immediately followed // by the high-resolution timer (via now()). While these two won't be set // at the _exact_ same time, they should be close enough to be able to calculate // high-resolution, monotonically non-decreasing timestamps relative to startTime. var startTime = new Date().getTime() var startTimeNow = now() } if (self._aborted) { return } self._started = true self.method = self.method || 'GET' self.href = self.uri.href if (self.src && self.src.stat && self.src.stat.size && !self.hasHeader('content-length')) { self.setHeader('content-length', self.src.stat.size) } if (self._aws) { self.aws(self._aws, true) } // We have a method named auth, which is completely different from the http.request // auth option. If we don't remove it, we're gonna have a bad time. var reqOptions = copy(self) delete reqOptions.auth debug('make request', self.uri.href) // node v6.8.0 now supports a `timeout` value in `http.request()`, but we // should delete it for now since we handle timeouts manually for better // consistency with node versions before v6.8.0 delete reqOptions.timeout try { self.req = self.httpModule.request(reqOptions) } catch (err) { self.emit('error', err) return } if (self.timing) { self.startTime = startTime self.startTimeNow = startTimeNow // Timing values will all be relative to startTime (by comparing to startTimeNow // so we have an accurate clock) self.timings = {} } var timeout if (self.timeout && !self.timeoutTimer) { if (self.timeout < 0) { timeout = 0 } else if (typeof self.timeout === 'number' && isFinite(self.timeout)) { timeout = self.timeout } } self.req.on('response', self.onRequestResponse.bind(self)) self.req.on('error', self.onRequestError.bind(self)) self.req.on('drain', function () { self.emit('drain') }) self.req.on('socket', function (socket) { // `._connecting` was the old property which was made public in node v6.1.0 var isConnecting = socket._connecting || socket.connecting if (self.timing) { self.timings.socket = now() - self.startTimeNow if (isConnecting) { var onLookupTiming = function () { self.timings.lookup = now() - self.startTimeNow } var onConnectTiming = function () { self.timings.connect = now() - self.startTimeNow } socket.once('lookup', onLookupTiming) socket.once('connect', onConnectTiming) // clean up timing event listeners if needed on error self.req.once('error', function () { socket.removeListener('lookup', onLookupTiming) socket.removeListener('connect', onConnectTiming) }) } } var setReqTimeout = function () { // This timeout sets the amount of time to wait *between* bytes sent // from the server once connected. // // In particular, it's useful for erroring if the server fails to send // data halfway through streaming a response. self.req.setTimeout(timeout, function () { if (self.req) { self.abort() var e = new Error('ESOCKETTIMEDOUT') e.code = 'ESOCKETTIMEDOUT' e.connect = false self.emit('error', e) } }) } if (timeout !== undefined) { // Only start the connection timer if we're actually connecting a new // socket, otherwise if we're already connected (because this is a // keep-alive connection) do not bother. This is important since we won't // get a 'connect' event for an already connected socket. if (isConnecting) { var onReqSockConnect = function () { socket.removeListener('connect', onReqSockConnect) self.clearTimeout() setReqTimeout() } socket.on('connect', onReqSockConnect) self.req.on('error', function (err) { // eslint-disable-line handle-callback-err socket.removeListener('connect', onReqSockConnect) }) // Set a timeout in memory - this block will throw if the server takes more // than `timeout` to write the HTTP status and headers (corresponding to // the on('response') event on the client). NB: this measures wall-clock // time, not the time between bytes sent by the server. self.timeoutTimer = setTimeout(function () { socket.removeListener('connect', onReqSockConnect) self.abort() var e = new Error('ETIMEDOUT') e.code = 'ETIMEDOUT' e.connect = true self.emit('error', e) }, timeout) } else { // We're already connected setReqTimeout() } } self.emit('socket', socket) }) self.emit('request', self.req) } Request.prototype.onRequestError = function (error) { var self = this if (self._aborted) { return } if (self.req && self.req._reusedSocket && error.code === 'ECONNRESET' && self.agent.addRequestNoreuse) { self.agent = { addRequest: self.agent.addRequestNoreuse.bind(self.agent) } self.start() self.req.end() return } self.clearTimeout() self.emit('error', error) } Request.prototype.onRequestResponse = function (response) { var self = this if (self.timing) { self.timings.response = now() - self.startTimeNow } debug('onRequestResponse', self.uri.href, response.statusCode, response.headers) response.on('end', function () { if (self.timing) { self.timings.end = now() - self.startTimeNow response.timingStart = self.startTime // fill in the blanks for any periods that didn't trigger, such as // no lookup or connect due to keep alive if (!self.timings.socket) { self.timings.socket = 0 } if (!self.timings.lookup) { self.timings.lookup = self.timings.socket } if (!self.timings.connect) { self.timings.connect = self.timings.lookup } if (!self.timings.response) { self.timings.response = self.timings.connect } debug('elapsed time', self.timings.end) // elapsedTime includes all redirects self.elapsedTime += Math.round(self.timings.end) // NOTE: elapsedTime is deprecated in favor of .timings response.elapsedTime = self.elapsedTime // timings is just for the final fetch response.timings = self.timings // pre-calculate phase timings as well response.timingPhases = { wait: self.timings.socket, dns: self.timings.lookup - self.timings.socket, tcp: self.timings.connect - self.timings.lookup, firstByte: self.timings.response - self.timings.connect, download: self.timings.end - self.timings.response, total: self.timings.end } } debug('response end', self.uri.href, response.statusCode, response.headers) }) if (self._aborted) { debug('aborted', self.uri.href) response.resume() return } self.response = response response.request = self response.toJSON = responseToJSON // XXX This is different on 0.10, because SSL is strict by default if (self.httpModule === https && self.strictSSL && (!response.hasOwnProperty('socket') || !response.socket.authorized)) { debug('strict ssl error', self.uri.href) var sslErr = response.hasOwnProperty('socket') ? response.socket.authorizationError : self.uri.href + ' does not support SSL' self.emit('error', new Error('SSL Error: ' + sslErr)) return } // Save the original host before any redirect (if it changes, we need to // remove any authorization headers). Also remember the case of the header // name because lots of broken servers expect Host instead of host and we // want the caller to be able to specify this. self.originalHost = self.getHeader('host') if (!self.originalHostHeaderName) { self.originalHostHeaderName = self.hasHeader('host') } if (self.setHost) { self.removeHeader('host') } self.clearTimeout() var targetCookieJar = (self._jar && self._jar.setCookie) ? self._jar : globalCookieJar var addCookie = function (cookie) { // set the cookie if it's domain in the href's domain. try { targetCookieJar.setCookie(cookie, self.uri.href, {ignoreError: true}) } catch (e) { self.emit('error', e) } } response.caseless = caseless(response.headers) if (response.caseless.has('set-cookie') && (!self._disableCookies)) { var headerName = response.caseless.has('set-cookie') if (Array.isArray(response.headers[headerName])) { response.headers[headerName].forEach(addCookie) } else { addCookie(response.headers[headerName]) } } if (self._redirect.onResponse(response)) { return // Ignore the rest of the response } else { // Be a good stream and emit end when the response is finished. // Hack to emit end on close because of a core bug that never fires end response.on('close', function () { if (!self._ended) { self.response.emit('end') } }) response.once('end', function () { self._ended = true }) var noBody = function (code) { return ( self.method === 'HEAD' || // Informational (code >= 100 && code < 200) || // No Content code === 204 || // Not Modified code === 304 ) } var responseContent if (self.gzip && !noBody(response.statusCode)) { var contentEncoding = response.headers['content-encoding'] || 'identity' contentEncoding = contentEncoding.trim().toLowerCase() // Be more lenient with decoding compressed responses, since (very rarely) // servers send slightly invalid gzip responses that are still accepted // by common browsers. // Always using Z_SYNC_FLUSH is what cURL does. var zlibOptions = { flush: zlib.Z_SYNC_FLUSH, finishFlush: zlib.Z_SYNC_FLUSH } if (contentEncoding === 'gzip') { responseContent = zlib.createGunzip(zlibOptions) response.pipe(responseContent) } else if (contentEncoding === 'deflate') { responseContent = zlib.createInflate(zlibOptions) response.pipe(responseContent) } else { // Since previous versions didn't check for Content-Encoding header, // ignore any invalid values to preserve backwards-compatibility if (contentEncoding !== 'identity') { debug('ignoring unrecognized Content-Encoding ' + contentEncoding) } responseContent = response } } else { responseContent = response } if (self.encoding) { if (self.dests.length !== 0) { console.error('Ignoring encoding parameter as this stream is being piped to another stream which makes the encoding option invalid.') } else { responseContent.setEncoding(self.encoding) } } if (self._paused) { responseContent.pause() } self.responseContent = responseContent self.emit('response', response) self.dests.forEach(function (dest) { self.pipeDest(dest) }) responseContent.on('data', function (chunk) { if (self.timing && !self.responseStarted) { self.responseStartTime = (new Date()).getTime() // NOTE: responseStartTime is deprecated in favor of .timings response.responseStartTime = self.responseStartTime } self._destdata = true self.emit('data', chunk) }) responseContent.once('end', function (chunk) { self.emit('end', chunk) }) responseContent.on('error', function (error) { self.emit('error', error) }) responseContent.on('close', function () { self.emit('close') }) if (self.callback) { self.readResponseBody(response) } else { // if no callback self.on('end', function () { if (self._aborted) { debug('aborted', self.uri.href) return } self.emit('complete', response) }) } } debug('finish init function', self.uri.href) } Request.prototype.readResponseBody = function (response) { var self = this debug("reading response's body") var buffers = [] var bufferLength = 0 var strings = [] self.on('data', function (chunk) { if (!Buffer.isBuffer(chunk)) { strings.push(chunk) } else if (chunk.length) { bufferLength += chunk.length buffers.push(chunk) } }) self.on('end', function () { debug('end event', self.uri.href) if (self._aborted) { debug('aborted', self.uri.href) // `buffer` is defined in the parent scope and used in a closure it exists for the life of the request. // This can lead to leaky behavior if the user retains a reference to the request object. buffers = [] bufferLength = 0 return } if (bufferLength) { debug('has body', self.uri.href, bufferLength) response.body = Buffer.concat(buffers, bufferLength) if (self.encoding !== null) { response.body = response.body.toString(self.encoding) } // `buffer` is defined in the parent scope and used in a closure it exists for the life of the Request. // This can lead to leaky behavior if the user retains a reference to the request object. buffers = [] bufferLength = 0 } else if (strings.length) { // The UTF8 BOM [0xEF,0xBB,0xBF] is converted to [0xFE,0xFF] in the JS UTC16/UCS2 representation. // Strip this value out when the encoding is set to 'utf8', as upstream consumers won't expect it and it breaks JSON.parse(). if (self.encoding === 'utf8' && strings[0].length > 0 && strings[0][0] === '\uFEFF') { strings[0] = strings[0].substring(1) } response.body = strings.join('') } if (self._json) { try { response.body = JSON.parse(response.body, self._jsonReviver) } catch (e) { debug('invalid JSON received', self.uri.href) } } debug('emitting complete', self.uri.href) if (typeof response.body === 'undefined' && !self._json) { response.body = self.encoding === null ? Buffer.alloc(0) : '' } self.emit('complete', response, response.body) }) } Request.prototype.abort = function () { var self = this self._aborted = true if (self.req) { self.req.abort() } else if (self.response) { self.response.destroy() } self.clearTimeout() self.emit('abort') } Request.prototype.pipeDest = function (dest) { var self = this var response = self.response // Called after the response is received if (dest.headers && !dest.headersSent) { if (response.caseless.has('content-type')) { var ctname = response.caseless.has('content-type') if (dest.setHeader) { dest.setHeader(ctname, response.headers[ctname]) } else { dest.headers[ctname] = response.headers[ctname] } } if (response.caseless.has('content-length')) { var clname = response.caseless.has('content-length') if (dest.setHeader) { dest.setHeader(clname, response.headers[clname]) } else { dest.headers[clname] = response.headers[clname] } } } if (dest.setHeader && !dest.headersSent) { for (var i in response.headers) { // If the response content is being decoded, the Content-Encoding header // of the response doesn't represent the piped content, so don't pass it. if (!self.gzip || i !== 'content-encoding') { dest.setHeader(i, response.headers[i]) } } dest.statusCode = response.statusCode } if (self.pipefilter) { self.pipefilter(response, dest) } } Request.prototype.qs = function (q, clobber) { var self = this var base if (!clobber && self.uri.query) { base = self._qs.parse(self.uri.query) } else { base = {} } for (var i in q) { base[i] = q[i] } var qs = self._qs.stringify(base) if (qs === '') { return self } self.uri = url.parse(self.uri.href.split('?')[0] + '?' + qs) self.url = self.uri self.path = self.uri.path if (self.uri.host === 'unix') { self.enableUnixSocket() } return self } Request.prototype.form = function (form) { var self = this if (form) { if (!/^application\/x-www-form-urlencoded\b/.test(self.getHeader('content-type'))) { self.setHeader('content-type', 'application/x-www-form-urlencoded') } self.body = (typeof form === 'string') ? self._qs.rfc3986(form.toString('utf8')) : self._qs.stringify(form).toString('utf8') return self } // create form-data object self._form = new FormData() self._form.on('error', function (err) { err.message = 'form-data: ' + err.message self.emit('error', err) self.abort() }) return self._form } Request.prototype.multipart = function (multipart) { var self = this self._multipart.onRequest(multipart) if (!self._multipart.chunked) { self.body = self._multipart.body } return self } Request.prototype.json = function (val) { var self = this if (!self.hasHeader('accept')) { self.setHeader('accept', 'application/json') } if (typeof self.jsonReplacer === 'function') { self._jsonReplacer = self.jsonReplacer } self._json = true if (typeof val === 'boolean') { if (self.body !== undefined) { if (!/^application\/x-www-form-urlencoded\b/.test(self.getHeader('content-type'))) { self.body = safeStringify(self.body, self._jsonReplacer) } else { self.body = self._qs.rfc3986(self.body) } if (!self.hasHeader('content-type')) { self.setHeader('content-type', 'application/json') } } } else { self.body = safeStringify(val, self._jsonReplacer) if (!self.hasHeader('content-type')) { self.setHeader('content-type', 'application/json') } } if (typeof self.jsonReviver === 'function') { self._jsonReviver = self.jsonReviver } return self } Request.prototype.getHeader = function (name, headers) { var self = this var result, re, match if (!headers) { headers = self.headers } Object.keys(headers).forEach(function (key) { if (key.length !== name.length) { return } re = new RegExp(name, 'i') match = key.match(re) if (match) { result = headers[key] } }) return result } Request.prototype.enableUnixSocket = function () { // Get the socket & request paths from the URL var unixParts = this.uri.path.split(':') var host = unixParts[0] var path = unixParts[1] // Apply unix properties to request this.socketPath = host this.uri.pathname = path this.uri.path = path this.uri.host = host this.uri.hostname = host this.uri.isUnix = true } Request.prototype.auth = function (user, pass, sendImmediately, bearer) { var self = this self._auth.onRequest(user, pass, sendImmediately, bearer) return self } Request.prototype.aws = function (opts, now) { var self = this if (!now) { self._aws = opts return self } if (opts.sign_version === 4 || opts.sign_version === '4') { // use aws4 var options = { host: self.uri.host, path: self.uri.path, method: self.method, headers: self.headers, body: self.body } if (opts.service) { options.service = opts.service } var signRes = aws4.sign(options, { accessKeyId: opts.key, secretAccessKey: opts.secret, sessionToken: opts.session }) self.setHeader('authorization', signRes.headers.Authorization) self.setHeader('x-amz-date', signRes.headers['X-Amz-Date']) if (signRes.headers['X-Amz-Security-Token']) { self.setHeader('x-amz-security-token', signRes.headers['X-Amz-Security-Token']) } } else { // default: use aws-sign2 var date = new Date() self.setHeader('date', date.toUTCString()) var auth = { key: opts.key, secret: opts.secret, verb: self.method.toUpperCase(), date: date, contentType: self.getHeader('content-type') || '', md5: self.getHeader('content-md5') || '', amazonHeaders: aws2.canonicalizeHeaders(self.headers) } var path = self.uri.path if (opts.bucket && path) { auth.resource = '/' + opts.bucket + path } else if (opts.bucket && !path) { auth.resource = '/' + opts.bucket } else if (!opts.bucket && path) { auth.resource = path } else if (!opts.bucket && !path) { auth.resource = '/' } auth.resource = aws2.canonicalizeResource(auth.resource) self.setHeader('authorization', aws2.authorization(auth)) } return self } Request.prototype.httpSignature = function (opts) { var self = this httpSignature.signRequest({ getHeader: function (header) { return self.getHeader(header, self.headers) }, setHeader: function (header, value) { self.setHeader(header, value) }, method: self.method, path: self.path }, opts) debug('httpSignature authorization', self.getHeader('authorization')) return self } Request.prototype.hawk = function (opts) { var self = this self.setHeader('Authorization', hawk.header(self.uri, self.method, opts)) } Request.prototype.oauth = function (_oauth) { var self = this self._oauth.onRequest(_oauth) return self } Request.prototype.jar = function (jar) { var self = this var cookies if (self._redirect.redirectsFollowed === 0) { self.originalCookieHeader = self.getHeader('cookie') } if (!jar) { // disable cookies cookies = false self._disableCookies = true } else { var targetCookieJar = jar.getCookieString ? jar : globalCookieJar var urihref = self.uri.href // fetch cookie in the Specified host if (targetCookieJar) { cookies = targetCookieJar.getCookieString(urihref) } } // if need cookie and cookie is not empty if (cookies && cookies.length) { if (self.originalCookieHeader) { // Don't overwrite existing Cookie header self.setHeader('cookie', self.originalCookieHeader + '; ' + cookies) } else { self.setHeader('cookie', cookies) } } self._jar = jar return self } // Stream API Request.prototype.pipe = function (dest, opts) { var self = this if (self.response) { if (self._destdata) { self.emit('error', new Error('You cannot pipe after data has been emitted from the response.')) } else if (self._ended) { self.emit('error', new Error('You cannot pipe after the response has been ended.')) } else { stream.Stream.prototype.pipe.call(self, dest, opts) self.pipeDest(dest) return dest } } else { self.dests.push(dest) stream.Stream.prototype.pipe.call(self, dest, opts) return dest } } Request.prototype.write = function () { var self = this if (self._aborted) { return } if (!self._started) { self.start() } if (self.req) { return self.req.write.apply(self.req, arguments) } } Request.prototype.end = function (chunk) { var self = this if (self._aborted) { return } if (chunk) { self.write(chunk) } if (!self._started) { self.start() } if (self.req) { self.req.end() } } Request.prototype.pause = function () { var self = this if (!self.responseContent) { self._paused = true } else { self.responseContent.pause.apply(self.responseContent, arguments) } } Request.prototype.resume = function () { var self = this if (!self.responseContent) { self._paused = false } else { self.responseContent.resume.apply(self.responseContent, arguments) } } Request.prototype.destroy = function () { var self = this this.clearTimeout() if (!self._ended) { self.end() } else if (self.response) { self.response.destroy() } } Request.prototype.clearTimeout = function () { if (this.timeoutTimer) { clearTimeout(this.timeoutTimer) this.timeoutTimer = null } } Request.defaultProxyHeaderWhiteList = Tunnel.defaultProxyHeaderWhiteList.slice() Request.defaultProxyHeaderExclusiveList = Tunnel.defaultProxyHeaderExclusiveList.slice() // Exports Request.prototype.toJSON = requestToJSON module.exports = Request /***/ }), /***/ 459: /***/ (function(module) { // generated by genversion module.exports = '2.5.0' /***/ }), /***/ 461: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; var url = __webpack_require__(835) var tunnel = __webpack_require__(243) var defaultProxyHeaderWhiteList = [ 'accept', 'accept-charset', 'accept-encoding', 'accept-language', 'accept-ranges', 'cache-control', 'content-encoding', 'content-language', 'content-location', 'content-md5', 'content-range', 'content-type', 'connection', 'date', 'expect', 'max-forwards', 'pragma', 'referer', 'te', 'user-agent', 'via' ] var defaultProxyHeaderExclusiveList = [ 'proxy-authorization' ] function constructProxyHost (uriObject) { var port = uriObject.port var protocol = uriObject.protocol var proxyHost = uriObject.hostname + ':' if (port) { proxyHost += port } else if (protocol === 'https:') { proxyHost += '443' } else { proxyHost += '80' } return proxyHost } function constructProxyHeaderWhiteList (headers, proxyHeaderWhiteList) { var whiteList = proxyHeaderWhiteList .reduce(function (set, header) { set[header.toLowerCase()] = true return set }, {}) return Object.keys(headers) .filter(function (header) { return whiteList[header.toLowerCase()] }) .reduce(function (set, header) { set[header] = headers[header] return set }, {}) } function constructTunnelOptions (request, proxyHeaders) { var proxy = request.proxy var tunnelOptions = { proxy: { host: proxy.hostname, port: +proxy.port, proxyAuth: proxy.auth, headers: proxyHeaders }, headers: request.headers, ca: request.ca, cert: request.cert, key: request.key, passphrase: request.passphrase, pfx: request.pfx, ciphers: request.ciphers, rejectUnauthorized: request.rejectUnauthorized, secureOptions: request.secureOptions, secureProtocol: request.secureProtocol } return tunnelOptions } function constructTunnelFnName (uri, proxy) { var uriProtocol = (uri.protocol === 'https:' ? 'https' : 'http') var proxyProtocol = (proxy.protocol === 'https:' ? 'Https' : 'Http') return [uriProtocol, proxyProtocol].join('Over') } function getTunnelFn (request) { var uri = request.uri var proxy = request.proxy var tunnelFnName = constructTunnelFnName(uri, proxy) return tunnel[tunnelFnName] } function Tunnel (request) { this.request = request this.proxyHeaderWhiteList = defaultProxyHeaderWhiteList this.proxyHeaderExclusiveList = [] if (typeof request.tunnel !== 'undefined') { this.tunnelOverride = request.tunnel } } Tunnel.prototype.isEnabled = function () { var self = this var request = self.request // Tunnel HTTPS by default. Allow the user to override this setting. // If self.tunnelOverride is set (the user specified a value), use it. if (typeof self.tunnelOverride !== 'undefined') { return self.tunnelOverride } // If the destination is HTTPS, tunnel. if (request.uri.protocol === 'https:') { return true } // Otherwise, do not use tunnel. return false } Tunnel.prototype.setup = function (options) { var self = this var request = self.request options = options || {} if (typeof request.proxy === 'string') { request.proxy = url.parse(request.proxy) } if (!request.proxy || !request.tunnel) { return false } // Setup Proxy Header Exclusive List and White List if (options.proxyHeaderWhiteList) { self.proxyHeaderWhiteList = options.proxyHeaderWhiteList } if (options.proxyHeaderExclusiveList) { self.proxyHeaderExclusiveList = options.proxyHeaderExclusiveList } var proxyHeaderExclusiveList = self.proxyHeaderExclusiveList.concat(defaultProxyHeaderExclusiveList) var proxyHeaderWhiteList = self.proxyHeaderWhiteList.concat(proxyHeaderExclusiveList) // Setup Proxy Headers and Proxy Headers Host // Only send the Proxy White Listed Header names var proxyHeaders = constructProxyHeaderWhiteList(request.headers, proxyHeaderWhiteList) proxyHeaders.host = constructProxyHost(request.uri) proxyHeaderExclusiveList.forEach(request.removeHeader, request) // Set Agent from Tunnel Data var tunnelFn = getTunnelFn(request) var tunnelOptions = constructTunnelOptions(request, proxyHeaders) request.agent = tunnelFn(tunnelOptions) return true } Tunnel.defaultProxyHeaderWhiteList = defaultProxyHeaderWhiteList Tunnel.defaultProxyHeaderExclusiveList = defaultProxyHeaderExclusiveList exports.Tunnel = Tunnel /***/ }), /***/ 469: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; var uuid = __webpack_require__(826) var CombinedStream = __webpack_require__(547) var isstream = __webpack_require__(382) var Buffer = __webpack_require__(149).Buffer function Multipart (request) { this.request = request this.boundary = uuid() this.chunked = false this.body = null } Multipart.prototype.isChunked = function (options) { var self = this var chunked = false var parts = options.data || options if (!parts.forEach) { self.request.emit('error', new Error('Argument error, options.multipart.')) } if (options.chunked !== undefined) { chunked = options.chunked } if (self.request.getHeader('transfer-encoding') === 'chunked') { chunked = true } if (!chunked) { parts.forEach(function (part) { if (typeof part.body === 'undefined') { self.request.emit('error', new Error('Body attribute missing in multipart.')) } if (isstream(part.body)) { chunked = true } }) } return chunked } Multipart.prototype.setHeaders = function (chunked) { var self = this if (chunked && !self.request.hasHeader('transfer-encoding')) { self.request.setHeader('transfer-encoding', 'chunked') } var header = self.request.getHeader('content-type') if (!header || header.indexOf('multipart') === -1) { self.request.setHeader('content-type', 'multipart/related; boundary=' + self.boundary) } else { if (header.indexOf('boundary') !== -1) { self.boundary = header.replace(/.*boundary=([^\s;]+).*/, '$1') } else { self.request.setHeader('content-type', header + '; boundary=' + self.boundary) } } } Multipart.prototype.build = function (parts, chunked) { var self = this var body = chunked ? new CombinedStream() : [] function add (part) { if (typeof part === 'number') { part = part.toString() } return chunked ? body.append(part) : body.push(Buffer.from(part)) } if (self.request.preambleCRLF) { add('\r\n') } parts.forEach(function (part) { var preamble = '--' + self.boundary + '\r\n' Object.keys(part).forEach(function (key) { if (key === 'body') { return } preamble += key + ': ' + part[key] + '\r\n' }) preamble += '\r\n' add(preamble) add(part.body) add('\r\n') }) add('--' + self.boundary + '--') if (self.request.postambleCRLF) { add('\r\n') } return body } Multipart.prototype.onRequest = function (options) { var self = this var chunked = self.isChunked(options) var parts = options.data || options self.setHeaders(chunked) self.chunked = chunked self.body = self.build(parts, chunked) } exports.Multipart = Multipart /***/ }), /***/ 470: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } return new (P || (P = Promise))(function (resolve, reject) { function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } step((generator = generator.apply(thisArg, _arguments || [])).next()); }); }; var __importStar = (this && this.__importStar) || function (mod) { if (mod && mod.__esModule) return mod; var result = {}; if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k]; result["default"] = mod; return result; }; Object.defineProperty(exports, "__esModule", { value: true }); const command_1 = __webpack_require__(431); const os = __importStar(__webpack_require__(87)); const path = __importStar(__webpack_require__(622)); /** * The code to exit an action */ var ExitCode; (function (ExitCode) { /** * A code indicating that the action was successful */ ExitCode[ExitCode["Success"] = 0] = "Success"; /** * A code indicating that the action was a failure */ ExitCode[ExitCode["Failure"] = 1] = "Failure"; })(ExitCode = exports.ExitCode || (exports.ExitCode = {})); //----------------------------------------------------------------------- // Variables //----------------------------------------------------------------------- /** * Sets env variable for this action and future actions in the job * @param name the name of the variable to set * @param val the value of the variable */ function exportVariable(name, val) { process.env[name] = val; command_1.issueCommand('set-env', { name }, val); } exports.exportVariable = exportVariable; /** * Registers a secret which will get masked from logs * @param secret value of the secret */ function setSecret(secret) { command_1.issueCommand('add-mask', {}, secret); } exports.setSecret = setSecret; /** * Prepends inputPath to the PATH (for this action and future actions) * @param inputPath */ function addPath(inputPath) { command_1.issueCommand('add-path', {}, inputPath); process.env['PATH'] = `${inputPath}${path.delimiter}${process.env['PATH']}`; } exports.addPath = addPath; /** * Gets the value of an input. The value is also trimmed. * * @param name name of the input to get * @param options optional. See InputOptions. * @returns string */ function getInput(name, options) { const val = process.env[`INPUT_${name.replace(/ /g, '_').toUpperCase()}`] || ''; if (options && options.required && !val) { throw new Error(`Input required and not supplied: ${name}`); } return val.trim(); } exports.getInput = getInput; /** * Sets the value of an output. * * @param name name of the output to set * @param value value to store */ function setOutput(name, value) { command_1.issueCommand('set-output', { name }, value); } exports.setOutput = setOutput; //----------------------------------------------------------------------- // Results //----------------------------------------------------------------------- /** * Sets the action status to failed. * When the action exits it will be with an exit code of 1 * @param message add error issue message */ function setFailed(message) { process.exitCode = ExitCode.Failure; error(message); } exports.setFailed = setFailed; //----------------------------------------------------------------------- // Logging Commands //----------------------------------------------------------------------- /** * Gets whether Actions Step Debug is on or not */ function isDebug() { return process.env['RUNNER_DEBUG'] === '1'; } exports.isDebug = isDebug; /** * Writes debug message to user log * @param message debug message */ function debug(message) { command_1.issueCommand('debug', {}, message); } exports.debug = debug; /** * Adds an error issue * @param message error issue message */ function error(message) { command_1.issue('error', message); } exports.error = error; /** * Adds an warning issue * @param message warning issue message */ function warning(message) { command_1.issue('warning', message); } exports.warning = warning; /** * Writes info to log with console.log. * @param message info message */ function info(message) { process.stdout.write(message + os.EOL); } exports.info = info; /** * Begin an output group. * * Output until the next `groupEnd` will be foldable in this group * * @param name The name of the output group */ function startGroup(name) { command_1.issue('group', name); } exports.startGroup = startGroup; /** * End an output group. */ function endGroup() { command_1.issue('endgroup'); } exports.endGroup = endGroup; /** * Wrap an asynchronous function call in a group. * * Returns the same type as the function itself. * * @param name The name of the group * @param fn The function to wrap in the group */ function group(name, fn) { return __awaiter(this, void 0, void 0, function* () { startGroup(name); let result; try { result = yield fn(); } finally { endGroup(); } return result; }); } exports.group = group; //----------------------------------------------------------------------- // Wrapper action state //----------------------------------------------------------------------- /** * Saves state for current action, the state can only be retrieved by this action's post job execution. * * @param name name of the state to store * @param value value to store */ function saveState(name, value) { command_1.issueCommand('save-state', { name }, value); } exports.saveState = saveState; /** * Gets the value of an state set by this action's main execution. * * @param name name of the state to get * @returns string */ function getState(name) { return process.env[`STATE_${name}`] || ''; } exports.getState = getState; //# sourceMappingURL=core.js.map /***/ }), /***/ 477: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright (c) 2012, Mark Cavage. All rights reserved. // Copyright 2015 Joyent, Inc. var assert = __webpack_require__(357); var Stream = __webpack_require__(413).Stream; var util = __webpack_require__(669); ///--- Globals /* JSSTYLED */ var UUID_REGEXP = /^[a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12}$/; ///--- Internal function _capitalize(str) { return (str.charAt(0).toUpperCase() + str.slice(1)); } function _toss(name, expected, oper, arg, actual) { throw new assert.AssertionError({ message: util.format('%s (%s) is required', name, expected), actual: (actual === undefined) ? typeof (arg) : actual(arg), expected: expected, operator: oper || '===', stackStartFunction: _toss.caller }); } function _getClass(arg) { return (Object.prototype.toString.call(arg).slice(8, -1)); } function noop() { // Why even bother with asserts? } ///--- Exports var types = { bool: { check: function (arg) { return typeof (arg) === 'boolean'; } }, func: { check: function (arg) { return typeof (arg) === 'function'; } }, string: { check: function (arg) { return typeof (arg) === 'string'; } }, object: { check: function (arg) { return typeof (arg) === 'object' && arg !== null; } }, number: { check: function (arg) { return typeof (arg) === 'number' && !isNaN(arg); } }, finite: { check: function (arg) { return typeof (arg) === 'number' && !isNaN(arg) && isFinite(arg); } }, buffer: { check: function (arg) { return Buffer.isBuffer(arg); }, operator: 'Buffer.isBuffer' }, array: { check: function (arg) { return Array.isArray(arg); }, operator: 'Array.isArray' }, stream: { check: function (arg) { return arg instanceof Stream; }, operator: 'instanceof', actual: _getClass }, date: { check: function (arg) { return arg instanceof Date; }, operator: 'instanceof', actual: _getClass }, regexp: { check: function (arg) { return arg instanceof RegExp; }, operator: 'instanceof', actual: _getClass }, uuid: { check: function (arg) { return typeof (arg) === 'string' && UUID_REGEXP.test(arg); }, operator: 'isUUID' } }; function _setExports(ndebug) { var keys = Object.keys(types); var out; /* re-export standard assert */ if (process.env.NODE_NDEBUG) { out = noop; } else { out = function (arg, msg) { if (!arg) { _toss(msg, 'true', arg); } }; } /* standard checks */ keys.forEach(function (k) { if (ndebug) { out[k] = noop; return; } var type = types[k]; out[k] = function (arg, msg) { if (!type.check(arg)) { _toss(msg, k, type.operator, arg, type.actual); } }; }); /* optional checks */ keys.forEach(function (k) { var name = 'optional' + _capitalize(k); if (ndebug) { out[name] = noop; return; } var type = types[k]; out[name] = function (arg, msg) { if (arg === undefined || arg === null) { return; } if (!type.check(arg)) { _toss(msg, k, type.operator, arg, type.actual); } }; }); /* arrayOf checks */ keys.forEach(function (k) { var name = 'arrayOf' + _capitalize(k); if (ndebug) { out[name] = noop; return; } var type = types[k]; var expected = '[' + k + ']'; out[name] = function (arg, msg) { if (!Array.isArray(arg)) { _toss(msg, expected, type.operator, arg, type.actual); } var i; for (i = 0; i < arg.length; i++) { if (!type.check(arg[i])) { _toss(msg, expected, type.operator, arg, type.actual); } } }; }); /* optionalArrayOf checks */ keys.forEach(function (k) { var name = 'optionalArrayOf' + _capitalize(k); if (ndebug) { out[name] = noop; return; } var type = types[k]; var expected = '[' + k + ']'; out[name] = function (arg, msg) { if (arg === undefined || arg === null) { return; } if (!Array.isArray(arg)) { _toss(msg, expected, type.operator, arg, type.actual); } var i; for (i = 0; i < arg.length; i++) { if (!type.check(arg[i])) { _toss(msg, expected, type.operator, arg, type.actual); } } }; }); /* re-export built-in assertions */ Object.keys(assert).forEach(function (k) { if (k === 'AssertionError') { out[k] = assert[k]; return; } if (ndebug) { out[k] = noop; return; } out[k] = assert[k]; }); /* export ourselves (for unit tests _only_) */ out._setExports = _setExports; return out; } module.exports = _setExports(process.env.NODE_NDEBUG); /***/ }), /***/ 479: /***/ (function(module) { "use strict"; module.exports = function generate_if(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $data = 'data' + ($dataLvl || ''); var $valid = 'valid' + $lvl; var $errs = 'errs__' + $lvl; var $it = it.util.copy(it); $it.level++; var $nextValid = 'valid' + $it.level; var $thenSch = it.schema['then'], $elseSch = it.schema['else'], $thenPresent = $thenSch !== undefined && (it.opts.strictKeywords ? typeof $thenSch == 'object' && Object.keys($thenSch).length > 0 : it.util.schemaHasRules($thenSch, it.RULES.all)), $elsePresent = $elseSch !== undefined && (it.opts.strictKeywords ? typeof $elseSch == 'object' && Object.keys($elseSch).length > 0 : it.util.schemaHasRules($elseSch, it.RULES.all)), $currentBaseId = $it.baseId; if ($thenPresent || $elsePresent) { var $ifClause; $it.createErrors = false; $it.schema = $schema; $it.schemaPath = $schemaPath; $it.errSchemaPath = $errSchemaPath; out += ' var ' + ($errs) + ' = errors; var ' + ($valid) + ' = true; '; var $wasComposite = it.compositeRule; it.compositeRule = $it.compositeRule = true; out += ' ' + (it.validate($it)) + ' '; $it.baseId = $currentBaseId; $it.createErrors = true; out += ' errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } '; it.compositeRule = $it.compositeRule = $wasComposite; if ($thenPresent) { out += ' if (' + ($nextValid) + ') { '; $it.schema = it.schema['then']; $it.schemaPath = it.schemaPath + '.then'; $it.errSchemaPath = it.errSchemaPath + '/then'; out += ' ' + (it.validate($it)) + ' '; $it.baseId = $currentBaseId; out += ' ' + ($valid) + ' = ' + ($nextValid) + '; '; if ($thenPresent && $elsePresent) { $ifClause = 'ifClause' + $lvl; out += ' var ' + ($ifClause) + ' = \'then\'; '; } else { $ifClause = '\'then\''; } out += ' } '; if ($elsePresent) { out += ' else { '; } } else { out += ' if (!' + ($nextValid) + ') { '; } if ($elsePresent) { $it.schema = it.schema['else']; $it.schemaPath = it.schemaPath + '.else'; $it.errSchemaPath = it.errSchemaPath + '/else'; out += ' ' + (it.validate($it)) + ' '; $it.baseId = $currentBaseId; out += ' ' + ($valid) + ' = ' + ($nextValid) + '; '; if ($thenPresent && $elsePresent) { $ifClause = 'ifClause' + $lvl; out += ' var ' + ($ifClause) + ' = \'else\'; '; } else { $ifClause = '\'else\''; } out += ' } '; } out += ' if (!' + ($valid) + ') { var err = '; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('if') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { failingKeyword: ' + ($ifClause) + ' } '; if (it.opts.messages !== false) { out += ' , message: \'should match "\' + ' + ($ifClause) + ' + \'" schema\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError(vErrors); '; } else { out += ' validate.errors = vErrors; return false; '; } } out += ' } '; if ($breakOnError) { out += ' else { '; } out = it.util.cleanUpCode(out); } else { if ($breakOnError) { out += ' if (true) { '; } } return out; } /***/ }), /***/ 496: /***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; var ruleModules = __webpack_require__(894) , toHash = __webpack_require__(855).toHash; module.exports = function rules() { var RULES = [ { type: 'number', rules: [ { 'maximum': ['exclusiveMaximum'] }, { 'minimum': ['exclusiveMinimum'] }, 'multipleOf', 'format'] }, { type: 'string', rules: [ 'maxLength', 'minLength', 'pattern', 'format' ] }, { type: 'array', rules: [ 'maxItems', 'minItems', 'items', 'contains', 'uniqueItems' ] }, { type: 'object', rules: [ 'maxProperties', 'minProperties', 'required', 'dependencies', 'propertyNames', { 'properties': ['additionalProperties', 'patternProperties'] } ] }, { rules: [ '$ref', 'const', 'enum', 'not', 'anyOf', 'oneOf', 'allOf', 'if' ] } ]; var ALL = [ 'type', '$comment' ]; var KEYWORDS = [ '$schema', '$id', 'id', '$data', '$async', 'title', 'description', 'default', 'definitions', 'examples', 'readOnly', 'writeOnly', 'contentMediaType', 'contentEncoding', 'additionalItems', 'then', 'else' ]; var TYPES = [ 'number', 'integer', 'string', 'array', 'object', 'boolean', 'null' ]; RULES.all = toHash(ALL); RULES.types = toHash(TYPES); RULES.forEach(function (group) { group.rules = group.rules.map(function (keyword) { var implKeywords; if (typeof keyword == 'object') { var key = Object.keys(keyword)[0]; implKeywords = keyword[key]; keyword = key; implKeywords.forEach(function (k) { ALL.push(k); RULES.all[k] = true; }); } ALL.push(keyword); var rule = RULES.all[keyword] = { keyword: keyword, code: ruleModules[keyword], implements: implKeywords }; return rule; }); RULES.all.$comment = { keyword: '$comment', code: ruleModules.$comment }; if (group.type) RULES.types[group.type] = group; }); RULES.keywords = toHash(ALL.concat(KEYWORDS)); RULES.custom = {}; return RULES; }; /***/ }), /***/ 500: /***/ (function(module) { module.exports = defer; /** * Runs provided function on next iteration of the event loop * * @param {function} fn - function to run */ function defer(fn) { var nextTick = typeof setImmediate == 'function' ? setImmediate : ( typeof process == 'object' && typeof process.nextTick == 'function' ? process.nextTick : null ); if (nextTick) { nextTick(fn); } else { setTimeout(fn, 0); } } /***/ }), /***/ 502: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2017 Joyent, Inc. module.exports = PrivateKey; var assert = __webpack_require__(477); var Buffer = __webpack_require__(215).Buffer; var algs = __webpack_require__(98); var crypto = __webpack_require__(417); var Fingerprint = __webpack_require__(400); var Signature = __webpack_require__(575); var errs = __webpack_require__(753); var util = __webpack_require__(669); var utils = __webpack_require__(270); var dhe = __webpack_require__(290); var generateECDSA = dhe.generateECDSA; var generateED25519 = dhe.generateED25519; var edCompat = __webpack_require__(363); var nacl = __webpack_require__(196); var Key = __webpack_require__(852); var InvalidAlgorithmError = errs.InvalidAlgorithmError; var KeyParseError = errs.KeyParseError; var KeyEncryptedError = errs.KeyEncryptedError; var formats = {}; formats['auto'] = __webpack_require__(241); formats['pem'] = __webpack_require__(268); formats['pkcs1'] = __webpack_require__(449); formats['pkcs8'] = __webpack_require__(707); formats['rfc4253'] = __webpack_require__(538); formats['ssh-private'] = __webpack_require__(78); formats['openssh'] = formats['ssh-private']; formats['ssh'] = formats['ssh-private']; formats['dnssec'] = __webpack_require__(982); function PrivateKey(opts) { assert.object(opts, 'options'); Key.call(this, opts); this._pubCache = undefined; } util.inherits(PrivateKey, Key); PrivateKey.formats = formats; PrivateKey.prototype.toBuffer = function (format, options) { if (format === undefined) format = 'pkcs1'; assert.string(format, 'format'); assert.object(formats[format], 'formats[format]'); assert.optionalObject(options, 'options'); return (formats[format].write(this, options)); }; PrivateKey.prototype.hash = function (algo, type) { return (this.toPublic().hash(algo, type)); }; PrivateKey.prototype.fingerprint = function (algo, type) { return (this.toPublic().fingerprint(algo, type)); }; PrivateKey.prototype.toPublic = function () { if (this._pubCache) return (this._pubCache); var algInfo = algs.info[this.type]; var pubParts = []; for (var i = 0; i < algInfo.parts.length; ++i) { var p = algInfo.parts[i]; pubParts.push(this.part[p]); } this._pubCache = new Key({ type: this.type, source: this, parts: pubParts }); if (this.comment) this._pubCache.comment = this.comment; return (this._pubCache); }; PrivateKey.prototype.derive = function (newType) { assert.string(newType, 'type'); var priv, pub, pair; if (this.type === 'ed25519' && newType === 'curve25519') { priv = this.part.k.data; if (priv[0] === 0x00) priv = priv.slice(1); pair = nacl.box.keyPair.fromSecretKey(new Uint8Array(priv)); pub = Buffer.from(pair.publicKey); return (new PrivateKey({ type: 'curve25519', parts: [ { name: 'A', data: utils.mpNormalize(pub) }, { name: 'k', data: utils.mpNormalize(priv) } ] })); } else if (this.type === 'curve25519' && newType === 'ed25519') { priv = this.part.k.data; if (priv[0] === 0x00) priv = priv.slice(1); pair = nacl.sign.keyPair.fromSeed(new Uint8Array(priv)); pub = Buffer.from(pair.publicKey); return (new PrivateKey({ type: 'ed25519', parts: [ { name: 'A', data: utils.mpNormalize(pub) }, { name: 'k', data: utils.mpNormalize(priv) } ] })); } throw (new Error('Key derivation not supported from ' + this.type + ' to ' + newType)); }; PrivateKey.prototype.createVerify = function (hashAlgo) { return (this.toPublic().createVerify(hashAlgo)); }; PrivateKey.prototype.createSign = function (hashAlgo) { if (hashAlgo === undefined) hashAlgo = this.defaultHashAlgorithm(); assert.string(hashAlgo, 'hash algorithm'); /* ED25519 is not supported by OpenSSL, use a javascript impl. */ if (this.type === 'ed25519' && edCompat !== undefined) return (new edCompat.Signer(this, hashAlgo)); if (this.type === 'curve25519') throw (new Error('Curve25519 keys are not suitable for ' + 'signing or verification')); var v, nm, err; try { nm = hashAlgo.toUpperCase(); v = crypto.createSign(nm); } catch (e) { err = e; } if (v === undefined || (err instanceof Error && err.message.match(/Unknown message digest/))) { nm = 'RSA-'; nm += hashAlgo.toUpperCase(); v = crypto.createSign(nm); } assert.ok(v, 'failed to create verifier'); var oldSign = v.sign.bind(v); var key = this.toBuffer('pkcs1'); var type = this.type; var curve = this.curve; v.sign = function () { var sig = oldSign(key); if (typeof (sig) === 'string') sig = Buffer.from(sig, 'binary'); sig = Signature.parse(sig, type, 'asn1'); sig.hashAlgorithm = hashAlgo; sig.curve = curve; return (sig); }; return (v); }; PrivateKey.parse = function (data, format, options) { if (typeof (data) !== 'string') assert.buffer(data, 'data'); if (format === undefined) format = 'auto'; assert.string(format, 'format'); if (typeof (options) === 'string') options = { filename: options }; assert.optionalObject(options, 'options'); if (options === undefined) options = {}; assert.optionalString(options.filename, 'options.filename'); if (options.filename === undefined) options.filename = '(unnamed)'; assert.object(formats[format], 'formats[format]'); try { var k = formats[format].read(data, options); assert.ok(k instanceof PrivateKey, 'key is not a private key'); if (!k.comment) k.comment = options.filename; return (k); } catch (e) { if (e.name === 'KeyEncryptedError') throw (e); throw (new KeyParseError(options.filename, format, e)); } }; PrivateKey.isPrivateKey = function (obj, ver) { return (utils.isCompatible(obj, PrivateKey, ver)); }; PrivateKey.generate = function (type, options) { if (options === undefined) options = {}; assert.object(options, 'options'); switch (type) { case 'ecdsa': if (options.curve === undefined) options.curve = 'nistp256'; assert.string(options.curve, 'options.curve'); return (generateECDSA(options.curve)); case 'ed25519': return (generateED25519()); default: throw (new Error('Key generation not supported with key ' + 'type "' + type + '"')); } }; /* * API versions for PrivateKey: * [1,0] -- initial ver * [1,1] -- added auto, pkcs[18], openssh/ssh-private formats * [1,2] -- added defaultHashAlgorithm * [1,3] -- added derive, ed, createDH * [1,4] -- first tagged version * [1,5] -- changed ed25519 part names and format * [1,6] -- type arguments for hash() and fingerprint() */ PrivateKey.prototype._sshpkApiVersion = [1, 6]; PrivateKey._oldVersionDetect = function (obj) { assert.func(obj.toPublic); assert.func(obj.createSign); if (obj.derive) return ([1, 3]); if (obj.defaultHashAlgorithm) return ([1, 2]); if (obj.formats['auto']) return ([1, 1]); return ([1, 0]); }; /***/ }), /***/ 512: /***/ (function(module) { module.exports = {"application/1d-interleaved-parityfec":{"source":"iana"},"application/3gpdash-qoe-report+xml":{"source":"iana","compressible":true},"application/3gpp-ims+xml":{"source":"iana","compressible":true},"application/a2l":{"source":"iana"},"application/activemessage":{"source":"iana"},"application/activity+json":{"source":"iana","compressible":true},"application/alto-costmap+json":{"source":"iana","compressible":true},"application/alto-costmapfilter+json":{"source":"iana","compressible":true},"application/alto-directory+json":{"source":"iana","compressible":true},"application/alto-endpointcost+json":{"source":"iana","compressible":true},"application/alto-endpointcostparams+json":{"source":"iana","compressible":true},"application/alto-endpointprop+json":{"source":"iana","compressible":true},"application/alto-endpointpropparams+json":{"source":"iana","compressible":true},"application/alto-error+json":{"source":"iana","compressible":true},"application/alto-networkmap+json":{"source":"iana","compressible":true},"application/alto-networkmapfilter+json":{"source":"iana","compressible":true},"application/aml":{"source":"iana"},"application/andrew-inset":{"source":"iana","extensions":["ez"]},"application/applefile":{"source":"iana"},"application/applixware":{"source":"apache","extensions":["aw"]},"application/atf":{"source":"iana"},"application/atfx":{"source":"iana"},"application/atom+xml":{"source":"iana","compressible":true,"extensions":["atom"]},"application/atomcat+xml":{"source":"iana","compressible":true,"extensions":["atomcat"]},"application/atomdeleted+xml":{"source":"iana","compressible":true,"extensions":["atomdeleted"]},"application/atomicmail":{"source":"iana"},"application/atomsvc+xml":{"source":"iana","compressible":true,"extensions":["atomsvc"]},"application/atsc-dwd+xml":{"source":"iana","compressible":true,"extensions":["dwd"]},"application/atsc-held+xml":{"source":"iana","compressible":true,"extensions":["held"]},"application/atsc-rdt+json":{"source":"iana","compressible":true},"application/atsc-rsat+xml":{"source":"iana","compressible":true,"extensions":["rsat"]},"application/atxml":{"source":"iana"},"application/auth-policy+xml":{"source":"iana","compressible":true},"application/bacnet-xdd+zip":{"source":"iana","compressible":false},"application/batch-smtp":{"source":"iana"},"application/bdoc":{"compressible":false,"extensions":["bdoc"]},"application/beep+xml":{"source":"iana","compressible":true},"application/calendar+json":{"source":"iana","compressible":true},"application/calendar+xml":{"source":"iana","compressible":true,"extensions":["xcs"]},"application/call-completion":{"source":"iana"},"application/cals-1840":{"source":"iana"},"application/cbor":{"source":"iana"},"application/cbor-seq":{"source":"iana"},"application/cccex":{"source":"iana"},"application/ccmp+xml":{"source":"iana","compressible":true},"application/ccxml+xml":{"source":"iana","compressible":true,"extensions":["ccxml"]},"application/cdfx+xml":{"source":"iana","compressible":true,"extensions":["cdfx"]},"application/cdmi-capability":{"source":"iana","extensions":["cdmia"]},"application/cdmi-container":{"source":"iana","extensions":["cdmic"]},"application/cdmi-domain":{"source":"iana","extensions":["cdmid"]},"application/cdmi-object":{"source":"iana","extensions":["cdmio"]},"application/cdmi-queue":{"source":"iana","extensions":["cdmiq"]},"application/cdni":{"source":"iana"},"application/cea":{"source":"iana"},"application/cea-2018+xml":{"source":"iana","compressible":true},"application/cellml+xml":{"source":"iana","compressible":true},"application/cfw":{"source":"iana"},"application/clue+xml":{"source":"iana","compressible":true},"application/clue_info+xml":{"source":"iana","compressible":true},"application/cms":{"source":"iana"},"application/cnrp+xml":{"source":"iana","compressible":true},"application/coap-group+json":{"source":"iana","compressible":true},"application/coap-payload":{"source":"iana"},"application/commonground":{"source":"iana"},"application/conference-info+xml":{"source":"iana","compressible":true},"application/cose":{"source":"iana"},"application/cose-key":{"source":"iana"},"application/cose-key-set":{"source":"iana"},"application/cpl+xml":{"source":"iana","compressible":true},"application/csrattrs":{"source":"iana"},"application/csta+xml":{"source":"iana","compressible":true},"application/cstadata+xml":{"source":"iana","compressible":true},"application/csvm+json":{"source":"iana","compressible":true},"application/cu-seeme":{"source":"apache","extensions":["cu"]},"application/cwt":{"source":"iana"},"application/cybercash":{"source":"iana"},"application/dart":{"compressible":true},"application/dash+xml":{"source":"iana","compressible":true,"extensions":["mpd"]},"application/dashdelta":{"source":"iana"},"application/davmount+xml":{"source":"iana","compressible":true,"extensions":["davmount"]},"application/dca-rft":{"source":"iana"},"application/dcd":{"source":"iana"},"application/dec-dx":{"source":"iana"},"application/dialog-info+xml":{"source":"iana","compressible":true},"application/dicom":{"source":"iana"},"application/dicom+json":{"source":"iana","compressible":true},"application/dicom+xml":{"source":"iana","compressible":true},"application/dii":{"source":"iana"},"application/dit":{"source":"iana"},"application/dns":{"source":"iana"},"application/dns+json":{"source":"iana","compressible":true},"application/dns-message":{"source":"iana"},"application/docbook+xml":{"source":"apache","compressible":true,"extensions":["dbk"]},"application/dskpp+xml":{"source":"iana","compressible":true},"application/dssc+der":{"source":"iana","extensions":["dssc"]},"application/dssc+xml":{"source":"iana","compressible":true,"extensions":["xdssc"]},"application/dvcs":{"source":"iana"},"application/ecmascript":{"source":"iana","compressible":true,"extensions":["ecma","es"]},"application/edi-consent":{"source":"iana"},"application/edi-x12":{"source":"iana","compressible":false},"application/edifact":{"source":"iana","compressible":false},"application/efi":{"source":"iana"},"application/emergencycalldata.comment+xml":{"source":"iana","compressible":true},"application/emergencycalldata.control+xml":{"source":"iana","compressible":true},"application/emergencycalldata.deviceinfo+xml":{"source":"iana","compressible":true},"application/emergencycalldata.ecall.msd":{"source":"iana"},"application/emergencycalldata.providerinfo+xml":{"source":"iana","compressible":true},"application/emergencycalldata.serviceinfo+xml":{"source":"iana","compressible":true},"application/emergencycalldata.subscriberinfo+xml":{"source":"iana","compressible":true},"application/emergencycalldata.veds+xml":{"source":"iana","compressible":true},"application/emma+xml":{"source":"iana","compressible":true,"extensions":["emma"]},"application/emotionml+xml":{"source":"iana","compressible":true,"extensions":["emotionml"]},"application/encaprtp":{"source":"iana"},"application/epp+xml":{"source":"iana","compressible":true},"application/epub+zip":{"source":"iana","compressible":false,"extensions":["epub"]},"application/eshop":{"source":"iana"},"application/exi":{"source":"iana","extensions":["exi"]},"application/expect-ct-report+json":{"source":"iana","compressible":true},"application/fastinfoset":{"source":"iana"},"application/fastsoap":{"source":"iana"},"application/fdt+xml":{"source":"iana","compressible":true,"extensions":["fdt"]},"application/fhir+json":{"source":"iana","compressible":true},"application/fhir+xml":{"source":"iana","compressible":true},"application/fido.trusted-apps+json":{"compressible":true},"application/fits":{"source":"iana"},"application/flexfec":{"source":"iana"},"application/font-sfnt":{"source":"iana"},"application/font-tdpfr":{"source":"iana","extensions":["pfr"]},"application/font-woff":{"source":"iana","compressible":false},"application/framework-attributes+xml":{"source":"iana","compressible":true},"application/geo+json":{"source":"iana","compressible":true,"extensions":["geojson"]},"application/geo+json-seq":{"source":"iana"},"application/geopackage+sqlite3":{"source":"iana"},"application/geoxacml+xml":{"source":"iana","compressible":true},"application/gltf-buffer":{"source":"iana"},"application/gml+xml":{"source":"iana","compressible":true,"extensions":["gml"]},"application/gpx+xml":{"source":"apache","compressible":true,"extensions":["gpx"]},"application/gxf":{"source":"apache","extensions":["gxf"]},"application/gzip":{"source":"iana","compressible":false,"extensions":["gz"]},"application/h224":{"source":"iana"},"application/held+xml":{"source":"iana","compressible":true},"application/hjson":{"extensions":["hjson"]},"application/http":{"source":"iana"},"application/hyperstudio":{"source":"iana","extensions":["stk"]},"application/ibe-key-request+xml":{"source":"iana","compressible":true},"application/ibe-pkg-reply+xml":{"source":"iana","compressible":true},"application/ibe-pp-data":{"source":"iana"},"application/iges":{"source":"iana"},"application/im-iscomposing+xml":{"source":"iana","compressible":true},"application/index":{"source":"iana"},"application/index.cmd":{"source":"iana"},"application/index.obj":{"source":"iana"},"application/index.response":{"source":"iana"},"application/index.vnd":{"source":"iana"},"application/inkml+xml":{"source":"iana","compressible":true,"extensions":["ink","inkml"]},"application/iotp":{"source":"iana"},"application/ipfix":{"source":"iana","extensions":["ipfix"]},"application/ipp":{"source":"iana"},"application/isup":{"source":"iana"},"application/its+xml":{"source":"iana","compressible":true,"extensions":["its"]},"application/java-archive":{"source":"apache","compressible":false,"extensions":["jar","war","ear"]},"application/java-serialized-object":{"source":"apache","compressible":false,"extensions":["ser"]},"application/java-vm":{"source":"apache","compressible":false,"extensions":["class"]},"application/javascript":{"source":"iana","charset":"UTF-8","compressible":true,"extensions":["js","mjs"]},"application/jf2feed+json":{"source":"iana","compressible":true},"application/jose":{"source":"iana"},"application/jose+json":{"source":"iana","compressible":true},"application/jrd+json":{"source":"iana","compressible":true},"application/json":{"source":"iana","charset":"UTF-8","compressible":true,"extensions":["json","map"]},"application/json-patch+json":{"source":"iana","compressible":true},"application/json-seq":{"source":"iana"},"application/json5":{"extensions":["json5"]},"application/jsonml+json":{"source":"apache","compressible":true,"extensions":["jsonml"]},"application/jwk+json":{"source":"iana","compressible":true},"application/jwk-set+json":{"source":"iana","compressible":true},"application/jwt":{"source":"iana"},"application/kpml-request+xml":{"source":"iana","compressible":true},"application/kpml-response+xml":{"source":"iana","compressible":true},"application/ld+json":{"source":"iana","compressible":true,"extensions":["jsonld"]},"application/lgr+xml":{"source":"iana","compressible":true,"extensions":["lgr"]},"application/link-format":{"source":"iana"},"application/load-control+xml":{"source":"iana","compressible":true},"application/lost+xml":{"source":"iana","compressible":true,"extensions":["lostxml"]},"application/lostsync+xml":{"source":"iana","compressible":true},"application/lxf":{"source":"iana"},"application/mac-binhex40":{"source":"iana","extensions":["hqx"]},"application/mac-compactpro":{"source":"apache","extensions":["cpt"]},"application/macwriteii":{"source":"iana"},"application/mads+xml":{"source":"iana","compressible":true,"extensions":["mads"]},"application/manifest+json":{"charset":"UTF-8","compressible":true,"extensions":["webmanifest"]},"application/marc":{"source":"iana","extensions":["mrc"]},"application/marcxml+xml":{"source":"iana","compressible":true,"extensions":["mrcx"]},"application/mathematica":{"source":"iana","extensions":["ma","nb","mb"]},"application/mathml+xml":{"source":"iana","compressible":true,"extensions":["mathml"]},"application/mathml-content+xml":{"source":"iana","compressible":true},"application/mathml-presentation+xml":{"source":"iana","compressible":true},"application/mbms-associated-procedure-description+xml":{"source":"iana","compressible":true},"application/mbms-deregister+xml":{"source":"iana","compressible":true},"application/mbms-envelope+xml":{"source":"iana","compressible":true},"application/mbms-msk+xml":{"source":"iana","compressible":true},"application/mbms-msk-response+xml":{"source":"iana","compressible":true},"application/mbms-protection-description+xml":{"source":"iana","compressible":true},"application/mbms-reception-report+xml":{"source":"iana","compressible":true},"application/mbms-register+xml":{"source":"iana","compressible":true},"application/mbms-register-response+xml":{"source":"iana","compressible":true},"application/mbms-schedule+xml":{"source":"iana","compressible":true},"application/mbms-user-service-description+xml":{"source":"iana","compressible":true},"application/mbox":{"source":"iana","extensions":["mbox"]},"application/media-policy-dataset+xml":{"source":"iana","compressible":true},"application/media_control+xml":{"source":"iana","compressible":true},"application/mediaservercontrol+xml":{"source":"iana","compressible":true,"extensions":["mscml"]},"application/merge-patch+json":{"source":"iana","compressible":true},"application/metalink+xml":{"source":"apache","compressible":true,"extensions":["metalink"]},"application/metalink4+xml":{"source":"iana","compressible":true,"extensions":["meta4"]},"application/mets+xml":{"source":"iana","compressible":true,"extensions":["mets"]},"application/mf4":{"source":"iana"},"application/mikey":{"source":"iana"},"application/mipc":{"source":"iana"},"application/mmt-aei+xml":{"source":"iana","compressible":true,"extensions":["maei"]},"application/mmt-usd+xml":{"source":"iana","compressible":true,"extensions":["musd"]},"application/mods+xml":{"source":"iana","compressible":true,"extensions":["mods"]},"application/moss-keys":{"source":"iana"},"application/moss-signature":{"source":"iana"},"application/mosskey-data":{"source":"iana"},"application/mosskey-request":{"source":"iana"},"application/mp21":{"source":"iana","extensions":["m21","mp21"]},"application/mp4":{"source":"iana","extensions":["mp4s","m4p"]},"application/mpeg4-generic":{"source":"iana"},"application/mpeg4-iod":{"source":"iana"},"application/mpeg4-iod-xmt":{"source":"iana"},"application/mrb-consumer+xml":{"source":"iana","compressible":true,"extensions":["xdf"]},"application/mrb-publish+xml":{"source":"iana","compressible":true,"extensions":["xdf"]},"application/msc-ivr+xml":{"source":"iana","compressible":true},"application/msc-mixer+xml":{"source":"iana","compressible":true},"application/msword":{"source":"iana","compressible":false,"extensions":["doc","dot"]},"application/mud+json":{"source":"iana","compressible":true},"application/multipart-core":{"source":"iana"},"application/mxf":{"source":"iana","extensions":["mxf"]},"application/n-quads":{"source":"iana","extensions":["nq"]},"application/n-triples":{"source":"iana","extensions":["nt"]},"application/nasdata":{"source":"iana"},"application/news-checkgroups":{"source":"iana"},"application/news-groupinfo":{"source":"iana"},"application/news-transmission":{"source":"iana"},"application/nlsml+xml":{"source":"iana","compressible":true},"application/node":{"source":"iana"},"application/nss":{"source":"iana"},"application/ocsp-request":{"source":"iana"},"application/ocsp-response":{"source":"iana"},"application/octet-stream":{"source":"iana","compressible":false,"extensions":["bin","dms","lrf","mar","so","dist","distz","pkg","bpk","dump","elc","deploy","exe","dll","deb","dmg","iso","img","msi","msp","msm","buffer"]},"application/oda":{"source":"iana","extensions":["oda"]},"application/odm+xml":{"source":"iana","compressible":true},"application/odx":{"source":"iana"},"application/oebps-package+xml":{"source":"iana","compressible":true,"extensions":["opf"]},"application/ogg":{"source":"iana","compressible":false,"extensions":["ogx"]},"application/omdoc+xml":{"source":"apache","compressible":true,"extensions":["omdoc"]},"application/onenote":{"source":"apache","extensions":["onetoc","onetoc2","onetmp","onepkg"]},"application/oscore":{"source":"iana"},"application/oxps":{"source":"iana","extensions":["oxps"]},"application/p2p-overlay+xml":{"source":"iana","compressible":true,"extensions":["relo"]},"application/parityfec":{"source":"iana"},"application/passport":{"source":"iana"},"application/patch-ops-error+xml":{"source":"iana","compressible":true,"extensions":["xer"]},"application/pdf":{"source":"iana","compressible":false,"extensions":["pdf"]},"application/pdx":{"source":"iana"},"application/pem-certificate-chain":{"source":"iana"},"application/pgp-encrypted":{"source":"iana","compressible":false,"extensions":["pgp"]},"application/pgp-keys":{"source":"iana"},"application/pgp-signature":{"source":"iana","extensions":["asc","sig"]},"application/pics-rules":{"source":"apache","extensions":["prf"]},"application/pidf+xml":{"source":"iana","compressible":true},"application/pidf-diff+xml":{"source":"iana","compressible":true},"application/pkcs10":{"source":"iana","extensions":["p10"]},"application/pkcs12":{"source":"iana"},"application/pkcs7-mime":{"source":"iana","extensions":["p7m","p7c"]},"application/pkcs7-signature":{"source":"iana","extensions":["p7s"]},"application/pkcs8":{"source":"iana","extensions":["p8"]},"application/pkcs8-encrypted":{"source":"iana"},"application/pkix-attr-cert":{"source":"iana","extensions":["ac"]},"application/pkix-cert":{"source":"iana","extensions":["cer"]},"application/pkix-crl":{"source":"iana","extensions":["crl"]},"application/pkix-pkipath":{"source":"iana","extensions":["pkipath"]},"application/pkixcmp":{"source":"iana","extensions":["pki"]},"application/pls+xml":{"source":"iana","compressible":true,"extensions":["pls"]},"application/poc-settings+xml":{"source":"iana","compressible":true},"application/postscript":{"source":"iana","compressible":true,"extensions":["ai","eps","ps"]},"application/ppsp-tracker+json":{"source":"iana","compressible":true},"application/problem+json":{"source":"iana","compressible":true},"application/problem+xml":{"source":"iana","compressible":true},"application/provenance+xml":{"source":"iana","compressible":true,"extensions":["provx"]},"application/prs.alvestrand.titrax-sheet":{"source":"iana"},"application/prs.cww":{"source":"iana","extensions":["cww"]},"application/prs.hpub+zip":{"source":"iana","compressible":false},"application/prs.nprend":{"source":"iana"},"application/prs.plucker":{"source":"iana"},"application/prs.rdf-xml-crypt":{"source":"iana"},"application/prs.xsf+xml":{"source":"iana","compressible":true},"application/pskc+xml":{"source":"iana","compressible":true,"extensions":["pskcxml"]},"application/qsig":{"source":"iana"},"application/raml+yaml":{"compressible":true,"extensions":["raml"]},"application/raptorfec":{"source":"iana"},"application/rdap+json":{"source":"iana","compressible":true},"application/rdf+xml":{"source":"iana","compressible":true,"extensions":["rdf","owl"]},"application/reginfo+xml":{"source":"iana","compressible":true,"extensions":["rif"]},"application/relax-ng-compact-syntax":{"source":"iana","extensions":["rnc"]},"application/remote-printing":{"source":"iana"},"application/reputon+json":{"source":"iana","compressible":true},"application/resource-lists+xml":{"source":"iana","compressible":true,"extensions":["rl"]},"application/resource-lists-diff+xml":{"source":"iana","compressible":true,"extensions":["rld"]},"application/rfc+xml":{"source":"iana","compressible":true},"application/riscos":{"source":"iana"},"application/rlmi+xml":{"source":"iana","compressible":true},"application/rls-services+xml":{"source":"iana","compressible":true,"extensions":["rs"]},"application/route-apd+xml":{"source":"iana","compressible":true,"extensions":["rapd"]},"application/route-s-tsid+xml":{"source":"iana","compressible":true,"extensions":["sls"]},"application/route-usd+xml":{"source":"iana","compressible":true,"extensions":["rusd"]},"application/rpki-ghostbusters":{"source":"iana","extensions":["gbr"]},"application/rpki-manifest":{"source":"iana","extensions":["mft"]},"application/rpki-publication":{"source":"iana"},"application/rpki-roa":{"source":"iana","extensions":["roa"]},"application/rpki-updown":{"source":"iana"},"application/rsd+xml":{"source":"apache","compressible":true,"extensions":["rsd"]},"application/rss+xml":{"source":"apache","compressible":true,"extensions":["rss"]},"application/rtf":{"source":"iana","compressible":true,"extensions":["rtf"]},"application/rtploopback":{"source":"iana"},"application/rtx":{"source":"iana"},"application/samlassertion+xml":{"source":"iana","compressible":true},"application/samlmetadata+xml":{"source":"iana","compressible":true},"application/sbml+xml":{"source":"iana","compressible":true,"extensions":["sbml"]},"application/scaip+xml":{"source":"iana","compressible":true},"application/scim+json":{"source":"iana","compressible":true},"application/scvp-cv-request":{"source":"iana","extensions":["scq"]},"application/scvp-cv-response":{"source":"iana","extensions":["scs"]},"application/scvp-vp-request":{"source":"iana","extensions":["spq"]},"application/scvp-vp-response":{"source":"iana","extensions":["spp"]},"application/sdp":{"source":"iana","extensions":["sdp"]},"application/secevent+jwt":{"source":"iana"},"application/senml+cbor":{"source":"iana"},"application/senml+json":{"source":"iana","compressible":true},"application/senml+xml":{"source":"iana","compressible":true,"extensions":["senmlx"]},"application/senml-exi":{"source":"iana"},"application/sensml+cbor":{"source":"iana"},"application/sensml+json":{"source":"iana","compressible":true},"application/sensml+xml":{"source":"iana","compressible":true,"extensions":["sensmlx"]},"application/sensml-exi":{"source":"iana"},"application/sep+xml":{"source":"iana","compressible":true},"application/sep-exi":{"source":"iana"},"application/session-info":{"source":"iana"},"application/set-payment":{"source":"iana"},"application/set-payment-initiation":{"source":"iana","extensions":["setpay"]},"application/set-registration":{"source":"iana"},"application/set-registration-initiation":{"source":"iana","extensions":["setreg"]},"application/sgml":{"source":"iana"},"application/sgml-open-catalog":{"source":"iana"},"application/shf+xml":{"source":"iana","compressible":true,"extensions":["shf"]},"application/sieve":{"source":"iana","extensions":["siv","sieve"]},"application/simple-filter+xml":{"source":"iana","compressible":true},"application/simple-message-summary":{"source":"iana"},"application/simplesymbolcontainer":{"source":"iana"},"application/sipc":{"source":"iana"},"application/slate":{"source":"iana"},"application/smil":{"source":"iana"},"application/smil+xml":{"source":"iana","compressible":true,"extensions":["smi","smil"]},"application/smpte336m":{"source":"iana"},"application/soap+fastinfoset":{"source":"iana"},"application/soap+xml":{"source":"iana","compressible":true},"application/sparql-query":{"source":"iana","extensions":["rq"]},"application/sparql-results+xml":{"source":"iana","compressible":true,"extensions":["srx"]},"application/spirits-event+xml":{"source":"iana","compressible":true},"application/sql":{"source":"iana"},"application/srgs":{"source":"iana","extensions":["gram"]},"application/srgs+xml":{"source":"iana","compressible":true,"extensions":["grxml"]},"application/sru+xml":{"source":"iana","compressible":true,"extensions":["sru"]},"application/ssdl+xml":{"source":"apache","compressible":true,"extensions":["ssdl"]},"application/ssml+xml":{"source":"iana","compressible":true,"extensions":["ssml"]},"application/stix+json":{"source":"iana","compressible":true},"application/swid+xml":{"source":"iana","compressible":true,"extensions":["swidtag"]},"application/tamp-apex-update":{"source":"iana"},"application/tamp-apex-update-confirm":{"source":"iana"},"application/tamp-community-update":{"source":"iana"},"application/tamp-community-update-confirm":{"source":"iana"},"application/tamp-error":{"source":"iana"},"application/tamp-sequence-adjust":{"source":"iana"},"application/tamp-sequence-adjust-confirm":{"source":"iana"},"application/tamp-status-query":{"source":"iana"},"application/tamp-status-response":{"source":"iana"},"application/tamp-update":{"source":"iana"},"application/tamp-update-confirm":{"source":"iana"},"application/tar":{"compressible":true},"application/taxii+json":{"source":"iana","compressible":true},"application/tei+xml":{"source":"iana","compressible":true,"extensions":["tei","teicorpus"]},"application/tetra_isi":{"source":"iana"},"application/thraud+xml":{"source":"iana","compressible":true,"extensions":["tfi"]},"application/timestamp-query":{"source":"iana"},"application/timestamp-reply":{"source":"iana"},"application/timestamped-data":{"source":"iana","extensions":["tsd"]},"application/tlsrpt+gzip":{"source":"iana"},"application/tlsrpt+json":{"source":"iana","compressible":true},"application/tnauthlist":{"source":"iana"},"application/toml":{"compressible":true,"extensions":["toml"]},"application/trickle-ice-sdpfrag":{"source":"iana"},"application/trig":{"source":"iana"},"application/ttml+xml":{"source":"iana","compressible":true,"extensions":["ttml"]},"application/tve-trigger":{"source":"iana"},"application/tzif":{"source":"iana"},"application/tzif-leap":{"source":"iana"},"application/ulpfec":{"source":"iana"},"application/urc-grpsheet+xml":{"source":"iana","compressible":true},"application/urc-ressheet+xml":{"source":"iana","compressible":true,"extensions":["rsheet"]},"application/urc-targetdesc+xml":{"source":"iana","compressible":true},"application/urc-uisocketdesc+xml":{"source":"iana","compressible":true},"application/vcard+json":{"source":"iana","compressible":true},"application/vcard+xml":{"source":"iana","compressible":true},"application/vemmi":{"source":"iana"},"application/vividence.scriptfile":{"source":"apache"},"application/vnd.1000minds.decision-model+xml":{"source":"iana","compressible":true,"extensions":["1km"]},"application/vnd.3gpp-prose+xml":{"source":"iana","compressible":true},"application/vnd.3gpp-prose-pc3ch+xml":{"source":"iana","compressible":true},"application/vnd.3gpp-v2x-local-service-information":{"source":"iana"},"application/vnd.3gpp.access-transfer-events+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.bsf+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.gmop+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mc-signalling-ear":{"source":"iana"},"application/vnd.3gpp.mcdata-affiliation-command+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcdata-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcdata-payload":{"source":"iana"},"application/vnd.3gpp.mcdata-service-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcdata-signalling":{"source":"iana"},"application/vnd.3gpp.mcdata-ue-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcdata-user-profile+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-affiliation-command+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-floor-request+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-location-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-mbms-usage-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-service-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-signed+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-ue-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-ue-init-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-user-profile+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-affiliation-command+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-affiliation-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-location-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-mbms-usage-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-service-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-transmission-request+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-ue-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-user-profile+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mid-call+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.pic-bw-large":{"source":"iana","extensions":["plb"]},"application/vnd.3gpp.pic-bw-small":{"source":"iana","extensions":["psb"]},"application/vnd.3gpp.pic-bw-var":{"source":"iana","extensions":["pvb"]},"application/vnd.3gpp.sms":{"source":"iana"},"application/vnd.3gpp.sms+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.srvcc-ext+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.srvcc-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.state-and-event-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.ussd+xml":{"source":"iana","compressible":true},"application/vnd.3gpp2.bcmcsinfo+xml":{"source":"iana","compressible":true},"application/vnd.3gpp2.sms":{"source":"iana"},"application/vnd.3gpp2.tcap":{"source":"iana","extensions":["tcap"]},"application/vnd.3lightssoftware.imagescal":{"source":"iana"},"application/vnd.3m.post-it-notes":{"source":"iana","extensions":["pwn"]},"application/vnd.accpac.simply.aso":{"source":"iana","extensions":["aso"]},"application/vnd.accpac.simply.imp":{"source":"iana","extensions":["imp"]},"application/vnd.acucobol":{"source":"iana","extensions":["acu"]},"application/vnd.acucorp":{"source":"iana","extensions":["atc","acutc"]},"application/vnd.adobe.air-application-installer-package+zip":{"source":"apache","compressible":false,"extensions":["air"]},"application/vnd.adobe.flash.movie":{"source":"iana"},"application/vnd.adobe.formscentral.fcdt":{"source":"iana","extensions":["fcdt"]},"application/vnd.adobe.fxp":{"source":"iana","extensions":["fxp","fxpl"]},"application/vnd.adobe.partial-upload":{"source":"iana"},"application/vnd.adobe.xdp+xml":{"source":"iana","compressible":true,"extensions":["xdp"]},"application/vnd.adobe.xfdf":{"source":"iana","extensions":["xfdf"]},"application/vnd.aether.imp":{"source":"iana"},"application/vnd.afpc.afplinedata":{"source":"iana"},"application/vnd.afpc.afplinedata-pagedef":{"source":"iana"},"application/vnd.afpc.foca-charset":{"source":"iana"},"application/vnd.afpc.foca-codedfont":{"source":"iana"},"application/vnd.afpc.foca-codepage":{"source":"iana"},"application/vnd.afpc.modca":{"source":"iana"},"application/vnd.afpc.modca-formdef":{"source":"iana"},"application/vnd.afpc.modca-mediummap":{"source":"iana"},"application/vnd.afpc.modca-objectcontainer":{"source":"iana"},"application/vnd.afpc.modca-overlay":{"source":"iana"},"application/vnd.afpc.modca-pagesegment":{"source":"iana"},"application/vnd.ah-barcode":{"source":"iana"},"application/vnd.ahead.space":{"source":"iana","extensions":["ahead"]},"application/vnd.airzip.filesecure.azf":{"source":"iana","extensions":["azf"]},"application/vnd.airzip.filesecure.azs":{"source":"iana","extensions":["azs"]},"application/vnd.amadeus+json":{"source":"iana","compressible":true},"application/vnd.amazon.ebook":{"source":"apache","extensions":["azw"]},"application/vnd.amazon.mobi8-ebook":{"source":"iana"},"application/vnd.americandynamics.acc":{"source":"iana","extensions":["acc"]},"application/vnd.amiga.ami":{"source":"iana","extensions":["ami"]},"application/vnd.amundsen.maze+xml":{"source":"iana","compressible":true},"application/vnd.android.ota":{"source":"iana"},"application/vnd.android.package-archive":{"source":"apache","compressible":false,"extensions":["apk"]},"application/vnd.anki":{"source":"iana"},"application/vnd.anser-web-certificate-issue-initiation":{"source":"iana","extensions":["cii"]},"application/vnd.anser-web-funds-transfer-initiation":{"source":"apache","extensions":["fti"]},"application/vnd.antix.game-component":{"source":"iana","extensions":["atx"]},"application/vnd.apache.thrift.binary":{"source":"iana"},"application/vnd.apache.thrift.compact":{"source":"iana"},"application/vnd.apache.thrift.json":{"source":"iana"},"application/vnd.api+json":{"source":"iana","compressible":true},"application/vnd.aplextor.warrp+json":{"source":"iana","compressible":true},"application/vnd.apothekende.reservation+json":{"source":"iana","compressible":true},"application/vnd.apple.installer+xml":{"source":"iana","compressible":true,"extensions":["mpkg"]},"application/vnd.apple.keynote":{"source":"iana","extensions":["keynote"]},"application/vnd.apple.mpegurl":{"source":"iana","extensions":["m3u8"]},"application/vnd.apple.numbers":{"source":"iana","extensions":["numbers"]},"application/vnd.apple.pages":{"source":"iana","extensions":["pages"]},"application/vnd.apple.pkpass":{"compressible":false,"extensions":["pkpass"]},"application/vnd.arastra.swi":{"source":"iana"},"application/vnd.aristanetworks.swi":{"source":"iana","extensions":["swi"]},"application/vnd.artisan+json":{"source":"iana","compressible":true},"application/vnd.artsquare":{"source":"iana"},"application/vnd.astraea-software.iota":{"source":"iana","extensions":["iota"]},"application/vnd.audiograph":{"source":"iana","extensions":["aep"]},"application/vnd.autopackage":{"source":"iana"},"application/vnd.avalon+json":{"source":"iana","compressible":true},"application/vnd.avistar+xml":{"source":"iana","compressible":true},"application/vnd.balsamiq.bmml+xml":{"source":"iana","compressible":true,"extensions":["bmml"]},"application/vnd.balsamiq.bmpr":{"source":"iana"},"application/vnd.banana-accounting":{"source":"iana"},"application/vnd.bbf.usp.error":{"source":"iana"},"application/vnd.bbf.usp.msg":{"source":"iana"},"application/vnd.bbf.usp.msg+json":{"source":"iana","compressible":true},"application/vnd.bekitzur-stech+json":{"source":"iana","compressible":true},"application/vnd.bint.med-content":{"source":"iana"},"application/vnd.biopax.rdf+xml":{"source":"iana","compressible":true},"application/vnd.blink-idb-value-wrapper":{"source":"iana"},"application/vnd.blueice.multipass":{"source":"iana","extensions":["mpm"]},"application/vnd.bluetooth.ep.oob":{"source":"iana"},"application/vnd.bluetooth.le.oob":{"source":"iana"},"application/vnd.bmi":{"source":"iana","extensions":["bmi"]},"application/vnd.bpf":{"source":"iana"},"application/vnd.bpf3":{"source":"iana"},"application/vnd.businessobjects":{"source":"iana","extensions":["rep"]},"application/vnd.byu.uapi+json":{"source":"iana","compressible":true},"application/vnd.cab-jscript":{"source":"iana"},"application/vnd.canon-cpdl":{"source":"iana"},"application/vnd.canon-lips":{"source":"iana"},"application/vnd.capasystems-pg+json":{"source":"iana","compressible":true},"application/vnd.cendio.thinlinc.clientconf":{"source":"iana"},"application/vnd.century-systems.tcp_stream":{"source":"iana"},"application/vnd.chemdraw+xml":{"source":"iana","compressible":true,"extensions":["cdxml"]},"application/vnd.chess-pgn":{"source":"iana"},"application/vnd.chipnuts.karaoke-mmd":{"source":"iana","extensions":["mmd"]},"application/vnd.ciedi":{"source":"iana"},"application/vnd.cinderella":{"source":"iana","extensions":["cdy"]},"application/vnd.cirpack.isdn-ext":{"source":"iana"},"application/vnd.citationstyles.style+xml":{"source":"iana","compressible":true,"extensions":["csl"]},"application/vnd.claymore":{"source":"iana","extensions":["cla"]},"application/vnd.cloanto.rp9":{"source":"iana","extensions":["rp9"]},"application/vnd.clonk.c4group":{"source":"iana","extensions":["c4g","c4d","c4f","c4p","c4u"]},"application/vnd.cluetrust.cartomobile-config":{"source":"iana","extensions":["c11amc"]},"application/vnd.cluetrust.cartomobile-config-pkg":{"source":"iana","extensions":["c11amz"]},"application/vnd.coffeescript":{"source":"iana"},"application/vnd.collabio.xodocuments.document":{"source":"iana"},"application/vnd.collabio.xodocuments.document-template":{"source":"iana"},"application/vnd.collabio.xodocuments.presentation":{"source":"iana"},"application/vnd.collabio.xodocuments.presentation-template":{"source":"iana"},"application/vnd.collabio.xodocuments.spreadsheet":{"source":"iana"},"application/vnd.collabio.xodocuments.spreadsheet-template":{"source":"iana"},"application/vnd.collection+json":{"source":"iana","compressible":true},"application/vnd.collection.doc+json":{"source":"iana","compressible":true},"application/vnd.collection.next+json":{"source":"iana","compressible":true},"application/vnd.comicbook+zip":{"source":"iana","compressible":false},"application/vnd.comicbook-rar":{"source":"iana"},"application/vnd.commerce-battelle":{"source":"iana"},"application/vnd.commonspace":{"source":"iana","extensions":["csp"]},"application/vnd.contact.cmsg":{"source":"iana","extensions":["cdbcmsg"]},"application/vnd.coreos.ignition+json":{"source":"iana","compressible":true},"application/vnd.cosmocaller":{"source":"iana","extensions":["cmc"]},"application/vnd.crick.clicker":{"source":"iana","extensions":["clkx"]},"application/vnd.crick.clicker.keyboard":{"source":"iana","extensions":["clkk"]},"application/vnd.crick.clicker.palette":{"source":"iana","extensions":["clkp"]},"application/vnd.crick.clicker.template":{"source":"iana","extensions":["clkt"]},"application/vnd.crick.clicker.wordbank":{"source":"iana","extensions":["clkw"]},"application/vnd.criticaltools.wbs+xml":{"source":"iana","compressible":true,"extensions":["wbs"]},"application/vnd.cryptii.pipe+json":{"source":"iana","compressible":true},"application/vnd.crypto-shade-file":{"source":"iana"},"application/vnd.ctc-posml":{"source":"iana","extensions":["pml"]},"application/vnd.ctct.ws+xml":{"source":"iana","compressible":true},"application/vnd.cups-pdf":{"source":"iana"},"application/vnd.cups-postscript":{"source":"iana"},"application/vnd.cups-ppd":{"source":"iana","extensions":["ppd"]},"application/vnd.cups-raster":{"source":"iana"},"application/vnd.cups-raw":{"source":"iana"},"application/vnd.curl":{"source":"iana"},"application/vnd.curl.car":{"source":"apache","extensions":["car"]},"application/vnd.curl.pcurl":{"source":"apache","extensions":["pcurl"]},"application/vnd.cyan.dean.root+xml":{"source":"iana","compressible":true},"application/vnd.cybank":{"source":"iana"},"application/vnd.d2l.coursepackage1p0+zip":{"source":"iana","compressible":false},"application/vnd.dart":{"source":"iana","compressible":true,"extensions":["dart"]},"application/vnd.data-vision.rdz":{"source":"iana","extensions":["rdz"]},"application/vnd.datapackage+json":{"source":"iana","compressible":true},"application/vnd.dataresource+json":{"source":"iana","compressible":true},"application/vnd.debian.binary-package":{"source":"iana"},"application/vnd.dece.data":{"source":"iana","extensions":["uvf","uvvf","uvd","uvvd"]},"application/vnd.dece.ttml+xml":{"source":"iana","compressible":true,"extensions":["uvt","uvvt"]},"application/vnd.dece.unspecified":{"source":"iana","extensions":["uvx","uvvx"]},"application/vnd.dece.zip":{"source":"iana","extensions":["uvz","uvvz"]},"application/vnd.denovo.fcselayout-link":{"source":"iana","extensions":["fe_launch"]},"application/vnd.desmume.movie":{"source":"iana"},"application/vnd.dir-bi.plate-dl-nosuffix":{"source":"iana"},"application/vnd.dm.delegation+xml":{"source":"iana","compressible":true},"application/vnd.dna":{"source":"iana","extensions":["dna"]},"application/vnd.document+json":{"source":"iana","compressible":true},"application/vnd.dolby.mlp":{"source":"apache","extensions":["mlp"]},"application/vnd.dolby.mobile.1":{"source":"iana"},"application/vnd.dolby.mobile.2":{"source":"iana"},"application/vnd.doremir.scorecloud-binary-document":{"source":"iana"},"application/vnd.dpgraph":{"source":"iana","extensions":["dpg"]},"application/vnd.dreamfactory":{"source":"iana","extensions":["dfac"]},"application/vnd.drive+json":{"source":"iana","compressible":true},"application/vnd.ds-keypoint":{"source":"apache","extensions":["kpxx"]},"application/vnd.dtg.local":{"source":"iana"},"application/vnd.dtg.local.flash":{"source":"iana"},"application/vnd.dtg.local.html":{"source":"iana"},"application/vnd.dvb.ait":{"source":"iana","extensions":["ait"]},"application/vnd.dvb.dvbj":{"source":"iana"},"application/vnd.dvb.esgcontainer":{"source":"iana"},"application/vnd.dvb.ipdcdftnotifaccess":{"source":"iana"},"application/vnd.dvb.ipdcesgaccess":{"source":"iana"},"application/vnd.dvb.ipdcesgaccess2":{"source":"iana"},"application/vnd.dvb.ipdcesgpdd":{"source":"iana"},"application/vnd.dvb.ipdcroaming":{"source":"iana"},"application/vnd.dvb.iptv.alfec-base":{"source":"iana"},"application/vnd.dvb.iptv.alfec-enhancement":{"source":"iana"},"application/vnd.dvb.notif-aggregate-root+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-container+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-generic+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-ia-msglist+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-ia-registration-request+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-ia-registration-response+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-init+xml":{"source":"iana","compressible":true},"application/vnd.dvb.pfr":{"source":"iana"},"application/vnd.dvb.service":{"source":"iana","extensions":["svc"]},"application/vnd.dxr":{"source":"iana"},"application/vnd.dynageo":{"source":"iana","extensions":["geo"]},"application/vnd.dzr":{"source":"iana"},"application/vnd.easykaraoke.cdgdownload":{"source":"iana"},"application/vnd.ecdis-update":{"source":"iana"},"application/vnd.ecip.rlp":{"source":"iana"},"application/vnd.ecowin.chart":{"source":"iana","extensions":["mag"]},"application/vnd.ecowin.filerequest":{"source":"iana"},"application/vnd.ecowin.fileupdate":{"source":"iana"},"application/vnd.ecowin.series":{"source":"iana"},"application/vnd.ecowin.seriesrequest":{"source":"iana"},"application/vnd.ecowin.seriesupdate":{"source":"iana"},"application/vnd.efi.img":{"source":"iana"},"application/vnd.efi.iso":{"source":"iana"},"application/vnd.emclient.accessrequest+xml":{"source":"iana","compressible":true},"application/vnd.enliven":{"source":"iana","extensions":["nml"]},"application/vnd.enphase.envoy":{"source":"iana"},"application/vnd.eprints.data+xml":{"source":"iana","compressible":true},"application/vnd.epson.esf":{"source":"iana","extensions":["esf"]},"application/vnd.epson.msf":{"source":"iana","extensions":["msf"]},"application/vnd.epson.quickanime":{"source":"iana","extensions":["qam"]},"application/vnd.epson.salt":{"source":"iana","extensions":["slt"]},"application/vnd.epson.ssf":{"source":"iana","extensions":["ssf"]},"application/vnd.ericsson.quickcall":{"source":"iana"},"application/vnd.espass-espass+zip":{"source":"iana","compressible":false},"application/vnd.eszigno3+xml":{"source":"iana","compressible":true,"extensions":["es3","et3"]},"application/vnd.etsi.aoc+xml":{"source":"iana","compressible":true},"application/vnd.etsi.asic-e+zip":{"source":"iana","compressible":false},"application/vnd.etsi.asic-s+zip":{"source":"iana","compressible":false},"application/vnd.etsi.cug+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvcommand+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvdiscovery+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvprofile+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvsad-bc+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvsad-cod+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvsad-npvr+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvservice+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvsync+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvueprofile+xml":{"source":"iana","compressible":true},"application/vnd.etsi.mcid+xml":{"source":"iana","compressible":true},"application/vnd.etsi.mheg5":{"source":"iana"},"application/vnd.etsi.overload-control-policy-dataset+xml":{"source":"iana","compressible":true},"application/vnd.etsi.pstn+xml":{"source":"iana","compressible":true},"application/vnd.etsi.sci+xml":{"source":"iana","compressible":true},"application/vnd.etsi.simservs+xml":{"source":"iana","compressible":true},"application/vnd.etsi.timestamp-token":{"source":"iana"},"application/vnd.etsi.tsl+xml":{"source":"iana","compressible":true},"application/vnd.etsi.tsl.der":{"source":"iana"},"application/vnd.eudora.data":{"source":"iana"},"application/vnd.evolv.ecig.profile":{"source":"iana"},"application/vnd.evolv.ecig.settings":{"source":"iana"},"application/vnd.evolv.ecig.theme":{"source":"iana"},"application/vnd.exstream-empower+zip":{"source":"iana","compressible":false},"application/vnd.exstream-package":{"source":"iana"},"application/vnd.ezpix-album":{"source":"iana","extensions":["ez2"]},"application/vnd.ezpix-package":{"source":"iana","extensions":["ez3"]},"application/vnd.f-secure.mobile":{"source":"iana"},"application/vnd.fastcopy-disk-image":{"source":"iana"},"application/vnd.fdf":{"source":"iana","extensions":["fdf"]},"application/vnd.fdsn.mseed":{"source":"iana","extensions":["mseed"]},"application/vnd.fdsn.seed":{"source":"iana","extensions":["seed","dataless"]},"application/vnd.ffsns":{"source":"iana"},"application/vnd.ficlab.flb+zip":{"source":"iana","compressible":false},"application/vnd.filmit.zfc":{"source":"iana"},"application/vnd.fints":{"source":"iana"},"application/vnd.firemonkeys.cloudcell":{"source":"iana"},"application/vnd.flographit":{"source":"iana","extensions":["gph"]},"application/vnd.fluxtime.clip":{"source":"iana","extensions":["ftc"]},"application/vnd.font-fontforge-sfd":{"source":"iana"},"application/vnd.framemaker":{"source":"iana","extensions":["fm","frame","maker","book"]},"application/vnd.frogans.fnc":{"source":"iana","extensions":["fnc"]},"application/vnd.frogans.ltf":{"source":"iana","extensions":["ltf"]},"application/vnd.fsc.weblaunch":{"source":"iana","extensions":["fsc"]},"application/vnd.fujitsu.oasys":{"source":"iana","extensions":["oas"]},"application/vnd.fujitsu.oasys2":{"source":"iana","extensions":["oa2"]},"application/vnd.fujitsu.oasys3":{"source":"iana","extensions":["oa3"]},"application/vnd.fujitsu.oasysgp":{"source":"iana","extensions":["fg5"]},"application/vnd.fujitsu.oasysprs":{"source":"iana","extensions":["bh2"]},"application/vnd.fujixerox.art-ex":{"source":"iana"},"application/vnd.fujixerox.art4":{"source":"iana"},"application/vnd.fujixerox.ddd":{"source":"iana","extensions":["ddd"]},"application/vnd.fujixerox.docuworks":{"source":"iana","extensions":["xdw"]},"application/vnd.fujixerox.docuworks.binder":{"source":"iana","extensions":["xbd"]},"application/vnd.fujixerox.docuworks.container":{"source":"iana"},"application/vnd.fujixerox.hbpl":{"source":"iana"},"application/vnd.fut-misnet":{"source":"iana"},"application/vnd.futoin+cbor":{"source":"iana"},"application/vnd.futoin+json":{"source":"iana","compressible":true},"application/vnd.fuzzysheet":{"source":"iana","extensions":["fzs"]},"application/vnd.genomatix.tuxedo":{"source":"iana","extensions":["txd"]},"application/vnd.gentics.grd+json":{"source":"iana","compressible":true},"application/vnd.geo+json":{"source":"iana","compressible":true},"application/vnd.geocube+xml":{"source":"iana","compressible":true},"application/vnd.geogebra.file":{"source":"iana","extensions":["ggb"]},"application/vnd.geogebra.tool":{"source":"iana","extensions":["ggt"]},"application/vnd.geometry-explorer":{"source":"iana","extensions":["gex","gre"]},"application/vnd.geonext":{"source":"iana","extensions":["gxt"]},"application/vnd.geoplan":{"source":"iana","extensions":["g2w"]},"application/vnd.geospace":{"source":"iana","extensions":["g3w"]},"application/vnd.gerber":{"source":"iana"},"application/vnd.globalplatform.card-content-mgt":{"source":"iana"},"application/vnd.globalplatform.card-content-mgt-response":{"source":"iana"},"application/vnd.gmx":{"source":"iana","extensions":["gmx"]},"application/vnd.google-apps.document":{"compressible":false,"extensions":["gdoc"]},"application/vnd.google-apps.presentation":{"compressible":false,"extensions":["gslides"]},"application/vnd.google-apps.spreadsheet":{"compressible":false,"extensions":["gsheet"]},"application/vnd.google-earth.kml+xml":{"source":"iana","compressible":true,"extensions":["kml"]},"application/vnd.google-earth.kmz":{"source":"iana","compressible":false,"extensions":["kmz"]},"application/vnd.gov.sk.e-form+xml":{"source":"iana","compressible":true},"application/vnd.gov.sk.e-form+zip":{"source":"iana","compressible":false},"application/vnd.gov.sk.xmldatacontainer+xml":{"source":"iana","compressible":true},"application/vnd.grafeq":{"source":"iana","extensions":["gqf","gqs"]},"application/vnd.gridmp":{"source":"iana"},"application/vnd.groove-account":{"source":"iana","extensions":["gac"]},"application/vnd.groove-help":{"source":"iana","extensions":["ghf"]},"application/vnd.groove-identity-message":{"source":"iana","extensions":["gim"]},"application/vnd.groove-injector":{"source":"iana","extensions":["grv"]},"application/vnd.groove-tool-message":{"source":"iana","extensions":["gtm"]},"application/vnd.groove-tool-template":{"source":"iana","extensions":["tpl"]},"application/vnd.groove-vcard":{"source":"iana","extensions":["vcg"]},"application/vnd.hal+json":{"source":"iana","compressible":true},"application/vnd.hal+xml":{"source":"iana","compressible":true,"extensions":["hal"]},"application/vnd.handheld-entertainment+xml":{"source":"iana","compressible":true,"extensions":["zmm"]},"application/vnd.hbci":{"source":"iana","extensions":["hbci"]},"application/vnd.hc+json":{"source":"iana","compressible":true},"application/vnd.hcl-bireports":{"source":"iana"},"application/vnd.hdt":{"source":"iana"},"application/vnd.heroku+json":{"source":"iana","compressible":true},"application/vnd.hhe.lesson-player":{"source":"iana","extensions":["les"]},"application/vnd.hp-hpgl":{"source":"iana","extensions":["hpgl"]},"application/vnd.hp-hpid":{"source":"iana","extensions":["hpid"]},"application/vnd.hp-hps":{"source":"iana","extensions":["hps"]},"application/vnd.hp-jlyt":{"source":"iana","extensions":["jlt"]},"application/vnd.hp-pcl":{"source":"iana","extensions":["pcl"]},"application/vnd.hp-pclxl":{"source":"iana","extensions":["pclxl"]},"application/vnd.httphone":{"source":"iana"},"application/vnd.hydrostatix.sof-data":{"source":"iana","extensions":["sfd-hdstx"]},"application/vnd.hyper+json":{"source":"iana","compressible":true},"application/vnd.hyper-item+json":{"source":"iana","compressible":true},"application/vnd.hyperdrive+json":{"source":"iana","compressible":true},"application/vnd.hzn-3d-crossword":{"source":"iana"},"application/vnd.ibm.afplinedata":{"source":"iana"},"application/vnd.ibm.electronic-media":{"source":"iana"},"application/vnd.ibm.minipay":{"source":"iana","extensions":["mpy"]},"application/vnd.ibm.modcap":{"source":"iana","extensions":["afp","listafp","list3820"]},"application/vnd.ibm.rights-management":{"source":"iana","extensions":["irm"]},"application/vnd.ibm.secure-container":{"source":"iana","extensions":["sc"]},"application/vnd.iccprofile":{"source":"iana","extensions":["icc","icm"]},"application/vnd.ieee.1905":{"source":"iana"},"application/vnd.igloader":{"source":"iana","extensions":["igl"]},"application/vnd.imagemeter.folder+zip":{"source":"iana","compressible":false},"application/vnd.imagemeter.image+zip":{"source":"iana","compressible":false},"application/vnd.immervision-ivp":{"source":"iana","extensions":["ivp"]},"application/vnd.immervision-ivu":{"source":"iana","extensions":["ivu"]},"application/vnd.ims.imsccv1p1":{"source":"iana"},"application/vnd.ims.imsccv1p2":{"source":"iana"},"application/vnd.ims.imsccv1p3":{"source":"iana"},"application/vnd.ims.lis.v2.result+json":{"source":"iana","compressible":true},"application/vnd.ims.lti.v2.toolconsumerprofile+json":{"source":"iana","compressible":true},"application/vnd.ims.lti.v2.toolproxy+json":{"source":"iana","compressible":true},"application/vnd.ims.lti.v2.toolproxy.id+json":{"source":"iana","compressible":true},"application/vnd.ims.lti.v2.toolsettings+json":{"source":"iana","compressible":true},"application/vnd.ims.lti.v2.toolsettings.simple+json":{"source":"iana","compressible":true},"application/vnd.informedcontrol.rms+xml":{"source":"iana","compressible":true},"application/vnd.informix-visionary":{"source":"iana"},"application/vnd.infotech.project":{"source":"iana"},"application/vnd.infotech.project+xml":{"source":"iana","compressible":true},"application/vnd.innopath.wamp.notification":{"source":"iana"},"application/vnd.insors.igm":{"source":"iana","extensions":["igm"]},"application/vnd.intercon.formnet":{"source":"iana","extensions":["xpw","xpx"]},"application/vnd.intergeo":{"source":"iana","extensions":["i2g"]},"application/vnd.intertrust.digibox":{"source":"iana"},"application/vnd.intertrust.nncp":{"source":"iana"},"application/vnd.intu.qbo":{"source":"iana","extensions":["qbo"]},"application/vnd.intu.qfx":{"source":"iana","extensions":["qfx"]},"application/vnd.iptc.g2.catalogitem+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.conceptitem+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.knowledgeitem+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.newsitem+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.newsmessage+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.packageitem+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.planningitem+xml":{"source":"iana","compressible":true},"application/vnd.ipunplugged.rcprofile":{"source":"iana","extensions":["rcprofile"]},"application/vnd.irepository.package+xml":{"source":"iana","compressible":true,"extensions":["irp"]},"application/vnd.is-xpr":{"source":"iana","extensions":["xpr"]},"application/vnd.isac.fcs":{"source":"iana","extensions":["fcs"]},"application/vnd.iso11783-10+zip":{"source":"iana","compressible":false},"application/vnd.jam":{"source":"iana","extensions":["jam"]},"application/vnd.japannet-directory-service":{"source":"iana"},"application/vnd.japannet-jpnstore-wakeup":{"source":"iana"},"application/vnd.japannet-payment-wakeup":{"source":"iana"},"application/vnd.japannet-registration":{"source":"iana"},"application/vnd.japannet-registration-wakeup":{"source":"iana"},"application/vnd.japannet-setstore-wakeup":{"source":"iana"},"application/vnd.japannet-verification":{"source":"iana"},"application/vnd.japannet-verification-wakeup":{"source":"iana"},"application/vnd.jcp.javame.midlet-rms":{"source":"iana","extensions":["rms"]},"application/vnd.jisp":{"source":"iana","extensions":["jisp"]},"application/vnd.joost.joda-archive":{"source":"iana","extensions":["joda"]},"application/vnd.jsk.isdn-ngn":{"source":"iana"},"application/vnd.kahootz":{"source":"iana","extensions":["ktz","ktr"]},"application/vnd.kde.karbon":{"source":"iana","extensions":["karbon"]},"application/vnd.kde.kchart":{"source":"iana","extensions":["chrt"]},"application/vnd.kde.kformula":{"source":"iana","extensions":["kfo"]},"application/vnd.kde.kivio":{"source":"iana","extensions":["flw"]},"application/vnd.kde.kontour":{"source":"iana","extensions":["kon"]},"application/vnd.kde.kpresenter":{"source":"iana","extensions":["kpr","kpt"]},"application/vnd.kde.kspread":{"source":"iana","extensions":["ksp"]},"application/vnd.kde.kword":{"source":"iana","extensions":["kwd","kwt"]},"application/vnd.kenameaapp":{"source":"iana","extensions":["htke"]},"application/vnd.kidspiration":{"source":"iana","extensions":["kia"]},"application/vnd.kinar":{"source":"iana","extensions":["kne","knp"]},"application/vnd.koan":{"source":"iana","extensions":["skp","skd","skt","skm"]},"application/vnd.kodak-descriptor":{"source":"iana","extensions":["sse"]},"application/vnd.las":{"source":"iana"},"application/vnd.las.las+json":{"source":"iana","compressible":true},"application/vnd.las.las+xml":{"source":"iana","compressible":true,"extensions":["lasxml"]},"application/vnd.laszip":{"source":"iana"},"application/vnd.leap+json":{"source":"iana","compressible":true},"application/vnd.liberty-request+xml":{"source":"iana","compressible":true},"application/vnd.llamagraphics.life-balance.desktop":{"source":"iana","extensions":["lbd"]},"application/vnd.llamagraphics.life-balance.exchange+xml":{"source":"iana","compressible":true,"extensions":["lbe"]},"application/vnd.logipipe.circuit+zip":{"source":"iana","compressible":false},"application/vnd.loom":{"source":"iana"},"application/vnd.lotus-1-2-3":{"source":"iana","extensions":["123"]},"application/vnd.lotus-approach":{"source":"iana","extensions":["apr"]},"application/vnd.lotus-freelance":{"source":"iana","extensions":["pre"]},"application/vnd.lotus-notes":{"source":"iana","extensions":["nsf"]},"application/vnd.lotus-organizer":{"source":"iana","extensions":["org"]},"application/vnd.lotus-screencam":{"source":"iana","extensions":["scm"]},"application/vnd.lotus-wordpro":{"source":"iana","extensions":["lwp"]},"application/vnd.macports.portpkg":{"source":"iana","extensions":["portpkg"]},"application/vnd.mapbox-vector-tile":{"source":"iana"},"application/vnd.marlin.drm.actiontoken+xml":{"source":"iana","compressible":true},"application/vnd.marlin.drm.conftoken+xml":{"source":"iana","compressible":true},"application/vnd.marlin.drm.license+xml":{"source":"iana","compressible":true},"application/vnd.marlin.drm.mdcf":{"source":"iana"},"application/vnd.mason+json":{"source":"iana","compressible":true},"application/vnd.maxmind.maxmind-db":{"source":"iana"},"application/vnd.mcd":{"source":"iana","extensions":["mcd"]},"application/vnd.medcalcdata":{"source":"iana","extensions":["mc1"]},"application/vnd.mediastation.cdkey":{"source":"iana","extensions":["cdkey"]},"application/vnd.meridian-slingshot":{"source":"iana"},"application/vnd.mfer":{"source":"iana","extensions":["mwf"]},"application/vnd.mfmp":{"source":"iana","extensions":["mfm"]},"application/vnd.micro+json":{"source":"iana","compressible":true},"application/vnd.micrografx.flo":{"source":"iana","extensions":["flo"]},"application/vnd.micrografx.igx":{"source":"iana","extensions":["igx"]},"application/vnd.microsoft.portable-executable":{"source":"iana"},"application/vnd.microsoft.windows.thumbnail-cache":{"source":"iana"},"application/vnd.miele+json":{"source":"iana","compressible":true},"application/vnd.mif":{"source":"iana","extensions":["mif"]},"application/vnd.minisoft-hp3000-save":{"source":"iana"},"application/vnd.mitsubishi.misty-guard.trustweb":{"source":"iana"},"application/vnd.mobius.daf":{"source":"iana","extensions":["daf"]},"application/vnd.mobius.dis":{"source":"iana","extensions":["dis"]},"application/vnd.mobius.mbk":{"source":"iana","extensions":["mbk"]},"application/vnd.mobius.mqy":{"source":"iana","extensions":["mqy"]},"application/vnd.mobius.msl":{"source":"iana","extensions":["msl"]},"application/vnd.mobius.plc":{"source":"iana","extensions":["plc"]},"application/vnd.mobius.txf":{"source":"iana","extensions":["txf"]},"application/vnd.mophun.application":{"source":"iana","extensions":["mpn"]},"application/vnd.mophun.certificate":{"source":"iana","extensions":["mpc"]},"application/vnd.motorola.flexsuite":{"source":"iana"},"application/vnd.motorola.flexsuite.adsi":{"source":"iana"},"application/vnd.motorola.flexsuite.fis":{"source":"iana"},"application/vnd.motorola.flexsuite.gotap":{"source":"iana"},"application/vnd.motorola.flexsuite.kmr":{"source":"iana"},"application/vnd.motorola.flexsuite.ttc":{"source":"iana"},"application/vnd.motorola.flexsuite.wem":{"source":"iana"},"application/vnd.motorola.iprm":{"source":"iana"},"application/vnd.mozilla.xul+xml":{"source":"iana","compressible":true,"extensions":["xul"]},"application/vnd.ms-3mfdocument":{"source":"iana"},"application/vnd.ms-artgalry":{"source":"iana","extensions":["cil"]},"application/vnd.ms-asf":{"source":"iana"},"application/vnd.ms-cab-compressed":{"source":"iana","extensions":["cab"]},"application/vnd.ms-color.iccprofile":{"source":"apache"},"application/vnd.ms-excel":{"source":"iana","compressible":false,"extensions":["xls","xlm","xla","xlc","xlt","xlw"]},"application/vnd.ms-excel.addin.macroenabled.12":{"source":"iana","extensions":["xlam"]},"application/vnd.ms-excel.sheet.binary.macroenabled.12":{"source":"iana","extensions":["xlsb"]},"application/vnd.ms-excel.sheet.macroenabled.12":{"source":"iana","extensions":["xlsm"]},"application/vnd.ms-excel.template.macroenabled.12":{"source":"iana","extensions":["xltm"]},"application/vnd.ms-fontobject":{"source":"iana","compressible":true,"extensions":["eot"]},"application/vnd.ms-htmlhelp":{"source":"iana","extensions":["chm"]},"application/vnd.ms-ims":{"source":"iana","extensions":["ims"]},"application/vnd.ms-lrm":{"source":"iana","extensions":["lrm"]},"application/vnd.ms-office.activex+xml":{"source":"iana","compressible":true},"application/vnd.ms-officetheme":{"source":"iana","extensions":["thmx"]},"application/vnd.ms-opentype":{"source":"apache","compressible":true},"application/vnd.ms-outlook":{"compressible":false,"extensions":["msg"]},"application/vnd.ms-package.obfuscated-opentype":{"source":"apache"},"application/vnd.ms-pki.seccat":{"source":"apache","extensions":["cat"]},"application/vnd.ms-pki.stl":{"source":"apache","extensions":["stl"]},"application/vnd.ms-playready.initiator+xml":{"source":"iana","compressible":true},"application/vnd.ms-powerpoint":{"source":"iana","compressible":false,"extensions":["ppt","pps","pot"]},"application/vnd.ms-powerpoint.addin.macroenabled.12":{"source":"iana","extensions":["ppam"]},"application/vnd.ms-powerpoint.presentation.macroenabled.12":{"source":"iana","extensions":["pptm"]},"application/vnd.ms-powerpoint.slide.macroenabled.12":{"source":"iana","extensions":["sldm"]},"application/vnd.ms-powerpoint.slideshow.macroenabled.12":{"source":"iana","extensions":["ppsm"]},"application/vnd.ms-powerpoint.template.macroenabled.12":{"source":"iana","extensions":["potm"]},"application/vnd.ms-printdevicecapabilities+xml":{"source":"iana","compressible":true},"application/vnd.ms-printing.printticket+xml":{"source":"apache","compressible":true},"application/vnd.ms-printschematicket+xml":{"source":"iana","compressible":true},"application/vnd.ms-project":{"source":"iana","extensions":["mpp","mpt"]},"application/vnd.ms-tnef":{"source":"iana"},"application/vnd.ms-windows.devicepairing":{"source":"iana"},"application/vnd.ms-windows.nwprinting.oob":{"source":"iana"},"application/vnd.ms-windows.printerpairing":{"source":"iana"},"application/vnd.ms-windows.wsd.oob":{"source":"iana"},"application/vnd.ms-wmdrm.lic-chlg-req":{"source":"iana"},"application/vnd.ms-wmdrm.lic-resp":{"source":"iana"},"application/vnd.ms-wmdrm.meter-chlg-req":{"source":"iana"},"application/vnd.ms-wmdrm.meter-resp":{"source":"iana"},"application/vnd.ms-word.document.macroenabled.12":{"source":"iana","extensions":["docm"]},"application/vnd.ms-word.template.macroenabled.12":{"source":"iana","extensions":["dotm"]},"application/vnd.ms-works":{"source":"iana","extensions":["wps","wks","wcm","wdb"]},"application/vnd.ms-wpl":{"source":"iana","extensions":["wpl"]},"application/vnd.ms-xpsdocument":{"source":"iana","compressible":false,"extensions":["xps"]},"application/vnd.msa-disk-image":{"source":"iana"},"application/vnd.mseq":{"source":"iana","extensions":["mseq"]},"application/vnd.msign":{"source":"iana"},"application/vnd.multiad.creator":{"source":"iana"},"application/vnd.multiad.creator.cif":{"source":"iana"},"application/vnd.music-niff":{"source":"iana"},"application/vnd.musician":{"source":"iana","extensions":["mus"]},"application/vnd.muvee.style":{"source":"iana","extensions":["msty"]},"application/vnd.mynfc":{"source":"iana","extensions":["taglet"]},"application/vnd.ncd.control":{"source":"iana"},"application/vnd.ncd.reference":{"source":"iana"},"application/vnd.nearst.inv+json":{"source":"iana","compressible":true},"application/vnd.nervana":{"source":"iana"},"application/vnd.netfpx":{"source":"iana"},"application/vnd.neurolanguage.nlu":{"source":"iana","extensions":["nlu"]},"application/vnd.nimn":{"source":"iana"},"application/vnd.nintendo.nitro.rom":{"source":"iana"},"application/vnd.nintendo.snes.rom":{"source":"iana"},"application/vnd.nitf":{"source":"iana","extensions":["ntf","nitf"]},"application/vnd.noblenet-directory":{"source":"iana","extensions":["nnd"]},"application/vnd.noblenet-sealer":{"source":"iana","extensions":["nns"]},"application/vnd.noblenet-web":{"source":"iana","extensions":["nnw"]},"application/vnd.nokia.catalogs":{"source":"iana"},"application/vnd.nokia.conml+wbxml":{"source":"iana"},"application/vnd.nokia.conml+xml":{"source":"iana","compressible":true},"application/vnd.nokia.iptv.config+xml":{"source":"iana","compressible":true},"application/vnd.nokia.isds-radio-presets":{"source":"iana"},"application/vnd.nokia.landmark+wbxml":{"source":"iana"},"application/vnd.nokia.landmark+xml":{"source":"iana","compressible":true},"application/vnd.nokia.landmarkcollection+xml":{"source":"iana","compressible":true},"application/vnd.nokia.n-gage.ac+xml":{"source":"iana","compressible":true,"extensions":["ac"]},"application/vnd.nokia.n-gage.data":{"source":"iana","extensions":["ngdat"]},"application/vnd.nokia.n-gage.symbian.install":{"source":"iana","extensions":["n-gage"]},"application/vnd.nokia.ncd":{"source":"iana"},"application/vnd.nokia.pcd+wbxml":{"source":"iana"},"application/vnd.nokia.pcd+xml":{"source":"iana","compressible":true},"application/vnd.nokia.radio-preset":{"source":"iana","extensions":["rpst"]},"application/vnd.nokia.radio-presets":{"source":"iana","extensions":["rpss"]},"application/vnd.novadigm.edm":{"source":"iana","extensions":["edm"]},"application/vnd.novadigm.edx":{"source":"iana","extensions":["edx"]},"application/vnd.novadigm.ext":{"source":"iana","extensions":["ext"]},"application/vnd.ntt-local.content-share":{"source":"iana"},"application/vnd.ntt-local.file-transfer":{"source":"iana"},"application/vnd.ntt-local.ogw_remote-access":{"source":"iana"},"application/vnd.ntt-local.sip-ta_remote":{"source":"iana"},"application/vnd.ntt-local.sip-ta_tcp_stream":{"source":"iana"},"application/vnd.oasis.opendocument.chart":{"source":"iana","extensions":["odc"]},"application/vnd.oasis.opendocument.chart-template":{"source":"iana","extensions":["otc"]},"application/vnd.oasis.opendocument.database":{"source":"iana","extensions":["odb"]},"application/vnd.oasis.opendocument.formula":{"source":"iana","extensions":["odf"]},"application/vnd.oasis.opendocument.formula-template":{"source":"iana","extensions":["odft"]},"application/vnd.oasis.opendocument.graphics":{"source":"iana","compressible":false,"extensions":["odg"]},"application/vnd.oasis.opendocument.graphics-template":{"source":"iana","extensions":["otg"]},"application/vnd.oasis.opendocument.image":{"source":"iana","extensions":["odi"]},"application/vnd.oasis.opendocument.image-template":{"source":"iana","extensions":["oti"]},"application/vnd.oasis.opendocument.presentation":{"source":"iana","compressible":false,"extensions":["odp"]},"application/vnd.oasis.opendocument.presentation-template":{"source":"iana","extensions":["otp"]},"application/vnd.oasis.opendocument.spreadsheet":{"source":"iana","compressible":false,"extensions":["ods"]},"application/vnd.oasis.opendocument.spreadsheet-template":{"source":"iana","extensions":["ots"]},"application/vnd.oasis.opendocument.text":{"source":"iana","compressible":false,"extensions":["odt"]},"application/vnd.oasis.opendocument.text-master":{"source":"iana","extensions":["odm"]},"application/vnd.oasis.opendocument.text-template":{"source":"iana","extensions":["ott"]},"application/vnd.oasis.opendocument.text-web":{"source":"iana","extensions":["oth"]},"application/vnd.obn":{"source":"iana"},"application/vnd.ocf+cbor":{"source":"iana"},"application/vnd.oftn.l10n+json":{"source":"iana","compressible":true},"application/vnd.oipf.contentaccessdownload+xml":{"source":"iana","compressible":true},"application/vnd.oipf.contentaccessstreaming+xml":{"source":"iana","compressible":true},"application/vnd.oipf.cspg-hexbinary":{"source":"iana"},"application/vnd.oipf.dae.svg+xml":{"source":"iana","compressible":true},"application/vnd.oipf.dae.xhtml+xml":{"source":"iana","compressible":true},"application/vnd.oipf.mippvcontrolmessage+xml":{"source":"iana","compressible":true},"application/vnd.oipf.pae.gem":{"source":"iana"},"application/vnd.oipf.spdiscovery+xml":{"source":"iana","compressible":true},"application/vnd.oipf.spdlist+xml":{"source":"iana","compressible":true},"application/vnd.oipf.ueprofile+xml":{"source":"iana","compressible":true},"application/vnd.oipf.userprofile+xml":{"source":"iana","compressible":true},"application/vnd.olpc-sugar":{"source":"iana","extensions":["xo"]},"application/vnd.oma-scws-config":{"source":"iana"},"application/vnd.oma-scws-http-request":{"source":"iana"},"application/vnd.oma-scws-http-response":{"source":"iana"},"application/vnd.oma.bcast.associated-procedure-parameter+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.drm-trigger+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.imd+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.ltkm":{"source":"iana"},"application/vnd.oma.bcast.notification+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.provisioningtrigger":{"source":"iana"},"application/vnd.oma.bcast.sgboot":{"source":"iana"},"application/vnd.oma.bcast.sgdd+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.sgdu":{"source":"iana"},"application/vnd.oma.bcast.simple-symbol-container":{"source":"iana"},"application/vnd.oma.bcast.smartcard-trigger+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.sprov+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.stkm":{"source":"iana"},"application/vnd.oma.cab-address-book+xml":{"source":"iana","compressible":true},"application/vnd.oma.cab-feature-handler+xml":{"source":"iana","compressible":true},"application/vnd.oma.cab-pcc+xml":{"source":"iana","compressible":true},"application/vnd.oma.cab-subs-invite+xml":{"source":"iana","compressible":true},"application/vnd.oma.cab-user-prefs+xml":{"source":"iana","compressible":true},"application/vnd.oma.dcd":{"source":"iana"},"application/vnd.oma.dcdc":{"source":"iana"},"application/vnd.oma.dd2+xml":{"source":"iana","compressible":true,"extensions":["dd2"]},"application/vnd.oma.drm.risd+xml":{"source":"iana","compressible":true},"application/vnd.oma.group-usage-list+xml":{"source":"iana","compressible":true},"application/vnd.oma.lwm2m+json":{"source":"iana","compressible":true},"application/vnd.oma.lwm2m+tlv":{"source":"iana"},"application/vnd.oma.pal+xml":{"source":"iana","compressible":true},"application/vnd.oma.poc.detailed-progress-report+xml":{"source":"iana","compressible":true},"application/vnd.oma.poc.final-report+xml":{"source":"iana","compressible":true},"application/vnd.oma.poc.groups+xml":{"source":"iana","compressible":true},"application/vnd.oma.poc.invocation-descriptor+xml":{"source":"iana","compressible":true},"application/vnd.oma.poc.optimized-progress-report+xml":{"source":"iana","compressible":true},"application/vnd.oma.push":{"source":"iana"},"application/vnd.oma.scidm.messages+xml":{"source":"iana","compressible":true},"application/vnd.oma.xcap-directory+xml":{"source":"iana","compressible":true},"application/vnd.omads-email+xml":{"source":"iana","compressible":true},"application/vnd.omads-file+xml":{"source":"iana","compressible":true},"application/vnd.omads-folder+xml":{"source":"iana","compressible":true},"application/vnd.omaloc-supl-init":{"source":"iana"},"application/vnd.onepager":{"source":"iana"},"application/vnd.onepagertamp":{"source":"iana"},"application/vnd.onepagertamx":{"source":"iana"},"application/vnd.onepagertat":{"source":"iana"},"application/vnd.onepagertatp":{"source":"iana"},"application/vnd.onepagertatx":{"source":"iana"},"application/vnd.openblox.game+xml":{"source":"iana","compressible":true,"extensions":["obgx"]},"application/vnd.openblox.game-binary":{"source":"iana"},"application/vnd.openeye.oeb":{"source":"iana"},"application/vnd.openofficeorg.extension":{"source":"apache","extensions":["oxt"]},"application/vnd.openstreetmap.data+xml":{"source":"iana","compressible":true,"extensions":["osm"]},"application/vnd.openxmlformats-officedocument.custom-properties+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.customxmlproperties+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawing+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.chart+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.chartshapes+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.diagramcolors+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.diagramdata+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.diagramlayout+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.diagramstyle+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.extended-properties+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.commentauthors+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.comments+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.handoutmaster+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.notesmaster+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.notesslide+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.presentation":{"source":"iana","compressible":false,"extensions":["pptx"]},"application/vnd.openxmlformats-officedocument.presentationml.presentation.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.presprops+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.slide":{"source":"iana","extensions":["sldx"]},"application/vnd.openxmlformats-officedocument.presentationml.slide+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.slidelayout+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.slidemaster+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.slideshow":{"source":"iana","extensions":["ppsx"]},"application/vnd.openxmlformats-officedocument.presentationml.slideshow.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.slideupdateinfo+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.tablestyles+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.tags+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.template":{"source":"iana","extensions":["potx"]},"application/vnd.openxmlformats-officedocument.presentationml.template.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.viewprops+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.calcchain+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.chartsheet+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.comments+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.connections+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.dialogsheet+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.externallink+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcachedefinition+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcacherecords+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.pivottable+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.querytable+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.revisionheaders+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.revisionlog+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.sharedstrings+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.sheet":{"source":"iana","compressible":false,"extensions":["xlsx"]},"application/vnd.openxmlformats-officedocument.spreadsheetml.sheet.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.sheetmetadata+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.styles+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.table+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.tablesinglecells+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.template":{"source":"iana","extensions":["xltx"]},"application/vnd.openxmlformats-officedocument.spreadsheetml.template.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.usernames+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.volatiledependencies+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.worksheet+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.theme+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.themeoverride+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.vmldrawing":{"source":"iana"},"application/vnd.openxmlformats-officedocument.wordprocessingml.comments+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.document":{"source":"iana","compressible":false,"extensions":["docx"]},"application/vnd.openxmlformats-officedocument.wordprocessingml.document.glossary+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.document.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.endnotes+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.fonttable+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.footer+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.footnotes+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.numbering+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.settings+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.styles+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.template":{"source":"iana","extensions":["dotx"]},"application/vnd.openxmlformats-officedocument.wordprocessingml.template.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.websettings+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-package.core-properties+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-package.digital-signature-xmlsignature+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-package.relationships+xml":{"source":"iana","compressible":true},"application/vnd.oracle.resource+json":{"source":"iana","compressible":true},"application/vnd.orange.indata":{"source":"iana"},"application/vnd.osa.netdeploy":{"source":"iana"},"application/vnd.osgeo.mapguide.package":{"source":"iana","extensions":["mgp"]},"application/vnd.osgi.bundle":{"source":"iana"},"application/vnd.osgi.dp":{"source":"iana","extensions":["dp"]},"application/vnd.osgi.subsystem":{"source":"iana","extensions":["esa"]},"application/vnd.otps.ct-kip+xml":{"source":"iana","compressible":true},"application/vnd.oxli.countgraph":{"source":"iana"},"application/vnd.pagerduty+json":{"source":"iana","compressible":true},"application/vnd.palm":{"source":"iana","extensions":["pdb","pqa","oprc"]},"application/vnd.panoply":{"source":"iana"},"application/vnd.paos.xml":{"source":"iana"},"application/vnd.patentdive":{"source":"iana"},"application/vnd.patientecommsdoc":{"source":"iana"},"application/vnd.pawaafile":{"source":"iana","extensions":["paw"]},"application/vnd.pcos":{"source":"iana"},"application/vnd.pg.format":{"source":"iana","extensions":["str"]},"application/vnd.pg.osasli":{"source":"iana","extensions":["ei6"]},"application/vnd.piaccess.application-licence":{"source":"iana"},"application/vnd.picsel":{"source":"iana","extensions":["efif"]},"application/vnd.pmi.widget":{"source":"iana","extensions":["wg"]},"application/vnd.poc.group-advertisement+xml":{"source":"iana","compressible":true},"application/vnd.pocketlearn":{"source":"iana","extensions":["plf"]},"application/vnd.powerbuilder6":{"source":"iana","extensions":["pbd"]},"application/vnd.powerbuilder6-s":{"source":"iana"},"application/vnd.powerbuilder7":{"source":"iana"},"application/vnd.powerbuilder7-s":{"source":"iana"},"application/vnd.powerbuilder75":{"source":"iana"},"application/vnd.powerbuilder75-s":{"source":"iana"},"application/vnd.preminet":{"source":"iana"},"application/vnd.previewsystems.box":{"source":"iana","extensions":["box"]},"application/vnd.proteus.magazine":{"source":"iana","extensions":["mgz"]},"application/vnd.psfs":{"source":"iana"},"application/vnd.publishare-delta-tree":{"source":"iana","extensions":["qps"]},"application/vnd.pvi.ptid1":{"source":"iana","extensions":["ptid"]},"application/vnd.pwg-multiplexed":{"source":"iana"},"application/vnd.pwg-xhtml-print+xml":{"source":"iana","compressible":true},"application/vnd.qualcomm.brew-app-res":{"source":"iana"},"application/vnd.quarantainenet":{"source":"iana"},"application/vnd.quark.quarkxpress":{"source":"iana","extensions":["qxd","qxt","qwd","qwt","qxl","qxb"]},"application/vnd.quobject-quoxdocument":{"source":"iana"},"application/vnd.radisys.moml+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-audit+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-audit-conf+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-audit-conn+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-audit-dialog+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-audit-stream+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-conf+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-base+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-fax-detect+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-fax-sendrecv+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-group+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-speech+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-transform+xml":{"source":"iana","compressible":true},"application/vnd.rainstor.data":{"source":"iana"},"application/vnd.rapid":{"source":"iana"},"application/vnd.rar":{"source":"iana"},"application/vnd.realvnc.bed":{"source":"iana","extensions":["bed"]},"application/vnd.recordare.musicxml":{"source":"iana","extensions":["mxl"]},"application/vnd.recordare.musicxml+xml":{"source":"iana","compressible":true,"extensions":["musicxml"]},"application/vnd.renlearn.rlprint":{"source":"iana"},"application/vnd.restful+json":{"source":"iana","compressible":true},"application/vnd.rig.cryptonote":{"source":"iana","extensions":["cryptonote"]},"application/vnd.rim.cod":{"source":"apache","extensions":["cod"]},"application/vnd.rn-realmedia":{"source":"apache","extensions":["rm"]},"application/vnd.rn-realmedia-vbr":{"source":"apache","extensions":["rmvb"]},"application/vnd.route66.link66+xml":{"source":"iana","compressible":true,"extensions":["link66"]},"application/vnd.rs-274x":{"source":"iana"},"application/vnd.ruckus.download":{"source":"iana"},"application/vnd.s3sms":{"source":"iana"},"application/vnd.sailingtracker.track":{"source":"iana","extensions":["st"]},"application/vnd.sbm.cid":{"source":"iana"},"application/vnd.sbm.mid2":{"source":"iana"},"application/vnd.scribus":{"source":"iana"},"application/vnd.sealed.3df":{"source":"iana"},"application/vnd.sealed.csf":{"source":"iana"},"application/vnd.sealed.doc":{"source":"iana"},"application/vnd.sealed.eml":{"source":"iana"},"application/vnd.sealed.mht":{"source":"iana"},"application/vnd.sealed.net":{"source":"iana"},"application/vnd.sealed.ppt":{"source":"iana"},"application/vnd.sealed.tiff":{"source":"iana"},"application/vnd.sealed.xls":{"source":"iana"},"application/vnd.sealedmedia.softseal.html":{"source":"iana"},"application/vnd.sealedmedia.softseal.pdf":{"source":"iana"},"application/vnd.seemail":{"source":"iana","extensions":["see"]},"application/vnd.sema":{"source":"iana","extensions":["sema"]},"application/vnd.semd":{"source":"iana","extensions":["semd"]},"application/vnd.semf":{"source":"iana","extensions":["semf"]},"application/vnd.shade-save-file":{"source":"iana"},"application/vnd.shana.informed.formdata":{"source":"iana","extensions":["ifm"]},"application/vnd.shana.informed.formtemplate":{"source":"iana","extensions":["itp"]},"application/vnd.shana.informed.interchange":{"source":"iana","extensions":["iif"]},"application/vnd.shana.informed.package":{"source":"iana","extensions":["ipk"]},"application/vnd.shootproof+json":{"source":"iana","compressible":true},"application/vnd.shopkick+json":{"source":"iana","compressible":true},"application/vnd.sigrok.session":{"source":"iana"},"application/vnd.simtech-mindmapper":{"source":"iana","extensions":["twd","twds"]},"application/vnd.siren+json":{"source":"iana","compressible":true},"application/vnd.smaf":{"source":"iana","extensions":["mmf"]},"application/vnd.smart.notebook":{"source":"iana"},"application/vnd.smart.teacher":{"source":"iana","extensions":["teacher"]},"application/vnd.software602.filler.form+xml":{"source":"iana","compressible":true,"extensions":["fo"]},"application/vnd.software602.filler.form-xml-zip":{"source":"iana"},"application/vnd.solent.sdkm+xml":{"source":"iana","compressible":true,"extensions":["sdkm","sdkd"]},"application/vnd.spotfire.dxp":{"source":"iana","extensions":["dxp"]},"application/vnd.spotfire.sfs":{"source":"iana","extensions":["sfs"]},"application/vnd.sqlite3":{"source":"iana"},"application/vnd.sss-cod":{"source":"iana"},"application/vnd.sss-dtf":{"source":"iana"},"application/vnd.sss-ntf":{"source":"iana"},"application/vnd.stardivision.calc":{"source":"apache","extensions":["sdc"]},"application/vnd.stardivision.draw":{"source":"apache","extensions":["sda"]},"application/vnd.stardivision.impress":{"source":"apache","extensions":["sdd"]},"application/vnd.stardivision.math":{"source":"apache","extensions":["smf"]},"application/vnd.stardivision.writer":{"source":"apache","extensions":["sdw","vor"]},"application/vnd.stardivision.writer-global":{"source":"apache","extensions":["sgl"]},"application/vnd.stepmania.package":{"source":"iana","extensions":["smzip"]},"application/vnd.stepmania.stepchart":{"source":"iana","extensions":["sm"]},"application/vnd.street-stream":{"source":"iana"},"application/vnd.sun.wadl+xml":{"source":"iana","compressible":true,"extensions":["wadl"]},"application/vnd.sun.xml.calc":{"source":"apache","extensions":["sxc"]},"application/vnd.sun.xml.calc.template":{"source":"apache","extensions":["stc"]},"application/vnd.sun.xml.draw":{"source":"apache","extensions":["sxd"]},"application/vnd.sun.xml.draw.template":{"source":"apache","extensions":["std"]},"application/vnd.sun.xml.impress":{"source":"apache","extensions":["sxi"]},"application/vnd.sun.xml.impress.template":{"source":"apache","extensions":["sti"]},"application/vnd.sun.xml.math":{"source":"apache","extensions":["sxm"]},"application/vnd.sun.xml.writer":{"source":"apache","extensions":["sxw"]},"application/vnd.sun.xml.writer.global":{"source":"apache","extensions":["sxg"]},"application/vnd.sun.xml.writer.template":{"source":"apache","extensions":["stw"]},"application/vnd.sus-calendar":{"source":"iana","extensions":["sus","susp"]},"application/vnd.svd":{"source":"iana","extensions":["svd"]},"application/vnd.swiftview-ics":{"source":"iana"},"application/vnd.symbian.install":{"source":"apache","extensions":["sis","sisx"]},"application/vnd.syncml+xml":{"source":"iana","compressible":true,"extensions":["xsm"]},"application/vnd.syncml.dm+wbxml":{"source":"iana","extensions":["bdm"]},"application/vnd.syncml.dm+xml":{"source":"iana","compressible":true,"extensions":["xdm"]},"application/vnd.syncml.dm.notification":{"source":"iana"},"application/vnd.syncml.dmddf+wbxml":{"source":"iana"},"application/vnd.syncml.dmddf+xml":{"source":"iana","compressible":true,"extensions":["ddf"]},"application/vnd.syncml.dmtnds+wbxml":{"source":"iana"},"application/vnd.syncml.dmtnds+xml":{"source":"iana","compressible":true},"application/vnd.syncml.ds.notification":{"source":"iana"},"application/vnd.tableschema+json":{"source":"iana","compressible":true},"application/vnd.tao.intent-module-archive":{"source":"iana","extensions":["tao"]},"application/vnd.tcpdump.pcap":{"source":"iana","extensions":["pcap","cap","dmp"]},"application/vnd.think-cell.ppttc+json":{"source":"iana","compressible":true},"application/vnd.tmd.mediaflex.api+xml":{"source":"iana","compressible":true},"application/vnd.tml":{"source":"iana"},"application/vnd.tmobile-livetv":{"source":"iana","extensions":["tmo"]},"application/vnd.tri.onesource":{"source":"iana"},"application/vnd.trid.tpt":{"source":"iana","extensions":["tpt"]},"application/vnd.triscape.mxs":{"source":"iana","extensions":["mxs"]},"application/vnd.trueapp":{"source":"iana","extensions":["tra"]},"application/vnd.truedoc":{"source":"iana"},"application/vnd.ubisoft.webplayer":{"source":"iana"},"application/vnd.ufdl":{"source":"iana","extensions":["ufd","ufdl"]},"application/vnd.uiq.theme":{"source":"iana","extensions":["utz"]},"application/vnd.umajin":{"source":"iana","extensions":["umj"]},"application/vnd.unity":{"source":"iana","extensions":["unityweb"]},"application/vnd.uoml+xml":{"source":"iana","compressible":true,"extensions":["uoml"]},"application/vnd.uplanet.alert":{"source":"iana"},"application/vnd.uplanet.alert-wbxml":{"source":"iana"},"application/vnd.uplanet.bearer-choice":{"source":"iana"},"application/vnd.uplanet.bearer-choice-wbxml":{"source":"iana"},"application/vnd.uplanet.cacheop":{"source":"iana"},"application/vnd.uplanet.cacheop-wbxml":{"source":"iana"},"application/vnd.uplanet.channel":{"source":"iana"},"application/vnd.uplanet.channel-wbxml":{"source":"iana"},"application/vnd.uplanet.list":{"source":"iana"},"application/vnd.uplanet.list-wbxml":{"source":"iana"},"application/vnd.uplanet.listcmd":{"source":"iana"},"application/vnd.uplanet.listcmd-wbxml":{"source":"iana"},"application/vnd.uplanet.signal":{"source":"iana"},"application/vnd.uri-map":{"source":"iana"},"application/vnd.valve.source.material":{"source":"iana"},"application/vnd.vcx":{"source":"iana","extensions":["vcx"]},"application/vnd.vd-study":{"source":"iana"},"application/vnd.vectorworks":{"source":"iana"},"application/vnd.vel+json":{"source":"iana","compressible":true},"application/vnd.verimatrix.vcas":{"source":"iana"},"application/vnd.veryant.thin":{"source":"iana"},"application/vnd.ves.encrypted":{"source":"iana"},"application/vnd.vidsoft.vidconference":{"source":"iana"},"application/vnd.visio":{"source":"iana","extensions":["vsd","vst","vss","vsw"]},"application/vnd.visionary":{"source":"iana","extensions":["vis"]},"application/vnd.vividence.scriptfile":{"source":"iana"},"application/vnd.vsf":{"source":"iana","extensions":["vsf"]},"application/vnd.wap.sic":{"source":"iana"},"application/vnd.wap.slc":{"source":"iana"},"application/vnd.wap.wbxml":{"source":"iana","extensions":["wbxml"]},"application/vnd.wap.wmlc":{"source":"iana","extensions":["wmlc"]},"application/vnd.wap.wmlscriptc":{"source":"iana","extensions":["wmlsc"]},"application/vnd.webturbo":{"source":"iana","extensions":["wtb"]},"application/vnd.wfa.p2p":{"source":"iana"},"application/vnd.wfa.wsc":{"source":"iana"},"application/vnd.windows.devicepairing":{"source":"iana"},"application/vnd.wmc":{"source":"iana"},"application/vnd.wmf.bootstrap":{"source":"iana"},"application/vnd.wolfram.mathematica":{"source":"iana"},"application/vnd.wolfram.mathematica.package":{"source":"iana"},"application/vnd.wolfram.player":{"source":"iana","extensions":["nbp"]},"application/vnd.wordperfect":{"source":"iana","extensions":["wpd"]},"application/vnd.wqd":{"source":"iana","extensions":["wqd"]},"application/vnd.wrq-hp3000-labelled":{"source":"iana"},"application/vnd.wt.stf":{"source":"iana","extensions":["stf"]},"application/vnd.wv.csp+wbxml":{"source":"iana"},"application/vnd.wv.csp+xml":{"source":"iana","compressible":true},"application/vnd.wv.ssp+xml":{"source":"iana","compressible":true},"application/vnd.xacml+json":{"source":"iana","compressible":true},"application/vnd.xara":{"source":"iana","extensions":["xar"]},"application/vnd.xfdl":{"source":"iana","extensions":["xfdl"]},"application/vnd.xfdl.webform":{"source":"iana"},"application/vnd.xmi+xml":{"source":"iana","compressible":true},"application/vnd.xmpie.cpkg":{"source":"iana"},"application/vnd.xmpie.dpkg":{"source":"iana"},"application/vnd.xmpie.plan":{"source":"iana"},"application/vnd.xmpie.ppkg":{"source":"iana"},"application/vnd.xmpie.xlim":{"source":"iana"},"application/vnd.yamaha.hv-dic":{"source":"iana","extensions":["hvd"]},"application/vnd.yamaha.hv-script":{"source":"iana","extensions":["hvs"]},"application/vnd.yamaha.hv-voice":{"source":"iana","extensions":["hvp"]},"application/vnd.yamaha.openscoreformat":{"source":"iana","extensions":["osf"]},"application/vnd.yamaha.openscoreformat.osfpvg+xml":{"source":"iana","compressible":true,"extensions":["osfpvg"]},"application/vnd.yamaha.remote-setup":{"source":"iana"},"application/vnd.yamaha.smaf-audio":{"source":"iana","extensions":["saf"]},"application/vnd.yamaha.smaf-phrase":{"source":"iana","extensions":["spf"]},"application/vnd.yamaha.through-ngn":{"source":"iana"},"application/vnd.yamaha.tunnel-udpencap":{"source":"iana"},"application/vnd.yaoweme":{"source":"iana"},"application/vnd.yellowriver-custom-menu":{"source":"iana","extensions":["cmp"]},"application/vnd.youtube.yt":{"source":"iana"},"application/vnd.zul":{"source":"iana","extensions":["zir","zirz"]},"application/vnd.zzazz.deck+xml":{"source":"iana","compressible":true,"extensions":["zaz"]},"application/voicexml+xml":{"source":"iana","compressible":true,"extensions":["vxml"]},"application/voucher-cms+json":{"source":"iana","compressible":true},"application/vq-rtcpxr":{"source":"iana"},"application/wasm":{"compressible":true,"extensions":["wasm"]},"application/watcherinfo+xml":{"source":"iana","compressible":true},"application/webpush-options+json":{"source":"iana","compressible":true},"application/whoispp-query":{"source":"iana"},"application/whoispp-response":{"source":"iana"},"application/widget":{"source":"iana","extensions":["wgt"]},"application/winhlp":{"source":"apache","extensions":["hlp"]},"application/wita":{"source":"iana"},"application/wordperfect5.1":{"source":"iana"},"application/wsdl+xml":{"source":"iana","compressible":true,"extensions":["wsdl"]},"application/wspolicy+xml":{"source":"iana","compressible":true,"extensions":["wspolicy"]},"application/x-7z-compressed":{"source":"apache","compressible":false,"extensions":["7z"]},"application/x-abiword":{"source":"apache","extensions":["abw"]},"application/x-ace-compressed":{"source":"apache","extensions":["ace"]},"application/x-amf":{"source":"apache"},"application/x-apple-diskimage":{"source":"apache","extensions":["dmg"]},"application/x-arj":{"compressible":false,"extensions":["arj"]},"application/x-authorware-bin":{"source":"apache","extensions":["aab","x32","u32","vox"]},"application/x-authorware-map":{"source":"apache","extensions":["aam"]},"application/x-authorware-seg":{"source":"apache","extensions":["aas"]},"application/x-bcpio":{"source":"apache","extensions":["bcpio"]},"application/x-bdoc":{"compressible":false,"extensions":["bdoc"]},"application/x-bittorrent":{"source":"apache","extensions":["torrent"]},"application/x-blorb":{"source":"apache","extensions":["blb","blorb"]},"application/x-bzip":{"source":"apache","compressible":false,"extensions":["bz"]},"application/x-bzip2":{"source":"apache","compressible":false,"extensions":["bz2","boz"]},"application/x-cbr":{"source":"apache","extensions":["cbr","cba","cbt","cbz","cb7"]},"application/x-cdlink":{"source":"apache","extensions":["vcd"]},"application/x-cfs-compressed":{"source":"apache","extensions":["cfs"]},"application/x-chat":{"source":"apache","extensions":["chat"]},"application/x-chess-pgn":{"source":"apache","extensions":["pgn"]},"application/x-chrome-extension":{"extensions":["crx"]},"application/x-cocoa":{"source":"nginx","extensions":["cco"]},"application/x-compress":{"source":"apache"},"application/x-conference":{"source":"apache","extensions":["nsc"]},"application/x-cpio":{"source":"apache","extensions":["cpio"]},"application/x-csh":{"source":"apache","extensions":["csh"]},"application/x-deb":{"compressible":false},"application/x-debian-package":{"source":"apache","extensions":["deb","udeb"]},"application/x-dgc-compressed":{"source":"apache","extensions":["dgc"]},"application/x-director":{"source":"apache","extensions":["dir","dcr","dxr","cst","cct","cxt","w3d","fgd","swa"]},"application/x-doom":{"source":"apache","extensions":["wad"]},"application/x-dtbncx+xml":{"source":"apache","compressible":true,"extensions":["ncx"]},"application/x-dtbook+xml":{"source":"apache","compressible":true,"extensions":["dtb"]},"application/x-dtbresource+xml":{"source":"apache","compressible":true,"extensions":["res"]},"application/x-dvi":{"source":"apache","compressible":false,"extensions":["dvi"]},"application/x-envoy":{"source":"apache","extensions":["evy"]},"application/x-eva":{"source":"apache","extensions":["eva"]},"application/x-font-bdf":{"source":"apache","extensions":["bdf"]},"application/x-font-dos":{"source":"apache"},"application/x-font-framemaker":{"source":"apache"},"application/x-font-ghostscript":{"source":"apache","extensions":["gsf"]},"application/x-font-libgrx":{"source":"apache"},"application/x-font-linux-psf":{"source":"apache","extensions":["psf"]},"application/x-font-pcf":{"source":"apache","extensions":["pcf"]},"application/x-font-snf":{"source":"apache","extensions":["snf"]},"application/x-font-speedo":{"source":"apache"},"application/x-font-sunos-news":{"source":"apache"},"application/x-font-type1":{"source":"apache","extensions":["pfa","pfb","pfm","afm"]},"application/x-font-vfont":{"source":"apache"},"application/x-freearc":{"source":"apache","extensions":["arc"]},"application/x-futuresplash":{"source":"apache","extensions":["spl"]},"application/x-gca-compressed":{"source":"apache","extensions":["gca"]},"application/x-glulx":{"source":"apache","extensions":["ulx"]},"application/x-gnumeric":{"source":"apache","extensions":["gnumeric"]},"application/x-gramps-xml":{"source":"apache","extensions":["gramps"]},"application/x-gtar":{"source":"apache","extensions":["gtar"]},"application/x-gzip":{"source":"apache"},"application/x-hdf":{"source":"apache","extensions":["hdf"]},"application/x-httpd-php":{"compressible":true,"extensions":["php"]},"application/x-install-instructions":{"source":"apache","extensions":["install"]},"application/x-iso9660-image":{"source":"apache","extensions":["iso"]},"application/x-java-archive-diff":{"source":"nginx","extensions":["jardiff"]},"application/x-java-jnlp-file":{"source":"apache","compressible":false,"extensions":["jnlp"]},"application/x-javascript":{"compressible":true},"application/x-keepass2":{"extensions":["kdbx"]},"application/x-latex":{"source":"apache","compressible":false,"extensions":["latex"]},"application/x-lua-bytecode":{"extensions":["luac"]},"application/x-lzh-compressed":{"source":"apache","extensions":["lzh","lha"]},"application/x-makeself":{"source":"nginx","extensions":["run"]},"application/x-mie":{"source":"apache","extensions":["mie"]},"application/x-mobipocket-ebook":{"source":"apache","extensions":["prc","mobi"]},"application/x-mpegurl":{"compressible":false},"application/x-ms-application":{"source":"apache","extensions":["application"]},"application/x-ms-shortcut":{"source":"apache","extensions":["lnk"]},"application/x-ms-wmd":{"source":"apache","extensions":["wmd"]},"application/x-ms-wmz":{"source":"apache","extensions":["wmz"]},"application/x-ms-xbap":{"source":"apache","extensions":["xbap"]},"application/x-msaccess":{"source":"apache","extensions":["mdb"]},"application/x-msbinder":{"source":"apache","extensions":["obd"]},"application/x-mscardfile":{"source":"apache","extensions":["crd"]},"application/x-msclip":{"source":"apache","extensions":["clp"]},"application/x-msdos-program":{"extensions":["exe"]},"application/x-msdownload":{"source":"apache","extensions":["exe","dll","com","bat","msi"]},"application/x-msmediaview":{"source":"apache","extensions":["mvb","m13","m14"]},"application/x-msmetafile":{"source":"apache","extensions":["wmf","wmz","emf","emz"]},"application/x-msmoney":{"source":"apache","extensions":["mny"]},"application/x-mspublisher":{"source":"apache","extensions":["pub"]},"application/x-msschedule":{"source":"apache","extensions":["scd"]},"application/x-msterminal":{"source":"apache","extensions":["trm"]},"application/x-mswrite":{"source":"apache","extensions":["wri"]},"application/x-netcdf":{"source":"apache","extensions":["nc","cdf"]},"application/x-ns-proxy-autoconfig":{"compressible":true,"extensions":["pac"]},"application/x-nzb":{"source":"apache","extensions":["nzb"]},"application/x-perl":{"source":"nginx","extensions":["pl","pm"]},"application/x-pilot":{"source":"nginx","extensions":["prc","pdb"]},"application/x-pkcs12":{"source":"apache","compressible":false,"extensions":["p12","pfx"]},"application/x-pkcs7-certificates":{"source":"apache","extensions":["p7b","spc"]},"application/x-pkcs7-certreqresp":{"source":"apache","extensions":["p7r"]},"application/x-rar-compressed":{"source":"apache","compressible":false,"extensions":["rar"]},"application/x-redhat-package-manager":{"source":"nginx","extensions":["rpm"]},"application/x-research-info-systems":{"source":"apache","extensions":["ris"]},"application/x-sea":{"source":"nginx","extensions":["sea"]},"application/x-sh":{"source":"apache","compressible":true,"extensions":["sh"]},"application/x-shar":{"source":"apache","extensions":["shar"]},"application/x-shockwave-flash":{"source":"apache","compressible":false,"extensions":["swf"]},"application/x-silverlight-app":{"source":"apache","extensions":["xap"]},"application/x-sql":{"source":"apache","extensions":["sql"]},"application/x-stuffit":{"source":"apache","compressible":false,"extensions":["sit"]},"application/x-stuffitx":{"source":"apache","extensions":["sitx"]},"application/x-subrip":{"source":"apache","extensions":["srt"]},"application/x-sv4cpio":{"source":"apache","extensions":["sv4cpio"]},"application/x-sv4crc":{"source":"apache","extensions":["sv4crc"]},"application/x-t3vm-image":{"source":"apache","extensions":["t3"]},"application/x-tads":{"source":"apache","extensions":["gam"]},"application/x-tar":{"source":"apache","compressible":true,"extensions":["tar"]},"application/x-tcl":{"source":"apache","extensions":["tcl","tk"]},"application/x-tex":{"source":"apache","extensions":["tex"]},"application/x-tex-tfm":{"source":"apache","extensions":["tfm"]},"application/x-texinfo":{"source":"apache","extensions":["texinfo","texi"]},"application/x-tgif":{"source":"apache","extensions":["obj"]},"application/x-ustar":{"source":"apache","extensions":["ustar"]},"application/x-virtualbox-hdd":{"compressible":true,"extensions":["hdd"]},"application/x-virtualbox-ova":{"compressible":true,"extensions":["ova"]},"application/x-virtualbox-ovf":{"compressible":true,"extensions":["ovf"]},"application/x-virtualbox-vbox":{"compressible":true,"extensions":["vbox"]},"application/x-virtualbox-vbox-extpack":{"compressible":false,"extensions":["vbox-extpack"]},"application/x-virtualbox-vdi":{"compressible":true,"extensions":["vdi"]},"application/x-virtualbox-vhd":{"compressible":true,"extensions":["vhd"]},"application/x-virtualbox-vmdk":{"compressible":true,"extensions":["vmdk"]},"application/x-wais-source":{"source":"apache","extensions":["src"]},"application/x-web-app-manifest+json":{"compressible":true,"extensions":["webapp"]},"application/x-www-form-urlencoded":{"source":"iana","compressible":true},"application/x-x509-ca-cert":{"source":"apache","extensions":["der","crt","pem"]},"application/x-xfig":{"source":"apache","extensions":["fig"]},"application/x-xliff+xml":{"source":"apache","compressible":true,"extensions":["xlf"]},"application/x-xpinstall":{"source":"apache","compressible":false,"extensions":["xpi"]},"application/x-xz":{"source":"apache","extensions":["xz"]},"application/x-zmachine":{"source":"apache","extensions":["z1","z2","z3","z4","z5","z6","z7","z8"]},"application/x400-bp":{"source":"iana"},"application/xacml+xml":{"source":"iana","compressible":true},"application/xaml+xml":{"source":"apache","compressible":true,"extensions":["xaml"]},"application/xcap-att+xml":{"source":"iana","compressible":true,"extensions":["xav"]},"application/xcap-caps+xml":{"source":"iana","compressible":true,"extensions":["xca"]},"application/xcap-diff+xml":{"source":"iana","compressible":true,"extensions":["xdf"]},"application/xcap-el+xml":{"source":"iana","compressible":true,"extensions":["xel"]},"application/xcap-error+xml":{"source":"iana","compressible":true,"extensions":["xer"]},"application/xcap-ns+xml":{"source":"iana","compressible":true,"extensions":["xns"]},"application/xcon-conference-info+xml":{"source":"iana","compressible":true},"application/xcon-conference-info-diff+xml":{"source":"iana","compressible":true},"application/xenc+xml":{"source":"iana","compressible":true,"extensions":["xenc"]},"application/xhtml+xml":{"source":"iana","compressible":true,"extensions":["xhtml","xht"]},"application/xhtml-voice+xml":{"source":"apache","compressible":true},"application/xliff+xml":{"source":"iana","compressible":true,"extensions":["xlf"]},"application/xml":{"source":"iana","compressible":true,"extensions":["xml","xsl","xsd","rng"]},"application/xml-dtd":{"source":"iana","compressible":true,"extensions":["dtd"]},"application/xml-external-parsed-entity":{"source":"iana"},"application/xml-patch+xml":{"source":"iana","compressible":true},"application/xmpp+xml":{"source":"iana","compressible":true},"application/xop+xml":{"source":"iana","compressible":true,"extensions":["xop"]},"application/xproc+xml":{"source":"apache","compressible":true,"extensions":["xpl"]},"application/xslt+xml":{"source":"iana","compressible":true,"extensions":["xslt"]},"application/xspf+xml":{"source":"apache","compressible":true,"extensions":["xspf"]},"application/xv+xml":{"source":"iana","compressible":true,"extensions":["mxml","xhvml","xvml","xvm"]},"application/yang":{"source":"iana","extensions":["yang"]},"application/yang-data+json":{"source":"iana","compressible":true},"application/yang-data+xml":{"source":"iana","compressible":true},"application/yang-patch+json":{"source":"iana","compressible":true},"application/yang-patch+xml":{"source":"iana","compressible":true},"application/yin+xml":{"source":"iana","compressible":true,"extensions":["yin"]},"application/zip":{"source":"iana","compressible":false,"extensions":["zip"]},"application/zlib":{"source":"iana"},"application/zstd":{"source":"iana"},"audio/1d-interleaved-parityfec":{"source":"iana"},"audio/32kadpcm":{"source":"iana"},"audio/3gpp":{"source":"iana","compressible":false,"extensions":["3gpp"]},"audio/3gpp2":{"source":"iana"},"audio/aac":{"source":"iana"},"audio/ac3":{"source":"iana"},"audio/adpcm":{"source":"apache","extensions":["adp"]},"audio/amr":{"source":"iana"},"audio/amr-wb":{"source":"iana"},"audio/amr-wb+":{"source":"iana"},"audio/aptx":{"source":"iana"},"audio/asc":{"source":"iana"},"audio/atrac-advanced-lossless":{"source":"iana"},"audio/atrac-x":{"source":"iana"},"audio/atrac3":{"source":"iana"},"audio/basic":{"source":"iana","compressible":false,"extensions":["au","snd"]},"audio/bv16":{"source":"iana"},"audio/bv32":{"source":"iana"},"audio/clearmode":{"source":"iana"},"audio/cn":{"source":"iana"},"audio/dat12":{"source":"iana"},"audio/dls":{"source":"iana"},"audio/dsr-es201108":{"source":"iana"},"audio/dsr-es202050":{"source":"iana"},"audio/dsr-es202211":{"source":"iana"},"audio/dsr-es202212":{"source":"iana"},"audio/dv":{"source":"iana"},"audio/dvi4":{"source":"iana"},"audio/eac3":{"source":"iana"},"audio/encaprtp":{"source":"iana"},"audio/evrc":{"source":"iana"},"audio/evrc-qcp":{"source":"iana"},"audio/evrc0":{"source":"iana"},"audio/evrc1":{"source":"iana"},"audio/evrcb":{"source":"iana"},"audio/evrcb0":{"source":"iana"},"audio/evrcb1":{"source":"iana"},"audio/evrcnw":{"source":"iana"},"audio/evrcnw0":{"source":"iana"},"audio/evrcnw1":{"source":"iana"},"audio/evrcwb":{"source":"iana"},"audio/evrcwb0":{"source":"iana"},"audio/evrcwb1":{"source":"iana"},"audio/evs":{"source":"iana"},"audio/flexfec":{"source":"iana"},"audio/fwdred":{"source":"iana"},"audio/g711-0":{"source":"iana"},"audio/g719":{"source":"iana"},"audio/g722":{"source":"iana"},"audio/g7221":{"source":"iana"},"audio/g723":{"source":"iana"},"audio/g726-16":{"source":"iana"},"audio/g726-24":{"source":"iana"},"audio/g726-32":{"source":"iana"},"audio/g726-40":{"source":"iana"},"audio/g728":{"source":"iana"},"audio/g729":{"source":"iana"},"audio/g7291":{"source":"iana"},"audio/g729d":{"source":"iana"},"audio/g729e":{"source":"iana"},"audio/gsm":{"source":"iana"},"audio/gsm-efr":{"source":"iana"},"audio/gsm-hr-08":{"source":"iana"},"audio/ilbc":{"source":"iana"},"audio/ip-mr_v2.5":{"source":"iana"},"audio/isac":{"source":"apache"},"audio/l16":{"source":"iana"},"audio/l20":{"source":"iana"},"audio/l24":{"source":"iana","compressible":false},"audio/l8":{"source":"iana"},"audio/lpc":{"source":"iana"},"audio/melp":{"source":"iana"},"audio/melp1200":{"source":"iana"},"audio/melp2400":{"source":"iana"},"audio/melp600":{"source":"iana"},"audio/midi":{"source":"apache","extensions":["mid","midi","kar","rmi"]},"audio/mobile-xmf":{"source":"iana","extensions":["mxmf"]},"audio/mp3":{"compressible":false,"extensions":["mp3"]},"audio/mp4":{"source":"iana","compressible":false,"extensions":["m4a","mp4a"]},"audio/mp4a-latm":{"source":"iana"},"audio/mpa":{"source":"iana"},"audio/mpa-robust":{"source":"iana"},"audio/mpeg":{"source":"iana","compressible":false,"extensions":["mpga","mp2","mp2a","mp3","m2a","m3a"]},"audio/mpeg4-generic":{"source":"iana"},"audio/musepack":{"source":"apache"},"audio/ogg":{"source":"iana","compressible":false,"extensions":["oga","ogg","spx"]},"audio/opus":{"source":"iana"},"audio/parityfec":{"source":"iana"},"audio/pcma":{"source":"iana"},"audio/pcma-wb":{"source":"iana"},"audio/pcmu":{"source":"iana"},"audio/pcmu-wb":{"source":"iana"},"audio/prs.sid":{"source":"iana"},"audio/qcelp":{"source":"iana"},"audio/raptorfec":{"source":"iana"},"audio/red":{"source":"iana"},"audio/rtp-enc-aescm128":{"source":"iana"},"audio/rtp-midi":{"source":"iana"},"audio/rtploopback":{"source":"iana"},"audio/rtx":{"source":"iana"},"audio/s3m":{"source":"apache","extensions":["s3m"]},"audio/silk":{"source":"apache","extensions":["sil"]},"audio/smv":{"source":"iana"},"audio/smv-qcp":{"source":"iana"},"audio/smv0":{"source":"iana"},"audio/sp-midi":{"source":"iana"},"audio/speex":{"source":"iana"},"audio/t140c":{"source":"iana"},"audio/t38":{"source":"iana"},"audio/telephone-event":{"source":"iana"},"audio/tetra_acelp":{"source":"iana"},"audio/tone":{"source":"iana"},"audio/uemclip":{"source":"iana"},"audio/ulpfec":{"source":"iana"},"audio/usac":{"source":"iana"},"audio/vdvi":{"source":"iana"},"audio/vmr-wb":{"source":"iana"},"audio/vnd.3gpp.iufp":{"source":"iana"},"audio/vnd.4sb":{"source":"iana"},"audio/vnd.audiokoz":{"source":"iana"},"audio/vnd.celp":{"source":"iana"},"audio/vnd.cisco.nse":{"source":"iana"},"audio/vnd.cmles.radio-events":{"source":"iana"},"audio/vnd.cns.anp1":{"source":"iana"},"audio/vnd.cns.inf1":{"source":"iana"},"audio/vnd.dece.audio":{"source":"iana","extensions":["uva","uvva"]},"audio/vnd.digital-winds":{"source":"iana","extensions":["eol"]},"audio/vnd.dlna.adts":{"source":"iana"},"audio/vnd.dolby.heaac.1":{"source":"iana"},"audio/vnd.dolby.heaac.2":{"source":"iana"},"audio/vnd.dolby.mlp":{"source":"iana"},"audio/vnd.dolby.mps":{"source":"iana"},"audio/vnd.dolby.pl2":{"source":"iana"},"audio/vnd.dolby.pl2x":{"source":"iana"},"audio/vnd.dolby.pl2z":{"source":"iana"},"audio/vnd.dolby.pulse.1":{"source":"iana"},"audio/vnd.dra":{"source":"iana","extensions":["dra"]},"audio/vnd.dts":{"source":"iana","extensions":["dts"]},"audio/vnd.dts.hd":{"source":"iana","extensions":["dtshd"]},"audio/vnd.dts.uhd":{"source":"iana"},"audio/vnd.dvb.file":{"source":"iana"},"audio/vnd.everad.plj":{"source":"iana"},"audio/vnd.hns.audio":{"source":"iana"},"audio/vnd.lucent.voice":{"source":"iana","extensions":["lvp"]},"audio/vnd.ms-playready.media.pya":{"source":"iana","extensions":["pya"]},"audio/vnd.nokia.mobile-xmf":{"source":"iana"},"audio/vnd.nortel.vbk":{"source":"iana"},"audio/vnd.nuera.ecelp4800":{"source":"iana","extensions":["ecelp4800"]},"audio/vnd.nuera.ecelp7470":{"source":"iana","extensions":["ecelp7470"]},"audio/vnd.nuera.ecelp9600":{"source":"iana","extensions":["ecelp9600"]},"audio/vnd.octel.sbc":{"source":"iana"},"audio/vnd.presonus.multitrack":{"source":"iana"},"audio/vnd.qcelp":{"source":"iana"},"audio/vnd.rhetorex.32kadpcm":{"source":"iana"},"audio/vnd.rip":{"source":"iana","extensions":["rip"]},"audio/vnd.rn-realaudio":{"compressible":false},"audio/vnd.sealedmedia.softseal.mpeg":{"source":"iana"},"audio/vnd.vmx.cvsd":{"source":"iana"},"audio/vnd.wave":{"compressible":false},"audio/vorbis":{"source":"iana","compressible":false},"audio/vorbis-config":{"source":"iana"},"audio/wav":{"compressible":false,"extensions":["wav"]},"audio/wave":{"compressible":false,"extensions":["wav"]},"audio/webm":{"source":"apache","compressible":false,"extensions":["weba"]},"audio/x-aac":{"source":"apache","compressible":false,"extensions":["aac"]},"audio/x-aiff":{"source":"apache","extensions":["aif","aiff","aifc"]},"audio/x-caf":{"source":"apache","compressible":false,"extensions":["caf"]},"audio/x-flac":{"source":"apache","extensions":["flac"]},"audio/x-m4a":{"source":"nginx","extensions":["m4a"]},"audio/x-matroska":{"source":"apache","extensions":["mka"]},"audio/x-mpegurl":{"source":"apache","extensions":["m3u"]},"audio/x-ms-wax":{"source":"apache","extensions":["wax"]},"audio/x-ms-wma":{"source":"apache","extensions":["wma"]},"audio/x-pn-realaudio":{"source":"apache","extensions":["ram","ra"]},"audio/x-pn-realaudio-plugin":{"source":"apache","extensions":["rmp"]},"audio/x-realaudio":{"source":"nginx","extensions":["ra"]},"audio/x-tta":{"source":"apache"},"audio/x-wav":{"source":"apache","extensions":["wav"]},"audio/xm":{"source":"apache","extensions":["xm"]},"chemical/x-cdx":{"source":"apache","extensions":["cdx"]},"chemical/x-cif":{"source":"apache","extensions":["cif"]},"chemical/x-cmdf":{"source":"apache","extensions":["cmdf"]},"chemical/x-cml":{"source":"apache","extensions":["cml"]},"chemical/x-csml":{"source":"apache","extensions":["csml"]},"chemical/x-pdb":{"source":"apache"},"chemical/x-xyz":{"source":"apache","extensions":["xyz"]},"font/collection":{"source":"iana","extensions":["ttc"]},"font/otf":{"source":"iana","compressible":true,"extensions":["otf"]},"font/sfnt":{"source":"iana"},"font/ttf":{"source":"iana","compressible":true,"extensions":["ttf"]},"font/woff":{"source":"iana","extensions":["woff"]},"font/woff2":{"source":"iana","extensions":["woff2"]},"image/aces":{"source":"iana","extensions":["exr"]},"image/apng":{"compressible":false,"extensions":["apng"]},"image/avci":{"source":"iana"},"image/avcs":{"source":"iana"},"image/bmp":{"source":"iana","compressible":true,"extensions":["bmp"]},"image/cgm":{"source":"iana","extensions":["cgm"]},"image/dicom-rle":{"source":"iana","extensions":["drle"]},"image/emf":{"source":"iana","extensions":["emf"]},"image/fits":{"source":"iana","extensions":["fits"]},"image/g3fax":{"source":"iana","extensions":["g3"]},"image/gif":{"source":"iana","compressible":false,"extensions":["gif"]},"image/heic":{"source":"iana","extensions":["heic"]},"image/heic-sequence":{"source":"iana","extensions":["heics"]},"image/heif":{"source":"iana","extensions":["heif"]},"image/heif-sequence":{"source":"iana","extensions":["heifs"]},"image/hej2k":{"source":"iana","extensions":["hej2"]},"image/hsj2":{"source":"iana","extensions":["hsj2"]},"image/ief":{"source":"iana","extensions":["ief"]},"image/jls":{"source":"iana","extensions":["jls"]},"image/jp2":{"source":"iana","compressible":false,"extensions":["jp2","jpg2"]},"image/jpeg":{"source":"iana","compressible":false,"extensions":["jpeg","jpg","jpe"]},"image/jph":{"source":"iana","extensions":["jph"]},"image/jphc":{"source":"iana","extensions":["jhc"]},"image/jpm":{"source":"iana","compressible":false,"extensions":["jpm"]},"image/jpx":{"source":"iana","compressible":false,"extensions":["jpx","jpf"]},"image/jxr":{"source":"iana","extensions":["jxr"]},"image/jxra":{"source":"iana","extensions":["jxra"]},"image/jxrs":{"source":"iana","extensions":["jxrs"]},"image/jxs":{"source":"iana","extensions":["jxs"]},"image/jxsc":{"source":"iana","extensions":["jxsc"]},"image/jxsi":{"source":"iana","extensions":["jxsi"]},"image/jxss":{"source":"iana","extensions":["jxss"]},"image/ktx":{"source":"iana","extensions":["ktx"]},"image/naplps":{"source":"iana"},"image/pjpeg":{"compressible":false},"image/png":{"source":"iana","compressible":false,"extensions":["png"]},"image/prs.btif":{"source":"iana","extensions":["btif"]},"image/prs.pti":{"source":"iana","extensions":["pti"]},"image/pwg-raster":{"source":"iana"},"image/sgi":{"source":"apache","extensions":["sgi"]},"image/svg+xml":{"source":"iana","compressible":true,"extensions":["svg","svgz"]},"image/t38":{"source":"iana","extensions":["t38"]},"image/tiff":{"source":"iana","compressible":false,"extensions":["tif","tiff"]},"image/tiff-fx":{"source":"iana","extensions":["tfx"]},"image/vnd.adobe.photoshop":{"source":"iana","compressible":true,"extensions":["psd"]},"image/vnd.airzip.accelerator.azv":{"source":"iana","extensions":["azv"]},"image/vnd.cns.inf2":{"source":"iana"},"image/vnd.dece.graphic":{"source":"iana","extensions":["uvi","uvvi","uvg","uvvg"]},"image/vnd.djvu":{"source":"iana","extensions":["djvu","djv"]},"image/vnd.dvb.subtitle":{"source":"iana","extensions":["sub"]},"image/vnd.dwg":{"source":"iana","extensions":["dwg"]},"image/vnd.dxf":{"source":"iana","extensions":["dxf"]},"image/vnd.fastbidsheet":{"source":"iana","extensions":["fbs"]},"image/vnd.fpx":{"source":"iana","extensions":["fpx"]},"image/vnd.fst":{"source":"iana","extensions":["fst"]},"image/vnd.fujixerox.edmics-mmr":{"source":"iana","extensions":["mmr"]},"image/vnd.fujixerox.edmics-rlc":{"source":"iana","extensions":["rlc"]},"image/vnd.globalgraphics.pgb":{"source":"iana"},"image/vnd.microsoft.icon":{"source":"iana","extensions":["ico"]},"image/vnd.mix":{"source":"iana"},"image/vnd.mozilla.apng":{"source":"iana"},"image/vnd.ms-dds":{"extensions":["dds"]},"image/vnd.ms-modi":{"source":"iana","extensions":["mdi"]},"image/vnd.ms-photo":{"source":"apache","extensions":["wdp"]},"image/vnd.net-fpx":{"source":"iana","extensions":["npx"]},"image/vnd.radiance":{"source":"iana"},"image/vnd.sealed.png":{"source":"iana"},"image/vnd.sealedmedia.softseal.gif":{"source":"iana"},"image/vnd.sealedmedia.softseal.jpg":{"source":"iana"},"image/vnd.svf":{"source":"iana"},"image/vnd.tencent.tap":{"source":"iana","extensions":["tap"]},"image/vnd.valve.source.texture":{"source":"iana","extensions":["vtf"]},"image/vnd.wap.wbmp":{"source":"iana","extensions":["wbmp"]},"image/vnd.xiff":{"source":"iana","extensions":["xif"]},"image/vnd.zbrush.pcx":{"source":"iana","extensions":["pcx"]},"image/webp":{"source":"apache","extensions":["webp"]},"image/wmf":{"source":"iana","extensions":["wmf"]},"image/x-3ds":{"source":"apache","extensions":["3ds"]},"image/x-cmu-raster":{"source":"apache","extensions":["ras"]},"image/x-cmx":{"source":"apache","extensions":["cmx"]},"image/x-freehand":{"source":"apache","extensions":["fh","fhc","fh4","fh5","fh7"]},"image/x-icon":{"source":"apache","compressible":true,"extensions":["ico"]},"image/x-jng":{"source":"nginx","extensions":["jng"]},"image/x-mrsid-image":{"source":"apache","extensions":["sid"]},"image/x-ms-bmp":{"source":"nginx","compressible":true,"extensions":["bmp"]},"image/x-pcx":{"source":"apache","extensions":["pcx"]},"image/x-pict":{"source":"apache","extensions":["pic","pct"]},"image/x-portable-anymap":{"source":"apache","extensions":["pnm"]},"image/x-portable-bitmap":{"source":"apache","extensions":["pbm"]},"image/x-portable-graymap":{"source":"apache","extensions":["pgm"]},"image/x-portable-pixmap":{"source":"apache","extensions":["ppm"]},"image/x-rgb":{"source":"apache","extensions":["rgb"]},"image/x-tga":{"source":"apache","extensions":["tga"]},"image/x-xbitmap":{"source":"apache","extensions":["xbm"]},"image/x-xcf":{"compressible":false},"image/x-xpixmap":{"source":"apache","extensions":["xpm"]},"image/x-xwindowdump":{"source":"apache","extensions":["xwd"]},"message/cpim":{"source":"iana"},"message/delivery-status":{"source":"iana"},"message/disposition-notification":{"source":"iana","extensions":["disposition-notification"]},"message/external-body":{"source":"iana"},"message/feedback-report":{"source":"iana"},"message/global":{"source":"iana","extensions":["u8msg"]},"message/global-delivery-status":{"source":"iana","extensions":["u8dsn"]},"message/global-disposition-notification":{"source":"iana","extensions":["u8mdn"]},"message/global-headers":{"source":"iana","extensions":["u8hdr"]},"message/http":{"source":"iana","compressible":false},"message/imdn+xml":{"source":"iana","compressible":true},"message/news":{"source":"iana"},"message/partial":{"source":"iana","compressible":false},"message/rfc822":{"source":"iana","compressible":true,"extensions":["eml","mime"]},"message/s-http":{"source":"iana"},"message/sip":{"source":"iana"},"message/sipfrag":{"source":"iana"},"message/tracking-status":{"source":"iana"},"message/vnd.si.simp":{"source":"iana"},"message/vnd.wfa.wsc":{"source":"iana","extensions":["wsc"]},"model/3mf":{"source":"iana","extensions":["3mf"]},"model/gltf+json":{"source":"iana","compressible":true,"extensions":["gltf"]},"model/gltf-binary":{"source":"iana","compressible":true,"extensions":["glb"]},"model/iges":{"source":"iana","compressible":false,"extensions":["igs","iges"]},"model/mesh":{"source":"iana","compressible":false,"extensions":["msh","mesh","silo"]},"model/stl":{"source":"iana","extensions":["stl"]},"model/vnd.collada+xml":{"source":"iana","compressible":true,"extensions":["dae"]},"model/vnd.dwf":{"source":"iana","extensions":["dwf"]},"model/vnd.flatland.3dml":{"source":"iana"},"model/vnd.gdl":{"source":"iana","extensions":["gdl"]},"model/vnd.gs-gdl":{"source":"apache"},"model/vnd.gs.gdl":{"source":"iana"},"model/vnd.gtw":{"source":"iana","extensions":["gtw"]},"model/vnd.moml+xml":{"source":"iana","compressible":true},"model/vnd.mts":{"source":"iana","extensions":["mts"]},"model/vnd.opengex":{"source":"iana","extensions":["ogex"]},"model/vnd.parasolid.transmit.binary":{"source":"iana","extensions":["x_b"]},"model/vnd.parasolid.transmit.text":{"source":"iana","extensions":["x_t"]},"model/vnd.rosette.annotated-data-model":{"source":"iana"},"model/vnd.usdz+zip":{"source":"iana","compressible":false,"extensions":["usdz"]},"model/vnd.valve.source.compiled-map":{"source":"iana","extensions":["bsp"]},"model/vnd.vtu":{"source":"iana","extensions":["vtu"]},"model/vrml":{"source":"iana","compressible":false,"extensions":["wrl","vrml"]},"model/x3d+binary":{"source":"apache","compressible":false,"extensions":["x3db","x3dbz"]},"model/x3d+fastinfoset":{"source":"iana","extensions":["x3db"]},"model/x3d+vrml":{"source":"apache","compressible":false,"extensions":["x3dv","x3dvz"]},"model/x3d+xml":{"source":"iana","compressible":true,"extensions":["x3d","x3dz"]},"model/x3d-vrml":{"source":"iana","extensions":["x3dv"]},"multipart/alternative":{"source":"iana","compressible":false},"multipart/appledouble":{"source":"iana"},"multipart/byteranges":{"source":"iana"},"multipart/digest":{"source":"iana"},"multipart/encrypted":{"source":"iana","compressible":false},"multipart/form-data":{"source":"iana","compressible":false},"multipart/header-set":{"source":"iana"},"multipart/mixed":{"source":"iana"},"multipart/multilingual":{"source":"iana"},"multipart/parallel":{"source":"iana"},"multipart/related":{"source":"iana","compressible":false},"multipart/report":{"source":"iana"},"multipart/signed":{"source":"iana","compressible":false},"multipart/vnd.bint.med-plus":{"source":"iana"},"multipart/voice-message":{"source":"iana"},"multipart/x-mixed-replace":{"source":"iana"},"text/1d-interleaved-parityfec":{"source":"iana"},"text/cache-manifest":{"source":"iana","compressible":true,"extensions":["appcache","manifest"]},"text/calendar":{"source":"iana","extensions":["ics","ifb"]},"text/calender":{"compressible":true},"text/cmd":{"compressible":true},"text/coffeescript":{"extensions":["coffee","litcoffee"]},"text/css":{"source":"iana","charset":"UTF-8","compressible":true,"extensions":["css"]},"text/csv":{"source":"iana","compressible":true,"extensions":["csv"]},"text/csv-schema":{"source":"iana"},"text/directory":{"source":"iana"},"text/dns":{"source":"iana"},"text/ecmascript":{"source":"iana"},"text/encaprtp":{"source":"iana"},"text/enriched":{"source":"iana"},"text/flexfec":{"source":"iana"},"text/fwdred":{"source":"iana"},"text/grammar-ref-list":{"source":"iana"},"text/html":{"source":"iana","compressible":true,"extensions":["html","htm","shtml"]},"text/jade":{"extensions":["jade"]},"text/javascript":{"source":"iana","compressible":true},"text/jcr-cnd":{"source":"iana"},"text/jsx":{"compressible":true,"extensions":["jsx"]},"text/less":{"compressible":true,"extensions":["less"]},"text/markdown":{"source":"iana","compressible":true,"extensions":["markdown","md"]},"text/mathml":{"source":"nginx","extensions":["mml"]},"text/mdx":{"compressible":true,"extensions":["mdx"]},"text/mizar":{"source":"iana"},"text/n3":{"source":"iana","compressible":true,"extensions":["n3"]},"text/parameters":{"source":"iana"},"text/parityfec":{"source":"iana"},"text/plain":{"source":"iana","compressible":true,"extensions":["txt","text","conf","def","list","log","in","ini"]},"text/provenance-notation":{"source":"iana"},"text/prs.fallenstein.rst":{"source":"iana"},"text/prs.lines.tag":{"source":"iana","extensions":["dsc"]},"text/prs.prop.logic":{"source":"iana"},"text/raptorfec":{"source":"iana"},"text/red":{"source":"iana"},"text/rfc822-headers":{"source":"iana"},"text/richtext":{"source":"iana","compressible":true,"extensions":["rtx"]},"text/rtf":{"source":"iana","compressible":true,"extensions":["rtf"]},"text/rtp-enc-aescm128":{"source":"iana"},"text/rtploopback":{"source":"iana"},"text/rtx":{"source":"iana"},"text/sgml":{"source":"iana","extensions":["sgml","sgm"]},"text/shex":{"extensions":["shex"]},"text/slim":{"extensions":["slim","slm"]},"text/strings":{"source":"iana"},"text/stylus":{"extensions":["stylus","styl"]},"text/t140":{"source":"iana"},"text/tab-separated-values":{"source":"iana","compressible":true,"extensions":["tsv"]},"text/troff":{"source":"iana","extensions":["t","tr","roff","man","me","ms"]},"text/turtle":{"source":"iana","charset":"UTF-8","extensions":["ttl"]},"text/ulpfec":{"source":"iana"},"text/uri-list":{"source":"iana","compressible":true,"extensions":["uri","uris","urls"]},"text/vcard":{"source":"iana","compressible":true,"extensions":["vcard"]},"text/vnd.a":{"source":"iana"},"text/vnd.abc":{"source":"iana"},"text/vnd.ascii-art":{"source":"iana"},"text/vnd.curl":{"source":"iana","extensions":["curl"]},"text/vnd.curl.dcurl":{"source":"apache","extensions":["dcurl"]},"text/vnd.curl.mcurl":{"source":"apache","extensions":["mcurl"]},"text/vnd.curl.scurl":{"source":"apache","extensions":["scurl"]},"text/vnd.debian.copyright":{"source":"iana"},"text/vnd.dmclientscript":{"source":"iana"},"text/vnd.dvb.subtitle":{"source":"iana","extensions":["sub"]},"text/vnd.esmertec.theme-descriptor":{"source":"iana"},"text/vnd.ficlab.flt":{"source":"iana"},"text/vnd.fly":{"source":"iana","extensions":["fly"]},"text/vnd.fmi.flexstor":{"source":"iana","extensions":["flx"]},"text/vnd.gml":{"source":"iana"},"text/vnd.graphviz":{"source":"iana","extensions":["gv"]},"text/vnd.hgl":{"source":"iana"},"text/vnd.in3d.3dml":{"source":"iana","extensions":["3dml"]},"text/vnd.in3d.spot":{"source":"iana","extensions":["spot"]},"text/vnd.iptc.newsml":{"source":"iana"},"text/vnd.iptc.nitf":{"source":"iana"},"text/vnd.latex-z":{"source":"iana"},"text/vnd.motorola.reflex":{"source":"iana"},"text/vnd.ms-mediapackage":{"source":"iana"},"text/vnd.net2phone.commcenter.command":{"source":"iana"},"text/vnd.radisys.msml-basic-layout":{"source":"iana"},"text/vnd.senx.warpscript":{"source":"iana"},"text/vnd.si.uricatalogue":{"source":"iana"},"text/vnd.sosi":{"source":"iana"},"text/vnd.sun.j2me.app-descriptor":{"source":"iana","extensions":["jad"]},"text/vnd.trolltech.linguist":{"source":"iana"},"text/vnd.wap.si":{"source":"iana"},"text/vnd.wap.sl":{"source":"iana"},"text/vnd.wap.wml":{"source":"iana","extensions":["wml"]},"text/vnd.wap.wmlscript":{"source":"iana","extensions":["wmls"]},"text/vtt":{"source":"iana","charset":"UTF-8","compressible":true,"extensions":["vtt"]},"text/x-asm":{"source":"apache","extensions":["s","asm"]},"text/x-c":{"source":"apache","extensions":["c","cc","cxx","cpp","h","hh","dic"]},"text/x-component":{"source":"nginx","extensions":["htc"]},"text/x-fortran":{"source":"apache","extensions":["f","for","f77","f90"]},"text/x-gwt-rpc":{"compressible":true},"text/x-handlebars-template":{"extensions":["hbs"]},"text/x-java-source":{"source":"apache","extensions":["java"]},"text/x-jquery-tmpl":{"compressible":true},"text/x-lua":{"extensions":["lua"]},"text/x-markdown":{"compressible":true,"extensions":["mkd"]},"text/x-nfo":{"source":"apache","extensions":["nfo"]},"text/x-opml":{"source":"apache","extensions":["opml"]},"text/x-org":{"compressible":true,"extensions":["org"]},"text/x-pascal":{"source":"apache","extensions":["p","pas"]},"text/x-processing":{"compressible":true,"extensions":["pde"]},"text/x-sass":{"extensions":["sass"]},"text/x-scss":{"extensions":["scss"]},"text/x-setext":{"source":"apache","extensions":["etx"]},"text/x-sfv":{"source":"apache","extensions":["sfv"]},"text/x-suse-ymp":{"compressible":true,"extensions":["ymp"]},"text/x-uuencode":{"source":"apache","extensions":["uu"]},"text/x-vcalendar":{"source":"apache","extensions":["vcs"]},"text/x-vcard":{"source":"apache","extensions":["vcf"]},"text/xml":{"source":"iana","compressible":true,"extensions":["xml"]},"text/xml-external-parsed-entity":{"source":"iana"},"text/yaml":{"extensions":["yaml","yml"]},"video/1d-interleaved-parityfec":{"source":"iana"},"video/3gpp":{"source":"iana","extensions":["3gp","3gpp"]},"video/3gpp-tt":{"source":"iana"},"video/3gpp2":{"source":"iana","extensions":["3g2"]},"video/bmpeg":{"source":"iana"},"video/bt656":{"source":"iana"},"video/celb":{"source":"iana"},"video/dv":{"source":"iana"},"video/encaprtp":{"source":"iana"},"video/flexfec":{"source":"iana"},"video/h261":{"source":"iana","extensions":["h261"]},"video/h263":{"source":"iana","extensions":["h263"]},"video/h263-1998":{"source":"iana"},"video/h263-2000":{"source":"iana"},"video/h264":{"source":"iana","extensions":["h264"]},"video/h264-rcdo":{"source":"iana"},"video/h264-svc":{"source":"iana"},"video/h265":{"source":"iana"},"video/iso.segment":{"source":"iana"},"video/jpeg":{"source":"iana","extensions":["jpgv"]},"video/jpeg2000":{"source":"iana"},"video/jpm":{"source":"apache","extensions":["jpm","jpgm"]},"video/mj2":{"source":"iana","extensions":["mj2","mjp2"]},"video/mp1s":{"source":"iana"},"video/mp2p":{"source":"iana"},"video/mp2t":{"source":"iana","extensions":["ts"]},"video/mp4":{"source":"iana","compressible":false,"extensions":["mp4","mp4v","mpg4"]},"video/mp4v-es":{"source":"iana"},"video/mpeg":{"source":"iana","compressible":false,"extensions":["mpeg","mpg","mpe","m1v","m2v"]},"video/mpeg4-generic":{"source":"iana"},"video/mpv":{"source":"iana"},"video/nv":{"source":"iana"},"video/ogg":{"source":"iana","compressible":false,"extensions":["ogv"]},"video/parityfec":{"source":"iana"},"video/pointer":{"source":"iana"},"video/quicktime":{"source":"iana","compressible":false,"extensions":["qt","mov"]},"video/raptorfec":{"source":"iana"},"video/raw":{"source":"iana"},"video/rtp-enc-aescm128":{"source":"iana"},"video/rtploopback":{"source":"iana"},"video/rtx":{"source":"iana"},"video/smpte291":{"source":"iana"},"video/smpte292m":{"source":"iana"},"video/ulpfec":{"source":"iana"},"video/vc1":{"source":"iana"},"video/vc2":{"source":"iana"},"video/vnd.cctv":{"source":"iana"},"video/vnd.dece.hd":{"source":"iana","extensions":["uvh","uvvh"]},"video/vnd.dece.mobile":{"source":"iana","extensions":["uvm","uvvm"]},"video/vnd.dece.mp4":{"source":"iana"},"video/vnd.dece.pd":{"source":"iana","extensions":["uvp","uvvp"]},"video/vnd.dece.sd":{"source":"iana","extensions":["uvs","uvvs"]},"video/vnd.dece.video":{"source":"iana","extensions":["uvv","uvvv"]},"video/vnd.directv.mpeg":{"source":"iana"},"video/vnd.directv.mpeg-tts":{"source":"iana"},"video/vnd.dlna.mpeg-tts":{"source":"iana"},"video/vnd.dvb.file":{"source":"iana","extensions":["dvb"]},"video/vnd.fvt":{"source":"iana","extensions":["fvt"]},"video/vnd.hns.video":{"source":"iana"},"video/vnd.iptvforum.1dparityfec-1010":{"source":"iana"},"video/vnd.iptvforum.1dparityfec-2005":{"source":"iana"},"video/vnd.iptvforum.2dparityfec-1010":{"source":"iana"},"video/vnd.iptvforum.2dparityfec-2005":{"source":"iana"},"video/vnd.iptvforum.ttsavc":{"source":"iana"},"video/vnd.iptvforum.ttsmpeg2":{"source":"iana"},"video/vnd.motorola.video":{"source":"iana"},"video/vnd.motorola.videop":{"source":"iana"},"video/vnd.mpegurl":{"source":"iana","extensions":["mxu","m4u"]},"video/vnd.ms-playready.media.pyv":{"source":"iana","extensions":["pyv"]},"video/vnd.nokia.interleaved-multimedia":{"source":"iana"},"video/vnd.nokia.mp4vr":{"source":"iana"},"video/vnd.nokia.videovoip":{"source":"iana"},"video/vnd.objectvideo":{"source":"iana"},"video/vnd.radgamettools.bink":{"source":"iana"},"video/vnd.radgamettools.smacker":{"source":"iana"},"video/vnd.sealed.mpeg1":{"source":"iana"},"video/vnd.sealed.mpeg4":{"source":"iana"},"video/vnd.sealed.swf":{"source":"iana"},"video/vnd.sealedmedia.softseal.mov":{"source":"iana"},"video/vnd.uvvu.mp4":{"source":"iana","extensions":["uvu","uvvu"]},"video/vnd.vivo":{"source":"iana","extensions":["viv"]},"video/vnd.youtube.yt":{"source":"iana"},"video/vp8":{"source":"iana"},"video/webm":{"source":"apache","compressible":false,"extensions":["webm"]},"video/x-f4v":{"source":"apache","extensions":["f4v"]},"video/x-fli":{"source":"apache","extensions":["fli"]},"video/x-flv":{"source":"apache","compressible":false,"extensions":["flv"]},"video/x-m4v":{"source":"apache","extensions":["m4v"]},"video/x-matroska":{"source":"apache","compressible":false,"extensions":["mkv","mk3d","mks"]},"video/x-mng":{"source":"apache","extensions":["mng"]},"video/x-ms-asf":{"source":"apache","extensions":["asf","asx"]},"video/x-ms-vob":{"source":"apache","extensions":["vob"]},"video/x-ms-wm":{"source":"apache","extensions":["wm"]},"video/x-ms-wmv":{"source":"apache","compressible":false,"extensions":["wmv"]},"video/x-ms-wmx":{"source":"apache","extensions":["wmx"]},"video/x-ms-wvx":{"source":"apache","extensions":["wvx"]},"video/x-msvideo":{"source":"apache","extensions":["avi"]},"video/x-sgi-movie":{"source":"apache","extensions":["movie"]},"video/x-smv":{"source":"apache","extensions":["smv"]},"x-conference/x-cooltalk":{"source":"apache","extensions":["ice"]},"x-shader/x-fragment":{"compressible":true},"x-shader/x-vertex":{"compressible":true}}; /***/ }), /***/ 514: /***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; var compileSchema = __webpack_require__(805) , resolve = __webpack_require__(867) , Cache = __webpack_require__(921) , SchemaObject = __webpack_require__(955) , stableStringify = __webpack_require__(741) , formats = __webpack_require__(881) , rules = __webpack_require__(496) , $dataMetaSchema = __webpack_require__(628) , util = __webpack_require__(855); module.exports = Ajv; Ajv.prototype.validate = validate; Ajv.prototype.compile = compile; Ajv.prototype.addSchema = addSchema; Ajv.prototype.addMetaSchema = addMetaSchema; Ajv.prototype.validateSchema = validateSchema; Ajv.prototype.getSchema = getSchema; Ajv.prototype.removeSchema = removeSchema; Ajv.prototype.addFormat = addFormat; Ajv.prototype.errorsText = errorsText; Ajv.prototype._addSchema = _addSchema; Ajv.prototype._compile = _compile; Ajv.prototype.compileAsync = __webpack_require__(890); var customKeyword = __webpack_require__(45); Ajv.prototype.addKeyword = customKeyword.add; Ajv.prototype.getKeyword = customKeyword.get; Ajv.prototype.removeKeyword = customKeyword.remove; Ajv.prototype.validateKeyword = customKeyword.validate; var errorClasses = __webpack_require__(844); Ajv.ValidationError = errorClasses.Validation; Ajv.MissingRefError = errorClasses.MissingRef; Ajv.$dataMetaSchema = $dataMetaSchema; var META_SCHEMA_ID = 'http://json-schema.org/draft-07/schema'; var META_IGNORE_OPTIONS = [ 'removeAdditional', 'useDefaults', 'coerceTypes', 'strictDefaults' ]; var META_SUPPORT_DATA = ['/properties']; /** * Creates validator instance. * Usage: `Ajv(opts)` * @param {Object} opts optional options * @return {Object} ajv instance */ function Ajv(opts) { if (!(this instanceof Ajv)) return new Ajv(opts); opts = this._opts = util.copy(opts) || {}; setLogger(this); this._schemas = {}; this._refs = {}; this._fragments = {}; this._formats = formats(opts.format); this._cache = opts.cache || new Cache; this._loadingSchemas = {}; this._compilations = []; this.RULES = rules(); this._getId = chooseGetId(opts); opts.loopRequired = opts.loopRequired || Infinity; if (opts.errorDataPath == 'property') opts._errorDataPathProperty = true; if (opts.serialize === undefined) opts.serialize = stableStringify; this._metaOpts = getMetaSchemaOptions(this); if (opts.formats) addInitialFormats(this); if (opts.keywords) addInitialKeywords(this); addDefaultMetaSchema(this); if (typeof opts.meta == 'object') this.addMetaSchema(opts.meta); if (opts.nullable) this.addKeyword('nullable', {metaSchema: {type: 'boolean'}}); addInitialSchemas(this); } /** * Validate data using schema * Schema will be compiled and cached (using serialized JSON as key. [fast-json-stable-stringify](https://github.com/epoberezkin/fast-json-stable-stringify) is used to serialize. * @this Ajv * @param {String|Object} schemaKeyRef key, ref or schema object * @param {Any} data to be validated * @return {Boolean} validation result. Errors from the last validation will be available in `ajv.errors` (and also in compiled schema: `schema.errors`). */ function validate(schemaKeyRef, data) { var v; if (typeof schemaKeyRef == 'string') { v = this.getSchema(schemaKeyRef); if (!v) throw new Error('no schema with key or ref "' + schemaKeyRef + '"'); } else { var schemaObj = this._addSchema(schemaKeyRef); v = schemaObj.validate || this._compile(schemaObj); } var valid = v(data); if (v.$async !== true) this.errors = v.errors; return valid; } /** * Create validating function for passed schema. * @this Ajv * @param {Object} schema schema object * @param {Boolean} _meta true if schema is a meta-schema. Used internally to compile meta schemas of custom keywords. * @return {Function} validating function */ function compile(schema, _meta) { var schemaObj = this._addSchema(schema, undefined, _meta); return schemaObj.validate || this._compile(schemaObj); } /** * Adds schema to the instance. * @this Ajv * @param {Object|Array} schema schema or array of schemas. If array is passed, `key` and other parameters will be ignored. * @param {String} key Optional schema key. Can be passed to `validate` method instead of schema object or id/ref. One schema per instance can have empty `id` and `key`. * @param {Boolean} _skipValidation true to skip schema validation. Used internally, option validateSchema should be used instead. * @param {Boolean} _meta true if schema is a meta-schema. Used internally, addMetaSchema should be used instead. * @return {Ajv} this for method chaining */ function addSchema(schema, key, _skipValidation, _meta) { if (Array.isArray(schema)){ for (var i=0; i} errors optional array of validation errors, if not passed errors from the instance are used. * @param {Object} options optional options with properties `separator` and `dataVar`. * @return {String} human readable string with all errors descriptions */ function errorsText(errors, options) { errors = errors || this.errors; if (!errors) return 'No errors'; options = options || {}; var separator = options.separator === undefined ? ', ' : options.separator; var dataVar = options.dataVar === undefined ? 'data' : options.dataVar; var text = ''; for (var i=0; i= 1, 'key must have at least one part'); assert.ok(partial || sshbuf.atEnd(), 'leftover bytes at end of key'); var Constructor = Key; var algInfo = algs.info[key.type]; if (type === 'private' || algInfo.parts.length !== parts.length) { algInfo = algs.privInfo[key.type]; Constructor = PrivateKey; } assert.strictEqual(algInfo.parts.length, parts.length); if (key.type === 'ecdsa') { var res = /^ecdsa-sha2-(.+)$/.exec(alg); assert.ok(res !== null); assert.strictEqual(res[1], parts[0].data.toString()); } var normalized = true; for (var i = 0; i < algInfo.parts.length; ++i) { var p = parts[i]; p.name = algInfo.parts[i]; /* * OpenSSH stores ed25519 "private" keys as seed + public key * concat'd together (k followed by A). We want to keep them * separate for other formats that don't do this. */ if (key.type === 'ed25519' && p.name === 'k') p.data = p.data.slice(0, 32); if (p.name !== 'curve' && algInfo.normalize !== false) { var nd; if (key.type === 'ed25519') { nd = utils.zeroPadToLength(p.data, 32); } else { nd = utils.mpNormalize(p.data); } if (nd.toString('binary') !== p.data.toString('binary')) { p.data = nd; normalized = false; } } } if (normalized) key._rfc4253Cache = sshbuf.toBuffer(); if (partial && typeof (partial) === 'object') { partial.remainder = sshbuf.remainder(); partial.consumed = sshbuf._offset; } return (new Constructor(key)); } function write(key, options) { assert.object(key); var alg = keyTypeToAlg(key); var i; var algInfo = algs.info[key.type]; if (PrivateKey.isPrivateKey(key)) algInfo = algs.privInfo[key.type]; var parts = algInfo.parts; var buf = new SSHBuffer({}); buf.writeString(alg); for (i = 0; i < parts.length; ++i) { var data = key.part[parts[i]].data; if (algInfo.normalize !== false) { if (key.type === 'ed25519') data = utils.zeroPadToLength(data, 32); else data = utils.mpNormalize(data); } if (key.type === 'ed25519' && parts[i] === 'k') data = Buffer.concat([data, key.part.A.data]); buf.writeBuffer(data); } return (buf.toBuffer()); } /***/ }), /***/ 542: /***/ (function(module) { "use strict"; module.exports = function generate_pattern(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $data = 'data' + ($dataLvl || ''); var $isData = it.opts.$data && $schema && $schema.$data, $schemaValue; if ($isData) { out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; $schemaValue = 'schema' + $lvl; } else { $schemaValue = $schema; } var $regexp = $isData ? '(new RegExp(' + $schemaValue + '))' : it.usePattern($schema); out += 'if ( '; if ($isData) { out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'string\') || '; } out += ' !' + ($regexp) + '.test(' + ($data) + ') ) { '; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('pattern') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { pattern: '; if ($isData) { out += '' + ($schemaValue); } else { out += '' + (it.util.toQuotedString($schema)); } out += ' } '; if (it.opts.messages !== false) { out += ' , message: \'should match pattern "'; if ($isData) { out += '\' + ' + ($schemaValue) + ' + \''; } else { out += '' + (it.util.escapeQuotes($schema)); } out += '"\' '; } if (it.opts.verbose) { out += ' , schema: '; if ($isData) { out += 'validate.schema' + ($schemaPath); } else { out += '' + (it.util.toQuotedString($schema)); } out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } out += '} '; if ($breakOnError) { out += ' else { '; } return out; } /***/ }), /***/ 547: /***/ (function(module, __unusedexports, __webpack_require__) { var util = __webpack_require__(669); var Stream = __webpack_require__(413).Stream; var DelayedStream = __webpack_require__(152); module.exports = CombinedStream; function CombinedStream() { this.writable = false; this.readable = true; this.dataSize = 0; this.maxDataSize = 2 * 1024 * 1024; this.pauseStreams = true; this._released = false; this._streams = []; this._currentStream = null; this._insideLoop = false; this._pendingNext = false; } util.inherits(CombinedStream, Stream); CombinedStream.create = function(options) { var combinedStream = new this(); options = options || {}; for (var option in options) { combinedStream[option] = options[option]; } return combinedStream; }; CombinedStream.isStreamLike = function(stream) { return (typeof stream !== 'function') && (typeof stream !== 'string') && (typeof stream !== 'boolean') && (typeof stream !== 'number') && (!Buffer.isBuffer(stream)); }; CombinedStream.prototype.append = function(stream) { var isStreamLike = CombinedStream.isStreamLike(stream); if (isStreamLike) { if (!(stream instanceof DelayedStream)) { var newStream = DelayedStream.create(stream, { maxDataSize: Infinity, pauseStream: this.pauseStreams, }); stream.on('data', this._checkDataSize.bind(this)); stream = newStream; } this._handleErrors(stream); if (this.pauseStreams) { stream.pause(); } } this._streams.push(stream); return this; }; CombinedStream.prototype.pipe = function(dest, options) { Stream.prototype.pipe.call(this, dest, options); this.resume(); return dest; }; CombinedStream.prototype._getNext = function() { this._currentStream = null; if (this._insideLoop) { this._pendingNext = true; return; // defer call } this._insideLoop = true; try { do { this._pendingNext = false; this._realGetNext(); } while (this._pendingNext); } finally { this._insideLoop = false; } }; CombinedStream.prototype._realGetNext = function() { var stream = this._streams.shift(); if (typeof stream == 'undefined') { this.end(); return; } if (typeof stream !== 'function') { this._pipeNext(stream); return; } var getStream = stream; getStream(function(stream) { var isStreamLike = CombinedStream.isStreamLike(stream); if (isStreamLike) { stream.on('data', this._checkDataSize.bind(this)); this._handleErrors(stream); } this._pipeNext(stream); }.bind(this)); }; CombinedStream.prototype._pipeNext = function(stream) { this._currentStream = stream; var isStreamLike = CombinedStream.isStreamLike(stream); if (isStreamLike) { stream.on('end', this._getNext.bind(this)); stream.pipe(this, {end: false}); return; } var value = stream; this.write(value); this._getNext(); }; CombinedStream.prototype._handleErrors = function(stream) { var self = this; stream.on('error', function(err) { self._emitError(err); }); }; CombinedStream.prototype.write = function(data) { this.emit('data', data); }; CombinedStream.prototype.pause = function() { if (!this.pauseStreams) { return; } if(this.pauseStreams && this._currentStream && typeof(this._currentStream.pause) == 'function') this._currentStream.pause(); this.emit('pause'); }; CombinedStream.prototype.resume = function() { if (!this._released) { this._released = true; this.writable = true; this._getNext(); } if(this.pauseStreams && this._currentStream && typeof(this._currentStream.resume) == 'function') this._currentStream.resume(); this.emit('resume'); }; CombinedStream.prototype.end = function() { this._reset(); this.emit('end'); }; CombinedStream.prototype.destroy = function() { this._reset(); this.emit('close'); }; CombinedStream.prototype._reset = function() { this.writable = false; this._streams = []; this._currentStream = null; }; CombinedStream.prototype._checkDataSize = function() { this._updateDataSize(); if (this.dataSize <= this.maxDataSize) { return; } var message = 'DelayedStream#maxDataSize of ' + this.maxDataSize + ' bytes exceeded.'; this._emitError(new Error(message)); }; CombinedStream.prototype._updateDataSize = function() { this.dataSize = 0; var self = this; this._streams.forEach(function(stream) { if (!stream.dataSize) { return; } self.dataSize += stream.dataSize; }); if (this._currentStream && this._currentStream.dataSize) { this.dataSize += this._currentStream.dataSize; } }; CombinedStream.prototype._emitError = function(err) { this._reset(); this.emit('error', err); }; /***/ }), /***/ 552: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; var url = __webpack_require__(835) var isUrl = /^https?:/ function Redirect (request) { this.request = request this.followRedirect = true this.followRedirects = true this.followAllRedirects = false this.followOriginalHttpMethod = false this.allowRedirect = function () { return true } this.maxRedirects = 10 this.redirects = [] this.redirectsFollowed = 0 this.removeRefererHeader = false } Redirect.prototype.onRequest = function (options) { var self = this if (options.maxRedirects !== undefined) { self.maxRedirects = options.maxRedirects } if (typeof options.followRedirect === 'function') { self.allowRedirect = options.followRedirect } if (options.followRedirect !== undefined) { self.followRedirects = !!options.followRedirect } if (options.followAllRedirects !== undefined) { self.followAllRedirects = options.followAllRedirects } if (self.followRedirects || self.followAllRedirects) { self.redirects = self.redirects || [] } if (options.removeRefererHeader !== undefined) { self.removeRefererHeader = options.removeRefererHeader } if (options.followOriginalHttpMethod !== undefined) { self.followOriginalHttpMethod = options.followOriginalHttpMethod } } Redirect.prototype.redirectTo = function (response) { var self = this var request = self.request var redirectTo = null if (response.statusCode >= 300 && response.statusCode < 400 && response.caseless.has('location')) { var location = response.caseless.get('location') request.debug('redirect', location) if (self.followAllRedirects) { redirectTo = location } else if (self.followRedirects) { switch (request.method) { case 'PATCH': case 'PUT': case 'POST': case 'DELETE': // Do not follow redirects break default: redirectTo = location break } } } else if (response.statusCode === 401) { var authHeader = request._auth.onResponse(response) if (authHeader) { request.setHeader('authorization', authHeader) redirectTo = request.uri } } return redirectTo } Redirect.prototype.onResponse = function (response) { var self = this var request = self.request var redirectTo = self.redirectTo(response) if (!redirectTo || !self.allowRedirect.call(request, response)) { return false } request.debug('redirect to', redirectTo) // ignore any potential response body. it cannot possibly be useful // to us at this point. // response.resume should be defined, but check anyway before calling. Workaround for browserify. if (response.resume) { response.resume() } if (self.redirectsFollowed >= self.maxRedirects) { request.emit('error', new Error('Exceeded maxRedirects. Probably stuck in a redirect loop ' + request.uri.href)) return false } self.redirectsFollowed += 1 if (!isUrl.test(redirectTo)) { redirectTo = url.resolve(request.uri.href, redirectTo) } var uriPrev = request.uri request.uri = url.parse(redirectTo) // handle the case where we change protocol from https to http or vice versa if (request.uri.protocol !== uriPrev.protocol) { delete request.agent } self.redirects.push({ statusCode: response.statusCode, redirectUri: redirectTo }) if (self.followAllRedirects && request.method !== 'HEAD' && response.statusCode !== 401 && response.statusCode !== 307) { request.method = self.followOriginalHttpMethod ? request.method : 'GET' } // request.method = 'GET' // Force all redirects to use GET || commented out fixes #215 delete request.src delete request.req delete request._started if (response.statusCode !== 401 && response.statusCode !== 307) { // Remove parameters from the previous response, unless this is the second request // for a server that requires digest authentication. delete request.body delete request._form if (request.headers) { request.removeHeader('host') request.removeHeader('content-type') request.removeHeader('content-length') if (request.uri.hostname !== request.originalHost.split(':')[0]) { // Remove authorization if changing hostnames (but not if just // changing ports or protocols). This matches the behavior of curl: // https://github.com/bagder/curl/blob/6beb0eee/lib/http.c#L710 request.removeHeader('authorization') } } } if (!self.removeRefererHeader) { request.setHeader('referer', uriPrev.href) } request.emit('redirect') request.init() return true } exports.Redirect = Redirect /***/ }), /***/ 554: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; var caseless = __webpack_require__(254) var uuid = __webpack_require__(826) var helpers = __webpack_require__(810) var md5 = helpers.md5 var toBase64 = helpers.toBase64 function Auth (request) { // define all public properties here this.request = request this.hasAuth = false this.sentAuth = false this.bearerToken = null this.user = null this.pass = null } Auth.prototype.basic = function (user, pass, sendImmediately) { var self = this if (typeof user !== 'string' || (pass !== undefined && typeof pass !== 'string')) { self.request.emit('error', new Error('auth() received invalid user or password')) } self.user = user self.pass = pass self.hasAuth = true var header = user + ':' + (pass || '') if (sendImmediately || typeof sendImmediately === 'undefined') { var authHeader = 'Basic ' + toBase64(header) self.sentAuth = true return authHeader } } Auth.prototype.bearer = function (bearer, sendImmediately) { var self = this self.bearerToken = bearer self.hasAuth = true if (sendImmediately || typeof sendImmediately === 'undefined') { if (typeof bearer === 'function') { bearer = bearer() } var authHeader = 'Bearer ' + (bearer || '') self.sentAuth = true return authHeader } } Auth.prototype.digest = function (method, path, authHeader) { // TODO: More complete implementation of RFC 2617. // - handle challenge.domain // - support qop="auth-int" only // - handle Authentication-Info (not necessarily?) // - check challenge.stale (not necessarily?) // - increase nc (not necessarily?) // For reference: // http://tools.ietf.org/html/rfc2617#section-3 // https://github.com/bagder/curl/blob/master/lib/http_digest.c var self = this var challenge = {} var re = /([a-z0-9_-]+)=(?:"([^"]+)"|([a-z0-9_-]+))/gi while (true) { var match = re.exec(authHeader) if (!match) { break } challenge[match[1]] = match[2] || match[3] } /** * RFC 2617: handle both MD5 and MD5-sess algorithms. * * If the algorithm directive's value is "MD5" or unspecified, then HA1 is * HA1=MD5(username:realm:password) * If the algorithm directive's value is "MD5-sess", then HA1 is * HA1=MD5(MD5(username:realm:password):nonce:cnonce) */ var ha1Compute = function (algorithm, user, realm, pass, nonce, cnonce) { var ha1 = md5(user + ':' + realm + ':' + pass) if (algorithm && algorithm.toLowerCase() === 'md5-sess') { return md5(ha1 + ':' + nonce + ':' + cnonce) } else { return ha1 } } var qop = /(^|,)\s*auth\s*($|,)/.test(challenge.qop) && 'auth' var nc = qop && '00000001' var cnonce = qop && uuid().replace(/-/g, '') var ha1 = ha1Compute(challenge.algorithm, self.user, challenge.realm, self.pass, challenge.nonce, cnonce) var ha2 = md5(method + ':' + path) var digestResponse = qop ? md5(ha1 + ':' + challenge.nonce + ':' + nc + ':' + cnonce + ':' + qop + ':' + ha2) : md5(ha1 + ':' + challenge.nonce + ':' + ha2) var authValues = { username: self.user, realm: challenge.realm, nonce: challenge.nonce, uri: path, qop: qop, response: digestResponse, nc: nc, cnonce: cnonce, algorithm: challenge.algorithm, opaque: challenge.opaque } authHeader = [] for (var k in authValues) { if (authValues[k]) { if (k === 'qop' || k === 'nc' || k === 'algorithm') { authHeader.push(k + '=' + authValues[k]) } else { authHeader.push(k + '="' + authValues[k] + '"') } } } authHeader = 'Digest ' + authHeader.join(', ') self.sentAuth = true return authHeader } Auth.prototype.onRequest = function (user, pass, sendImmediately, bearer) { var self = this var request = self.request var authHeader if (bearer === undefined && user === undefined) { self.request.emit('error', new Error('no auth mechanism defined')) } else if (bearer !== undefined) { authHeader = self.bearer(bearer, sendImmediately) } else { authHeader = self.basic(user, pass, sendImmediately) } if (authHeader) { request.setHeader('authorization', authHeader) } } Auth.prototype.onResponse = function (response) { var self = this var request = self.request if (!self.hasAuth || self.sentAuth) { return null } var c = caseless(response.headers) var authHeader = c.get('www-authenticate') var authVerb = authHeader && authHeader.split(' ')[0].toLowerCase() request.debug('reauth', authVerb) switch (authVerb) { case 'basic': return self.basic(self.user, self.pass, true) case 'bearer': return self.bearer(self.bearerToken, true) case 'digest': return self.digest(request.method, request.path, authHeader) } } exports.Auth = Auth /***/ }), /***/ 560: /***/ (function(module) { "use strict"; module.exports = function generate__limitProperties(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $errorKeyword; var $data = 'data' + ($dataLvl || ''); var $isData = it.opts.$data && $schema && $schema.$data, $schemaValue; if ($isData) { out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; $schemaValue = 'schema' + $lvl; } else { $schemaValue = $schema; } var $op = $keyword == 'maxProperties' ? '>' : '<'; out += 'if ( '; if ($isData) { out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; } out += ' Object.keys(' + ($data) + ').length ' + ($op) + ' ' + ($schemaValue) + ') { '; var $errorKeyword = $keyword; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ($errorKeyword || '_limitProperties') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schemaValue) + ' } '; if (it.opts.messages !== false) { out += ' , message: \'should NOT have '; if ($keyword == 'maxProperties') { out += 'more'; } else { out += 'fewer'; } out += ' than '; if ($isData) { out += '\' + ' + ($schemaValue) + ' + \''; } else { out += '' + ($schema); } out += ' properties\' '; } if (it.opts.verbose) { out += ' , schema: '; if ($isData) { out += 'validate.schema' + ($schemaPath); } else { out += '' + ($schema); } out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } out += '} '; if ($breakOnError) { out += ' else { '; } return out; } /***/ }), /***/ 566: /***/ (function(module) { // API module.exports = abort; /** * Aborts leftover active jobs * * @param {object} state - current state object */ function abort(state) { Object.keys(state.jobs).forEach(clean.bind(state)); // reset leftover jobs state.jobs = {}; } /** * Cleans up leftover job by invoking abort function for the provided job id * * @this state * @param {string|number} key - job id to abort */ function clean(key) { if (typeof this.jobs[key] == 'function') { this.jobs[key](); } } /***/ }), /***/ 575: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2015 Joyent, Inc. module.exports = Signature; var assert = __webpack_require__(477); var Buffer = __webpack_require__(215).Buffer; var algs = __webpack_require__(98); var crypto = __webpack_require__(417); var errs = __webpack_require__(753); var utils = __webpack_require__(270); var asn1 = __webpack_require__(62); var SSHBuffer = __webpack_require__(940); var InvalidAlgorithmError = errs.InvalidAlgorithmError; var SignatureParseError = errs.SignatureParseError; function Signature(opts) { assert.object(opts, 'options'); assert.arrayOfObject(opts.parts, 'options.parts'); assert.string(opts.type, 'options.type'); var partLookup = {}; for (var i = 0; i < opts.parts.length; ++i) { var part = opts.parts[i]; partLookup[part.name] = part; } this.type = opts.type; this.hashAlgorithm = opts.hashAlgo; this.curve = opts.curve; this.parts = opts.parts; this.part = partLookup; } Signature.prototype.toBuffer = function (format) { if (format === undefined) format = 'asn1'; assert.string(format, 'format'); var buf; var stype = 'ssh-' + this.type; switch (this.type) { case 'rsa': switch (this.hashAlgorithm) { case 'sha256': stype = 'rsa-sha2-256'; break; case 'sha512': stype = 'rsa-sha2-512'; break; case 'sha1': case undefined: break; default: throw (new Error('SSH signature ' + 'format does not support hash ' + 'algorithm ' + this.hashAlgorithm)); } if (format === 'ssh') { buf = new SSHBuffer({}); buf.writeString(stype); buf.writePart(this.part.sig); return (buf.toBuffer()); } else { return (this.part.sig.data); } break; case 'ed25519': if (format === 'ssh') { buf = new SSHBuffer({}); buf.writeString(stype); buf.writePart(this.part.sig); return (buf.toBuffer()); } else { return (this.part.sig.data); } break; case 'dsa': case 'ecdsa': var r, s; if (format === 'asn1') { var der = new asn1.BerWriter(); der.startSequence(); r = utils.mpNormalize(this.part.r.data); s = utils.mpNormalize(this.part.s.data); der.writeBuffer(r, asn1.Ber.Integer); der.writeBuffer(s, asn1.Ber.Integer); der.endSequence(); return (der.buffer); } else if (format === 'ssh' && this.type === 'dsa') { buf = new SSHBuffer({}); buf.writeString('ssh-dss'); r = this.part.r.data; if (r.length > 20 && r[0] === 0x00) r = r.slice(1); s = this.part.s.data; if (s.length > 20 && s[0] === 0x00) s = s.slice(1); if ((this.hashAlgorithm && this.hashAlgorithm !== 'sha1') || r.length + s.length !== 40) { throw (new Error('OpenSSH only supports ' + 'DSA signatures with SHA1 hash')); } buf.writeBuffer(Buffer.concat([r, s])); return (buf.toBuffer()); } else if (format === 'ssh' && this.type === 'ecdsa') { var inner = new SSHBuffer({}); r = this.part.r.data; inner.writeBuffer(r); inner.writePart(this.part.s); buf = new SSHBuffer({}); /* XXX: find a more proper way to do this? */ var curve; if (r[0] === 0x00) r = r.slice(1); var sz = r.length * 8; if (sz === 256) curve = 'nistp256'; else if (sz === 384) curve = 'nistp384'; else if (sz === 528) curve = 'nistp521'; buf.writeString('ecdsa-sha2-' + curve); buf.writeBuffer(inner.toBuffer()); return (buf.toBuffer()); } throw (new Error('Invalid signature format')); default: throw (new Error('Invalid signature data')); } }; Signature.prototype.toString = function (format) { assert.optionalString(format, 'format'); return (this.toBuffer(format).toString('base64')); }; Signature.parse = function (data, type, format) { if (typeof (data) === 'string') data = Buffer.from(data, 'base64'); assert.buffer(data, 'data'); assert.string(format, 'format'); assert.string(type, 'type'); var opts = {}; opts.type = type.toLowerCase(); opts.parts = []; try { assert.ok(data.length > 0, 'signature must not be empty'); switch (opts.type) { case 'rsa': return (parseOneNum(data, type, format, opts)); case 'ed25519': return (parseOneNum(data, type, format, opts)); case 'dsa': case 'ecdsa': if (format === 'asn1') return (parseDSAasn1(data, type, format, opts)); else if (opts.type === 'dsa') return (parseDSA(data, type, format, opts)); else return (parseECDSA(data, type, format, opts)); default: throw (new InvalidAlgorithmError(type)); } } catch (e) { if (e instanceof InvalidAlgorithmError) throw (e); throw (new SignatureParseError(type, format, e)); } }; function parseOneNum(data, type, format, opts) { if (format === 'ssh') { try { var buf = new SSHBuffer({buffer: data}); var head = buf.readString(); } catch (e) { /* fall through */ } if (buf !== undefined) { var msg = 'SSH signature does not match expected ' + 'type (expected ' + type + ', got ' + head + ')'; switch (head) { case 'ssh-rsa': assert.strictEqual(type, 'rsa', msg); opts.hashAlgo = 'sha1'; break; case 'rsa-sha2-256': assert.strictEqual(type, 'rsa', msg); opts.hashAlgo = 'sha256'; break; case 'rsa-sha2-512': assert.strictEqual(type, 'rsa', msg); opts.hashAlgo = 'sha512'; break; case 'ssh-ed25519': assert.strictEqual(type, 'ed25519', msg); opts.hashAlgo = 'sha512'; break; default: throw (new Error('Unknown SSH signature ' + 'type: ' + head)); } var sig = buf.readPart(); assert.ok(buf.atEnd(), 'extra trailing bytes'); sig.name = 'sig'; opts.parts.push(sig); return (new Signature(opts)); } } opts.parts.push({name: 'sig', data: data}); return (new Signature(opts)); } function parseDSAasn1(data, type, format, opts) { var der = new asn1.BerReader(data); der.readSequence(); var r = der.readString(asn1.Ber.Integer, true); var s = der.readString(asn1.Ber.Integer, true); opts.parts.push({name: 'r', data: utils.mpNormalize(r)}); opts.parts.push({name: 's', data: utils.mpNormalize(s)}); return (new Signature(opts)); } function parseDSA(data, type, format, opts) { if (data.length != 40) { var buf = new SSHBuffer({buffer: data}); var d = buf.readBuffer(); if (d.toString('ascii') === 'ssh-dss') d = buf.readBuffer(); assert.ok(buf.atEnd(), 'extra trailing bytes'); assert.strictEqual(d.length, 40, 'invalid inner length'); data = d; } opts.parts.push({name: 'r', data: data.slice(0, 20)}); opts.parts.push({name: 's', data: data.slice(20, 40)}); return (new Signature(opts)); } function parseECDSA(data, type, format, opts) { var buf = new SSHBuffer({buffer: data}); var r, s; var inner = buf.readBuffer(); var stype = inner.toString('ascii'); if (stype.slice(0, 6) === 'ecdsa-') { var parts = stype.split('-'); assert.strictEqual(parts[0], 'ecdsa'); assert.strictEqual(parts[1], 'sha2'); opts.curve = parts[2]; switch (opts.curve) { case 'nistp256': opts.hashAlgo = 'sha256'; break; case 'nistp384': opts.hashAlgo = 'sha384'; break; case 'nistp521': opts.hashAlgo = 'sha512'; break; default: throw (new Error('Unsupported ECDSA curve: ' + opts.curve)); } inner = buf.readBuffer(); assert.ok(buf.atEnd(), 'extra trailing bytes on outer'); buf = new SSHBuffer({buffer: inner}); r = buf.readPart(); } else { r = {data: inner}; } s = buf.readPart(); assert.ok(buf.atEnd(), 'extra trailing bytes'); r.name = 'r'; s.name = 's'; opts.parts.push(r); opts.parts.push(s); return (new Signature(opts)); } Signature.isSignature = function (obj, ver) { return (utils.isCompatible(obj, Signature, ver)); }; /* * API versions for Signature: * [1,0] -- initial ver * [2,0] -- support for rsa in full ssh format, compat with sshpk-agent * hashAlgorithm property * [2,1] -- first tagged version */ Signature.prototype._sshpkApiVersion = [2, 1]; Signature._oldVersionDetect = function (obj) { assert.func(obj.toBuffer); if (obj.hasOwnProperty('hashAlgorithm')) return ([2, 0]); return ([1, 0]); }; /***/ }), /***/ 581: /***/ (function(module) { "use strict"; var has = Object.prototype.hasOwnProperty; var hexTable = (function () { var array = []; for (var i = 0; i < 256; ++i) { array.push('%' + ((i < 16 ? '0' : '') + i.toString(16)).toUpperCase()); } return array; }()); var compactQueue = function compactQueue(queue) { var obj; while (queue.length) { var item = queue.pop(); obj = item.obj[item.prop]; if (Array.isArray(obj)) { var compacted = []; for (var j = 0; j < obj.length; ++j) { if (typeof obj[j] !== 'undefined') { compacted.push(obj[j]); } } item.obj[item.prop] = compacted; } } return obj; }; var arrayToObject = function arrayToObject(source, options) { var obj = options && options.plainObjects ? Object.create(null) : {}; for (var i = 0; i < source.length; ++i) { if (typeof source[i] !== 'undefined') { obj[i] = source[i]; } } return obj; }; var merge = function merge(target, source, options) { if (!source) { return target; } if (typeof source !== 'object') { if (Array.isArray(target)) { target.push(source); } else if (typeof target === 'object') { if (options.plainObjects || options.allowPrototypes || !has.call(Object.prototype, source)) { target[source] = true; } } else { return [target, source]; } return target; } if (typeof target !== 'object') { return [target].concat(source); } var mergeTarget = target; if (Array.isArray(target) && !Array.isArray(source)) { mergeTarget = arrayToObject(target, options); } if (Array.isArray(target) && Array.isArray(source)) { source.forEach(function (item, i) { if (has.call(target, i)) { if (target[i] && typeof target[i] === 'object') { target[i] = merge(target[i], item, options); } else { target.push(item); } } else { target[i] = item; } }); return target; } return Object.keys(source).reduce(function (acc, key) { var value = source[key]; if (has.call(acc, key)) { acc[key] = merge(acc[key], value, options); } else { acc[key] = value; } return acc; }, mergeTarget); }; var assign = function assignSingleSource(target, source) { return Object.keys(source).reduce(function (acc, key) { acc[key] = source[key]; return acc; }, target); }; var decode = function (str) { try { return decodeURIComponent(str.replace(/\+/g, ' ')); } catch (e) { return str; } }; var encode = function encode(str) { // This code was originally written by Brian White (mscdex) for the io.js core querystring library. // It has been adapted here for stricter adherence to RFC 3986 if (str.length === 0) { return str; } var string = typeof str === 'string' ? str : String(str); var out = ''; for (var i = 0; i < string.length; ++i) { var c = string.charCodeAt(i); if ( c === 0x2D // - || c === 0x2E // . || c === 0x5F // _ || c === 0x7E // ~ || (c >= 0x30 && c <= 0x39) // 0-9 || (c >= 0x41 && c <= 0x5A) // a-z || (c >= 0x61 && c <= 0x7A) // A-Z ) { out += string.charAt(i); continue; } if (c < 0x80) { out = out + hexTable[c]; continue; } if (c < 0x800) { out = out + (hexTable[0xC0 | (c >> 6)] + hexTable[0x80 | (c & 0x3F)]); continue; } if (c < 0xD800 || c >= 0xE000) { out = out + (hexTable[0xE0 | (c >> 12)] + hexTable[0x80 | ((c >> 6) & 0x3F)] + hexTable[0x80 | (c & 0x3F)]); continue; } i += 1; c = 0x10000 + (((c & 0x3FF) << 10) | (string.charCodeAt(i) & 0x3FF)); out += hexTable[0xF0 | (c >> 18)] + hexTable[0x80 | ((c >> 12) & 0x3F)] + hexTable[0x80 | ((c >> 6) & 0x3F)] + hexTable[0x80 | (c & 0x3F)]; } return out; }; var compact = function compact(value) { var queue = [{ obj: { o: value }, prop: 'o' }]; var refs = []; for (var i = 0; i < queue.length; ++i) { var item = queue[i]; var obj = item.obj[item.prop]; var keys = Object.keys(obj); for (var j = 0; j < keys.length; ++j) { var key = keys[j]; var val = obj[key]; if (typeof val === 'object' && val !== null && refs.indexOf(val) === -1) { queue.push({ obj: obj, prop: key }); refs.push(val); } } } return compactQueue(queue); }; var isRegExp = function isRegExp(obj) { return Object.prototype.toString.call(obj) === '[object RegExp]'; }; var isBuffer = function isBuffer(obj) { if (obj === null || typeof obj === 'undefined') { return false; } return !!(obj.constructor && obj.constructor.isBuffer && obj.constructor.isBuffer(obj)); }; module.exports = { arrayToObject: arrayToObject, assign: assign, compact: compact, decode: decode, encode: encode, isBuffer: isBuffer, isRegExp: isRegExp, merge: merge }; /***/ }), /***/ 584: /***/ (function(module) { // Copyright 2011 Mark Cavage All rights reserved. module.exports = { newInvalidAsn1Error: function (msg) { var e = new Error(); e.name = 'InvalidAsn1Error'; e.message = msg || ''; return e; } }; /***/ }), /***/ 602: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; var tough = __webpack_require__(701) var Cookie = tough.Cookie var CookieJar = tough.CookieJar exports.parse = function (str) { if (str && str.uri) { str = str.uri } if (typeof str !== 'string') { throw new Error('The cookie function only accepts STRING as param') } return Cookie.parse(str, {loose: true}) } // Adapt the sometimes-Async api of tough.CookieJar to our requirements function RequestJar (store) { var self = this self._jar = new CookieJar(store, {looseMode: true}) } RequestJar.prototype.setCookie = function (cookieOrStr, uri, options) { var self = this return self._jar.setCookieSync(cookieOrStr, uri, options || {}) } RequestJar.prototype.getCookieString = function (uri) { var self = this return self._jar.getCookieStringSync(uri) } RequestJar.prototype.getCookies = function (uri) { var self = this return self._jar.getCookiesSync(uri) } exports.jar = function (store) { return new RequestJar(store) } /***/ }), /***/ 603: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2015 Joyent, Inc. module.exports = { read: read, write: write }; var assert = __webpack_require__(477); var Buffer = __webpack_require__(215).Buffer; var rfc4253 = __webpack_require__(538); var utils = __webpack_require__(270); var Key = __webpack_require__(852); var PrivateKey = __webpack_require__(502); var sshpriv = __webpack_require__(78); /*JSSTYLED*/ var SSHKEY_RE = /^([a-z0-9-]+)[ \t]+([a-zA-Z0-9+\/]+[=]*)([ \t]+([^ \t][^\n]*[\n]*)?)?$/; /*JSSTYLED*/ var SSHKEY_RE2 = /^([a-z0-9-]+)[ \t\n]+([a-zA-Z0-9+\/][a-zA-Z0-9+\/ \t\n=]*)([^a-zA-Z0-9+\/ \t\n=].*)?$/; function read(buf, options) { if (typeof (buf) !== 'string') { assert.buffer(buf, 'buf'); buf = buf.toString('ascii'); } var trimmed = buf.trim().replace(/[\\\r]/g, ''); var m = trimmed.match(SSHKEY_RE); if (!m) m = trimmed.match(SSHKEY_RE2); assert.ok(m, 'key must match regex'); var type = rfc4253.algToKeyType(m[1]); var kbuf = Buffer.from(m[2], 'base64'); /* * This is a bit tricky. If we managed to parse the key and locate the * key comment with the regex, then do a non-partial read and assert * that we have consumed all bytes. If we couldn't locate the key * comment, though, there may be whitespace shenanigans going on that * have conjoined the comment to the rest of the key. We do a partial * read in this case to try to make the best out of a sorry situation. */ var key; var ret = {}; if (m[4]) { try { key = rfc4253.read(kbuf); } catch (e) { m = trimmed.match(SSHKEY_RE2); assert.ok(m, 'key must match regex'); kbuf = Buffer.from(m[2], 'base64'); key = rfc4253.readInternal(ret, 'public', kbuf); } } else { key = rfc4253.readInternal(ret, 'public', kbuf); } assert.strictEqual(type, key.type); if (m[4] && m[4].length > 0) { key.comment = m[4]; } else if (ret.consumed) { /* * Now the magic: trying to recover the key comment when it's * gotten conjoined to the key or otherwise shenanigan'd. * * Work out how much base64 we used, then drop all non-base64 * chars from the beginning up to this point in the the string. * Then offset in this and try to make up for missing = chars. */ var data = m[2] + (m[3] ? m[3] : ''); var realOffset = Math.ceil(ret.consumed / 3) * 4; data = data.slice(0, realOffset - 2). /*JSSTYLED*/ replace(/[^a-zA-Z0-9+\/=]/g, '') + data.slice(realOffset - 2); var padding = ret.consumed % 3; if (padding > 0 && data.slice(realOffset - 1, realOffset) !== '=') realOffset--; while (data.slice(realOffset, realOffset + 1) === '=') realOffset++; /* Finally, grab what we think is the comment & clean it up. */ var trailer = data.slice(realOffset); trailer = trailer.replace(/[\r\n]/g, ' '). replace(/^\s+/, ''); if (trailer.match(/^[a-zA-Z0-9]/)) key.comment = trailer; } return (key); } function write(key, options) { assert.object(key); if (!Key.isKey(key)) throw (new Error('Must be a public key')); var parts = []; var alg = rfc4253.keyTypeToAlg(key); parts.push(alg); var buf = rfc4253.write(key); parts.push(buf.toString('base64')); if (key.comment) parts.push(key.comment); return (Buffer.from(parts.join(' '))); } /***/ }), /***/ 605: /***/ (function(module) { module.exports = require("http"); /***/ }), /***/ 614: /***/ (function(module) { module.exports = require("events"); /***/ }), /***/ 622: /***/ (function(module) { module.exports = require("path"); /***/ }), /***/ 624: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2018 Joyent, Inc. module.exports = { read: read, write: write }; var assert = __webpack_require__(477); var Buffer = __webpack_require__(215).Buffer; var rfc4253 = __webpack_require__(538); var Key = __webpack_require__(852); var errors = __webpack_require__(753); function read(buf, options) { var lines = buf.toString('ascii').split(/[\r\n]+/); var found = false; var parts; var si = 0; while (si < lines.length) { parts = splitHeader(lines[si++]); if (parts && parts[0].toLowerCase() === 'putty-user-key-file-2') { found = true; break; } } if (!found) { throw (new Error('No PuTTY format first line found')); } var alg = parts[1]; parts = splitHeader(lines[si++]); assert.equal(parts[0].toLowerCase(), 'encryption'); parts = splitHeader(lines[si++]); assert.equal(parts[0].toLowerCase(), 'comment'); var comment = parts[1]; parts = splitHeader(lines[si++]); assert.equal(parts[0].toLowerCase(), 'public-lines'); var publicLines = parseInt(parts[1], 10); if (!isFinite(publicLines) || publicLines < 0 || publicLines > lines.length) { throw (new Error('Invalid public-lines count')); } var publicBuf = Buffer.from( lines.slice(si, si + publicLines).join(''), 'base64'); var keyType = rfc4253.algToKeyType(alg); var key = rfc4253.read(publicBuf); if (key.type !== keyType) { throw (new Error('Outer key algorithm mismatch')); } key.comment = comment; return (key); } function splitHeader(line) { var idx = line.indexOf(':'); if (idx === -1) return (null); var header = line.slice(0, idx); ++idx; while (line[idx] === ' ') ++idx; var rest = line.slice(idx); return ([header, rest]); } function write(key, options) { assert.object(key); if (!Key.isKey(key)) throw (new Error('Must be a public key')); var alg = rfc4253.keyTypeToAlg(key); var buf = rfc4253.write(key); var comment = key.comment || ''; var b64 = buf.toString('base64'); var lines = wrap(b64, 64); lines.unshift('Public-Lines: ' + lines.length); lines.unshift('Comment: ' + comment); lines.unshift('Encryption: none'); lines.unshift('PuTTY-User-Key-File-2: ' + alg); return (Buffer.from(lines.join('\n') + '\n')); } function wrap(txt, len) { var lines = []; var pos = 0; while (pos < txt.length) { lines.push(txt.slice(pos, pos + 64)); pos += 64; } return (lines); } /***/ }), /***/ 627: /***/ (function(__unusedmodule, exports) { "use strict"; /*! * Copyright (c) 2015, Salesforce.com, Inc. * All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions are met: * * 1. Redistributions of source code must retain the above copyright notice, * this list of conditions and the following disclaimer. * * 2. Redistributions in binary form must reproduce the above copyright notice, * this list of conditions and the following disclaimer in the documentation * and/or other materials provided with the distribution. * * 3. Neither the name of Salesforce.com nor the names of its contributors may * be used to endorse or promote products derived from this software without * specific prior written permission. * * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE * POSSIBILITY OF SUCH DAMAGE. */ /*jshint unused:false */ function Store() { } exports.Store = Store; // Stores may be synchronous, but are still required to use a // Continuation-Passing Style API. The CookieJar itself will expose a "*Sync" // API that converts from synchronous-callbacks to imperative style. Store.prototype.synchronous = false; Store.prototype.findCookie = function(domain, path, key, cb) { throw new Error('findCookie is not implemented'); }; Store.prototype.findCookies = function(domain, path, cb) { throw new Error('findCookies is not implemented'); }; Store.prototype.putCookie = function(cookie, cb) { throw new Error('putCookie is not implemented'); }; Store.prototype.updateCookie = function(oldCookie, newCookie, cb) { // recommended default implementation: // return this.putCookie(newCookie, cb); throw new Error('updateCookie is not implemented'); }; Store.prototype.removeCookie = function(domain, path, key, cb) { throw new Error('removeCookie is not implemented'); }; Store.prototype.removeCookies = function(domain, path, cb) { throw new Error('removeCookies is not implemented'); }; Store.prototype.removeAllCookies = function(cb) { throw new Error('removeAllCookies is not implemented'); } Store.prototype.getAllCookies = function(cb) { throw new Error('getAllCookies is not implemented (therefore jar cannot be serialized)'); }; /***/ }), /***/ 628: /***/ (function(module) { "use strict"; var KEYWORDS = [ 'multipleOf', 'maximum', 'exclusiveMaximum', 'minimum', 'exclusiveMinimum', 'maxLength', 'minLength', 'pattern', 'additionalItems', 'maxItems', 'minItems', 'uniqueItems', 'maxProperties', 'minProperties', 'required', 'additionalProperties', 'enum', 'format', 'const' ]; module.exports = function (metaSchema, keywordsJsonPointers) { for (var i=0; i */ /* * The Blowfish portions are under the following license: * * Blowfish block cipher for OpenBSD * Copyright 1997 Niels Provos * All rights reserved. * * Implementation advice by David Mazieres . * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions * are met: * 1. Redistributions of source code must retain the above copyright * notice, this list of conditions and the following disclaimer. * 2. Redistributions in binary form must reproduce the above copyright * notice, this list of conditions and the following disclaimer in the * documentation and/or other materials provided with the distribution. * 3. The name of the author may not be used to endorse or promote products * derived from this software without specific prior written permission. * * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR * IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES * OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. * IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, * INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF * THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. */ /* * The bcrypt_pbkdf portions are under the following license: * * Copyright (c) 2013 Ted Unangst * * Permission to use, copy, modify, and distribute this software for any * purpose with or without fee is hereby granted, provided that the above * copyright notice and this permission notice appear in all copies. * * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. */ /* * Performance improvements (Javascript-specific): * * Copyright 2016, Joyent Inc * Author: Alex Wilson * * Permission to use, copy, modify, and distribute this software for any * purpose with or without fee is hereby granted, provided that the above * copyright notice and this permission notice appear in all copies. * * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. */ // Ported from OpenBSD bcrypt_pbkdf.c v1.9 var BLF_J = 0; var Blowfish = function() { this.S = [ new Uint32Array([ 0xd1310ba6, 0x98dfb5ac, 0x2ffd72db, 0xd01adfb7, 0xb8e1afed, 0x6a267e96, 0xba7c9045, 0xf12c7f99, 0x24a19947, 0xb3916cf7, 0x0801f2e2, 0x858efc16, 0x636920d8, 0x71574e69, 0xa458fea3, 0xf4933d7e, 0x0d95748f, 0x728eb658, 0x718bcd58, 0x82154aee, 0x7b54a41d, 0xc25a59b5, 0x9c30d539, 0x2af26013, 0xc5d1b023, 0x286085f0, 0xca417918, 0xb8db38ef, 0x8e79dcb0, 0x603a180e, 0x6c9e0e8b, 0xb01e8a3e, 0xd71577c1, 0xbd314b27, 0x78af2fda, 0x55605c60, 0xe65525f3, 0xaa55ab94, 0x57489862, 0x63e81440, 0x55ca396a, 0x2aab10b6, 0xb4cc5c34, 0x1141e8ce, 0xa15486af, 0x7c72e993, 0xb3ee1411, 0x636fbc2a, 0x2ba9c55d, 0x741831f6, 0xce5c3e16, 0x9b87931e, 0xafd6ba33, 0x6c24cf5c, 0x7a325381, 0x28958677, 0x3b8f4898, 0x6b4bb9af, 0xc4bfe81b, 0x66282193, 0x61d809cc, 0xfb21a991, 0x487cac60, 0x5dec8032, 0xef845d5d, 0xe98575b1, 0xdc262302, 0xeb651b88, 0x23893e81, 0xd396acc5, 0x0f6d6ff3, 0x83f44239, 0x2e0b4482, 0xa4842004, 0x69c8f04a, 0x9e1f9b5e, 0x21c66842, 0xf6e96c9a, 0x670c9c61, 0xabd388f0, 0x6a51a0d2, 0xd8542f68, 0x960fa728, 0xab5133a3, 0x6eef0b6c, 0x137a3be4, 0xba3bf050, 0x7efb2a98, 0xa1f1651d, 0x39af0176, 0x66ca593e, 0x82430e88, 0x8cee8619, 0x456f9fb4, 0x7d84a5c3, 0x3b8b5ebe, 0xe06f75d8, 0x85c12073, 0x401a449f, 0x56c16aa6, 0x4ed3aa62, 0x363f7706, 0x1bfedf72, 0x429b023d, 0x37d0d724, 0xd00a1248, 0xdb0fead3, 0x49f1c09b, 0x075372c9, 0x80991b7b, 0x25d479d8, 0xf6e8def7, 0xe3fe501a, 0xb6794c3b, 0x976ce0bd, 0x04c006ba, 0xc1a94fb6, 0x409f60c4, 0x5e5c9ec2, 0x196a2463, 0x68fb6faf, 0x3e6c53b5, 0x1339b2eb, 0x3b52ec6f, 0x6dfc511f, 0x9b30952c, 0xcc814544, 0xaf5ebd09, 0xbee3d004, 0xde334afd, 0x660f2807, 0x192e4bb3, 0xc0cba857, 0x45c8740f, 0xd20b5f39, 0xb9d3fbdb, 0x5579c0bd, 0x1a60320a, 0xd6a100c6, 0x402c7279, 0x679f25fe, 0xfb1fa3cc, 0x8ea5e9f8, 0xdb3222f8, 0x3c7516df, 0xfd616b15, 0x2f501ec8, 0xad0552ab, 0x323db5fa, 0xfd238760, 0x53317b48, 0x3e00df82, 0x9e5c57bb, 0xca6f8ca0, 0x1a87562e, 0xdf1769db, 0xd542a8f6, 0x287effc3, 0xac6732c6, 0x8c4f5573, 0x695b27b0, 0xbbca58c8, 0xe1ffa35d, 0xb8f011a0, 0x10fa3d98, 0xfd2183b8, 0x4afcb56c, 0x2dd1d35b, 0x9a53e479, 0xb6f84565, 0xd28e49bc, 0x4bfb9790, 0xe1ddf2da, 0xa4cb7e33, 0x62fb1341, 0xcee4c6e8, 0xef20cada, 0x36774c01, 0xd07e9efe, 0x2bf11fb4, 0x95dbda4d, 0xae909198, 0xeaad8e71, 0x6b93d5a0, 0xd08ed1d0, 0xafc725e0, 0x8e3c5b2f, 0x8e7594b7, 0x8ff6e2fb, 0xf2122b64, 0x8888b812, 0x900df01c, 0x4fad5ea0, 0x688fc31c, 0xd1cff191, 0xb3a8c1ad, 0x2f2f2218, 0xbe0e1777, 0xea752dfe, 0x8b021fa1, 0xe5a0cc0f, 0xb56f74e8, 0x18acf3d6, 0xce89e299, 0xb4a84fe0, 0xfd13e0b7, 0x7cc43b81, 0xd2ada8d9, 0x165fa266, 0x80957705, 0x93cc7314, 0x211a1477, 0xe6ad2065, 0x77b5fa86, 0xc75442f5, 0xfb9d35cf, 0xebcdaf0c, 0x7b3e89a0, 0xd6411bd3, 0xae1e7e49, 0x00250e2d, 0x2071b35e, 0x226800bb, 0x57b8e0af, 0x2464369b, 0xf009b91e, 0x5563911d, 0x59dfa6aa, 0x78c14389, 0xd95a537f, 0x207d5ba2, 0x02e5b9c5, 0x83260376, 0x6295cfa9, 0x11c81968, 0x4e734a41, 0xb3472dca, 0x7b14a94a, 0x1b510052, 0x9a532915, 0xd60f573f, 0xbc9bc6e4, 0x2b60a476, 0x81e67400, 0x08ba6fb5, 0x571be91f, 0xf296ec6b, 0x2a0dd915, 0xb6636521, 0xe7b9f9b6, 0xff34052e, 0xc5855664, 0x53b02d5d, 0xa99f8fa1, 0x08ba4799, 0x6e85076a]), new Uint32Array([ 0x4b7a70e9, 0xb5b32944, 0xdb75092e, 0xc4192623, 0xad6ea6b0, 0x49a7df7d, 0x9cee60b8, 0x8fedb266, 0xecaa8c71, 0x699a17ff, 0x5664526c, 0xc2b19ee1, 0x193602a5, 0x75094c29, 0xa0591340, 0xe4183a3e, 0x3f54989a, 0x5b429d65, 0x6b8fe4d6, 0x99f73fd6, 0xa1d29c07, 0xefe830f5, 0x4d2d38e6, 0xf0255dc1, 0x4cdd2086, 0x8470eb26, 0x6382e9c6, 0x021ecc5e, 0x09686b3f, 0x3ebaefc9, 0x3c971814, 0x6b6a70a1, 0x687f3584, 0x52a0e286, 0xb79c5305, 0xaa500737, 0x3e07841c, 0x7fdeae5c, 0x8e7d44ec, 0x5716f2b8, 0xb03ada37, 0xf0500c0d, 0xf01c1f04, 0x0200b3ff, 0xae0cf51a, 0x3cb574b2, 0x25837a58, 0xdc0921bd, 0xd19113f9, 0x7ca92ff6, 0x94324773, 0x22f54701, 0x3ae5e581, 0x37c2dadc, 0xc8b57634, 0x9af3dda7, 0xa9446146, 0x0fd0030e, 0xecc8c73e, 0xa4751e41, 0xe238cd99, 0x3bea0e2f, 0x3280bba1, 0x183eb331, 0x4e548b38, 0x4f6db908, 0x6f420d03, 0xf60a04bf, 0x2cb81290, 0x24977c79, 0x5679b072, 0xbcaf89af, 0xde9a771f, 0xd9930810, 0xb38bae12, 0xdccf3f2e, 0x5512721f, 0x2e6b7124, 0x501adde6, 0x9f84cd87, 0x7a584718, 0x7408da17, 0xbc9f9abc, 0xe94b7d8c, 0xec7aec3a, 0xdb851dfa, 0x63094366, 0xc464c3d2, 0xef1c1847, 0x3215d908, 0xdd433b37, 0x24c2ba16, 0x12a14d43, 0x2a65c451, 0x50940002, 0x133ae4dd, 0x71dff89e, 0x10314e55, 0x81ac77d6, 0x5f11199b, 0x043556f1, 0xd7a3c76b, 0x3c11183b, 0x5924a509, 0xf28fe6ed, 0x97f1fbfa, 0x9ebabf2c, 0x1e153c6e, 0x86e34570, 0xeae96fb1, 0x860e5e0a, 0x5a3e2ab3, 0x771fe71c, 0x4e3d06fa, 0x2965dcb9, 0x99e71d0f, 0x803e89d6, 0x5266c825, 0x2e4cc978, 0x9c10b36a, 0xc6150eba, 0x94e2ea78, 0xa5fc3c53, 0x1e0a2df4, 0xf2f74ea7, 0x361d2b3d, 0x1939260f, 0x19c27960, 0x5223a708, 0xf71312b6, 0xebadfe6e, 0xeac31f66, 0xe3bc4595, 0xa67bc883, 0xb17f37d1, 0x018cff28, 0xc332ddef, 0xbe6c5aa5, 0x65582185, 0x68ab9802, 0xeecea50f, 0xdb2f953b, 0x2aef7dad, 0x5b6e2f84, 0x1521b628, 0x29076170, 0xecdd4775, 0x619f1510, 0x13cca830, 0xeb61bd96, 0x0334fe1e, 0xaa0363cf, 0xb5735c90, 0x4c70a239, 0xd59e9e0b, 0xcbaade14, 0xeecc86bc, 0x60622ca7, 0x9cab5cab, 0xb2f3846e, 0x648b1eaf, 0x19bdf0ca, 0xa02369b9, 0x655abb50, 0x40685a32, 0x3c2ab4b3, 0x319ee9d5, 0xc021b8f7, 0x9b540b19, 0x875fa099, 0x95f7997e, 0x623d7da8, 0xf837889a, 0x97e32d77, 0x11ed935f, 0x16681281, 0x0e358829, 0xc7e61fd6, 0x96dedfa1, 0x7858ba99, 0x57f584a5, 0x1b227263, 0x9b83c3ff, 0x1ac24696, 0xcdb30aeb, 0x532e3054, 0x8fd948e4, 0x6dbc3128, 0x58ebf2ef, 0x34c6ffea, 0xfe28ed61, 0xee7c3c73, 0x5d4a14d9, 0xe864b7e3, 0x42105d14, 0x203e13e0, 0x45eee2b6, 0xa3aaabea, 0xdb6c4f15, 0xfacb4fd0, 0xc742f442, 0xef6abbb5, 0x654f3b1d, 0x41cd2105, 0xd81e799e, 0x86854dc7, 0xe44b476a, 0x3d816250, 0xcf62a1f2, 0x5b8d2646, 0xfc8883a0, 0xc1c7b6a3, 0x7f1524c3, 0x69cb7492, 0x47848a0b, 0x5692b285, 0x095bbf00, 0xad19489d, 0x1462b174, 0x23820e00, 0x58428d2a, 0x0c55f5ea, 0x1dadf43e, 0x233f7061, 0x3372f092, 0x8d937e41, 0xd65fecf1, 0x6c223bdb, 0x7cde3759, 0xcbee7460, 0x4085f2a7, 0xce77326e, 0xa6078084, 0x19f8509e, 0xe8efd855, 0x61d99735, 0xa969a7aa, 0xc50c06c2, 0x5a04abfc, 0x800bcadc, 0x9e447a2e, 0xc3453484, 0xfdd56705, 0x0e1e9ec9, 0xdb73dbd3, 0x105588cd, 0x675fda79, 0xe3674340, 0xc5c43465, 0x713e38d8, 0x3d28f89e, 0xf16dff20, 0x153e21e7, 0x8fb03d4a, 0xe6e39f2b, 0xdb83adf7]), new Uint32Array([ 0xe93d5a68, 0x948140f7, 0xf64c261c, 0x94692934, 0x411520f7, 0x7602d4f7, 0xbcf46b2e, 0xd4a20068, 0xd4082471, 0x3320f46a, 0x43b7d4b7, 0x500061af, 0x1e39f62e, 0x97244546, 0x14214f74, 0xbf8b8840, 0x4d95fc1d, 0x96b591af, 0x70f4ddd3, 0x66a02f45, 0xbfbc09ec, 0x03bd9785, 0x7fac6dd0, 0x31cb8504, 0x96eb27b3, 0x55fd3941, 0xda2547e6, 0xabca0a9a, 0x28507825, 0x530429f4, 0x0a2c86da, 0xe9b66dfb, 0x68dc1462, 0xd7486900, 0x680ec0a4, 0x27a18dee, 0x4f3ffea2, 0xe887ad8c, 0xb58ce006, 0x7af4d6b6, 0xaace1e7c, 0xd3375fec, 0xce78a399, 0x406b2a42, 0x20fe9e35, 0xd9f385b9, 0xee39d7ab, 0x3b124e8b, 0x1dc9faf7, 0x4b6d1856, 0x26a36631, 0xeae397b2, 0x3a6efa74, 0xdd5b4332, 0x6841e7f7, 0xca7820fb, 0xfb0af54e, 0xd8feb397, 0x454056ac, 0xba489527, 0x55533a3a, 0x20838d87, 0xfe6ba9b7, 0xd096954b, 0x55a867bc, 0xa1159a58, 0xcca92963, 0x99e1db33, 0xa62a4a56, 0x3f3125f9, 0x5ef47e1c, 0x9029317c, 0xfdf8e802, 0x04272f70, 0x80bb155c, 0x05282ce3, 0x95c11548, 0xe4c66d22, 0x48c1133f, 0xc70f86dc, 0x07f9c9ee, 0x41041f0f, 0x404779a4, 0x5d886e17, 0x325f51eb, 0xd59bc0d1, 0xf2bcc18f, 0x41113564, 0x257b7834, 0x602a9c60, 0xdff8e8a3, 0x1f636c1b, 0x0e12b4c2, 0x02e1329e, 0xaf664fd1, 0xcad18115, 0x6b2395e0, 0x333e92e1, 0x3b240b62, 0xeebeb922, 0x85b2a20e, 0xe6ba0d99, 0xde720c8c, 0x2da2f728, 0xd0127845, 0x95b794fd, 0x647d0862, 0xe7ccf5f0, 0x5449a36f, 0x877d48fa, 0xc39dfd27, 0xf33e8d1e, 0x0a476341, 0x992eff74, 0x3a6f6eab, 0xf4f8fd37, 0xa812dc60, 0xa1ebddf8, 0x991be14c, 0xdb6e6b0d, 0xc67b5510, 0x6d672c37, 0x2765d43b, 0xdcd0e804, 0xf1290dc7, 0xcc00ffa3, 0xb5390f92, 0x690fed0b, 0x667b9ffb, 0xcedb7d9c, 0xa091cf0b, 0xd9155ea3, 0xbb132f88, 0x515bad24, 0x7b9479bf, 0x763bd6eb, 0x37392eb3, 0xcc115979, 0x8026e297, 0xf42e312d, 0x6842ada7, 0xc66a2b3b, 0x12754ccc, 0x782ef11c, 0x6a124237, 0xb79251e7, 0x06a1bbe6, 0x4bfb6350, 0x1a6b1018, 0x11caedfa, 0x3d25bdd8, 0xe2e1c3c9, 0x44421659, 0x0a121386, 0xd90cec6e, 0xd5abea2a, 0x64af674e, 0xda86a85f, 0xbebfe988, 0x64e4c3fe, 0x9dbc8057, 0xf0f7c086, 0x60787bf8, 0x6003604d, 0xd1fd8346, 0xf6381fb0, 0x7745ae04, 0xd736fccc, 0x83426b33, 0xf01eab71, 0xb0804187, 0x3c005e5f, 0x77a057be, 0xbde8ae24, 0x55464299, 0xbf582e61, 0x4e58f48f, 0xf2ddfda2, 0xf474ef38, 0x8789bdc2, 0x5366f9c3, 0xc8b38e74, 0xb475f255, 0x46fcd9b9, 0x7aeb2661, 0x8b1ddf84, 0x846a0e79, 0x915f95e2, 0x466e598e, 0x20b45770, 0x8cd55591, 0xc902de4c, 0xb90bace1, 0xbb8205d0, 0x11a86248, 0x7574a99e, 0xb77f19b6, 0xe0a9dc09, 0x662d09a1, 0xc4324633, 0xe85a1f02, 0x09f0be8c, 0x4a99a025, 0x1d6efe10, 0x1ab93d1d, 0x0ba5a4df, 0xa186f20f, 0x2868f169, 0xdcb7da83, 0x573906fe, 0xa1e2ce9b, 0x4fcd7f52, 0x50115e01, 0xa70683fa, 0xa002b5c4, 0x0de6d027, 0x9af88c27, 0x773f8641, 0xc3604c06, 0x61a806b5, 0xf0177a28, 0xc0f586e0, 0x006058aa, 0x30dc7d62, 0x11e69ed7, 0x2338ea63, 0x53c2dd94, 0xc2c21634, 0xbbcbee56, 0x90bcb6de, 0xebfc7da1, 0xce591d76, 0x6f05e409, 0x4b7c0188, 0x39720a3d, 0x7c927c24, 0x86e3725f, 0x724d9db9, 0x1ac15bb4, 0xd39eb8fc, 0xed545578, 0x08fca5b5, 0xd83d7cd3, 0x4dad0fc4, 0x1e50ef5e, 0xb161e6f8, 0xa28514d9, 0x6c51133c, 0x6fd5c7e7, 0x56e14ec4, 0x362abfce, 0xddc6c837, 0xd79a3234, 0x92638212, 0x670efa8e, 0x406000e0]), new Uint32Array([ 0x3a39ce37, 0xd3faf5cf, 0xabc27737, 0x5ac52d1b, 0x5cb0679e, 0x4fa33742, 0xd3822740, 0x99bc9bbe, 0xd5118e9d, 0xbf0f7315, 0xd62d1c7e, 0xc700c47b, 0xb78c1b6b, 0x21a19045, 0xb26eb1be, 0x6a366eb4, 0x5748ab2f, 0xbc946e79, 0xc6a376d2, 0x6549c2c8, 0x530ff8ee, 0x468dde7d, 0xd5730a1d, 0x4cd04dc6, 0x2939bbdb, 0xa9ba4650, 0xac9526e8, 0xbe5ee304, 0xa1fad5f0, 0x6a2d519a, 0x63ef8ce2, 0x9a86ee22, 0xc089c2b8, 0x43242ef6, 0xa51e03aa, 0x9cf2d0a4, 0x83c061ba, 0x9be96a4d, 0x8fe51550, 0xba645bd6, 0x2826a2f9, 0xa73a3ae1, 0x4ba99586, 0xef5562e9, 0xc72fefd3, 0xf752f7da, 0x3f046f69, 0x77fa0a59, 0x80e4a915, 0x87b08601, 0x9b09e6ad, 0x3b3ee593, 0xe990fd5a, 0x9e34d797, 0x2cf0b7d9, 0x022b8b51, 0x96d5ac3a, 0x017da67d, 0xd1cf3ed6, 0x7c7d2d28, 0x1f9f25cf, 0xadf2b89b, 0x5ad6b472, 0x5a88f54c, 0xe029ac71, 0xe019a5e6, 0x47b0acfd, 0xed93fa9b, 0xe8d3c48d, 0x283b57cc, 0xf8d56629, 0x79132e28, 0x785f0191, 0xed756055, 0xf7960e44, 0xe3d35e8c, 0x15056dd4, 0x88f46dba, 0x03a16125, 0x0564f0bd, 0xc3eb9e15, 0x3c9057a2, 0x97271aec, 0xa93a072a, 0x1b3f6d9b, 0x1e6321f5, 0xf59c66fb, 0x26dcf319, 0x7533d928, 0xb155fdf5, 0x03563482, 0x8aba3cbb, 0x28517711, 0xc20ad9f8, 0xabcc5167, 0xccad925f, 0x4de81751, 0x3830dc8e, 0x379d5862, 0x9320f991, 0xea7a90c2, 0xfb3e7bce, 0x5121ce64, 0x774fbe32, 0xa8b6e37e, 0xc3293d46, 0x48de5369, 0x6413e680, 0xa2ae0810, 0xdd6db224, 0x69852dfd, 0x09072166, 0xb39a460a, 0x6445c0dd, 0x586cdecf, 0x1c20c8ae, 0x5bbef7dd, 0x1b588d40, 0xccd2017f, 0x6bb4e3bb, 0xdda26a7e, 0x3a59ff45, 0x3e350a44, 0xbcb4cdd5, 0x72eacea8, 0xfa6484bb, 0x8d6612ae, 0xbf3c6f47, 0xd29be463, 0x542f5d9e, 0xaec2771b, 0xf64e6370, 0x740e0d8d, 0xe75b1357, 0xf8721671, 0xaf537d5d, 0x4040cb08, 0x4eb4e2cc, 0x34d2466a, 0x0115af84, 0xe1b00428, 0x95983a1d, 0x06b89fb4, 0xce6ea048, 0x6f3f3b82, 0x3520ab82, 0x011a1d4b, 0x277227f8, 0x611560b1, 0xe7933fdc, 0xbb3a792b, 0x344525bd, 0xa08839e1, 0x51ce794b, 0x2f32c9b7, 0xa01fbac9, 0xe01cc87e, 0xbcc7d1f6, 0xcf0111c3, 0xa1e8aac7, 0x1a908749, 0xd44fbd9a, 0xd0dadecb, 0xd50ada38, 0x0339c32a, 0xc6913667, 0x8df9317c, 0xe0b12b4f, 0xf79e59b7, 0x43f5bb3a, 0xf2d519ff, 0x27d9459c, 0xbf97222c, 0x15e6fc2a, 0x0f91fc71, 0x9b941525, 0xfae59361, 0xceb69ceb, 0xc2a86459, 0x12baa8d1, 0xb6c1075e, 0xe3056a0c, 0x10d25065, 0xcb03a442, 0xe0ec6e0e, 0x1698db3b, 0x4c98a0be, 0x3278e964, 0x9f1f9532, 0xe0d392df, 0xd3a0342b, 0x8971f21e, 0x1b0a7441, 0x4ba3348c, 0xc5be7120, 0xc37632d8, 0xdf359f8d, 0x9b992f2e, 0xe60b6f47, 0x0fe3f11d, 0xe54cda54, 0x1edad891, 0xce6279cf, 0xcd3e7e6f, 0x1618b166, 0xfd2c1d05, 0x848fd2c5, 0xf6fb2299, 0xf523f357, 0xa6327623, 0x93a83531, 0x56cccd02, 0xacf08162, 0x5a75ebb5, 0x6e163697, 0x88d273cc, 0xde966292, 0x81b949d0, 0x4c50901b, 0x71c65614, 0xe6c6c7bd, 0x327a140a, 0x45e1d006, 0xc3f27b9a, 0xc9aa53fd, 0x62a80f00, 0xbb25bfe2, 0x35bdd2f6, 0x71126905, 0xb2040222, 0xb6cbcf7c, 0xcd769c2b, 0x53113ec0, 0x1640e3d3, 0x38abbd60, 0x2547adf0, 0xba38209c, 0xf746ce76, 0x77afa1c5, 0x20756060, 0x85cbfe4e, 0x8ae88dd8, 0x7aaaf9b0, 0x4cf9aa7e, 0x1948c25c, 0x02fb8a8c, 0x01c36ae4, 0xd6ebe1f9, 0x90d4f869, 0xa65cdea0, 0x3f09252d, 0xc208e69f, 0xb74e6132, 0xce77e25b, 0x578fdfe3, 0x3ac372e6]) ]; this.P = new Uint32Array([ 0x243f6a88, 0x85a308d3, 0x13198a2e, 0x03707344, 0xa4093822, 0x299f31d0, 0x082efa98, 0xec4e6c89, 0x452821e6, 0x38d01377, 0xbe5466cf, 0x34e90c6c, 0xc0ac29b7, 0xc97c50dd, 0x3f84d5b5, 0xb5470917, 0x9216d5d9, 0x8979fb1b]); }; function F(S, x8, i) { return (((S[0][x8[i+3]] + S[1][x8[i+2]]) ^ S[2][x8[i+1]]) + S[3][x8[i]]); }; Blowfish.prototype.encipher = function(x, x8) { if (x8 === undefined) { x8 = new Uint8Array(x.buffer); if (x.byteOffset !== 0) x8 = x8.subarray(x.byteOffset); } x[0] ^= this.P[0]; for (var i = 1; i < 16; i += 2) { x[1] ^= F(this.S, x8, 0) ^ this.P[i]; x[0] ^= F(this.S, x8, 4) ^ this.P[i+1]; } var t = x[0]; x[0] = x[1] ^ this.P[17]; x[1] = t; }; Blowfish.prototype.decipher = function(x) { var x8 = new Uint8Array(x.buffer); if (x.byteOffset !== 0) x8 = x8.subarray(x.byteOffset); x[0] ^= this.P[17]; for (var i = 16; i > 0; i -= 2) { x[1] ^= F(this.S, x8, 0) ^ this.P[i]; x[0] ^= F(this.S, x8, 4) ^ this.P[i-1]; } var t = x[0]; x[0] = x[1] ^ this.P[0]; x[1] = t; }; function stream2word(data, databytes){ var i, temp = 0; for (i = 0; i < 4; i++, BLF_J++) { if (BLF_J >= databytes) BLF_J = 0; temp = (temp << 8) | data[BLF_J]; } return temp; }; Blowfish.prototype.expand0state = function(key, keybytes) { var d = new Uint32Array(2), i, k; var d8 = new Uint8Array(d.buffer); for (i = 0, BLF_J = 0; i < 18; i++) { this.P[i] ^= stream2word(key, keybytes); } BLF_J = 0; for (i = 0; i < 18; i += 2) { this.encipher(d, d8); this.P[i] = d[0]; this.P[i+1] = d[1]; } for (i = 0; i < 4; i++) { for (k = 0; k < 256; k += 2) { this.encipher(d, d8); this.S[i][k] = d[0]; this.S[i][k+1] = d[1]; } } }; Blowfish.prototype.expandstate = function(data, databytes, key, keybytes) { var d = new Uint32Array(2), i, k; for (i = 0, BLF_J = 0; i < 18; i++) { this.P[i] ^= stream2word(key, keybytes); } for (i = 0, BLF_J = 0; i < 18; i += 2) { d[0] ^= stream2word(data, databytes); d[1] ^= stream2word(data, databytes); this.encipher(d); this.P[i] = d[0]; this.P[i+1] = d[1]; } for (i = 0; i < 4; i++) { for (k = 0; k < 256; k += 2) { d[0] ^= stream2word(data, databytes); d[1] ^= stream2word(data, databytes); this.encipher(d); this.S[i][k] = d[0]; this.S[i][k+1] = d[1]; } } BLF_J = 0; }; Blowfish.prototype.enc = function(data, blocks) { for (var i = 0; i < blocks; i++) { this.encipher(data.subarray(i*2)); } }; Blowfish.prototype.dec = function(data, blocks) { for (var i = 0; i < blocks; i++) { this.decipher(data.subarray(i*2)); } }; var BCRYPT_BLOCKS = 8, BCRYPT_HASHSIZE = 32; function bcrypt_hash(sha2pass, sha2salt, out) { var state = new Blowfish(), cdata = new Uint32Array(BCRYPT_BLOCKS), i, ciphertext = new Uint8Array([79,120,121,99,104,114,111,109,97,116,105, 99,66,108,111,119,102,105,115,104,83,119,97,116,68,121,110,97,109, 105,116,101]); //"OxychromaticBlowfishSwatDynamite" state.expandstate(sha2salt, 64, sha2pass, 64); for (i = 0; i < 64; i++) { state.expand0state(sha2salt, 64); state.expand0state(sha2pass, 64); } for (i = 0; i < BCRYPT_BLOCKS; i++) cdata[i] = stream2word(ciphertext, ciphertext.byteLength); for (i = 0; i < 64; i++) state.enc(cdata, cdata.byteLength / 8); for (i = 0; i < BCRYPT_BLOCKS; i++) { out[4*i+3] = cdata[i] >>> 24; out[4*i+2] = cdata[i] >>> 16; out[4*i+1] = cdata[i] >>> 8; out[4*i+0] = cdata[i]; } }; function bcrypt_pbkdf(pass, passlen, salt, saltlen, key, keylen, rounds) { var sha2pass = new Uint8Array(64), sha2salt = new Uint8Array(64), out = new Uint8Array(BCRYPT_HASHSIZE), tmpout = new Uint8Array(BCRYPT_HASHSIZE), countsalt = new Uint8Array(saltlen+4), i, j, amt, stride, dest, count, origkeylen = keylen; if (rounds < 1) return -1; if (passlen === 0 || saltlen === 0 || keylen === 0 || keylen > (out.byteLength * out.byteLength) || saltlen > (1<<20)) return -1; stride = Math.floor((keylen + out.byteLength - 1) / out.byteLength); amt = Math.floor((keylen + stride - 1) / stride); for (i = 0; i < saltlen; i++) countsalt[i] = salt[i]; crypto_hash_sha512(sha2pass, pass, passlen); for (count = 1; keylen > 0; count++) { countsalt[saltlen+0] = count >>> 24; countsalt[saltlen+1] = count >>> 16; countsalt[saltlen+2] = count >>> 8; countsalt[saltlen+3] = count; crypto_hash_sha512(sha2salt, countsalt, saltlen + 4); bcrypt_hash(sha2pass, sha2salt, tmpout); for (i = out.byteLength; i--;) out[i] = tmpout[i]; for (i = 1; i < rounds; i++) { crypto_hash_sha512(sha2salt, tmpout, tmpout.byteLength); bcrypt_hash(sha2pass, sha2salt, tmpout); for (j = 0; j < out.byteLength; j++) out[j] ^= tmpout[j]; } amt = Math.min(amt, keylen); for (i = 0; i < amt; i++) { dest = i * stride + (count - 1); if (dest >= origkeylen) break; key[dest] = out[i]; } keylen -= i; } return 0; }; module.exports = { BLOCKS: BCRYPT_BLOCKS, HASHSIZE: BCRYPT_HASHSIZE, hash: bcrypt_hash, pbkdf: bcrypt_pbkdf }; /***/ }), /***/ 643: /***/ (function(module) { "use strict"; module.exports = function generate_items(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $data = 'data' + ($dataLvl || ''); var $valid = 'valid' + $lvl; var $errs = 'errs__' + $lvl; var $it = it.util.copy(it); var $closingBraces = ''; $it.level++; var $nextValid = 'valid' + $it.level; var $idx = 'i' + $lvl, $dataNxt = $it.dataLevel = it.dataLevel + 1, $nextData = 'data' + $dataNxt, $currentBaseId = it.baseId; out += 'var ' + ($errs) + ' = errors;var ' + ($valid) + ';'; if (Array.isArray($schema)) { var $additionalItems = it.schema.additionalItems; if ($additionalItems === false) { out += ' ' + ($valid) + ' = ' + ($data) + '.length <= ' + ($schema.length) + '; '; var $currErrSchemaPath = $errSchemaPath; $errSchemaPath = it.errSchemaPath + '/additionalItems'; out += ' if (!' + ($valid) + ') { '; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('additionalItems') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schema.length) + ' } '; if (it.opts.messages !== false) { out += ' , message: \'should NOT have more than ' + ($schema.length) + ' items\' '; } if (it.opts.verbose) { out += ' , schema: false , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } out += ' } '; $errSchemaPath = $currErrSchemaPath; if ($breakOnError) { $closingBraces += '}'; out += ' else { '; } } var arr1 = $schema; if (arr1) { var $sch, $i = -1, l1 = arr1.length - 1; while ($i < l1) { $sch = arr1[$i += 1]; if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { out += ' ' + ($nextValid) + ' = true; if (' + ($data) + '.length > ' + ($i) + ') { '; var $passData = $data + '[' + $i + ']'; $it.schema = $sch; $it.schemaPath = $schemaPath + '[' + $i + ']'; $it.errSchemaPath = $errSchemaPath + '/' + $i; $it.errorPath = it.util.getPathExpr(it.errorPath, $i, it.opts.jsonPointers, true); $it.dataPathArr[$dataNxt] = $i; var $code = it.validate($it); $it.baseId = $currentBaseId; if (it.util.varOccurences($code, $nextData) < 2) { out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; } else { out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; } out += ' } '; if ($breakOnError) { out += ' if (' + ($nextValid) + ') { '; $closingBraces += '}'; } } } } if (typeof $additionalItems == 'object' && (it.opts.strictKeywords ? typeof $additionalItems == 'object' && Object.keys($additionalItems).length > 0 : it.util.schemaHasRules($additionalItems, it.RULES.all))) { $it.schema = $additionalItems; $it.schemaPath = it.schemaPath + '.additionalItems'; $it.errSchemaPath = it.errSchemaPath + '/additionalItems'; out += ' ' + ($nextValid) + ' = true; if (' + ($data) + '.length > ' + ($schema.length) + ') { for (var ' + ($idx) + ' = ' + ($schema.length) + '; ' + ($idx) + ' < ' + ($data) + '.length; ' + ($idx) + '++) { '; $it.errorPath = it.util.getPathExpr(it.errorPath, $idx, it.opts.jsonPointers, true); var $passData = $data + '[' + $idx + ']'; $it.dataPathArr[$dataNxt] = $idx; var $code = it.validate($it); $it.baseId = $currentBaseId; if (it.util.varOccurences($code, $nextData) < 2) { out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; } else { out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; } if ($breakOnError) { out += ' if (!' + ($nextValid) + ') break; '; } out += ' } } '; if ($breakOnError) { out += ' if (' + ($nextValid) + ') { '; $closingBraces += '}'; } } } else if ((it.opts.strictKeywords ? typeof $schema == 'object' && Object.keys($schema).length > 0 : it.util.schemaHasRules($schema, it.RULES.all))) { $it.schema = $schema; $it.schemaPath = $schemaPath; $it.errSchemaPath = $errSchemaPath; out += ' for (var ' + ($idx) + ' = ' + (0) + '; ' + ($idx) + ' < ' + ($data) + '.length; ' + ($idx) + '++) { '; $it.errorPath = it.util.getPathExpr(it.errorPath, $idx, it.opts.jsonPointers, true); var $passData = $data + '[' + $idx + ']'; $it.dataPathArr[$dataNxt] = $idx; var $code = it.validate($it); $it.baseId = $currentBaseId; if (it.util.varOccurences($code, $nextData) < 2) { out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; } else { out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; } if ($breakOnError) { out += ' if (!' + ($nextValid) + ') break; '; } out += ' }'; } if ($breakOnError) { out += ' ' + ($closingBraces) + ' if (' + ($errs) + ' == errors) {'; } out = it.util.cleanUpCode(out); return out; } /***/ }), /***/ 650: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2015 Joyent, Inc. var Key = __webpack_require__(852); var Fingerprint = __webpack_require__(400); var Signature = __webpack_require__(575); var PrivateKey = __webpack_require__(502); var Certificate = __webpack_require__(752); var Identity = __webpack_require__(378); var errs = __webpack_require__(753); module.exports = { /* top-level classes */ Key: Key, parseKey: Key.parse, Fingerprint: Fingerprint, parseFingerprint: Fingerprint.parse, Signature: Signature, parseSignature: Signature.parse, PrivateKey: PrivateKey, parsePrivateKey: PrivateKey.parse, generatePrivateKey: PrivateKey.generate, Certificate: Certificate, parseCertificate: Certificate.parse, createSelfSignedCertificate: Certificate.createSelfSigned, createCertificate: Certificate.create, Identity: Identity, identityFromDN: Identity.parseDN, identityForHost: Identity.forHost, identityForUser: Identity.forUser, identityForEmail: Identity.forEmail, identityFromArray: Identity.fromArray, /* errors */ FingerprintFormatError: errs.FingerprintFormatError, InvalidAlgorithmError: errs.InvalidAlgorithmError, KeyParseError: errs.KeyParseError, SignatureParseError: errs.SignatureParseError, KeyEncryptedError: errs.KeyEncryptedError, CertificateParseError: errs.CertificateParseError }; /***/ }), /***/ 653: /***/ (function(module) { "use strict"; module.exports = function generate_oneOf(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $data = 'data' + ($dataLvl || ''); var $valid = 'valid' + $lvl; var $errs = 'errs__' + $lvl; var $it = it.util.copy(it); var $closingBraces = ''; $it.level++; var $nextValid = 'valid' + $it.level; var $currentBaseId = $it.baseId, $prevValid = 'prevValid' + $lvl, $passingSchemas = 'passingSchemas' + $lvl; out += 'var ' + ($errs) + ' = errors , ' + ($prevValid) + ' = false , ' + ($valid) + ' = false , ' + ($passingSchemas) + ' = null; '; var $wasComposite = it.compositeRule; it.compositeRule = $it.compositeRule = true; var arr1 = $schema; if (arr1) { var $sch, $i = -1, l1 = arr1.length - 1; while ($i < l1) { $sch = arr1[$i += 1]; if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { $it.schema = $sch; $it.schemaPath = $schemaPath + '[' + $i + ']'; $it.errSchemaPath = $errSchemaPath + '/' + $i; out += ' ' + (it.validate($it)) + ' '; $it.baseId = $currentBaseId; } else { out += ' var ' + ($nextValid) + ' = true; '; } if ($i) { out += ' if (' + ($nextValid) + ' && ' + ($prevValid) + ') { ' + ($valid) + ' = false; ' + ($passingSchemas) + ' = [' + ($passingSchemas) + ', ' + ($i) + ']; } else { '; $closingBraces += '}'; } out += ' if (' + ($nextValid) + ') { ' + ($valid) + ' = ' + ($prevValid) + ' = true; ' + ($passingSchemas) + ' = ' + ($i) + '; }'; } } it.compositeRule = $it.compositeRule = $wasComposite; out += '' + ($closingBraces) + 'if (!' + ($valid) + ') { var err = '; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('oneOf') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { passingSchemas: ' + ($passingSchemas) + ' } '; if (it.opts.messages !== false) { out += ' , message: \'should match exactly one schema in oneOf\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError(vErrors); '; } else { out += ' validate.errors = vErrors; return false; '; } } out += '} else { errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; }'; if (it.opts.allErrors) { out += ' } '; } return out; } /***/ }), /***/ 658: /***/ (function(__unusedmodule, exports, __webpack_require__) { var aws4 = exports, url = __webpack_require__(835), querystring = __webpack_require__(191), crypto = __webpack_require__(417), lru = __webpack_require__(985), credentialsCache = lru(1000) // http://docs.amazonwebservices.com/general/latest/gr/signature-version-4.html function hmac(key, string, encoding) { return crypto.createHmac('sha256', key).update(string, 'utf8').digest(encoding) } function hash(string, encoding) { return crypto.createHash('sha256').update(string, 'utf8').digest(encoding) } // This function assumes the string has already been percent encoded function encodeRfc3986(urlEncodedString) { return urlEncodedString.replace(/[!'()*]/g, function(c) { return '%' + c.charCodeAt(0).toString(16).toUpperCase() }) } function encodeRfc3986Full(str) { return encodeRfc3986(encodeURIComponent(str)) } // request: { path | body, [host], [method], [headers], [service], [region] } // credentials: { accessKeyId, secretAccessKey, [sessionToken] } function RequestSigner(request, credentials) { if (typeof request === 'string') request = url.parse(request) var headers = request.headers = (request.headers || {}), hostParts = this.matchHost(request.hostname || request.host || headers.Host || headers.host) this.request = request this.credentials = credentials || this.defaultCredentials() this.service = request.service || hostParts[0] || '' this.region = request.region || hostParts[1] || 'us-east-1' // SES uses a different domain from the service name if (this.service === 'email') this.service = 'ses' if (!request.method && request.body) request.method = 'POST' if (!headers.Host && !headers.host) { headers.Host = request.hostname || request.host || this.createHost() // If a port is specified explicitly, use it as is if (request.port) headers.Host += ':' + request.port } if (!request.hostname && !request.host) request.hostname = headers.Host || headers.host this.isCodeCommitGit = this.service === 'codecommit' && request.method === 'GIT' } RequestSigner.prototype.matchHost = function(host) { var match = (host || '').match(/([^\.]+)\.(?:([^\.]*)\.)?amazonaws\.com(\.cn)?$/) var hostParts = (match || []).slice(1, 3) // ES's hostParts are sometimes the other way round, if the value that is expected // to be region equals ‘es’ switch them back // e.g. search-cluster-name-aaaa00aaaa0aaa0aaaaaaa0aaa.us-east-1.es.amazonaws.com if (hostParts[1] === 'es') hostParts = hostParts.reverse() return hostParts } // http://docs.aws.amazon.com/general/latest/gr/rande.html RequestSigner.prototype.isSingleRegion = function() { // Special case for S3 and SimpleDB in us-east-1 if (['s3', 'sdb'].indexOf(this.service) >= 0 && this.region === 'us-east-1') return true return ['cloudfront', 'ls', 'route53', 'iam', 'importexport', 'sts'] .indexOf(this.service) >= 0 } RequestSigner.prototype.createHost = function() { var region = this.isSingleRegion() ? '' : (this.service === 's3' && this.region !== 'us-east-1' ? '-' : '.') + this.region, service = this.service === 'ses' ? 'email' : this.service return service + region + '.amazonaws.com' } RequestSigner.prototype.prepareRequest = function() { this.parsePath() var request = this.request, headers = request.headers, query if (request.signQuery) { this.parsedPath.query = query = this.parsedPath.query || {} if (this.credentials.sessionToken) query['X-Amz-Security-Token'] = this.credentials.sessionToken if (this.service === 's3' && !query['X-Amz-Expires']) query['X-Amz-Expires'] = 86400 if (query['X-Amz-Date']) this.datetime = query['X-Amz-Date'] else query['X-Amz-Date'] = this.getDateTime() query['X-Amz-Algorithm'] = 'AWS4-HMAC-SHA256' query['X-Amz-Credential'] = this.credentials.accessKeyId + '/' + this.credentialString() query['X-Amz-SignedHeaders'] = this.signedHeaders() } else { if (!request.doNotModifyHeaders && !this.isCodeCommitGit) { if (request.body && !headers['Content-Type'] && !headers['content-type']) headers['Content-Type'] = 'application/x-www-form-urlencoded; charset=utf-8' if (request.body && !headers['Content-Length'] && !headers['content-length']) headers['Content-Length'] = Buffer.byteLength(request.body) if (this.credentials.sessionToken && !headers['X-Amz-Security-Token'] && !headers['x-amz-security-token']) headers['X-Amz-Security-Token'] = this.credentials.sessionToken if (this.service === 's3' && !headers['X-Amz-Content-Sha256'] && !headers['x-amz-content-sha256']) headers['X-Amz-Content-Sha256'] = hash(this.request.body || '', 'hex') if (headers['X-Amz-Date'] || headers['x-amz-date']) this.datetime = headers['X-Amz-Date'] || headers['x-amz-date'] else headers['X-Amz-Date'] = this.getDateTime() } delete headers.Authorization delete headers.authorization } } RequestSigner.prototype.sign = function() { if (!this.parsedPath) this.prepareRequest() if (this.request.signQuery) { this.parsedPath.query['X-Amz-Signature'] = this.signature() } else { this.request.headers.Authorization = this.authHeader() } this.request.path = this.formatPath() return this.request } RequestSigner.prototype.getDateTime = function() { if (!this.datetime) { var headers = this.request.headers, date = new Date(headers.Date || headers.date || new Date) this.datetime = date.toISOString().replace(/[:\-]|\.\d{3}/g, '') // Remove the trailing 'Z' on the timestamp string for CodeCommit git access if (this.isCodeCommitGit) this.datetime = this.datetime.slice(0, -1) } return this.datetime } RequestSigner.prototype.getDate = function() { return this.getDateTime().substr(0, 8) } RequestSigner.prototype.authHeader = function() { return [ 'AWS4-HMAC-SHA256 Credential=' + this.credentials.accessKeyId + '/' + this.credentialString(), 'SignedHeaders=' + this.signedHeaders(), 'Signature=' + this.signature(), ].join(', ') } RequestSigner.prototype.signature = function() { var date = this.getDate(), cacheKey = [this.credentials.secretAccessKey, date, this.region, this.service].join(), kDate, kRegion, kService, kCredentials = credentialsCache.get(cacheKey) if (!kCredentials) { kDate = hmac('AWS4' + this.credentials.secretAccessKey, date) kRegion = hmac(kDate, this.region) kService = hmac(kRegion, this.service) kCredentials = hmac(kService, 'aws4_request') credentialsCache.set(cacheKey, kCredentials) } return hmac(kCredentials, this.stringToSign(), 'hex') } RequestSigner.prototype.stringToSign = function() { return [ 'AWS4-HMAC-SHA256', this.getDateTime(), this.credentialString(), hash(this.canonicalString(), 'hex'), ].join('\n') } RequestSigner.prototype.canonicalString = function() { if (!this.parsedPath) this.prepareRequest() var pathStr = this.parsedPath.path, query = this.parsedPath.query, headers = this.request.headers, queryStr = '', normalizePath = this.service !== 's3', decodePath = this.service === 's3' || this.request.doNotEncodePath, decodeSlashesInPath = this.service === 's3', firstValOnly = this.service === 's3', bodyHash if (this.service === 's3' && this.request.signQuery) { bodyHash = 'UNSIGNED-PAYLOAD' } else if (this.isCodeCommitGit) { bodyHash = '' } else { bodyHash = headers['X-Amz-Content-Sha256'] || headers['x-amz-content-sha256'] || hash(this.request.body || '', 'hex') } if (query) { var reducedQuery = Object.keys(query).reduce(function(obj, key) { if (!key) return obj obj[encodeRfc3986Full(key)] = !Array.isArray(query[key]) ? query[key] : (firstValOnly ? query[key][0] : query[key]) return obj }, {}) var encodedQueryPieces = [] Object.keys(reducedQuery).sort().forEach(function(key) { if (!Array.isArray(reducedQuery[key])) { encodedQueryPieces.push(key + '=' + encodeRfc3986Full(reducedQuery[key])) } else { reducedQuery[key].map(encodeRfc3986Full).sort() .forEach(function(val) { encodedQueryPieces.push(key + '=' + val) }) } }) queryStr = encodedQueryPieces.join('&') } if (pathStr !== '/') { if (normalizePath) pathStr = pathStr.replace(/\/{2,}/g, '/') pathStr = pathStr.split('/').reduce(function(path, piece) { if (normalizePath && piece === '..') { path.pop() } else if (!normalizePath || piece !== '.') { if (decodePath) piece = decodeURIComponent(piece).replace(/\+/g, ' ') path.push(encodeRfc3986Full(piece)) } return path }, []).join('/') if (pathStr[0] !== '/') pathStr = '/' + pathStr if (decodeSlashesInPath) pathStr = pathStr.replace(/%2F/g, '/') } return [ this.request.method || 'GET', pathStr, queryStr, this.canonicalHeaders() + '\n', this.signedHeaders(), bodyHash, ].join('\n') } RequestSigner.prototype.canonicalHeaders = function() { var headers = this.request.headers function trimAll(header) { return header.toString().trim().replace(/\s+/g, ' ') } return Object.keys(headers) .sort(function(a, b) { return a.toLowerCase() < b.toLowerCase() ? -1 : 1 }) .map(function(key) { return key.toLowerCase() + ':' + trimAll(headers[key]) }) .join('\n') } RequestSigner.prototype.signedHeaders = function() { return Object.keys(this.request.headers) .map(function(key) { return key.toLowerCase() }) .sort() .join(';') } RequestSigner.prototype.credentialString = function() { return [ this.getDate(), this.region, this.service, 'aws4_request', ].join('/') } RequestSigner.prototype.defaultCredentials = function() { var env = process.env return { accessKeyId: env.AWS_ACCESS_KEY_ID || env.AWS_ACCESS_KEY, secretAccessKey: env.AWS_SECRET_ACCESS_KEY || env.AWS_SECRET_KEY, sessionToken: env.AWS_SESSION_TOKEN, } } RequestSigner.prototype.parsePath = function() { var path = this.request.path || '/' // S3 doesn't always encode characters > 127 correctly and // all services don't encode characters > 255 correctly // So if there are non-reserved chars (and it's not already all % encoded), just encode them all if (/[^0-9A-Za-z;,/?:@&=+$\-_.!~*'()#%]/.test(path)) { path = encodeURI(decodeURI(path)) } var queryIx = path.indexOf('?'), query = null if (queryIx >= 0) { query = querystring.parse(path.slice(queryIx + 1)) path = path.slice(0, queryIx) } this.parsedPath = { path: path, query: query, } } RequestSigner.prototype.formatPath = function() { var path = this.parsedPath.path, query = this.parsedPath.query if (!query) return path // Services don't support empty query string keys if (query[''] != null) delete query[''] return path + '?' + encodeRfc3986(querystring.stringify(query)) } aws4.RequestSigner = RequestSigner aws4.sign = function(request, credentials) { return new RequestSigner(request, credentials).sign() } /***/ }), /***/ 662: /***/ (function(module) { "use strict"; module.exports = function generate_const(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $data = 'data' + ($dataLvl || ''); var $valid = 'valid' + $lvl; var $isData = it.opts.$data && $schema && $schema.$data, $schemaValue; if ($isData) { out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; $schemaValue = 'schema' + $lvl; } else { $schemaValue = $schema; } if (!$isData) { out += ' var schema' + ($lvl) + ' = validate.schema' + ($schemaPath) + ';'; } out += 'var ' + ($valid) + ' = equal(' + ($data) + ', schema' + ($lvl) + '); if (!' + ($valid) + ') { '; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('const') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { allowedValue: schema' + ($lvl) + ' } '; if (it.opts.messages !== false) { out += ' , message: \'should be equal to constant\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } out += ' }'; if ($breakOnError) { out += ' else { '; } return out; } /***/ }), /***/ 669: /***/ (function(module) { module.exports = require("util"); /***/ }), /***/ 671: /***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; module.exports = { afterRequest: __webpack_require__(140), beforeRequest: __webpack_require__(820), browser: __webpack_require__(222), cache: __webpack_require__(993), content: __webpack_require__(162), cookie: __webpack_require__(326), creator: __webpack_require__(776), entry: __webpack_require__(919), har: __webpack_require__(41), header: __webpack_require__(883), log: __webpack_require__(319), page: __webpack_require__(744), pageTimings: __webpack_require__(181), postData: __webpack_require__(740), query: __webpack_require__(813), request: __webpack_require__(380), response: __webpack_require__(226), timings: __webpack_require__(758) } /***/ }), /***/ 672: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } return new (P || (P = Promise))(function (resolve, reject) { function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } step((generator = generator.apply(thisArg, _arguments || [])).next()); }); }; var _a; Object.defineProperty(exports, "__esModule", { value: true }); const assert_1 = __webpack_require__(357); const fs = __webpack_require__(747); const path = __webpack_require__(622); _a = fs.promises, exports.chmod = _a.chmod, exports.copyFile = _a.copyFile, exports.lstat = _a.lstat, exports.mkdir = _a.mkdir, exports.readdir = _a.readdir, exports.readlink = _a.readlink, exports.rename = _a.rename, exports.rmdir = _a.rmdir, exports.stat = _a.stat, exports.symlink = _a.symlink, exports.unlink = _a.unlink; exports.IS_WINDOWS = process.platform === 'win32'; function exists(fsPath) { return __awaiter(this, void 0, void 0, function* () { try { yield exports.stat(fsPath); } catch (err) { if (err.code === 'ENOENT') { return false; } throw err; } return true; }); } exports.exists = exists; function isDirectory(fsPath, useStat = false) { return __awaiter(this, void 0, void 0, function* () { const stats = useStat ? yield exports.stat(fsPath) : yield exports.lstat(fsPath); return stats.isDirectory(); }); } exports.isDirectory = isDirectory; /** * On OSX/Linux, true if path starts with '/'. On Windows, true for paths like: * \, \hello, \\hello\share, C:, and C:\hello (and corresponding alternate separator cases). */ function isRooted(p) { p = normalizeSeparators(p); if (!p) { throw new Error('isRooted() parameter "p" cannot be empty'); } if (exports.IS_WINDOWS) { return (p.startsWith('\\') || /^[A-Z]:/i.test(p) // e.g. \ or \hello or \\hello ); // e.g. C: or C:\hello } return p.startsWith('/'); } exports.isRooted = isRooted; /** * Recursively create a directory at `fsPath`. * * This implementation is optimistic, meaning it attempts to create the full * path first, and backs up the path stack from there. * * @param fsPath The path to create * @param maxDepth The maximum recursion depth * @param depth The current recursion depth */ function mkdirP(fsPath, maxDepth = 1000, depth = 1) { return __awaiter(this, void 0, void 0, function* () { assert_1.ok(fsPath, 'a path argument must be provided'); fsPath = path.resolve(fsPath); if (depth >= maxDepth) return exports.mkdir(fsPath); try { yield exports.mkdir(fsPath); return; } catch (err) { switch (err.code) { case 'ENOENT': { yield mkdirP(path.dirname(fsPath), maxDepth, depth + 1); yield exports.mkdir(fsPath); return; } default: { let stats; try { stats = yield exports.stat(fsPath); } catch (err2) { throw err; } if (!stats.isDirectory()) throw err; } } } }); } exports.mkdirP = mkdirP; /** * Best effort attempt to determine whether a file exists and is executable. * @param filePath file path to check * @param extensions additional file extensions to try * @return if file exists and is executable, returns the file path. otherwise empty string. */ function tryGetExecutablePath(filePath, extensions) { return __awaiter(this, void 0, void 0, function* () { let stats = undefined; try { // test file exists stats = yield exports.stat(filePath); } catch (err) { if (err.code !== 'ENOENT') { // eslint-disable-next-line no-console console.log(`Unexpected error attempting to determine if executable file exists '${filePath}': ${err}`); } } if (stats && stats.isFile()) { if (exports.IS_WINDOWS) { // on Windows, test for valid extension const upperExt = path.extname(filePath).toUpperCase(); if (extensions.some(validExt => validExt.toUpperCase() === upperExt)) { return filePath; } } else { if (isUnixExecutable(stats)) { return filePath; } } } // try each extension const originalFilePath = filePath; for (const extension of extensions) { filePath = originalFilePath + extension; stats = undefined; try { stats = yield exports.stat(filePath); } catch (err) { if (err.code !== 'ENOENT') { // eslint-disable-next-line no-console console.log(`Unexpected error attempting to determine if executable file exists '${filePath}': ${err}`); } } if (stats && stats.isFile()) { if (exports.IS_WINDOWS) { // preserve the case of the actual file (since an extension was appended) try { const directory = path.dirname(filePath); const upperName = path.basename(filePath).toUpperCase(); for (const actualName of yield exports.readdir(directory)) { if (upperName === actualName.toUpperCase()) { filePath = path.join(directory, actualName); break; } } } catch (err) { // eslint-disable-next-line no-console console.log(`Unexpected error attempting to determine the actual case of the file '${filePath}': ${err}`); } return filePath; } else { if (isUnixExecutable(stats)) { return filePath; } } } } return ''; }); } exports.tryGetExecutablePath = tryGetExecutablePath; function normalizeSeparators(p) { p = p || ''; if (exports.IS_WINDOWS) { // convert slashes on Windows p = p.replace(/\//g, '\\'); // remove redundant slashes return p.replace(/\\\\+/g, '\\'); } // remove redundant slashes return p.replace(/\/\/+/g, '/'); } // on Mac/Linux, test the execute bit // R W X R W X R W X // 256 128 64 32 16 8 4 2 1 function isUnixExecutable(stats) { return ((stats.mode & 1) > 0 || ((stats.mode & 8) > 0 && stats.gid === process.getgid()) || ((stats.mode & 64) > 0 && stats.uid === process.getuid())); } //# sourceMappingURL=io-util.js.map /***/ }), /***/ 673: /***/ (function(module) { "use strict"; module.exports = function generate_not(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $data = 'data' + ($dataLvl || ''); var $errs = 'errs__' + $lvl; var $it = it.util.copy(it); $it.level++; var $nextValid = 'valid' + $it.level; if ((it.opts.strictKeywords ? typeof $schema == 'object' && Object.keys($schema).length > 0 : it.util.schemaHasRules($schema, it.RULES.all))) { $it.schema = $schema; $it.schemaPath = $schemaPath; $it.errSchemaPath = $errSchemaPath; out += ' var ' + ($errs) + ' = errors; '; var $wasComposite = it.compositeRule; it.compositeRule = $it.compositeRule = true; $it.createErrors = false; var $allErrorsOption; if ($it.opts.allErrors) { $allErrorsOption = $it.opts.allErrors; $it.opts.allErrors = false; } out += ' ' + (it.validate($it)) + ' '; $it.createErrors = true; if ($allErrorsOption) $it.opts.allErrors = $allErrorsOption; it.compositeRule = $it.compositeRule = $wasComposite; out += ' if (' + ($nextValid) + ') { '; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('not') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; if (it.opts.messages !== false) { out += ' , message: \'should NOT be valid\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } out += ' } else { errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } '; if (it.opts.allErrors) { out += ' } '; } } else { out += ' var err = '; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('not') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; if (it.opts.messages !== false) { out += ' , message: \'should NOT be valid\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; if ($breakOnError) { out += ' if (false) { '; } } return out; } /***/ }), /***/ 680: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2016 Joyent, Inc. var x509 = __webpack_require__(866); module.exports = { read: read, verify: x509.verify, sign: x509.sign, write: write }; var assert = __webpack_require__(477); var asn1 = __webpack_require__(62); var Buffer = __webpack_require__(215).Buffer; var algs = __webpack_require__(98); var utils = __webpack_require__(270); var Key = __webpack_require__(852); var PrivateKey = __webpack_require__(502); var pem = __webpack_require__(268); var Identity = __webpack_require__(378); var Signature = __webpack_require__(575); var Certificate = __webpack_require__(752); function read(buf, options) { if (typeof (buf) !== 'string') { assert.buffer(buf, 'buf'); buf = buf.toString('ascii'); } var lines = buf.trim().split(/[\r\n]+/g); var m; var si = -1; while (!m && si < lines.length) { m = lines[++si].match(/*JSSTYLED*/ /[-]+[ ]*BEGIN CERTIFICATE[ ]*[-]+/); } assert.ok(m, 'invalid PEM header'); var m2; var ei = lines.length; while (!m2 && ei > 0) { m2 = lines[--ei].match(/*JSSTYLED*/ /[-]+[ ]*END CERTIFICATE[ ]*[-]+/); } assert.ok(m2, 'invalid PEM footer'); lines = lines.slice(si, ei + 1); var headers = {}; while (true) { lines = lines.slice(1); m = lines[0].match(/*JSSTYLED*/ /^([A-Za-z0-9-]+): (.+)$/); if (!m) break; headers[m[1].toLowerCase()] = m[2]; } /* Chop off the first and last lines */ lines = lines.slice(0, -1).join(''); buf = Buffer.from(lines, 'base64'); return (x509.read(buf, options)); } function write(cert, options) { var dbuf = x509.write(cert, options); var header = 'CERTIFICATE'; var tmp = dbuf.toString('base64'); var len = tmp.length + (tmp.length / 64) + 18 + 16 + header.length*2 + 10; var buf = Buffer.alloc(len); var o = 0; o += buf.write('-----BEGIN ' + header + '-----\n', o); for (var i = 0; i < tmp.length; ) { var limit = i + 64; if (limit > tmp.length) limit = tmp.length; o += buf.write(tmp.slice(i, limit), o); buf[o++] = 10; i = limit; } o += buf.write('-----END ' + header + '-----\n', o); return (buf.slice(0, o)); } /***/ }), /***/ 687: /***/ (function(module) { "use strict"; module.exports = function generate_format(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $data = 'data' + ($dataLvl || ''); if (it.opts.format === false) { if ($breakOnError) { out += ' if (true) { '; } return out; } var $isData = it.opts.$data && $schema && $schema.$data, $schemaValue; if ($isData) { out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; $schemaValue = 'schema' + $lvl; } else { $schemaValue = $schema; } var $unknownFormats = it.opts.unknownFormats, $allowUnknown = Array.isArray($unknownFormats); if ($isData) { var $format = 'format' + $lvl, $isObject = 'isObject' + $lvl, $formatType = 'formatType' + $lvl; out += ' var ' + ($format) + ' = formats[' + ($schemaValue) + ']; var ' + ($isObject) + ' = typeof ' + ($format) + ' == \'object\' && !(' + ($format) + ' instanceof RegExp) && ' + ($format) + '.validate; var ' + ($formatType) + ' = ' + ($isObject) + ' && ' + ($format) + '.type || \'string\'; if (' + ($isObject) + ') { '; if (it.async) { out += ' var async' + ($lvl) + ' = ' + ($format) + '.async; '; } out += ' ' + ($format) + ' = ' + ($format) + '.validate; } if ( '; if ($isData) { out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'string\') || '; } out += ' ('; if ($unknownFormats != 'ignore') { out += ' (' + ($schemaValue) + ' && !' + ($format) + ' '; if ($allowUnknown) { out += ' && self._opts.unknownFormats.indexOf(' + ($schemaValue) + ') == -1 '; } out += ') || '; } out += ' (' + ($format) + ' && ' + ($formatType) + ' == \'' + ($ruleType) + '\' && !(typeof ' + ($format) + ' == \'function\' ? '; if (it.async) { out += ' (async' + ($lvl) + ' ? await ' + ($format) + '(' + ($data) + ') : ' + ($format) + '(' + ($data) + ')) '; } else { out += ' ' + ($format) + '(' + ($data) + ') '; } out += ' : ' + ($format) + '.test(' + ($data) + '))))) {'; } else { var $format = it.formats[$schema]; if (!$format) { if ($unknownFormats == 'ignore') { it.logger.warn('unknown format "' + $schema + '" ignored in schema at path "' + it.errSchemaPath + '"'); if ($breakOnError) { out += ' if (true) { '; } return out; } else if ($allowUnknown && $unknownFormats.indexOf($schema) >= 0) { if ($breakOnError) { out += ' if (true) { '; } return out; } else { throw new Error('unknown format "' + $schema + '" is used in schema at path "' + it.errSchemaPath + '"'); } } var $isObject = typeof $format == 'object' && !($format instanceof RegExp) && $format.validate; var $formatType = $isObject && $format.type || 'string'; if ($isObject) { var $async = $format.async === true; $format = $format.validate; } if ($formatType != $ruleType) { if ($breakOnError) { out += ' if (true) { '; } return out; } if ($async) { if (!it.async) throw new Error('async format in sync schema'); var $formatRef = 'formats' + it.util.getProperty($schema) + '.validate'; out += ' if (!(await ' + ($formatRef) + '(' + ($data) + '))) { '; } else { out += ' if (! '; var $formatRef = 'formats' + it.util.getProperty($schema); if ($isObject) $formatRef += '.validate'; if (typeof $format == 'function') { out += ' ' + ($formatRef) + '(' + ($data) + ') '; } else { out += ' ' + ($formatRef) + '.test(' + ($data) + ') '; } out += ') { '; } } var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('format') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { format: '; if ($isData) { out += '' + ($schemaValue); } else { out += '' + (it.util.toQuotedString($schema)); } out += ' } '; if (it.opts.messages !== false) { out += ' , message: \'should match format "'; if ($isData) { out += '\' + ' + ($schemaValue) + ' + \''; } else { out += '' + (it.util.escapeQuotes($schema)); } out += '"\' '; } if (it.opts.verbose) { out += ' , schema: '; if ($isData) { out += 'validate.schema' + ($schemaPath); } else { out += '' + (it.util.toQuotedString($schema)); } out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } out += ' } '; if ($breakOnError) { out += ' else { '; } return out; } /***/ }), /***/ 691: /***/ (function(module) { "use strict"; // https://mathiasbynens.be/notes/javascript-encoding // https://github.com/bestiejs/punycode.js - punycode.ucs2.decode module.exports = function ucs2length(str) { var length = 0 , len = str.length , pos = 0 , value; while (pos < len) { length++; value = str.charCodeAt(pos++); if (value >= 0xD800 && value <= 0xDBFF && pos < len) { // high surrogate, and there is a next character value = str.charCodeAt(pos); if ((value & 0xFC00) == 0xDC00) pos++; // low surrogate } } return length; }; /***/ }), /***/ 697: /***/ (function(__unusedmodule, exports, __webpack_require__) { /* * extsprintf.js: extended POSIX-style sprintf */ var mod_assert = __webpack_require__(357); var mod_util = __webpack_require__(669); /* * Public interface */ exports.sprintf = jsSprintf; exports.printf = jsPrintf; exports.fprintf = jsFprintf; /* * Stripped down version of s[n]printf(3c). We make a best effort to throw an * exception when given a format string we don't understand, rather than * ignoring it, so that we won't break existing programs if/when we go implement * the rest of this. * * This implementation currently supports specifying * - field alignment ('-' flag), * - zero-pad ('0' flag) * - always show numeric sign ('+' flag), * - field width * - conversions for strings, decimal integers, and floats (numbers). * - argument size specifiers. These are all accepted but ignored, since * Javascript has no notion of the physical size of an argument. * * Everything else is currently unsupported, most notably precision, unsigned * numbers, non-decimal numbers, and characters. */ function jsSprintf(fmt) { var regex = [ '([^%]*)', /* normal text */ '%', /* start of format */ '([\'\\-+ #0]*?)', /* flags (optional) */ '([1-9]\\d*)?', /* width (optional) */ '(\\.([1-9]\\d*))?', /* precision (optional) */ '[lhjztL]*?', /* length mods (ignored) */ '([diouxXfFeEgGaAcCsSp%jr])' /* conversion */ ].join(''); var re = new RegExp(regex); var args = Array.prototype.slice.call(arguments, 1); var flags, width, precision, conversion; var left, pad, sign, arg, match; var ret = ''; var argn = 1; mod_assert.equal('string', typeof (fmt)); while ((match = re.exec(fmt)) !== null) { ret += match[1]; fmt = fmt.substring(match[0].length); flags = match[2] || ''; width = match[3] || 0; precision = match[4] || ''; conversion = match[6]; left = false; sign = false; pad = ' '; if (conversion == '%') { ret += '%'; continue; } if (args.length === 0) throw (new Error('too few args to sprintf')); arg = args.shift(); argn++; if (flags.match(/[\' #]/)) throw (new Error( 'unsupported flags: ' + flags)); if (precision.length > 0) throw (new Error( 'non-zero precision not supported')); if (flags.match(/-/)) left = true; if (flags.match(/0/)) pad = '0'; if (flags.match(/\+/)) sign = true; switch (conversion) { case 's': if (arg === undefined || arg === null) throw (new Error('argument ' + argn + ': attempted to print undefined or null ' + 'as a string')); ret += doPad(pad, width, left, arg.toString()); break; case 'd': arg = Math.floor(arg); /*jsl:fallthru*/ case 'f': sign = sign && arg > 0 ? '+' : ''; ret += sign + doPad(pad, width, left, arg.toString()); break; case 'x': ret += doPad(pad, width, left, arg.toString(16)); break; case 'j': /* non-standard */ if (width === 0) width = 10; ret += mod_util.inspect(arg, false, width); break; case 'r': /* non-standard */ ret += dumpException(arg); break; default: throw (new Error('unsupported conversion: ' + conversion)); } } ret += fmt; return (ret); } function jsPrintf() { var args = Array.prototype.slice.call(arguments); args.unshift(process.stdout); jsFprintf.apply(null, args); } function jsFprintf(stream) { var args = Array.prototype.slice.call(arguments, 1); return (stream.write(jsSprintf.apply(this, args))); } function doPad(chr, width, left, str) { var ret = str; while (ret.length < width) { if (left) ret += chr; else ret = chr + ret; } return (ret); } /* * This function dumps long stack traces for exceptions having a cause() method. * See node-verror for an example. */ function dumpException(ex) { var ret; if (!(ex instanceof Error)) throw (new Error(jsSprintf('invalid type for %%r: %j', ex))); /* Note that V8 prepends "ex.stack" with ex.toString(). */ ret = 'EXCEPTION: ' + ex.constructor.name + ': ' + ex.stack; if (ex.cause && typeof (ex.cause) === 'function') { var cex = ex.cause(); if (cex) { ret += '\nCaused by: ' + dumpException(cex); } } return (ret); } /***/ }), /***/ 701: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; /*! * Copyright (c) 2015, Salesforce.com, Inc. * All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions are met: * * 1. Redistributions of source code must retain the above copyright notice, * this list of conditions and the following disclaimer. * * 2. Redistributions in binary form must reproduce the above copyright notice, * this list of conditions and the following disclaimer in the documentation * and/or other materials provided with the distribution. * * 3. Neither the name of Salesforce.com nor the names of its contributors may * be used to endorse or promote products derived from this software without * specific prior written permission. * * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE * POSSIBILITY OF SUCH DAMAGE. */ var net = __webpack_require__(631); var urlParse = __webpack_require__(835).parse; var util = __webpack_require__(669); var pubsuffix = __webpack_require__(519); var Store = __webpack_require__(627).Store; var MemoryCookieStore = __webpack_require__(349).MemoryCookieStore; var pathMatch = __webpack_require__(54).pathMatch; var VERSION = __webpack_require__(459); var punycode; try { punycode = __webpack_require__(213); } catch(e) { console.warn("tough-cookie: can't load punycode; won't use punycode for domain normalization"); } // From RFC6265 S4.1.1 // note that it excludes \x3B ";" var COOKIE_OCTETS = /^[\x21\x23-\x2B\x2D-\x3A\x3C-\x5B\x5D-\x7E]+$/; var CONTROL_CHARS = /[\x00-\x1F]/; // From Chromium // '\r', '\n' and '\0' should be treated as a terminator in // the "relaxed" mode, see: // https://github.com/ChromiumWebApps/chromium/blob/b3d3b4da8bb94c1b2e061600df106d590fda3620/net/cookies/parsed_cookie.cc#L60 var TERMINATORS = ['\n', '\r', '\0']; // RFC6265 S4.1.1 defines path value as 'any CHAR except CTLs or ";"' // Note ';' is \x3B var PATH_VALUE = /[\x20-\x3A\x3C-\x7E]+/; // date-time parsing constants (RFC6265 S5.1.1) var DATE_DELIM = /[\x09\x20-\x2F\x3B-\x40\x5B-\x60\x7B-\x7E]/; var MONTH_TO_NUM = { jan:0, feb:1, mar:2, apr:3, may:4, jun:5, jul:6, aug:7, sep:8, oct:9, nov:10, dec:11 }; var NUM_TO_MONTH = [ 'Jan','Feb','Mar','Apr','May','Jun','Jul','Aug','Sep','Oct','Nov','Dec' ]; var NUM_TO_DAY = [ 'Sun','Mon','Tue','Wed','Thu','Fri','Sat' ]; var MAX_TIME = 2147483647000; // 31-bit max var MIN_TIME = 0; // 31-bit min /* * Parses a Natural number (i.e., non-negative integer) with either the * *DIGIT ( non-digit *OCTET ) * or * *DIGIT * grammar (RFC6265 S5.1.1). * * The "trailingOK" boolean controls if the grammar accepts a * "( non-digit *OCTET )" trailer. */ function parseDigits(token, minDigits, maxDigits, trailingOK) { var count = 0; while (count < token.length) { var c = token.charCodeAt(count); // "non-digit = %x00-2F / %x3A-FF" if (c <= 0x2F || c >= 0x3A) { break; } count++; } // constrain to a minimum and maximum number of digits. if (count < minDigits || count > maxDigits) { return null; } if (!trailingOK && count != token.length) { return null; } return parseInt(token.substr(0,count), 10); } function parseTime(token) { var parts = token.split(':'); var result = [0,0,0]; /* RF6256 S5.1.1: * time = hms-time ( non-digit *OCTET ) * hms-time = time-field ":" time-field ":" time-field * time-field = 1*2DIGIT */ if (parts.length !== 3) { return null; } for (var i = 0; i < 3; i++) { // "time-field" must be strictly "1*2DIGIT", HOWEVER, "hms-time" can be // followed by "( non-digit *OCTET )" so therefore the last time-field can // have a trailer var trailingOK = (i == 2); var num = parseDigits(parts[i], 1, 2, trailingOK); if (num === null) { return null; } result[i] = num; } return result; } function parseMonth(token) { token = String(token).substr(0,3).toLowerCase(); var num = MONTH_TO_NUM[token]; return num >= 0 ? num : null; } /* * RFC6265 S5.1.1 date parser (see RFC for full grammar) */ function parseDate(str) { if (!str) { return; } /* RFC6265 S5.1.1: * 2. Process each date-token sequentially in the order the date-tokens * appear in the cookie-date */ var tokens = str.split(DATE_DELIM); if (!tokens) { return; } var hour = null; var minute = null; var second = null; var dayOfMonth = null; var month = null; var year = null; for (var i=0; i= 70 && year <= 99) { year += 1900; } else if (year >= 0 && year <= 69) { year += 2000; } } } } /* RFC 6265 S5.1.1 * "5. Abort these steps and fail to parse the cookie-date if: * * at least one of the found-day-of-month, found-month, found- * year, or found-time flags is not set, * * the day-of-month-value is less than 1 or greater than 31, * * the year-value is less than 1601, * * the hour-value is greater than 23, * * the minute-value is greater than 59, or * * the second-value is greater than 59. * (Note that leap seconds cannot be represented in this syntax.)" * * So, in order as above: */ if ( dayOfMonth === null || month === null || year === null || second === null || dayOfMonth < 1 || dayOfMonth > 31 || year < 1601 || hour > 23 || minute > 59 || second > 59 ) { return; } return new Date(Date.UTC(year, month, dayOfMonth, hour, minute, second)); } function formatDate(date) { var d = date.getUTCDate(); d = d >= 10 ? d : '0'+d; var h = date.getUTCHours(); h = h >= 10 ? h : '0'+h; var m = date.getUTCMinutes(); m = m >= 10 ? m : '0'+m; var s = date.getUTCSeconds(); s = s >= 10 ? s : '0'+s; return NUM_TO_DAY[date.getUTCDay()] + ', ' + d+' '+ NUM_TO_MONTH[date.getUTCMonth()] +' '+ date.getUTCFullYear() +' '+ h+':'+m+':'+s+' GMT'; } // S5.1.2 Canonicalized Host Names function canonicalDomain(str) { if (str == null) { return null; } str = str.trim().replace(/^\./,''); // S4.1.2.3 & S5.2.3: ignore leading . // convert to IDN if any non-ASCII characters if (punycode && /[^\u0001-\u007f]/.test(str)) { str = punycode.toASCII(str); } return str.toLowerCase(); } // S5.1.3 Domain Matching function domainMatch(str, domStr, canonicalize) { if (str == null || domStr == null) { return null; } if (canonicalize !== false) { str = canonicalDomain(str); domStr = canonicalDomain(domStr); } /* * "The domain string and the string are identical. (Note that both the * domain string and the string will have been canonicalized to lower case at * this point)" */ if (str == domStr) { return true; } /* "All of the following [three] conditions hold:" (order adjusted from the RFC) */ /* "* The string is a host name (i.e., not an IP address)." */ if (net.isIP(str)) { return false; } /* "* The domain string is a suffix of the string" */ var idx = str.indexOf(domStr); if (idx <= 0) { return false; // it's a non-match (-1) or prefix (0) } // e.g "a.b.c".indexOf("b.c") === 2 // 5 === 3+2 if (str.length !== domStr.length + idx) { // it's not a suffix return false; } /* "* The last character of the string that is not included in the domain * string is a %x2E (".") character." */ if (str.substr(idx-1,1) !== '.') { return false; } return true; } // RFC6265 S5.1.4 Paths and Path-Match /* * "The user agent MUST use an algorithm equivalent to the following algorithm * to compute the default-path of a cookie:" * * Assumption: the path (and not query part or absolute uri) is passed in. */ function defaultPath(path) { // "2. If the uri-path is empty or if the first character of the uri-path is not // a %x2F ("/") character, output %x2F ("/") and skip the remaining steps. if (!path || path.substr(0,1) !== "/") { return "/"; } // "3. If the uri-path contains no more than one %x2F ("/") character, output // %x2F ("/") and skip the remaining step." if (path === "/") { return path; } var rightSlash = path.lastIndexOf("/"); if (rightSlash === 0) { return "/"; } // "4. Output the characters of the uri-path from the first character up to, // but not including, the right-most %x2F ("/")." return path.slice(0, rightSlash); } function trimTerminator(str) { for (var t = 0; t < TERMINATORS.length; t++) { var terminatorIdx = str.indexOf(TERMINATORS[t]); if (terminatorIdx !== -1) { str = str.substr(0,terminatorIdx); } } return str; } function parseCookiePair(cookiePair, looseMode) { cookiePair = trimTerminator(cookiePair); var firstEq = cookiePair.indexOf('='); if (looseMode) { if (firstEq === 0) { // '=' is immediately at start cookiePair = cookiePair.substr(1); firstEq = cookiePair.indexOf('='); // might still need to split on '=' } } else { // non-loose mode if (firstEq <= 0) { // no '=' or is at start return; // needs to have non-empty "cookie-name" } } var cookieName, cookieValue; if (firstEq <= 0) { cookieName = ""; cookieValue = cookiePair.trim(); } else { cookieName = cookiePair.substr(0, firstEq).trim(); cookieValue = cookiePair.substr(firstEq+1).trim(); } if (CONTROL_CHARS.test(cookieName) || CONTROL_CHARS.test(cookieValue)) { return; } var c = new Cookie(); c.key = cookieName; c.value = cookieValue; return c; } function parse(str, options) { if (!options || typeof options !== 'object') { options = {}; } str = str.trim(); // We use a regex to parse the "name-value-pair" part of S5.2 var firstSemi = str.indexOf(';'); // S5.2 step 1 var cookiePair = (firstSemi === -1) ? str : str.substr(0, firstSemi); var c = parseCookiePair(cookiePair, !!options.loose); if (!c) { return; } if (firstSemi === -1) { return c; } // S5.2.3 "unparsed-attributes consist of the remainder of the set-cookie-string // (including the %x3B (";") in question)." plus later on in the same section // "discard the first ";" and trim". var unparsed = str.slice(firstSemi + 1).trim(); // "If the unparsed-attributes string is empty, skip the rest of these // steps." if (unparsed.length === 0) { return c; } /* * S5.2 says that when looping over the items "[p]rocess the attribute-name * and attribute-value according to the requirements in the following * subsections" for every item. Plus, for many of the individual attributes * in S5.3 it says to use the "attribute-value of the last attribute in the * cookie-attribute-list". Therefore, in this implementation, we overwrite * the previous value. */ var cookie_avs = unparsed.split(';'); while (cookie_avs.length) { var av = cookie_avs.shift().trim(); if (av.length === 0) { // happens if ";;" appears continue; } var av_sep = av.indexOf('='); var av_key, av_value; if (av_sep === -1) { av_key = av; av_value = null; } else { av_key = av.substr(0,av_sep); av_value = av.substr(av_sep+1); } av_key = av_key.trim().toLowerCase(); if (av_value) { av_value = av_value.trim(); } switch(av_key) { case 'expires': // S5.2.1 if (av_value) { var exp = parseDate(av_value); // "If the attribute-value failed to parse as a cookie date, ignore the // cookie-av." if (exp) { // over and underflow not realistically a concern: V8's getTime() seems to // store something larger than a 32-bit time_t (even with 32-bit node) c.expires = exp; } } break; case 'max-age': // S5.2.2 if (av_value) { // "If the first character of the attribute-value is not a DIGIT or a "-" // character ...[or]... If the remainder of attribute-value contains a // non-DIGIT character, ignore the cookie-av." if (/^-?[0-9]+$/.test(av_value)) { var delta = parseInt(av_value, 10); // "If delta-seconds is less than or equal to zero (0), let expiry-time // be the earliest representable date and time." c.setMaxAge(delta); } } break; case 'domain': // S5.2.3 // "If the attribute-value is empty, the behavior is undefined. However, // the user agent SHOULD ignore the cookie-av entirely." if (av_value) { // S5.2.3 "Let cookie-domain be the attribute-value without the leading %x2E // (".") character." var domain = av_value.trim().replace(/^\./, ''); if (domain) { // "Convert the cookie-domain to lower case." c.domain = domain.toLowerCase(); } } break; case 'path': // S5.2.4 /* * "If the attribute-value is empty or if the first character of the * attribute-value is not %x2F ("/"): * Let cookie-path be the default-path. * Otherwise: * Let cookie-path be the attribute-value." * * We'll represent the default-path as null since it depends on the * context of the parsing. */ c.path = av_value && av_value[0] === "/" ? av_value : null; break; case 'secure': // S5.2.5 /* * "If the attribute-name case-insensitively matches the string "Secure", * the user agent MUST append an attribute to the cookie-attribute-list * with an attribute-name of Secure and an empty attribute-value." */ c.secure = true; break; case 'httponly': // S5.2.6 -- effectively the same as 'secure' c.httpOnly = true; break; default: c.extensions = c.extensions || []; c.extensions.push(av); break; } } return c; } // avoid the V8 deoptimization monster! function jsonParse(str) { var obj; try { obj = JSON.parse(str); } catch (e) { return e; } return obj; } function fromJSON(str) { if (!str) { return null; } var obj; if (typeof str === 'string') { obj = jsonParse(str); if (obj instanceof Error) { return null; } } else { // assume it's an Object obj = str; } var c = new Cookie(); for (var i=0; i 1) { var lindex = path.lastIndexOf('/'); if (lindex === 0) { break; } path = path.substr(0,lindex); permutations.push(path); } permutations.push('/'); return permutations; } function getCookieContext(url) { if (url instanceof Object) { return url; } // NOTE: decodeURI will throw on malformed URIs (see GH-32). // Therefore, we will just skip decoding for such URIs. try { url = decodeURI(url); } catch(err) { // Silently swallow error } return urlParse(url); } function Cookie(options) { options = options || {}; Object.keys(options).forEach(function(prop) { if (Cookie.prototype.hasOwnProperty(prop) && Cookie.prototype[prop] !== options[prop] && prop.substr(0,1) !== '_') { this[prop] = options[prop]; } }, this); this.creation = this.creation || new Date(); // used to break creation ties in cookieCompare(): Object.defineProperty(this, 'creationIndex', { configurable: false, enumerable: false, // important for assert.deepEqual checks writable: true, value: ++Cookie.cookiesCreated }); } Cookie.cookiesCreated = 0; // incremented each time a cookie is created Cookie.parse = parse; Cookie.fromJSON = fromJSON; Cookie.prototype.key = ""; Cookie.prototype.value = ""; // the order in which the RFC has them: Cookie.prototype.expires = "Infinity"; // coerces to literal Infinity Cookie.prototype.maxAge = null; // takes precedence over expires for TTL Cookie.prototype.domain = null; Cookie.prototype.path = null; Cookie.prototype.secure = false; Cookie.prototype.httpOnly = false; Cookie.prototype.extensions = null; // set by the CookieJar: Cookie.prototype.hostOnly = null; // boolean when set Cookie.prototype.pathIsDefault = null; // boolean when set Cookie.prototype.creation = null; // Date when set; defaulted by Cookie.parse Cookie.prototype.lastAccessed = null; // Date when set Object.defineProperty(Cookie.prototype, 'creationIndex', { configurable: true, enumerable: false, writable: true, value: 0 }); Cookie.serializableProperties = Object.keys(Cookie.prototype) .filter(function(prop) { return !( Cookie.prototype[prop] instanceof Function || prop === 'creationIndex' || prop.substr(0,1) === '_' ); }); Cookie.prototype.inspect = function inspect() { var now = Date.now(); return 'Cookie="'+this.toString() + '; hostOnly='+(this.hostOnly != null ? this.hostOnly : '?') + '; aAge='+(this.lastAccessed ? (now-this.lastAccessed.getTime())+'ms' : '?') + '; cAge='+(this.creation ? (now-this.creation.getTime())+'ms' : '?') + '"'; }; // Use the new custom inspection symbol to add the custom inspect function if // available. if (util.inspect.custom) { Cookie.prototype[util.inspect.custom] = Cookie.prototype.inspect; } Cookie.prototype.toJSON = function() { var obj = {}; var props = Cookie.serializableProperties; for (var i=0; i schema.maxItems){ addError("There must be a maximum of " + schema.maxItems + " in the array"); } }else if(schema.properties || schema.additionalProperties){ errors.concat(checkObj(value, schema.properties, path, schema.additionalProperties)); } if(schema.pattern && typeof value == 'string' && !value.match(schema.pattern)){ addError("does not match the regex pattern " + schema.pattern); } if(schema.maxLength && typeof value == 'string' && value.length > schema.maxLength){ addError("may only be " + schema.maxLength + " characters long"); } if(schema.minLength && typeof value == 'string' && value.length < schema.minLength){ addError("must be at least " + schema.minLength + " characters long"); } if(typeof schema.minimum !== undefined && typeof value == typeof schema.minimum && schema.minimum > value){ addError("must have a minimum value of " + schema.minimum); } if(typeof schema.maximum !== undefined && typeof value == typeof schema.maximum && schema.maximum < value){ addError("must have a maximum value of " + schema.maximum); } if(schema['enum']){ var enumer = schema['enum']; l = enumer.length; var found; for(var j = 0; j < l; j++){ if(enumer[j]===value){ found=1; break; } } if(!found){ addError("does not have a value in the enumeration " + enumer.join(", ")); } } if(typeof schema.maxDecimal == 'number' && (value.toString().match(new RegExp("\\.[0-9]{" + (schema.maxDecimal + 1) + ",}")))){ addError("may only have " + schema.maxDecimal + " digits of decimal places"); } } } return null; } // validate an object against a schema function checkObj(instance,objTypeDef,path,additionalProp){ if(typeof objTypeDef =='object'){ if(typeof instance != 'object' || instance instanceof Array){ errors.push({property:path,message:"an object is required"}); } for(var i in objTypeDef){ if(objTypeDef.hasOwnProperty(i)){ var value = instance[i]; // skip _not_ specified properties if (value === undefined && options.existingOnly) continue; var propDef = objTypeDef[i]; // set default if(value === undefined && propDef["default"]){ value = instance[i] = propDef["default"]; } if(options.coerce && i in instance){ value = instance[i] = options.coerce(value, propDef); } checkProp(value,propDef,path,i); } } } for(i in instance){ if(instance.hasOwnProperty(i) && !(i.charAt(0) == '_' && i.charAt(1) == '_') && objTypeDef && !objTypeDef[i] && additionalProp===false){ if (options.filter) { delete instance[i]; continue; } else { errors.push({property:path,message:(typeof value) + "The property " + i + " is not defined in the schema and the schema does not allow additional properties"}); } } var requires = objTypeDef && objTypeDef[i] && objTypeDef[i].requires; if(requires && !(requires in instance)){ errors.push({property:path,message:"the presence of the property " + i + " requires that " + requires + " also be present"}); } value = instance[i]; if(additionalProp && (!(objTypeDef && typeof objTypeDef == 'object') || !(i in objTypeDef))){ if(options.coerce){ value = instance[i] = options.coerce(value, additionalProp); } checkProp(value,additionalProp,path,i); } if(!_changing && value && value.$schema){ errors = errors.concat(checkProp(value,value.$schema,path,i)); } } return errors; } if(schema){ checkProp(instance,schema,'',_changing || ''); } if(!_changing && instance && instance.$schema){ checkProp(instance,instance.$schema,'',''); } return {valid:!errors.length,errors:errors}; }; exports.mustBeValid = function(result){ // summary: // This checks to ensure that the result is valid and will throw an appropriate error message if it is not // result: the result returned from checkPropertyChange or validate if(!result.valid){ throw new TypeError(result.errors.map(function(error){return "for property " + error.property + ': ' + error.message;}).join(", \n")); } } return exports; })); /***/ }), /***/ 704: /***/ (function(module, exports) { exports = module.exports = stringify exports.getSerialize = serializer function stringify(obj, replacer, spaces, cycleReplacer) { return JSON.stringify(obj, serializer(replacer, cycleReplacer), spaces) } function serializer(replacer, cycleReplacer) { var stack = [], keys = [] if (cycleReplacer == null) cycleReplacer = function(key, value) { if (stack[0] === value) return "[Circular ~]" return "[Circular ~." + keys.slice(0, stack.indexOf(value)).join(".") + "]" } return function(key, value) { if (stack.length > 0) { var thisPos = stack.indexOf(this) ~thisPos ? stack.splice(thisPos + 1) : stack.push(this) ~thisPos ? keys.splice(thisPos, Infinity, key) : keys.push(key) if (~stack.indexOf(value)) value = cycleReplacer.call(this, key, value) } else stack.push(value) return replacer == null ? value : replacer.call(this, key, value) } } /***/ }), /***/ 707: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2018 Joyent, Inc. module.exports = { read: read, readPkcs8: readPkcs8, write: write, writePkcs8: writePkcs8, pkcs8ToBuffer: pkcs8ToBuffer, readECDSACurve: readECDSACurve, writeECDSACurve: writeECDSACurve }; var assert = __webpack_require__(477); var asn1 = __webpack_require__(62); var Buffer = __webpack_require__(215).Buffer; var algs = __webpack_require__(98); var utils = __webpack_require__(270); var Key = __webpack_require__(852); var PrivateKey = __webpack_require__(502); var pem = __webpack_require__(268); function read(buf, options) { return (pem.read(buf, options, 'pkcs8')); } function write(key, options) { return (pem.write(key, options, 'pkcs8')); } /* Helper to read in a single mpint */ function readMPInt(der, nm) { assert.strictEqual(der.peek(), asn1.Ber.Integer, nm + ' is not an Integer'); return (utils.mpNormalize(der.readString(asn1.Ber.Integer, true))); } function readPkcs8(alg, type, der) { /* Private keys in pkcs#8 format have a weird extra int */ if (der.peek() === asn1.Ber.Integer) { assert.strictEqual(type, 'private', 'unexpected Integer at start of public key'); der.readString(asn1.Ber.Integer, true); } der.readSequence(); var next = der.offset + der.length; var oid = der.readOID(); switch (oid) { case '1.2.840.113549.1.1.1': der._offset = next; if (type === 'public') return (readPkcs8RSAPublic(der)); else return (readPkcs8RSAPrivate(der)); case '1.2.840.10040.4.1': if (type === 'public') return (readPkcs8DSAPublic(der)); else return (readPkcs8DSAPrivate(der)); case '1.2.840.10045.2.1': if (type === 'public') return (readPkcs8ECDSAPublic(der)); else return (readPkcs8ECDSAPrivate(der)); case '1.3.101.112': if (type === 'public') { return (readPkcs8EdDSAPublic(der)); } else { return (readPkcs8EdDSAPrivate(der)); } case '1.3.101.110': if (type === 'public') { return (readPkcs8X25519Public(der)); } else { return (readPkcs8X25519Private(der)); } default: throw (new Error('Unknown key type OID ' + oid)); } } function readPkcs8RSAPublic(der) { // bit string sequence der.readSequence(asn1.Ber.BitString); der.readByte(); der.readSequence(); // modulus var n = readMPInt(der, 'modulus'); var e = readMPInt(der, 'exponent'); // now, make the key var key = { type: 'rsa', source: der.originalInput, parts: [ { name: 'e', data: e }, { name: 'n', data: n } ] }; return (new Key(key)); } function readPkcs8RSAPrivate(der) { der.readSequence(asn1.Ber.OctetString); der.readSequence(); var ver = readMPInt(der, 'version'); assert.equal(ver[0], 0x0, 'unknown RSA private key version'); // modulus then public exponent var n = readMPInt(der, 'modulus'); var e = readMPInt(der, 'public exponent'); var d = readMPInt(der, 'private exponent'); var p = readMPInt(der, 'prime1'); var q = readMPInt(der, 'prime2'); var dmodp = readMPInt(der, 'exponent1'); var dmodq = readMPInt(der, 'exponent2'); var iqmp = readMPInt(der, 'iqmp'); // now, make the key var key = { type: 'rsa', parts: [ { name: 'n', data: n }, { name: 'e', data: e }, { name: 'd', data: d }, { name: 'iqmp', data: iqmp }, { name: 'p', data: p }, { name: 'q', data: q }, { name: 'dmodp', data: dmodp }, { name: 'dmodq', data: dmodq } ] }; return (new PrivateKey(key)); } function readPkcs8DSAPublic(der) { der.readSequence(); var p = readMPInt(der, 'p'); var q = readMPInt(der, 'q'); var g = readMPInt(der, 'g'); // bit string sequence der.readSequence(asn1.Ber.BitString); der.readByte(); var y = readMPInt(der, 'y'); // now, make the key var key = { type: 'dsa', parts: [ { name: 'p', data: p }, { name: 'q', data: q }, { name: 'g', data: g }, { name: 'y', data: y } ] }; return (new Key(key)); } function readPkcs8DSAPrivate(der) { der.readSequence(); var p = readMPInt(der, 'p'); var q = readMPInt(der, 'q'); var g = readMPInt(der, 'g'); der.readSequence(asn1.Ber.OctetString); var x = readMPInt(der, 'x'); /* The pkcs#8 format does not include the public key */ var y = utils.calculateDSAPublic(g, p, x); var key = { type: 'dsa', parts: [ { name: 'p', data: p }, { name: 'q', data: q }, { name: 'g', data: g }, { name: 'y', data: y }, { name: 'x', data: x } ] }; return (new PrivateKey(key)); } function readECDSACurve(der) { var curveName, curveNames; var j, c, cd; if (der.peek() === asn1.Ber.OID) { var oid = der.readOID(); curveNames = Object.keys(algs.curves); for (j = 0; j < curveNames.length; ++j) { c = curveNames[j]; cd = algs.curves[c]; if (cd.pkcs8oid === oid) { curveName = c; break; } } } else { // ECParameters sequence der.readSequence(); var version = der.readString(asn1.Ber.Integer, true); assert.strictEqual(version[0], 1, 'ECDSA key not version 1'); var curve = {}; // FieldID sequence der.readSequence(); var fieldTypeOid = der.readOID(); assert.strictEqual(fieldTypeOid, '1.2.840.10045.1.1', 'ECDSA key is not from a prime-field'); var p = curve.p = utils.mpNormalize( der.readString(asn1.Ber.Integer, true)); /* * p always starts with a 1 bit, so count the zeros to get its * real size. */ curve.size = p.length * 8 - utils.countZeros(p); // Curve sequence der.readSequence(); curve.a = utils.mpNormalize( der.readString(asn1.Ber.OctetString, true)); curve.b = utils.mpNormalize( der.readString(asn1.Ber.OctetString, true)); if (der.peek() === asn1.Ber.BitString) curve.s = der.readString(asn1.Ber.BitString, true); // Combined Gx and Gy curve.G = der.readString(asn1.Ber.OctetString, true); assert.strictEqual(curve.G[0], 0x4, 'uncompressed G is required'); curve.n = utils.mpNormalize( der.readString(asn1.Ber.Integer, true)); curve.h = utils.mpNormalize( der.readString(asn1.Ber.Integer, true)); assert.strictEqual(curve.h[0], 0x1, 'a cofactor=1 curve is ' + 'required'); curveNames = Object.keys(algs.curves); var ks = Object.keys(curve); for (j = 0; j < curveNames.length; ++j) { c = curveNames[j]; cd = algs.curves[c]; var equal = true; for (var i = 0; i < ks.length; ++i) { var k = ks[i]; if (cd[k] === undefined) continue; if (typeof (cd[k]) === 'object' && cd[k].equals !== undefined) { if (!cd[k].equals(curve[k])) { equal = false; break; } } else if (Buffer.isBuffer(cd[k])) { if (cd[k].toString('binary') !== curve[k].toString('binary')) { equal = false; break; } } else { if (cd[k] !== curve[k]) { equal = false; break; } } } if (equal) { curveName = c; break; } } } return (curveName); } function readPkcs8ECDSAPrivate(der) { var curveName = readECDSACurve(der); assert.string(curveName, 'a known elliptic curve'); der.readSequence(asn1.Ber.OctetString); der.readSequence(); var version = readMPInt(der, 'version'); assert.equal(version[0], 1, 'unknown version of ECDSA key'); var d = der.readString(asn1.Ber.OctetString, true); var Q; if (der.peek() == 0xa0) { der.readSequence(0xa0); der._offset += der.length; } if (der.peek() == 0xa1) { der.readSequence(0xa1); Q = der.readString(asn1.Ber.BitString, true); Q = utils.ecNormalize(Q); } if (Q === undefined) { var pub = utils.publicFromPrivateECDSA(curveName, d); Q = pub.part.Q.data; } var key = { type: 'ecdsa', parts: [ { name: 'curve', data: Buffer.from(curveName) }, { name: 'Q', data: Q }, { name: 'd', data: d } ] }; return (new PrivateKey(key)); } function readPkcs8ECDSAPublic(der) { var curveName = readECDSACurve(der); assert.string(curveName, 'a known elliptic curve'); var Q = der.readString(asn1.Ber.BitString, true); Q = utils.ecNormalize(Q); var key = { type: 'ecdsa', parts: [ { name: 'curve', data: Buffer.from(curveName) }, { name: 'Q', data: Q } ] }; return (new Key(key)); } function readPkcs8EdDSAPublic(der) { if (der.peek() === 0x00) der.readByte(); var A = utils.readBitString(der); var key = { type: 'ed25519', parts: [ { name: 'A', data: utils.zeroPadToLength(A, 32) } ] }; return (new Key(key)); } function readPkcs8X25519Public(der) { var A = utils.readBitString(der); var key = { type: 'curve25519', parts: [ { name: 'A', data: utils.zeroPadToLength(A, 32) } ] }; return (new Key(key)); } function readPkcs8EdDSAPrivate(der) { if (der.peek() === 0x00) der.readByte(); der.readSequence(asn1.Ber.OctetString); var k = der.readString(asn1.Ber.OctetString, true); k = utils.zeroPadToLength(k, 32); var A; if (der.peek() === asn1.Ber.BitString) { A = utils.readBitString(der); A = utils.zeroPadToLength(A, 32); } else { A = utils.calculateED25519Public(k); } var key = { type: 'ed25519', parts: [ { name: 'A', data: utils.zeroPadToLength(A, 32) }, { name: 'k', data: utils.zeroPadToLength(k, 32) } ] }; return (new PrivateKey(key)); } function readPkcs8X25519Private(der) { if (der.peek() === 0x00) der.readByte(); der.readSequence(asn1.Ber.OctetString); var k = der.readString(asn1.Ber.OctetString, true); k = utils.zeroPadToLength(k, 32); var A = utils.calculateX25519Public(k); var key = { type: 'curve25519', parts: [ { name: 'A', data: utils.zeroPadToLength(A, 32) }, { name: 'k', data: utils.zeroPadToLength(k, 32) } ] }; return (new PrivateKey(key)); } function pkcs8ToBuffer(key) { var der = new asn1.BerWriter(); writePkcs8(der, key); return (der.buffer); } function writePkcs8(der, key) { der.startSequence(); if (PrivateKey.isPrivateKey(key)) { var sillyInt = Buffer.from([0]); der.writeBuffer(sillyInt, asn1.Ber.Integer); } der.startSequence(); switch (key.type) { case 'rsa': der.writeOID('1.2.840.113549.1.1.1'); if (PrivateKey.isPrivateKey(key)) writePkcs8RSAPrivate(key, der); else writePkcs8RSAPublic(key, der); break; case 'dsa': der.writeOID('1.2.840.10040.4.1'); if (PrivateKey.isPrivateKey(key)) writePkcs8DSAPrivate(key, der); else writePkcs8DSAPublic(key, der); break; case 'ecdsa': der.writeOID('1.2.840.10045.2.1'); if (PrivateKey.isPrivateKey(key)) writePkcs8ECDSAPrivate(key, der); else writePkcs8ECDSAPublic(key, der); break; case 'ed25519': der.writeOID('1.3.101.112'); if (PrivateKey.isPrivateKey(key)) throw (new Error('Ed25519 private keys in pkcs8 ' + 'format are not supported')); writePkcs8EdDSAPublic(key, der); break; default: throw (new Error('Unsupported key type: ' + key.type)); } der.endSequence(); } function writePkcs8RSAPrivate(key, der) { der.writeNull(); der.endSequence(); der.startSequence(asn1.Ber.OctetString); der.startSequence(); var version = Buffer.from([0]); der.writeBuffer(version, asn1.Ber.Integer); der.writeBuffer(key.part.n.data, asn1.Ber.Integer); der.writeBuffer(key.part.e.data, asn1.Ber.Integer); der.writeBuffer(key.part.d.data, asn1.Ber.Integer); der.writeBuffer(key.part.p.data, asn1.Ber.Integer); der.writeBuffer(key.part.q.data, asn1.Ber.Integer); if (!key.part.dmodp || !key.part.dmodq) utils.addRSAMissing(key); der.writeBuffer(key.part.dmodp.data, asn1.Ber.Integer); der.writeBuffer(key.part.dmodq.data, asn1.Ber.Integer); der.writeBuffer(key.part.iqmp.data, asn1.Ber.Integer); der.endSequence(); der.endSequence(); } function writePkcs8RSAPublic(key, der) { der.writeNull(); der.endSequence(); der.startSequence(asn1.Ber.BitString); der.writeByte(0x00); der.startSequence(); der.writeBuffer(key.part.n.data, asn1.Ber.Integer); der.writeBuffer(key.part.e.data, asn1.Ber.Integer); der.endSequence(); der.endSequence(); } function writePkcs8DSAPrivate(key, der) { der.startSequence(); der.writeBuffer(key.part.p.data, asn1.Ber.Integer); der.writeBuffer(key.part.q.data, asn1.Ber.Integer); der.writeBuffer(key.part.g.data, asn1.Ber.Integer); der.endSequence(); der.endSequence(); der.startSequence(asn1.Ber.OctetString); der.writeBuffer(key.part.x.data, asn1.Ber.Integer); der.endSequence(); } function writePkcs8DSAPublic(key, der) { der.startSequence(); der.writeBuffer(key.part.p.data, asn1.Ber.Integer); der.writeBuffer(key.part.q.data, asn1.Ber.Integer); der.writeBuffer(key.part.g.data, asn1.Ber.Integer); der.endSequence(); der.endSequence(); der.startSequence(asn1.Ber.BitString); der.writeByte(0x00); der.writeBuffer(key.part.y.data, asn1.Ber.Integer); der.endSequence(); } function writeECDSACurve(key, der) { var curve = algs.curves[key.curve]; if (curve.pkcs8oid) { /* This one has a name in pkcs#8, so just write the oid */ der.writeOID(curve.pkcs8oid); } else { // ECParameters sequence der.startSequence(); var version = Buffer.from([1]); der.writeBuffer(version, asn1.Ber.Integer); // FieldID sequence der.startSequence(); der.writeOID('1.2.840.10045.1.1'); // prime-field der.writeBuffer(curve.p, asn1.Ber.Integer); der.endSequence(); // Curve sequence der.startSequence(); var a = curve.p; if (a[0] === 0x0) a = a.slice(1); der.writeBuffer(a, asn1.Ber.OctetString); der.writeBuffer(curve.b, asn1.Ber.OctetString); der.writeBuffer(curve.s, asn1.Ber.BitString); der.endSequence(); der.writeBuffer(curve.G, asn1.Ber.OctetString); der.writeBuffer(curve.n, asn1.Ber.Integer); var h = curve.h; if (!h) { h = Buffer.from([1]); } der.writeBuffer(h, asn1.Ber.Integer); // ECParameters der.endSequence(); } } function writePkcs8ECDSAPublic(key, der) { writeECDSACurve(key, der); der.endSequence(); var Q = utils.ecNormalize(key.part.Q.data, true); der.writeBuffer(Q, asn1.Ber.BitString); } function writePkcs8ECDSAPrivate(key, der) { writeECDSACurve(key, der); der.endSequence(); der.startSequence(asn1.Ber.OctetString); der.startSequence(); var version = Buffer.from([1]); der.writeBuffer(version, asn1.Ber.Integer); der.writeBuffer(key.part.d.data, asn1.Ber.OctetString); der.startSequence(0xa1); var Q = utils.ecNormalize(key.part.Q.data, true); der.writeBuffer(Q, asn1.Ber.BitString); der.endSequence(); der.endSequence(); der.endSequence(); } function writePkcs8EdDSAPublic(key, der) { der.endSequence(); utils.writeBitString(der, key.part.A.data); } function writePkcs8EdDSAPrivate(key, der) { der.endSequence(); var k = utils.mpNormalize(key.part.k.data, true); der.startSequence(asn1.Ber.OctetString); der.writeBuffer(k, asn1.Ber.OctetString); der.endSequence(); } /***/ }), /***/ 721: /***/ (function(module) { "use strict"; function formatHostname (hostname) { // canonicalize the hostname, so that 'oogle.com' won't match 'google.com' return hostname.replace(/^\.*/, '.').toLowerCase() } function parseNoProxyZone (zone) { zone = zone.trim().toLowerCase() var zoneParts = zone.split(':', 2) var zoneHost = formatHostname(zoneParts[0]) var zonePort = zoneParts[1] var hasPort = zone.indexOf(':') > -1 return {hostname: zoneHost, port: zonePort, hasPort: hasPort} } function uriInNoProxy (uri, noProxy) { var port = uri.port || (uri.protocol === 'https:' ? '443' : '80') var hostname = formatHostname(uri.hostname) var noProxyList = noProxy.split(',') // iterate through the noProxyList until it finds a match. return noProxyList.map(parseNoProxyZone).some(function (noProxyZone) { var isMatchedAt = hostname.indexOf(noProxyZone.hostname) var hostnameMatched = ( isMatchedAt > -1 && (isMatchedAt === hostname.length - noProxyZone.hostname.length) ) if (noProxyZone.hasPort) { return (port === noProxyZone.port) && hostnameMatched } return hostnameMatched }) } function getProxyFromURI (uri) { // Decide the proper request proxy to use based on the request URI object and the // environmental variables (NO_PROXY, HTTP_PROXY, etc.) // respect NO_PROXY environment variables (see: https://lynx.invisible-island.net/lynx2.8.7/breakout/lynx_help/keystrokes/environments.html) var noProxy = process.env.NO_PROXY || process.env.no_proxy || '' // if the noProxy is a wildcard then return null if (noProxy === '*') { return null } // if the noProxy is not empty and the uri is found return null if (noProxy !== '' && uriInNoProxy(uri, noProxy)) { return null } // Check for HTTP or HTTPS Proxy in environment Else default to null if (uri.protocol === 'http:') { return process.env.HTTP_PROXY || process.env.http_proxy || null } if (uri.protocol === 'https:') { return process.env.HTTPS_PROXY || process.env.https_proxy || process.env.HTTP_PROXY || process.env.http_proxy || null } // if none of that works, return null // (What uri protocol are you using then?) return null } module.exports = getProxyFromURI /***/ }), /***/ 722: /***/ (function(module) { /** * Convert array of 16 byte values to UUID string format of the form: * XXXXXXXX-XXXX-XXXX-XXXX-XXXXXXXXXXXX */ var byteToHex = []; for (var i = 0; i < 256; ++i) { byteToHex[i] = (i + 0x100).toString(16).substr(1); } function bytesToUuid(buf, offset) { var i = offset || 0; var bth = byteToHex; // join used to fix memory issue caused by concatenation: https://bugs.chromium.org/p/v8/issues/detail?id=3175#c4 return ([ bth[buf[i++]], bth[buf[i++]], bth[buf[i++]], bth[buf[i++]], '-', bth[buf[i++]], bth[buf[i++]], '-', bth[buf[i++]], bth[buf[i++]], '-', bth[buf[i++]], bth[buf[i++]], '-', bth[buf[i++]], bth[buf[i++]], bth[buf[i++]], bth[buf[i++]], bth[buf[i++]], bth[buf[i++]] ]).join(''); } module.exports = bytesToUuid; /***/ }), /***/ 729: /***/ (function(module, __unusedexports, __webpack_require__) { // Basic Javascript Elliptic Curve implementation // Ported loosely from BouncyCastle's Java EC code // Only Fp curves implemented for now // Requires jsbn.js and jsbn2.js var BigInteger = __webpack_require__(242).BigInteger var Barrett = BigInteger.prototype.Barrett // ---------------- // ECFieldElementFp // constructor function ECFieldElementFp(q,x) { this.x = x; // TODO if(x.compareTo(q) >= 0) error this.q = q; } function feFpEquals(other) { if(other == this) return true; return (this.q.equals(other.q) && this.x.equals(other.x)); } function feFpToBigInteger() { return this.x; } function feFpNegate() { return new ECFieldElementFp(this.q, this.x.negate().mod(this.q)); } function feFpAdd(b) { return new ECFieldElementFp(this.q, this.x.add(b.toBigInteger()).mod(this.q)); } function feFpSubtract(b) { return new ECFieldElementFp(this.q, this.x.subtract(b.toBigInteger()).mod(this.q)); } function feFpMultiply(b) { return new ECFieldElementFp(this.q, this.x.multiply(b.toBigInteger()).mod(this.q)); } function feFpSquare() { return new ECFieldElementFp(this.q, this.x.square().mod(this.q)); } function feFpDivide(b) { return new ECFieldElementFp(this.q, this.x.multiply(b.toBigInteger().modInverse(this.q)).mod(this.q)); } ECFieldElementFp.prototype.equals = feFpEquals; ECFieldElementFp.prototype.toBigInteger = feFpToBigInteger; ECFieldElementFp.prototype.negate = feFpNegate; ECFieldElementFp.prototype.add = feFpAdd; ECFieldElementFp.prototype.subtract = feFpSubtract; ECFieldElementFp.prototype.multiply = feFpMultiply; ECFieldElementFp.prototype.square = feFpSquare; ECFieldElementFp.prototype.divide = feFpDivide; // ---------------- // ECPointFp // constructor function ECPointFp(curve,x,y,z) { this.curve = curve; this.x = x; this.y = y; // Projective coordinates: either zinv == null or z * zinv == 1 // z and zinv are just BigIntegers, not fieldElements if(z == null) { this.z = BigInteger.ONE; } else { this.z = z; } this.zinv = null; //TODO: compression flag } function pointFpGetX() { if(this.zinv == null) { this.zinv = this.z.modInverse(this.curve.q); } var r = this.x.toBigInteger().multiply(this.zinv); this.curve.reduce(r); return this.curve.fromBigInteger(r); } function pointFpGetY() { if(this.zinv == null) { this.zinv = this.z.modInverse(this.curve.q); } var r = this.y.toBigInteger().multiply(this.zinv); this.curve.reduce(r); return this.curve.fromBigInteger(r); } function pointFpEquals(other) { if(other == this) return true; if(this.isInfinity()) return other.isInfinity(); if(other.isInfinity()) return this.isInfinity(); var u, v; // u = Y2 * Z1 - Y1 * Z2 u = other.y.toBigInteger().multiply(this.z).subtract(this.y.toBigInteger().multiply(other.z)).mod(this.curve.q); if(!u.equals(BigInteger.ZERO)) return false; // v = X2 * Z1 - X1 * Z2 v = other.x.toBigInteger().multiply(this.z).subtract(this.x.toBigInteger().multiply(other.z)).mod(this.curve.q); return v.equals(BigInteger.ZERO); } function pointFpIsInfinity() { if((this.x == null) && (this.y == null)) return true; return this.z.equals(BigInteger.ZERO) && !this.y.toBigInteger().equals(BigInteger.ZERO); } function pointFpNegate() { return new ECPointFp(this.curve, this.x, this.y.negate(), this.z); } function pointFpAdd(b) { if(this.isInfinity()) return b; if(b.isInfinity()) return this; // u = Y2 * Z1 - Y1 * Z2 var u = b.y.toBigInteger().multiply(this.z).subtract(this.y.toBigInteger().multiply(b.z)).mod(this.curve.q); // v = X2 * Z1 - X1 * Z2 var v = b.x.toBigInteger().multiply(this.z).subtract(this.x.toBigInteger().multiply(b.z)).mod(this.curve.q); if(BigInteger.ZERO.equals(v)) { if(BigInteger.ZERO.equals(u)) { return this.twice(); // this == b, so double } return this.curve.getInfinity(); // this = -b, so infinity } var THREE = new BigInteger("3"); var x1 = this.x.toBigInteger(); var y1 = this.y.toBigInteger(); var x2 = b.x.toBigInteger(); var y2 = b.y.toBigInteger(); var v2 = v.square(); var v3 = v2.multiply(v); var x1v2 = x1.multiply(v2); var zu2 = u.square().multiply(this.z); // x3 = v * (z2 * (z1 * u^2 - 2 * x1 * v^2) - v^3) var x3 = zu2.subtract(x1v2.shiftLeft(1)).multiply(b.z).subtract(v3).multiply(v).mod(this.curve.q); // y3 = z2 * (3 * x1 * u * v^2 - y1 * v^3 - z1 * u^3) + u * v^3 var y3 = x1v2.multiply(THREE).multiply(u).subtract(y1.multiply(v3)).subtract(zu2.multiply(u)).multiply(b.z).add(u.multiply(v3)).mod(this.curve.q); // z3 = v^3 * z1 * z2 var z3 = v3.multiply(this.z).multiply(b.z).mod(this.curve.q); return new ECPointFp(this.curve, this.curve.fromBigInteger(x3), this.curve.fromBigInteger(y3), z3); } function pointFpTwice() { if(this.isInfinity()) return this; if(this.y.toBigInteger().signum() == 0) return this.curve.getInfinity(); // TODO: optimized handling of constants var THREE = new BigInteger("3"); var x1 = this.x.toBigInteger(); var y1 = this.y.toBigInteger(); var y1z1 = y1.multiply(this.z); var y1sqz1 = y1z1.multiply(y1).mod(this.curve.q); var a = this.curve.a.toBigInteger(); // w = 3 * x1^2 + a * z1^2 var w = x1.square().multiply(THREE); if(!BigInteger.ZERO.equals(a)) { w = w.add(this.z.square().multiply(a)); } w = w.mod(this.curve.q); //this.curve.reduce(w); // x3 = 2 * y1 * z1 * (w^2 - 8 * x1 * y1^2 * z1) var x3 = w.square().subtract(x1.shiftLeft(3).multiply(y1sqz1)).shiftLeft(1).multiply(y1z1).mod(this.curve.q); // y3 = 4 * y1^2 * z1 * (3 * w * x1 - 2 * y1^2 * z1) - w^3 var y3 = w.multiply(THREE).multiply(x1).subtract(y1sqz1.shiftLeft(1)).shiftLeft(2).multiply(y1sqz1).subtract(w.square().multiply(w)).mod(this.curve.q); // z3 = 8 * (y1 * z1)^3 var z3 = y1z1.square().multiply(y1z1).shiftLeft(3).mod(this.curve.q); return new ECPointFp(this.curve, this.curve.fromBigInteger(x3), this.curve.fromBigInteger(y3), z3); } // Simple NAF (Non-Adjacent Form) multiplication algorithm // TODO: modularize the multiplication algorithm function pointFpMultiply(k) { if(this.isInfinity()) return this; if(k.signum() == 0) return this.curve.getInfinity(); var e = k; var h = e.multiply(new BigInteger("3")); var neg = this.negate(); var R = this; var i; for(i = h.bitLength() - 2; i > 0; --i) { R = R.twice(); var hBit = h.testBit(i); var eBit = e.testBit(i); if (hBit != eBit) { R = R.add(hBit ? this : neg); } } return R; } // Compute this*j + x*k (simultaneous multiplication) function pointFpMultiplyTwo(j,x,k) { var i; if(j.bitLength() > k.bitLength()) i = j.bitLength() - 1; else i = k.bitLength() - 1; var R = this.curve.getInfinity(); var both = this.add(x); while(i >= 0) { R = R.twice(); if(j.testBit(i)) { if(k.testBit(i)) { R = R.add(both); } else { R = R.add(this); } } else { if(k.testBit(i)) { R = R.add(x); } } --i; } return R; } ECPointFp.prototype.getX = pointFpGetX; ECPointFp.prototype.getY = pointFpGetY; ECPointFp.prototype.equals = pointFpEquals; ECPointFp.prototype.isInfinity = pointFpIsInfinity; ECPointFp.prototype.negate = pointFpNegate; ECPointFp.prototype.add = pointFpAdd; ECPointFp.prototype.twice = pointFpTwice; ECPointFp.prototype.multiply = pointFpMultiply; ECPointFp.prototype.multiplyTwo = pointFpMultiplyTwo; // ---------------- // ECCurveFp // constructor function ECCurveFp(q,a,b) { this.q = q; this.a = this.fromBigInteger(a); this.b = this.fromBigInteger(b); this.infinity = new ECPointFp(this, null, null); this.reducer = new Barrett(this.q); } function curveFpGetQ() { return this.q; } function curveFpGetA() { return this.a; } function curveFpGetB() { return this.b; } function curveFpEquals(other) { if(other == this) return true; return(this.q.equals(other.q) && this.a.equals(other.a) && this.b.equals(other.b)); } function curveFpGetInfinity() { return this.infinity; } function curveFpFromBigInteger(x) { return new ECFieldElementFp(this.q, x); } function curveReduce(x) { this.reducer.reduce(x); } // for now, work with hex strings because they're easier in JS function curveFpDecodePointHex(s) { switch(parseInt(s.substr(0,2), 16)) { // first byte case 0: return this.infinity; case 2: case 3: // point compression not supported yet return null; case 4: case 6: case 7: var len = (s.length - 2) / 2; var xHex = s.substr(2, len); var yHex = s.substr(len+2, len); return new ECPointFp(this, this.fromBigInteger(new BigInteger(xHex, 16)), this.fromBigInteger(new BigInteger(yHex, 16))); default: // unsupported return null; } } function curveFpEncodePointHex(p) { if (p.isInfinity()) return "00"; var xHex = p.getX().toBigInteger().toString(16); var yHex = p.getY().toBigInteger().toString(16); var oLen = this.getQ().toString(16).length; if ((oLen % 2) != 0) oLen++; while (xHex.length < oLen) { xHex = "0" + xHex; } while (yHex.length < oLen) { yHex = "0" + yHex; } return "04" + xHex + yHex; } ECCurveFp.prototype.getQ = curveFpGetQ; ECCurveFp.prototype.getA = curveFpGetA; ECCurveFp.prototype.getB = curveFpGetB; ECCurveFp.prototype.equals = curveFpEquals; ECCurveFp.prototype.getInfinity = curveFpGetInfinity; ECCurveFp.prototype.fromBigInteger = curveFpFromBigInteger; ECCurveFp.prototype.reduce = curveReduce; //ECCurveFp.prototype.decodePointHex = curveFpDecodePointHex; ECCurveFp.prototype.encodePointHex = curveFpEncodePointHex; // from: https://github.com/kaielvin/jsbn-ec-point-compression ECCurveFp.prototype.decodePointHex = function(s) { var yIsEven; switch(parseInt(s.substr(0,2), 16)) { // first byte case 0: return this.infinity; case 2: yIsEven = false; case 3: if(yIsEven == undefined) yIsEven = true; var len = s.length - 2; var xHex = s.substr(2, len); var x = this.fromBigInteger(new BigInteger(xHex,16)); var alpha = x.multiply(x.square().add(this.getA())).add(this.getB()); var beta = alpha.sqrt(); if (beta == null) throw "Invalid point compression"; var betaValue = beta.toBigInteger(); if (betaValue.testBit(0) != yIsEven) { // Use the other root beta = this.fromBigInteger(this.getQ().subtract(betaValue)); } return new ECPointFp(this,x,beta); case 4: case 6: case 7: var len = (s.length - 2) / 2; var xHex = s.substr(2, len); var yHex = s.substr(len+2, len); return new ECPointFp(this, this.fromBigInteger(new BigInteger(xHex, 16)), this.fromBigInteger(new BigInteger(yHex, 16))); default: // unsupported return null; } } ECCurveFp.prototype.encodeCompressedPointHex = function(p) { if (p.isInfinity()) return "00"; var xHex = p.getX().toBigInteger().toString(16); var oLen = this.getQ().toString(16).length; if ((oLen % 2) != 0) oLen++; while (xHex.length < oLen) xHex = "0" + xHex; var yPrefix; if(p.getY().toBigInteger().isEven()) yPrefix = "02"; else yPrefix = "03"; return yPrefix + xHex; } ECFieldElementFp.prototype.getR = function() { if(this.r != undefined) return this.r; this.r = null; var bitLength = this.q.bitLength(); if (bitLength > 128) { var firstWord = this.q.shiftRight(bitLength - 64); if (firstWord.intValue() == -1) { this.r = BigInteger.ONE.shiftLeft(bitLength).subtract(this.q); } } return this.r; } ECFieldElementFp.prototype.modMult = function(x1,x2) { return this.modReduce(x1.multiply(x2)); } ECFieldElementFp.prototype.modReduce = function(x) { if (this.getR() != null) { var qLen = q.bitLength(); while (x.bitLength() > (qLen + 1)) { var u = x.shiftRight(qLen); var v = x.subtract(u.shiftLeft(qLen)); if (!this.getR().equals(BigInteger.ONE)) { u = u.multiply(this.getR()); } x = u.add(v); } while (x.compareTo(q) >= 0) { x = x.subtract(q); } } else { x = x.mod(q); } return x; } ECFieldElementFp.prototype.sqrt = function() { if (!this.q.testBit(0)) throw "unsupported"; // p mod 4 == 3 if (this.q.testBit(1)) { var z = new ECFieldElementFp(this.q,this.x.modPow(this.q.shiftRight(2).add(BigInteger.ONE),this.q)); return z.square().equals(this) ? z : null; } // p mod 4 == 1 var qMinusOne = this.q.subtract(BigInteger.ONE); var legendreExponent = qMinusOne.shiftRight(1); if (!(this.x.modPow(legendreExponent, this.q).equals(BigInteger.ONE))) { return null; } var u = qMinusOne.shiftRight(2); var k = u.shiftLeft(1).add(BigInteger.ONE); var Q = this.x; var fourQ = modDouble(modDouble(Q)); var U, V; do { var P; do { P = new BigInteger(this.q.bitLength(), new SecureRandom()); } while (P.compareTo(this.q) >= 0 || !(P.multiply(P).subtract(fourQ).modPow(legendreExponent, this.q).equals(qMinusOne))); var result = this.lucasSequence(P, Q, k); U = result[0]; V = result[1]; if (this.modMult(V, V).equals(fourQ)) { // Integer division by 2, mod q if (V.testBit(0)) { V = V.add(q); } V = V.shiftRight(1); return new ECFieldElementFp(q,V); } } while (U.equals(BigInteger.ONE) || U.equals(qMinusOne)); return null; } ECFieldElementFp.prototype.lucasSequence = function(P,Q,k) { var n = k.bitLength(); var s = k.getLowestSetBit(); var Uh = BigInteger.ONE; var Vl = BigInteger.TWO; var Vh = P; var Ql = BigInteger.ONE; var Qh = BigInteger.ONE; for (var j = n - 1; j >= s + 1; --j) { Ql = this.modMult(Ql, Qh); if (k.testBit(j)) { Qh = this.modMult(Ql, Q); Uh = this.modMult(Uh, Vh); Vl = this.modReduce(Vh.multiply(Vl).subtract(P.multiply(Ql))); Vh = this.modReduce(Vh.multiply(Vh).subtract(Qh.shiftLeft(1))); } else { Qh = Ql; Uh = this.modReduce(Uh.multiply(Vl).subtract(Ql)); Vh = this.modReduce(Vh.multiply(Vl).subtract(P.multiply(Ql))); Vl = this.modReduce(Vl.multiply(Vl).subtract(Ql.shiftLeft(1))); } } Ql = this.modMult(Ql, Qh); Qh = this.modMult(Ql, Q); Uh = this.modReduce(Uh.multiply(Vl).subtract(Ql)); Vl = this.modReduce(Vh.multiply(Vl).subtract(P.multiply(Ql))); Ql = this.modMult(Ql, Qh); for (var j = 1; j <= s; ++j) { Uh = this.modMult(Uh, Vl); Vl = this.modReduce(Vl.multiply(Vl).subtract(Ql.shiftLeft(1))); Ql = this.modMult(Ql, Ql); } return [ Uh, Vl ]; } var exports = { ECCurveFp: ECCurveFp, ECPointFp: ECPointFp, ECFieldElementFp: ECFieldElementFp } module.exports = exports /***/ }), /***/ 733: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2011 Mark Cavage All rights reserved. var assert = __webpack_require__(357); var Buffer = __webpack_require__(215).Buffer; var ASN1 = __webpack_require__(362); var errors = __webpack_require__(584); // --- Globals var newInvalidAsn1Error = errors.newInvalidAsn1Error; // --- API function Reader(data) { if (!data || !Buffer.isBuffer(data)) throw new TypeError('data must be a node Buffer'); this._buf = data; this._size = data.length; // These hold the "current" state this._len = 0; this._offset = 0; } Object.defineProperty(Reader.prototype, 'length', { enumerable: true, get: function () { return (this._len); } }); Object.defineProperty(Reader.prototype, 'offset', { enumerable: true, get: function () { return (this._offset); } }); Object.defineProperty(Reader.prototype, 'remain', { get: function () { return (this._size - this._offset); } }); Object.defineProperty(Reader.prototype, 'buffer', { get: function () { return (this._buf.slice(this._offset)); } }); /** * Reads a single byte and advances offset; you can pass in `true` to make this * a "peek" operation (i.e., get the byte, but don't advance the offset). * * @param {Boolean} peek true means don't move offset. * @return {Number} the next byte, null if not enough data. */ Reader.prototype.readByte = function (peek) { if (this._size - this._offset < 1) return null; var b = this._buf[this._offset] & 0xff; if (!peek) this._offset += 1; return b; }; Reader.prototype.peek = function () { return this.readByte(true); }; /** * Reads a (potentially) variable length off the BER buffer. This call is * not really meant to be called directly, as callers have to manipulate * the internal buffer afterwards. * * As a result of this call, you can call `Reader.length`, until the * next thing called that does a readLength. * * @return {Number} the amount of offset to advance the buffer. * @throws {InvalidAsn1Error} on bad ASN.1 */ Reader.prototype.readLength = function (offset) { if (offset === undefined) offset = this._offset; if (offset >= this._size) return null; var lenB = this._buf[offset++] & 0xff; if (lenB === null) return null; if ((lenB & 0x80) === 0x80) { lenB &= 0x7f; if (lenB === 0) throw newInvalidAsn1Error('Indefinite length not supported'); if (lenB > 4) throw newInvalidAsn1Error('encoding too long'); if (this._size - offset < lenB) return null; this._len = 0; for (var i = 0; i < lenB; i++) this._len = (this._len << 8) + (this._buf[offset++] & 0xff); } else { // Wasn't a variable length this._len = lenB; } return offset; }; /** * Parses the next sequence in this BER buffer. * * To get the length of the sequence, call `Reader.length`. * * @return {Number} the sequence's tag. */ Reader.prototype.readSequence = function (tag) { var seq = this.peek(); if (seq === null) return null; if (tag !== undefined && tag !== seq) throw newInvalidAsn1Error('Expected 0x' + tag.toString(16) + ': got 0x' + seq.toString(16)); var o = this.readLength(this._offset + 1); // stored in `length` if (o === null) return null; this._offset = o; return seq; }; Reader.prototype.readInt = function () { return this._readTag(ASN1.Integer); }; Reader.prototype.readBoolean = function () { return (this._readTag(ASN1.Boolean) === 0 ? false : true); }; Reader.prototype.readEnumeration = function () { return this._readTag(ASN1.Enumeration); }; Reader.prototype.readString = function (tag, retbuf) { if (!tag) tag = ASN1.OctetString; var b = this.peek(); if (b === null) return null; if (b !== tag) throw newInvalidAsn1Error('Expected 0x' + tag.toString(16) + ': got 0x' + b.toString(16)); var o = this.readLength(this._offset + 1); // stored in `length` if (o === null) return null; if (this.length > this._size - o) return null; this._offset = o; if (this.length === 0) return retbuf ? Buffer.alloc(0) : ''; var str = this._buf.slice(this._offset, this._offset + this.length); this._offset += this.length; return retbuf ? str : str.toString('utf8'); }; Reader.prototype.readOID = function (tag) { if (!tag) tag = ASN1.OID; var b = this.readString(tag, true); if (b === null) return null; var values = []; var value = 0; for (var i = 0; i < b.length; i++) { var byte = b[i] & 0xff; value <<= 7; value += byte & 0x7f; if ((byte & 0x80) === 0) { values.push(value); value = 0; } } value = values.shift(); values.unshift(value % 40); values.unshift((value / 40) >> 0); return values.join('.'); }; Reader.prototype._readTag = function (tag) { assert.ok(tag !== undefined); var b = this.peek(); if (b === null) return null; if (b !== tag) throw newInvalidAsn1Error('Expected 0x' + tag.toString(16) + ': got 0x' + b.toString(16)); var o = this.readLength(this._offset + 1); // stored in `length` if (o === null) return null; if (this.length > 4) throw newInvalidAsn1Error('Integer too long: ' + this.length); if (this.length > this._size - o) return null; this._offset = o; var fb = this._buf[this._offset]; var value = 0; for (var i = 0; i < this.length; i++) { value <<= 8; value |= (this._buf[this._offset++] & 0xff); } if ((fb & 0x80) === 0x80 && i !== 4) value -= (1 << (i * 8)); return value >> 0; }; // --- Exported API module.exports = Reader; /***/ }), /***/ 740: /***/ (function(module) { module.exports = {"$id":"postData.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","optional":true,"required":["mimeType"],"properties":{"mimeType":{"type":"string"},"text":{"type":"string"},"params":{"type":"array","required":["name"],"properties":{"name":{"type":"string"},"value":{"type":"string"},"fileName":{"type":"string"},"contentType":{"type":"string"},"comment":{"type":"string"}}},"comment":{"type":"string"}}}; /***/ }), /***/ 741: /***/ (function(module) { "use strict"; module.exports = function (data, opts) { if (!opts) opts = {}; if (typeof opts === 'function') opts = { cmp: opts }; var cycles = (typeof opts.cycles === 'boolean') ? opts.cycles : false; var cmp = opts.cmp && (function (f) { return function (node) { return function (a, b) { var aobj = { key: a, value: node[a] }; var bobj = { key: b, value: node[b] }; return f(aobj, bobj); }; }; })(opts.cmp); var seen = []; return (function stringify (node) { if (node && node.toJSON && typeof node.toJSON === 'function') { node = node.toJSON(); } if (node === undefined) return; if (typeof node == 'number') return isFinite(node) ? '' + node : 'null'; if (typeof node !== 'object') return JSON.stringify(node); var i, out; if (Array.isArray(node)) { out = '['; for (i = 0; i < node.length; i++) { if (i) out += ','; out += stringify(node[i]) || 'null'; } return out + ']'; } if (node === null) return 'null'; if (seen.indexOf(node) !== -1) { if (cycles) return JSON.stringify('__cycle__'); throw new TypeError('Converting circular structure to JSON'); } var seenIndex = seen.push(node) - 1; var keys = Object.keys(node).sort(cmp && cmp(node)); out = ''; for (i = 0; i < keys.length; i++) { var key = keys[i]; var value = stringify(node[key]); if (!value) continue; if (out) out += ','; out += JSON.stringify(key) + ':' + value; } seen.splice(seenIndex, 1); return '{' + out + '}'; })(data); }; /***/ }), /***/ 742: /***/ (function(module) { // Generated by CoffeeScript 1.12.2 (function() { var getNanoSeconds, hrtime, loadTime, moduleLoadTime, nodeLoadTime, upTime; if ((typeof performance !== "undefined" && performance !== null) && performance.now) { module.exports = function() { return performance.now(); }; } else if ((typeof process !== "undefined" && process !== null) && process.hrtime) { module.exports = function() { return (getNanoSeconds() - nodeLoadTime) / 1e6; }; hrtime = process.hrtime; getNanoSeconds = function() { var hr; hr = hrtime(); return hr[0] * 1e9 + hr[1]; }; moduleLoadTime = getNanoSeconds(); upTime = process.uptime() * 1e9; nodeLoadTime = moduleLoadTime - upTime; } else if (Date.now) { module.exports = function() { return Date.now() - loadTime; }; loadTime = Date.now(); } else { module.exports = function() { return new Date().getTime() - loadTime; }; loadTime = new Date().getTime(); } }).call(this); //# sourceMappingURL=performance-now.js.map /***/ }), /***/ 744: /***/ (function(module) { module.exports = {"$id":"page.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","optional":true,"required":["startedDateTime","id","title","pageTimings"],"properties":{"startedDateTime":{"type":"string","format":"date-time","pattern":"^(\\d{4})(-)?(\\d\\d)(-)?(\\d\\d)(T)?(\\d\\d)(:)?(\\d\\d)(:)?(\\d\\d)(\\.\\d+)?(Z|([+-])(\\d\\d)(:)?(\\d\\d))"},"id":{"type":"string","unique":true},"title":{"type":"string"},"pageTimings":{"$ref":"pageTimings.json#"},"comment":{"type":"string"}}}; /***/ }), /***/ 747: /***/ (function(module) { module.exports = require("fs"); /***/ }), /***/ 750: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; /*eslint no-var:0, prefer-arrow-callback: 0, object-shorthand: 0 */ var Punycode = __webpack_require__(213); var internals = {}; // // Read rules from file. // internals.rules = __webpack_require__(50).map(function (rule) { return { rule: rule, suffix: rule.replace(/^(\*\.|\!)/, ''), punySuffix: -1, wildcard: rule.charAt(0) === '*', exception: rule.charAt(0) === '!' }; }); // // Check is given string ends with `suffix`. // internals.endsWith = function (str, suffix) { return str.indexOf(suffix, str.length - suffix.length) !== -1; }; // // Find rule for a given domain. // internals.findRule = function (domain) { var punyDomain = Punycode.toASCII(domain); return internals.rules.reduce(function (memo, rule) { if (rule.punySuffix === -1){ rule.punySuffix = Punycode.toASCII(rule.suffix); } if (!internals.endsWith(punyDomain, '.' + rule.punySuffix) && punyDomain !== rule.punySuffix) { return memo; } // This has been commented out as it never seems to run. This is because // sub tlds always appear after their parents and we never find a shorter // match. //if (memo) { // var memoSuffix = Punycode.toASCII(memo.suffix); // if (memoSuffix.length >= punySuffix.length) { // return memo; // } //} return rule; }, null); }; // // Error codes and messages. // exports.errorCodes = { DOMAIN_TOO_SHORT: 'Domain name too short.', DOMAIN_TOO_LONG: 'Domain name too long. It should be no more than 255 chars.', LABEL_STARTS_WITH_DASH: 'Domain name label can not start with a dash.', LABEL_ENDS_WITH_DASH: 'Domain name label can not end with a dash.', LABEL_TOO_LONG: 'Domain name label should be at most 63 chars long.', LABEL_TOO_SHORT: 'Domain name label should be at least 1 character long.', LABEL_INVALID_CHARS: 'Domain name label can only contain alphanumeric characters or dashes.' }; // // Validate domain name and throw if not valid. // // From wikipedia: // // Hostnames are composed of series of labels concatenated with dots, as are all // domain names. Each label must be between 1 and 63 characters long, and the // entire hostname (including the delimiting dots) has a maximum of 255 chars. // // Allowed chars: // // * `a-z` // * `0-9` // * `-` but not as a starting or ending character // * `.` as a separator for the textual portions of a domain name // // * http://en.wikipedia.org/wiki/Domain_name // * http://en.wikipedia.org/wiki/Hostname // internals.validate = function (input) { // Before we can validate we need to take care of IDNs with unicode chars. var ascii = Punycode.toASCII(input); if (ascii.length < 1) { return 'DOMAIN_TOO_SHORT'; } if (ascii.length > 255) { return 'DOMAIN_TOO_LONG'; } // Check each part's length and allowed chars. var labels = ascii.split('.'); var label; for (var i = 0; i < labels.length; ++i) { label = labels[i]; if (!label.length) { return 'LABEL_TOO_SHORT'; } if (label.length > 63) { return 'LABEL_TOO_LONG'; } if (label.charAt(0) === '-') { return 'LABEL_STARTS_WITH_DASH'; } if (label.charAt(label.length - 1) === '-') { return 'LABEL_ENDS_WITH_DASH'; } if (!/^[a-z0-9\-]+$/.test(label)) { return 'LABEL_INVALID_CHARS'; } } }; // // Public API // // // Parse domain. // exports.parse = function (input) { if (typeof input !== 'string') { throw new TypeError('Domain name must be a string.'); } // Force domain to lowercase. var domain = input.slice(0).toLowerCase(); // Handle FQDN. // TODO: Simply remove trailing dot? if (domain.charAt(domain.length - 1) === '.') { domain = domain.slice(0, domain.length - 1); } // Validate and sanitise input. var error = internals.validate(domain); if (error) { return { input: input, error: { message: exports.errorCodes[error], code: error } }; } var parsed = { input: input, tld: null, sld: null, domain: null, subdomain: null, listed: false }; var domainParts = domain.split('.'); // Non-Internet TLD if (domainParts[domainParts.length - 1] === 'local') { return parsed; } var handlePunycode = function () { if (!/xn--/.test(domain)) { return parsed; } if (parsed.domain) { parsed.domain = Punycode.toASCII(parsed.domain); } if (parsed.subdomain) { parsed.subdomain = Punycode.toASCII(parsed.subdomain); } return parsed; }; var rule = internals.findRule(domain); // Unlisted tld. if (!rule) { if (domainParts.length < 2) { return parsed; } parsed.tld = domainParts.pop(); parsed.sld = domainParts.pop(); parsed.domain = [parsed.sld, parsed.tld].join('.'); if (domainParts.length) { parsed.subdomain = domainParts.pop(); } return handlePunycode(); } // At this point we know the public suffix is listed. parsed.listed = true; var tldParts = rule.suffix.split('.'); var privateParts = domainParts.slice(0, domainParts.length - tldParts.length); if (rule.exception) { privateParts.push(tldParts.shift()); } parsed.tld = tldParts.join('.'); if (!privateParts.length) { return handlePunycode(); } if (rule.wildcard) { tldParts.unshift(privateParts.pop()); parsed.tld = tldParts.join('.'); } if (!privateParts.length) { return handlePunycode(); } parsed.sld = privateParts.pop(); parsed.domain = [parsed.sld, parsed.tld].join('.'); if (privateParts.length) { parsed.subdomain = privateParts.join('.'); } return handlePunycode(); }; // // Get domain. // exports.get = function (domain) { if (!domain) { return null; } return exports.parse(domain).domain || null; }; // // Check whether domain belongs to a known public suffix. // exports.isValid = function (domain) { var parsed = exports.parse(domain); return Boolean(parsed.domain && parsed.listed); }; /***/ }), /***/ 751: /***/ (function(module, __unusedexports, __webpack_require__) { var defer = __webpack_require__(500); // API module.exports = async; /** * Runs provided callback asynchronously * even if callback itself is not * * @param {function} callback - callback to invoke * @returns {function} - augmented callback */ function async(callback) { var isAsync = false; // check if async happened defer(function() { isAsync = true; }); return function async_callback(err, result) { if (isAsync) { callback(err, result); } else { defer(function nextTick_callback() { callback(err, result); }); } }; } /***/ }), /***/ 752: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2016 Joyent, Inc. module.exports = Certificate; var assert = __webpack_require__(477); var Buffer = __webpack_require__(215).Buffer; var algs = __webpack_require__(98); var crypto = __webpack_require__(417); var Fingerprint = __webpack_require__(400); var Signature = __webpack_require__(575); var errs = __webpack_require__(753); var util = __webpack_require__(669); var utils = __webpack_require__(270); var Key = __webpack_require__(852); var PrivateKey = __webpack_require__(502); var Identity = __webpack_require__(378); var formats = {}; formats['openssh'] = __webpack_require__(893); formats['x509'] = __webpack_require__(866); formats['pem'] = __webpack_require__(680); var CertificateParseError = errs.CertificateParseError; var InvalidAlgorithmError = errs.InvalidAlgorithmError; function Certificate(opts) { assert.object(opts, 'options'); assert.arrayOfObject(opts.subjects, 'options.subjects'); utils.assertCompatible(opts.subjects[0], Identity, [1, 0], 'options.subjects'); utils.assertCompatible(opts.subjectKey, Key, [1, 0], 'options.subjectKey'); utils.assertCompatible(opts.issuer, Identity, [1, 0], 'options.issuer'); if (opts.issuerKey !== undefined) { utils.assertCompatible(opts.issuerKey, Key, [1, 0], 'options.issuerKey'); } assert.object(opts.signatures, 'options.signatures'); assert.buffer(opts.serial, 'options.serial'); assert.date(opts.validFrom, 'options.validFrom'); assert.date(opts.validUntil, 'optons.validUntil'); assert.optionalArrayOfString(opts.purposes, 'options.purposes'); this._hashCache = {}; this.subjects = opts.subjects; this.issuer = opts.issuer; this.subjectKey = opts.subjectKey; this.issuerKey = opts.issuerKey; this.signatures = opts.signatures; this.serial = opts.serial; this.validFrom = opts.validFrom; this.validUntil = opts.validUntil; this.purposes = opts.purposes; } Certificate.formats = formats; Certificate.prototype.toBuffer = function (format, options) { if (format === undefined) format = 'x509'; assert.string(format, 'format'); assert.object(formats[format], 'formats[format]'); assert.optionalObject(options, 'options'); return (formats[format].write(this, options)); }; Certificate.prototype.toString = function (format, options) { if (format === undefined) format = 'pem'; return (this.toBuffer(format, options).toString()); }; Certificate.prototype.fingerprint = function (algo) { if (algo === undefined) algo = 'sha256'; assert.string(algo, 'algorithm'); var opts = { type: 'certificate', hash: this.hash(algo), algorithm: algo }; return (new Fingerprint(opts)); }; Certificate.prototype.hash = function (algo) { assert.string(algo, 'algorithm'); algo = algo.toLowerCase(); if (algs.hashAlgs[algo] === undefined) throw (new InvalidAlgorithmError(algo)); if (this._hashCache[algo]) return (this._hashCache[algo]); var hash = crypto.createHash(algo). update(this.toBuffer('x509')).digest(); this._hashCache[algo] = hash; return (hash); }; Certificate.prototype.isExpired = function (when) { if (when === undefined) when = new Date(); return (!((when.getTime() >= this.validFrom.getTime()) && (when.getTime() < this.validUntil.getTime()))); }; Certificate.prototype.isSignedBy = function (issuerCert) { utils.assertCompatible(issuerCert, Certificate, [1, 0], 'issuer'); if (!this.issuer.equals(issuerCert.subjects[0])) return (false); if (this.issuer.purposes && this.issuer.purposes.length > 0 && this.issuer.purposes.indexOf('ca') === -1) { return (false); } return (this.isSignedByKey(issuerCert.subjectKey)); }; Certificate.prototype.getExtension = function (keyOrOid) { assert.string(keyOrOid, 'keyOrOid'); var ext = this.getExtensions().filter(function (maybeExt) { if (maybeExt.format === 'x509') return (maybeExt.oid === keyOrOid); if (maybeExt.format === 'openssh') return (maybeExt.name === keyOrOid); return (false); })[0]; return (ext); }; Certificate.prototype.getExtensions = function () { var exts = []; var x509 = this.signatures.x509; if (x509 && x509.extras && x509.extras.exts) { x509.extras.exts.forEach(function (ext) { ext.format = 'x509'; exts.push(ext); }); } var openssh = this.signatures.openssh; if (openssh && openssh.exts) { openssh.exts.forEach(function (ext) { ext.format = 'openssh'; exts.push(ext); }); } return (exts); }; Certificate.prototype.isSignedByKey = function (issuerKey) { utils.assertCompatible(issuerKey, Key, [1, 2], 'issuerKey'); if (this.issuerKey !== undefined) { return (this.issuerKey. fingerprint('sha512').matches(issuerKey)); } var fmt = Object.keys(this.signatures)[0]; var valid = formats[fmt].verify(this, issuerKey); if (valid) this.issuerKey = issuerKey; return (valid); }; Certificate.prototype.signWith = function (key) { utils.assertCompatible(key, PrivateKey, [1, 2], 'key'); var fmts = Object.keys(formats); var didOne = false; for (var i = 0; i < fmts.length; ++i) { if (fmts[i] !== 'pem') { var ret = formats[fmts[i]].sign(this, key); if (ret === true) didOne = true; } } if (!didOne) { throw (new Error('Failed to sign the certificate for any ' + 'available certificate formats')); } }; Certificate.createSelfSigned = function (subjectOrSubjects, key, options) { var subjects; if (Array.isArray(subjectOrSubjects)) subjects = subjectOrSubjects; else subjects = [subjectOrSubjects]; assert.arrayOfObject(subjects); subjects.forEach(function (subject) { utils.assertCompatible(subject, Identity, [1, 0], 'subject'); }); utils.assertCompatible(key, PrivateKey, [1, 2], 'private key'); assert.optionalObject(options, 'options'); if (options === undefined) options = {}; assert.optionalObject(options.validFrom, 'options.validFrom'); assert.optionalObject(options.validUntil, 'options.validUntil'); var validFrom = options.validFrom; var validUntil = options.validUntil; if (validFrom === undefined) validFrom = new Date(); if (validUntil === undefined) { assert.optionalNumber(options.lifetime, 'options.lifetime'); var lifetime = options.lifetime; if (lifetime === undefined) lifetime = 10*365*24*3600; validUntil = new Date(); validUntil.setTime(validUntil.getTime() + lifetime*1000); } assert.optionalBuffer(options.serial, 'options.serial'); var serial = options.serial; if (serial === undefined) serial = Buffer.from('0000000000000001', 'hex'); var purposes = options.purposes; if (purposes === undefined) purposes = []; if (purposes.indexOf('signature') === -1) purposes.push('signature'); /* Self-signed certs are always CAs. */ if (purposes.indexOf('ca') === -1) purposes.push('ca'); if (purposes.indexOf('crl') === -1) purposes.push('crl'); /* * If we weren't explicitly given any other purposes, do the sensible * thing and add some basic ones depending on the subject type. */ if (purposes.length <= 3) { var hostSubjects = subjects.filter(function (subject) { return (subject.type === 'host'); }); var userSubjects = subjects.filter(function (subject) { return (subject.type === 'user'); }); if (hostSubjects.length > 0) { if (purposes.indexOf('serverAuth') === -1) purposes.push('serverAuth'); } if (userSubjects.length > 0) { if (purposes.indexOf('clientAuth') === -1) purposes.push('clientAuth'); } if (userSubjects.length > 0 || hostSubjects.length > 0) { if (purposes.indexOf('keyAgreement') === -1) purposes.push('keyAgreement'); if (key.type === 'rsa' && purposes.indexOf('encryption') === -1) purposes.push('encryption'); } } var cert = new Certificate({ subjects: subjects, issuer: subjects[0], subjectKey: key.toPublic(), issuerKey: key.toPublic(), signatures: {}, serial: serial, validFrom: validFrom, validUntil: validUntil, purposes: purposes }); cert.signWith(key); return (cert); }; Certificate.create = function (subjectOrSubjects, key, issuer, issuerKey, options) { var subjects; if (Array.isArray(subjectOrSubjects)) subjects = subjectOrSubjects; else subjects = [subjectOrSubjects]; assert.arrayOfObject(subjects); subjects.forEach(function (subject) { utils.assertCompatible(subject, Identity, [1, 0], 'subject'); }); utils.assertCompatible(key, Key, [1, 0], 'key'); if (PrivateKey.isPrivateKey(key)) key = key.toPublic(); utils.assertCompatible(issuer, Identity, [1, 0], 'issuer'); utils.assertCompatible(issuerKey, PrivateKey, [1, 2], 'issuer key'); assert.optionalObject(options, 'options'); if (options === undefined) options = {}; assert.optionalObject(options.validFrom, 'options.validFrom'); assert.optionalObject(options.validUntil, 'options.validUntil'); var validFrom = options.validFrom; var validUntil = options.validUntil; if (validFrom === undefined) validFrom = new Date(); if (validUntil === undefined) { assert.optionalNumber(options.lifetime, 'options.lifetime'); var lifetime = options.lifetime; if (lifetime === undefined) lifetime = 10*365*24*3600; validUntil = new Date(); validUntil.setTime(validUntil.getTime() + lifetime*1000); } assert.optionalBuffer(options.serial, 'options.serial'); var serial = options.serial; if (serial === undefined) serial = Buffer.from('0000000000000001', 'hex'); var purposes = options.purposes; if (purposes === undefined) purposes = []; if (purposes.indexOf('signature') === -1) purposes.push('signature'); if (options.ca === true) { if (purposes.indexOf('ca') === -1) purposes.push('ca'); if (purposes.indexOf('crl') === -1) purposes.push('crl'); } var hostSubjects = subjects.filter(function (subject) { return (subject.type === 'host'); }); var userSubjects = subjects.filter(function (subject) { return (subject.type === 'user'); }); if (hostSubjects.length > 0) { if (purposes.indexOf('serverAuth') === -1) purposes.push('serverAuth'); } if (userSubjects.length > 0) { if (purposes.indexOf('clientAuth') === -1) purposes.push('clientAuth'); } if (userSubjects.length > 0 || hostSubjects.length > 0) { if (purposes.indexOf('keyAgreement') === -1) purposes.push('keyAgreement'); if (key.type === 'rsa' && purposes.indexOf('encryption') === -1) purposes.push('encryption'); } var cert = new Certificate({ subjects: subjects, issuer: issuer, subjectKey: key, issuerKey: issuerKey.toPublic(), signatures: {}, serial: serial, validFrom: validFrom, validUntil: validUntil, purposes: purposes }); cert.signWith(issuerKey); return (cert); }; Certificate.parse = function (data, format, options) { if (typeof (data) !== 'string') assert.buffer(data, 'data'); if (format === undefined) format = 'auto'; assert.string(format, 'format'); if (typeof (options) === 'string') options = { filename: options }; assert.optionalObject(options, 'options'); if (options === undefined) options = {}; assert.optionalString(options.filename, 'options.filename'); if (options.filename === undefined) options.filename = '(unnamed)'; assert.object(formats[format], 'formats[format]'); try { var k = formats[format].read(data, options); return (k); } catch (e) { throw (new CertificateParseError(options.filename, format, e)); } }; Certificate.isCertificate = function (obj, ver) { return (utils.isCompatible(obj, Certificate, ver)); }; /* * API versions for Certificate: * [1,0] -- initial ver * [1,1] -- openssh format now unpacks extensions */ Certificate.prototype._sshpkApiVersion = [1, 1]; Certificate._oldVersionDetect = function (obj) { return ([1, 0]); }; /***/ }), /***/ 753: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2015 Joyent, Inc. var assert = __webpack_require__(477); var util = __webpack_require__(669); function FingerprintFormatError(fp, format) { if (Error.captureStackTrace) Error.captureStackTrace(this, FingerprintFormatError); this.name = 'FingerprintFormatError'; this.fingerprint = fp; this.format = format; this.message = 'Fingerprint format is not supported, or is invalid: '; if (fp !== undefined) this.message += ' fingerprint = ' + fp; if (format !== undefined) this.message += ' format = ' + format; } util.inherits(FingerprintFormatError, Error); function InvalidAlgorithmError(alg) { if (Error.captureStackTrace) Error.captureStackTrace(this, InvalidAlgorithmError); this.name = 'InvalidAlgorithmError'; this.algorithm = alg; this.message = 'Algorithm "' + alg + '" is not supported'; } util.inherits(InvalidAlgorithmError, Error); function KeyParseError(name, format, innerErr) { if (Error.captureStackTrace) Error.captureStackTrace(this, KeyParseError); this.name = 'KeyParseError'; this.format = format; this.keyName = name; this.innerErr = innerErr; this.message = 'Failed to parse ' + name + ' as a valid ' + format + ' format key: ' + innerErr.message; } util.inherits(KeyParseError, Error); function SignatureParseError(type, format, innerErr) { if (Error.captureStackTrace) Error.captureStackTrace(this, SignatureParseError); this.name = 'SignatureParseError'; this.type = type; this.format = format; this.innerErr = innerErr; this.message = 'Failed to parse the given data as a ' + type + ' signature in ' + format + ' format: ' + innerErr.message; } util.inherits(SignatureParseError, Error); function CertificateParseError(name, format, innerErr) { if (Error.captureStackTrace) Error.captureStackTrace(this, CertificateParseError); this.name = 'CertificateParseError'; this.format = format; this.certName = name; this.innerErr = innerErr; this.message = 'Failed to parse ' + name + ' as a valid ' + format + ' format certificate: ' + innerErr.message; } util.inherits(CertificateParseError, Error); function KeyEncryptedError(name, format) { if (Error.captureStackTrace) Error.captureStackTrace(this, KeyEncryptedError); this.name = 'KeyEncryptedError'; this.format = format; this.keyName = name; this.message = 'The ' + format + ' format key ' + name + ' is ' + 'encrypted (password-protected), and no passphrase was ' + 'provided in `options`'; } util.inherits(KeyEncryptedError, Error); module.exports = { FingerprintFormatError: FingerprintFormatError, InvalidAlgorithmError: InvalidAlgorithmError, KeyParseError: KeyParseError, SignatureParseError: SignatureParseError, KeyEncryptedError: KeyEncryptedError, CertificateParseError: CertificateParseError }; /***/ }), /***/ 755: /***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; var utils = __webpack_require__(581); var has = Object.prototype.hasOwnProperty; var defaults = { allowDots: false, allowPrototypes: false, arrayLimit: 20, decoder: utils.decode, delimiter: '&', depth: 5, parameterLimit: 1000, plainObjects: false, strictNullHandling: false }; var parseValues = function parseQueryStringValues(str, options) { var obj = {}; var cleanStr = options.ignoreQueryPrefix ? str.replace(/^\?/, '') : str; var limit = options.parameterLimit === Infinity ? undefined : options.parameterLimit; var parts = cleanStr.split(options.delimiter, limit); for (var i = 0; i < parts.length; ++i) { var part = parts[i]; var bracketEqualsPos = part.indexOf(']='); var pos = bracketEqualsPos === -1 ? part.indexOf('=') : bracketEqualsPos + 1; var key, val; if (pos === -1) { key = options.decoder(part, defaults.decoder); val = options.strictNullHandling ? null : ''; } else { key = options.decoder(part.slice(0, pos), defaults.decoder); val = options.decoder(part.slice(pos + 1), defaults.decoder); } if (has.call(obj, key)) { obj[key] = [].concat(obj[key]).concat(val); } else { obj[key] = val; } } return obj; }; var parseObject = function (chain, val, options) { var leaf = val; for (var i = chain.length - 1; i >= 0; --i) { var obj; var root = chain[i]; if (root === '[]') { obj = []; obj = obj.concat(leaf); } else { obj = options.plainObjects ? Object.create(null) : {}; var cleanRoot = root.charAt(0) === '[' && root.charAt(root.length - 1) === ']' ? root.slice(1, -1) : root; var index = parseInt(cleanRoot, 10); if ( !isNaN(index) && root !== cleanRoot && String(index) === cleanRoot && index >= 0 && (options.parseArrays && index <= options.arrayLimit) ) { obj = []; obj[index] = leaf; } else { obj[cleanRoot] = leaf; } } leaf = obj; } return leaf; }; var parseKeys = function parseQueryStringKeys(givenKey, val, options) { if (!givenKey) { return; } // Transform dot notation to bracket notation var key = options.allowDots ? givenKey.replace(/\.([^.[]+)/g, '[$1]') : givenKey; // The regex chunks var brackets = /(\[[^[\]]*])/; var child = /(\[[^[\]]*])/g; // Get the parent var segment = brackets.exec(key); var parent = segment ? key.slice(0, segment.index) : key; // Stash the parent if it exists var keys = []; if (parent) { // If we aren't using plain objects, optionally prefix keys // that would overwrite object prototype properties if (!options.plainObjects && has.call(Object.prototype, parent)) { if (!options.allowPrototypes) { return; } } keys.push(parent); } // Loop through children appending to the array until we hit depth var i = 0; while ((segment = child.exec(key)) !== null && i < options.depth) { i += 1; if (!options.plainObjects && has.call(Object.prototype, segment[1].slice(1, -1))) { if (!options.allowPrototypes) { return; } } keys.push(segment[1]); } // If there's a remainder, just add whatever is left if (segment) { keys.push('[' + key.slice(segment.index) + ']'); } return parseObject(keys, val, options); }; module.exports = function (str, opts) { var options = opts ? utils.assign({}, opts) : {}; if (options.decoder !== null && options.decoder !== undefined && typeof options.decoder !== 'function') { throw new TypeError('Decoder has to be a function.'); } options.ignoreQueryPrefix = options.ignoreQueryPrefix === true; options.delimiter = typeof options.delimiter === 'string' || utils.isRegExp(options.delimiter) ? options.delimiter : defaults.delimiter; options.depth = typeof options.depth === 'number' ? options.depth : defaults.depth; options.arrayLimit = typeof options.arrayLimit === 'number' ? options.arrayLimit : defaults.arrayLimit; options.parseArrays = options.parseArrays !== false; options.decoder = typeof options.decoder === 'function' ? options.decoder : defaults.decoder; options.allowDots = typeof options.allowDots === 'boolean' ? options.allowDots : defaults.allowDots; options.plainObjects = typeof options.plainObjects === 'boolean' ? options.plainObjects : defaults.plainObjects; options.allowPrototypes = typeof options.allowPrototypes === 'boolean' ? options.allowPrototypes : defaults.allowPrototypes; options.parameterLimit = typeof options.parameterLimit === 'number' ? options.parameterLimit : defaults.parameterLimit; options.strictNullHandling = typeof options.strictNullHandling === 'boolean' ? options.strictNullHandling : defaults.strictNullHandling; if (str === '' || str === null || typeof str === 'undefined') { return options.plainObjects ? Object.create(null) : {}; } var tempObj = typeof str === 'string' ? parseValues(str, options) : str; var obj = options.plainObjects ? Object.create(null) : {}; // Iterate over the keys and setup the new object var keys = Object.keys(tempObj); for (var i = 0; i < keys.length; ++i) { var key = keys[i]; var newObj = parseKeys(key, tempObj[key], options); obj = utils.merge(obj, newObj, options); } return utils.compact(obj); }; /***/ }), /***/ 758: /***/ (function(module) { module.exports = {"$id":"timings.json#","$schema":"http://json-schema.org/draft-06/schema#","required":["send","wait","receive"],"properties":{"dns":{"type":"number","min":-1},"connect":{"type":"number","min":-1},"blocked":{"type":"number","min":-1},"send":{"type":"number","min":-1},"wait":{"type":"number","min":-1},"receive":{"type":"number","min":-1},"ssl":{"type":"number","min":-1},"comment":{"type":"string"}}}; /***/ }), /***/ 761: /***/ (function(module) { module.exports = require("zlib"); /***/ }), /***/ 772: /***/ (function(module) { "use strict"; module.exports = function generate__limitLength(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $errorKeyword; var $data = 'data' + ($dataLvl || ''); var $isData = it.opts.$data && $schema && $schema.$data, $schemaValue; if ($isData) { out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; $schemaValue = 'schema' + $lvl; } else { $schemaValue = $schema; } var $op = $keyword == 'maxLength' ? '>' : '<'; out += 'if ( '; if ($isData) { out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; } if (it.opts.unicode === false) { out += ' ' + ($data) + '.length '; } else { out += ' ucs2length(' + ($data) + ') '; } out += ' ' + ($op) + ' ' + ($schemaValue) + ') { '; var $errorKeyword = $keyword; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ($errorKeyword || '_limitLength') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schemaValue) + ' } '; if (it.opts.messages !== false) { out += ' , message: \'should NOT be '; if ($keyword == 'maxLength') { out += 'longer'; } else { out += 'shorter'; } out += ' than '; if ($isData) { out += '\' + ' + ($schemaValue) + ' + \''; } else { out += '' + ($schema); } out += ' characters\' '; } if (it.opts.verbose) { out += ' , schema: '; if ($isData) { out += 'validate.schema' + ($schemaPath); } else { out += '' + ($schema); } out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } out += '} '; if ($breakOnError) { out += ' else { '; } return out; } /***/ }), /***/ 776: /***/ (function(module) { module.exports = {"$id":"creator.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["name","version"],"properties":{"name":{"type":"string"},"version":{"type":"string"},"comment":{"type":"string"}}}; /***/ }), /***/ 779: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; /*! * mime-types * Copyright(c) 2014 Jonathan Ong * Copyright(c) 2015 Douglas Christopher Wilson * MIT Licensed */ /** * Module dependencies. * @private */ var db = __webpack_require__(972) var extname = __webpack_require__(622).extname /** * Module variables. * @private */ var EXTRACT_TYPE_REGEXP = /^\s*([^;\s]*)(?:;|\s|$)/ var TEXT_TYPE_REGEXP = /^text\//i /** * Module exports. * @public */ exports.charset = charset exports.charsets = { lookup: charset } exports.contentType = contentType exports.extension = extension exports.extensions = Object.create(null) exports.lookup = lookup exports.types = Object.create(null) // Populate the extensions/types maps populateMaps(exports.extensions, exports.types) /** * Get the default charset for a MIME type. * * @param {string} type * @return {boolean|string} */ function charset (type) { if (!type || typeof type !== 'string') { return false } // TODO: use media-typer var match = EXTRACT_TYPE_REGEXP.exec(type) var mime = match && db[match[1].toLowerCase()] if (mime && mime.charset) { return mime.charset } // default text/* to utf-8 if (match && TEXT_TYPE_REGEXP.test(match[1])) { return 'UTF-8' } return false } /** * Create a full Content-Type header given a MIME type or extension. * * @param {string} str * @return {boolean|string} */ function contentType (str) { // TODO: should this even be in this module? if (!str || typeof str !== 'string') { return false } var mime = str.indexOf('/') === -1 ? exports.lookup(str) : str if (!mime) { return false } // TODO: use content-type or other module if (mime.indexOf('charset') === -1) { var charset = exports.charset(mime) if (charset) mime += '; charset=' + charset.toLowerCase() } return mime } /** * Get the default extension for a MIME type. * * @param {string} type * @return {boolean|string} */ function extension (type) { if (!type || typeof type !== 'string') { return false } // TODO: use media-typer var match = EXTRACT_TYPE_REGEXP.exec(type) // get extensions var exts = match && exports.extensions[match[1].toLowerCase()] if (!exts || !exts.length) { return false } return exts[0] } /** * Lookup the MIME type for a file path/extension. * * @param {string} path * @return {boolean|string} */ function lookup (path) { if (!path || typeof path !== 'string') { return false } // get the extension ("ext" or ".ext" or full path) var extension = extname('x.' + path) .toLowerCase() .substr(1) if (!extension) { return false } return exports.types[extension] || false } /** * Populate the extensions and types maps. * @private */ function populateMaps (extensions, types) { // source preference (least -> most) var preference = ['nginx', 'apache', undefined, 'iana'] Object.keys(db).forEach(function forEachMimeType (type) { var mime = db[type] var exts = mime.extensions if (!exts || !exts.length) { return } // mime -> extensions extensions[type] = exts // extension -> mime for (var i = 0; i < exts.length; i++) { var extension = exts[i] if (types[extension]) { var from = preference.indexOf(db[types[extension]].source) var to = preference.indexOf(mime.source) if (types[extension] !== 'application/octet-stream' && (from > to || (from === to && types[extension].substr(0, 12) === 'application/'))) { // skip the remapping continue } } // set the extension -> mime types[extension] = type } }) } /***/ }), /***/ 789: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2015 Joyent, Inc. var parser = __webpack_require__(342); var signer = __webpack_require__(64); var verify = __webpack_require__(428); var utils = __webpack_require__(909); ///--- API module.exports = { parse: parser.parseRequest, parseRequest: parser.parseRequest, sign: signer.signRequest, signRequest: signer.signRequest, createSigner: signer.createSigner, isSigner: signer.isSigner, sshKeyToPEM: utils.sshKeyToPEM, sshKeyFingerprint: utils.fingerprint, pemToRsaSSHKey: utils.pemToRsaSSHKey, verify: verify.verifySignature, verifySignature: verify.verifySignature, verifyHMAC: verify.verifyHMAC }; /***/ }), /***/ 792: /***/ (function(module, __unusedexports, __webpack_require__) { module.exports = ForeverAgent ForeverAgent.SSL = ForeverAgentSSL var util = __webpack_require__(669) , Agent = __webpack_require__(605).Agent , net = __webpack_require__(631) , tls = __webpack_require__(16) , AgentSSL = __webpack_require__(211).Agent function getConnectionName(host, port) { var name = '' if (typeof host === 'string') { name = host + ':' + port } else { // For node.js v012.0 and iojs-v1.5.1, host is an object. And any existing localAddress is part of the connection name. name = host.host + ':' + host.port + ':' + (host.localAddress ? (host.localAddress + ':') : ':') } return name } function ForeverAgent(options) { var self = this self.options = options || {} self.requests = {} self.sockets = {} self.freeSockets = {} self.maxSockets = self.options.maxSockets || Agent.defaultMaxSockets self.minSockets = self.options.minSockets || ForeverAgent.defaultMinSockets self.on('free', function(socket, host, port) { var name = getConnectionName(host, port) if (self.requests[name] && self.requests[name].length) { self.requests[name].shift().onSocket(socket) } else if (self.sockets[name].length < self.minSockets) { if (!self.freeSockets[name]) self.freeSockets[name] = [] self.freeSockets[name].push(socket) // if an error happens while we don't use the socket anyway, meh, throw the socket away var onIdleError = function() { socket.destroy() } socket._onIdleError = onIdleError socket.on('error', onIdleError) } else { // If there are no pending requests just destroy the // socket and it will get removed from the pool. This // gets us out of timeout issues and allows us to // default to Connection:keep-alive. socket.destroy() } }) } util.inherits(ForeverAgent, Agent) ForeverAgent.defaultMinSockets = 5 ForeverAgent.prototype.createConnection = net.createConnection ForeverAgent.prototype.addRequestNoreuse = Agent.prototype.addRequest ForeverAgent.prototype.addRequest = function(req, host, port) { var name = getConnectionName(host, port) if (typeof host !== 'string') { var options = host port = options.port host = options.host } if (this.freeSockets[name] && this.freeSockets[name].length > 0 && !req.useChunkedEncodingByDefault) { var idleSocket = this.freeSockets[name].pop() idleSocket.removeListener('error', idleSocket._onIdleError) delete idleSocket._onIdleError req._reusedSocket = true req.onSocket(idleSocket) } else { this.addRequestNoreuse(req, host, port) } } ForeverAgent.prototype.removeSocket = function(s, name, host, port) { if (this.sockets[name]) { var index = this.sockets[name].indexOf(s) if (index !== -1) { this.sockets[name].splice(index, 1) } } else if (this.sockets[name] && this.sockets[name].length === 0) { // don't leak delete this.sockets[name] delete this.requests[name] } if (this.freeSockets[name]) { var index = this.freeSockets[name].indexOf(s) if (index !== -1) { this.freeSockets[name].splice(index, 1) if (this.freeSockets[name].length === 0) { delete this.freeSockets[name] } } } if (this.requests[name] && this.requests[name].length) { // If we have pending requests and a socket gets closed a new one // needs to be created to take over in the pool for the one that closed. this.createSocket(name, host, port).emit('free') } } function ForeverAgentSSL (options) { ForeverAgent.call(this, options) } util.inherits(ForeverAgentSSL, ForeverAgent) ForeverAgentSSL.prototype.createConnection = createConnectionSSL ForeverAgentSSL.prototype.addRequestNoreuse = AgentSSL.prototype.addRequest function createConnectionSSL (port, host, options) { if (typeof port === 'object') { options = port; } else if (typeof host === 'object') { options = host; } else if (typeof options === 'object') { options = options; } else { options = {}; } if (typeof port === 'number') { options.port = port; } if (typeof host === 'string') { options.host = host; } return tls.connect(options); } /***/ }), /***/ 805: /***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; var resolve = __webpack_require__(867) , util = __webpack_require__(855) , errorClasses = __webpack_require__(844) , stableStringify = __webpack_require__(741); var validateGenerator = __webpack_require__(967); /** * Functions below are used inside compiled validations function */ var ucs2length = util.ucs2length; var equal = __webpack_require__(832); // this error is thrown by async schemas to return validation errors via exception var ValidationError = errorClasses.Validation; module.exports = compile; /** * Compiles schema to validation function * @this Ajv * @param {Object} schema schema object * @param {Object} root object with information about the root schema for this schema * @param {Object} localRefs the hash of local references inside the schema (created by resolve.id), used for inline resolution * @param {String} baseId base ID for IDs in the schema * @return {Function} validation function */ function compile(schema, root, localRefs, baseId) { /* jshint validthis: true, evil: true */ /* eslint no-shadow: 0 */ var self = this , opts = this._opts , refVal = [ undefined ] , refs = {} , patterns = [] , patternsHash = {} , defaults = [] , defaultsHash = {} , customRules = []; root = root || { schema: schema, refVal: refVal, refs: refs }; var c = checkCompiling.call(this, schema, root, baseId); var compilation = this._compilations[c.index]; if (c.compiling) return (compilation.callValidate = callValidate); var formats = this._formats; var RULES = this.RULES; try { var v = localCompile(schema, root, localRefs, baseId); compilation.validate = v; var cv = compilation.callValidate; if (cv) { cv.schema = v.schema; cv.errors = null; cv.refs = v.refs; cv.refVal = v.refVal; cv.root = v.root; cv.$async = v.$async; if (opts.sourceCode) cv.source = v.source; } return v; } finally { endCompiling.call(this, schema, root, baseId); } /* @this {*} - custom context, see passContext option */ function callValidate() { /* jshint validthis: true */ var validate = compilation.validate; var result = validate.apply(this, arguments); callValidate.errors = validate.errors; return result; } function localCompile(_schema, _root, localRefs, baseId) { var isRoot = !_root || (_root && _root.schema == _schema); if (_root.schema != root.schema) return compile.call(self, _schema, _root, localRefs, baseId); var $async = _schema.$async === true; var sourceCode = validateGenerator({ isTop: true, schema: _schema, isRoot: isRoot, baseId: baseId, root: _root, schemaPath: '', errSchemaPath: '#', errorPath: '""', MissingRefError: errorClasses.MissingRef, RULES: RULES, validate: validateGenerator, util: util, resolve: resolve, resolveRef: resolveRef, usePattern: usePattern, useDefault: useDefault, useCustomRule: useCustomRule, opts: opts, formats: formats, logger: self.logger, self: self }); sourceCode = vars(refVal, refValCode) + vars(patterns, patternCode) + vars(defaults, defaultCode) + vars(customRules, customRuleCode) + sourceCode; if (opts.processCode) sourceCode = opts.processCode(sourceCode); // console.log('\n\n\n *** \n', JSON.stringify(sourceCode)); var validate; try { var makeValidate = new Function( 'self', 'RULES', 'formats', 'root', 'refVal', 'defaults', 'customRules', 'equal', 'ucs2length', 'ValidationError', sourceCode ); validate = makeValidate( self, RULES, formats, root, refVal, defaults, customRules, equal, ucs2length, ValidationError ); refVal[0] = validate; } catch(e) { self.logger.error('Error compiling schema, function code:', sourceCode); throw e; } validate.schema = _schema; validate.errors = null; validate.refs = refs; validate.refVal = refVal; validate.root = isRoot ? validate : _root; if ($async) validate.$async = true; if (opts.sourceCode === true) { validate.source = { code: sourceCode, patterns: patterns, defaults: defaults }; } return validate; } function resolveRef(baseId, ref, isRoot) { ref = resolve.url(baseId, ref); var refIndex = refs[ref]; var _refVal, refCode; if (refIndex !== undefined) { _refVal = refVal[refIndex]; refCode = 'refVal[' + refIndex + ']'; return resolvedRef(_refVal, refCode); } if (!isRoot && root.refs) { var rootRefId = root.refs[ref]; if (rootRefId !== undefined) { _refVal = root.refVal[rootRefId]; refCode = addLocalRef(ref, _refVal); return resolvedRef(_refVal, refCode); } } refCode = addLocalRef(ref); var v = resolve.call(self, localCompile, root, ref); if (v === undefined) { var localSchema = localRefs && localRefs[ref]; if (localSchema) { v = resolve.inlineRef(localSchema, opts.inlineRefs) ? localSchema : compile.call(self, localSchema, root, localRefs, baseId); } } if (v === undefined) { removeLocalRef(ref); } else { replaceLocalRef(ref, v); return resolvedRef(v, refCode); } } function addLocalRef(ref, v) { var refId = refVal.length; refVal[refId] = v; refs[ref] = refId; return 'refVal' + refId; } function removeLocalRef(ref) { delete refs[ref]; } function replaceLocalRef(ref, v) { var refId = refs[ref]; refVal[refId] = v; } function resolvedRef(refVal, code) { return typeof refVal == 'object' || typeof refVal == 'boolean' ? { code: code, schema: refVal, inline: true } : { code: code, $async: refVal && !!refVal.$async }; } function usePattern(regexStr) { var index = patternsHash[regexStr]; if (index === undefined) { index = patternsHash[regexStr] = patterns.length; patterns[index] = regexStr; } return 'pattern' + index; } function useDefault(value) { switch (typeof value) { case 'boolean': case 'number': return '' + value; case 'string': return util.toQuotedString(value); case 'object': if (value === null) return 'null'; var valueStr = stableStringify(value); var index = defaultsHash[valueStr]; if (index === undefined) { index = defaultsHash[valueStr] = defaults.length; defaults[index] = value; } return 'default' + index; } } function useCustomRule(rule, schema, parentSchema, it) { if (self._opts.validateSchema !== false) { var deps = rule.definition.dependencies; if (deps && !deps.every(function(keyword) { return Object.prototype.hasOwnProperty.call(parentSchema, keyword); })) throw new Error('parent schema must have all required keywords: ' + deps.join(',')); var validateSchema = rule.definition.validateSchema; if (validateSchema) { var valid = validateSchema(schema); if (!valid) { var message = 'keyword schema is invalid: ' + self.errorsText(validateSchema.errors); if (self._opts.validateSchema == 'log') self.logger.error(message); else throw new Error(message); } } } var compile = rule.definition.compile , inline = rule.definition.inline , macro = rule.definition.macro; var validate; if (compile) { validate = compile.call(self, schema, parentSchema, it); } else if (macro) { validate = macro.call(self, schema, parentSchema, it); if (opts.validateSchema !== false) self.validateSchema(validate, true); } else if (inline) { validate = inline.call(self, it, rule.keyword, schema, parentSchema); } else { validate = rule.definition.validate; if (!validate) return; } if (validate === undefined) throw new Error('custom keyword "' + rule.keyword + '"failed to compile'); var index = customRules.length; customRules[index] = validate; return { code: 'customRule' + index, validate: validate }; } } /** * Checks if the schema is currently compiled * @this Ajv * @param {Object} schema schema to compile * @param {Object} root root object * @param {String} baseId base schema ID * @return {Object} object with properties "index" (compilation index) and "compiling" (boolean) */ function checkCompiling(schema, root, baseId) { /* jshint validthis: true */ var index = compIndex.call(this, schema, root, baseId); if (index >= 0) return { index: index, compiling: true }; index = this._compilations.length; this._compilations[index] = { schema: schema, root: root, baseId: baseId }; return { index: index, compiling: false }; } /** * Removes the schema from the currently compiled list * @this Ajv * @param {Object} schema schema to compile * @param {Object} root root object * @param {String} baseId base schema ID */ function endCompiling(schema, root, baseId) { /* jshint validthis: true */ var i = compIndex.call(this, schema, root, baseId); if (i >= 0) this._compilations.splice(i, 1); } /** * Index of schema compilation in the currently compiled list * @this Ajv * @param {Object} schema schema to compile * @param {Object} root root object * @param {String} baseId base schema ID * @return {Integer} compilation index */ function compIndex(schema, root, baseId) { /* jshint validthis: true */ for (var i=0; i 1024) hashAlgo = 'sha256'; if (this.type === 'ed25519') hashAlgo = 'sha512'; if (this.type === 'ecdsa') { if (this.size <= 256) hashAlgo = 'sha256'; else if (this.size <= 384) hashAlgo = 'sha384'; else hashAlgo = 'sha512'; } return (hashAlgo); }; Key.prototype.createVerify = function (hashAlgo) { if (hashAlgo === undefined) hashAlgo = this.defaultHashAlgorithm(); assert.string(hashAlgo, 'hash algorithm'); /* ED25519 is not supported by OpenSSL, use a javascript impl. */ if (this.type === 'ed25519' && edCompat !== undefined) return (new edCompat.Verifier(this, hashAlgo)); if (this.type === 'curve25519') throw (new Error('Curve25519 keys are not suitable for ' + 'signing or verification')); var v, nm, err; try { nm = hashAlgo.toUpperCase(); v = crypto.createVerify(nm); } catch (e) { err = e; } if (v === undefined || (err instanceof Error && err.message.match(/Unknown message digest/))) { nm = 'RSA-'; nm += hashAlgo.toUpperCase(); v = crypto.createVerify(nm); } assert.ok(v, 'failed to create verifier'); var oldVerify = v.verify.bind(v); var key = this.toBuffer('pkcs8'); var curve = this.curve; var self = this; v.verify = function (signature, fmt) { if (Signature.isSignature(signature, [2, 0])) { if (signature.type !== self.type) return (false); if (signature.hashAlgorithm && signature.hashAlgorithm !== hashAlgo) return (false); if (signature.curve && self.type === 'ecdsa' && signature.curve !== curve) return (false); return (oldVerify(key, signature.toBuffer('asn1'))); } else if (typeof (signature) === 'string' || Buffer.isBuffer(signature)) { return (oldVerify(key, signature, fmt)); /* * Avoid doing this on valid arguments, walking the prototype * chain can be quite slow. */ } else if (Signature.isSignature(signature, [1, 0])) { throw (new Error('signature was created by too old ' + 'a version of sshpk and cannot be verified')); } else { throw (new TypeError('signature must be a string, ' + 'Buffer, or Signature object')); } }; return (v); }; Key.prototype.createDiffieHellman = function () { if (this.type === 'rsa') throw (new Error('RSA keys do not support Diffie-Hellman')); return (new DiffieHellman(this)); }; Key.prototype.createDH = Key.prototype.createDiffieHellman; Key.parse = function (data, format, options) { if (typeof (data) !== 'string') assert.buffer(data, 'data'); if (format === undefined) format = 'auto'; assert.string(format, 'format'); if (typeof (options) === 'string') options = { filename: options }; assert.optionalObject(options, 'options'); if (options === undefined) options = {}; assert.optionalString(options.filename, 'options.filename'); if (options.filename === undefined) options.filename = '(unnamed)'; assert.object(formats[format], 'formats[format]'); try { var k = formats[format].read(data, options); if (k instanceof PrivateKey) k = k.toPublic(); if (!k.comment) k.comment = options.filename; return (k); } catch (e) { if (e.name === 'KeyEncryptedError') throw (e); throw (new KeyParseError(options.filename, format, e)); } }; Key.isKey = function (obj, ver) { return (utils.isCompatible(obj, Key, ver)); }; /* * API versions for Key: * [1,0] -- initial ver, may take Signature for createVerify or may not * [1,1] -- added pkcs1, pkcs8 formats * [1,2] -- added auto, ssh-private, openssh formats * [1,3] -- added defaultHashAlgorithm * [1,4] -- added ed support, createDH * [1,5] -- first explicitly tagged version * [1,6] -- changed ed25519 part names * [1,7] -- spki hash types */ Key.prototype._sshpkApiVersion = [1, 7]; Key._oldVersionDetect = function (obj) { assert.func(obj.toBuffer); assert.func(obj.fingerprint); if (obj.createDH) return ([1, 4]); if (obj.defaultHashAlgorithm) return ([1, 3]); if (obj.formats['auto']) return ([1, 2]); if (obj.formats['pkcs1']) return ([1, 1]); return ([1, 0]); }; /***/ }), /***/ 853: /***/ (function(__unusedmodule, exports) { /** @license URI.js v4.2.1 (c) 2011 Gary Court. License: http://github.com/garycourt/uri-js */ (function (global, factory) { true ? factory(exports) : undefined; }(this, (function (exports) { 'use strict'; function merge() { for (var _len = arguments.length, sets = Array(_len), _key = 0; _key < _len; _key++) { sets[_key] = arguments[_key]; } if (sets.length > 1) { sets[0] = sets[0].slice(0, -1); var xl = sets.length - 1; for (var x = 1; x < xl; ++x) { sets[x] = sets[x].slice(1, -1); } sets[xl] = sets[xl].slice(1); return sets.join(''); } else { return sets[0]; } } function subexp(str) { return "(?:" + str + ")"; } function typeOf(o) { return o === undefined ? "undefined" : o === null ? "null" : Object.prototype.toString.call(o).split(" ").pop().split("]").shift().toLowerCase(); } function toUpperCase(str) { return str.toUpperCase(); } function toArray(obj) { return obj !== undefined && obj !== null ? obj instanceof Array ? obj : typeof obj.length !== "number" || obj.split || obj.setInterval || obj.call ? [obj] : Array.prototype.slice.call(obj) : []; } function assign(target, source) { var obj = target; if (source) { for (var key in source) { obj[key] = source[key]; } } return obj; } function buildExps(isIRI) { var ALPHA$$ = "[A-Za-z]", CR$ = "[\\x0D]", DIGIT$$ = "[0-9]", DQUOTE$$ = "[\\x22]", HEXDIG$$ = merge(DIGIT$$, "[A-Fa-f]"), //case-insensitive LF$$ = "[\\x0A]", SP$$ = "[\\x20]", PCT_ENCODED$ = subexp(subexp("%[EFef]" + HEXDIG$$ + "%" + HEXDIG$$ + HEXDIG$$ + "%" + HEXDIG$$ + HEXDIG$$) + "|" + subexp("%[89A-Fa-f]" + HEXDIG$$ + "%" + HEXDIG$$ + HEXDIG$$) + "|" + subexp("%" + HEXDIG$$ + HEXDIG$$)), //expanded GEN_DELIMS$$ = "[\\:\\/\\?\\#\\[\\]\\@]", SUB_DELIMS$$ = "[\\!\\$\\&\\'\\(\\)\\*\\+\\,\\;\\=]", RESERVED$$ = merge(GEN_DELIMS$$, SUB_DELIMS$$), UCSCHAR$$ = isIRI ? "[\\xA0-\\u200D\\u2010-\\u2029\\u202F-\\uD7FF\\uF900-\\uFDCF\\uFDF0-\\uFFEF]" : "[]", //subset, excludes bidi control characters IPRIVATE$$ = isIRI ? "[\\uE000-\\uF8FF]" : "[]", //subset UNRESERVED$$ = merge(ALPHA$$, DIGIT$$, "[\\-\\.\\_\\~]", UCSCHAR$$), SCHEME$ = subexp(ALPHA$$ + merge(ALPHA$$, DIGIT$$, "[\\+\\-\\.]") + "*"), USERINFO$ = subexp(subexp(PCT_ENCODED$ + "|" + merge(UNRESERVED$$, SUB_DELIMS$$, "[\\:]")) + "*"), DEC_OCTET$ = subexp(subexp("25[0-5]") + "|" + subexp("2[0-4]" + DIGIT$$) + "|" + subexp("1" + DIGIT$$ + DIGIT$$) + "|" + subexp("[1-9]" + DIGIT$$) + "|" + DIGIT$$), DEC_OCTET_RELAXED$ = subexp(subexp("25[0-5]") + "|" + subexp("2[0-4]" + DIGIT$$) + "|" + subexp("1" + DIGIT$$ + DIGIT$$) + "|" + subexp("0?[1-9]" + DIGIT$$) + "|0?0?" + DIGIT$$), //relaxed parsing rules IPV4ADDRESS$ = subexp(DEC_OCTET_RELAXED$ + "\\." + DEC_OCTET_RELAXED$ + "\\." + DEC_OCTET_RELAXED$ + "\\." + DEC_OCTET_RELAXED$), H16$ = subexp(HEXDIG$$ + "{1,4}"), LS32$ = subexp(subexp(H16$ + "\\:" + H16$) + "|" + IPV4ADDRESS$), IPV6ADDRESS1$ = subexp(subexp(H16$ + "\\:") + "{6}" + LS32$), // 6( h16 ":" ) ls32 IPV6ADDRESS2$ = subexp("\\:\\:" + subexp(H16$ + "\\:") + "{5}" + LS32$), // "::" 5( h16 ":" ) ls32 IPV6ADDRESS3$ = subexp(subexp(H16$) + "?\\:\\:" + subexp(H16$ + "\\:") + "{4}" + LS32$), //[ h16 ] "::" 4( h16 ":" ) ls32 IPV6ADDRESS4$ = subexp(subexp(subexp(H16$ + "\\:") + "{0,1}" + H16$) + "?\\:\\:" + subexp(H16$ + "\\:") + "{3}" + LS32$), //[ *1( h16 ":" ) h16 ] "::" 3( h16 ":" ) ls32 IPV6ADDRESS5$ = subexp(subexp(subexp(H16$ + "\\:") + "{0,2}" + H16$) + "?\\:\\:" + subexp(H16$ + "\\:") + "{2}" + LS32$), //[ *2( h16 ":" ) h16 ] "::" 2( h16 ":" ) ls32 IPV6ADDRESS6$ = subexp(subexp(subexp(H16$ + "\\:") + "{0,3}" + H16$) + "?\\:\\:" + H16$ + "\\:" + LS32$), //[ *3( h16 ":" ) h16 ] "::" h16 ":" ls32 IPV6ADDRESS7$ = subexp(subexp(subexp(H16$ + "\\:") + "{0,4}" + H16$) + "?\\:\\:" + LS32$), //[ *4( h16 ":" ) h16 ] "::" ls32 IPV6ADDRESS8$ = subexp(subexp(subexp(H16$ + "\\:") + "{0,5}" + H16$) + "?\\:\\:" + H16$), //[ *5( h16 ":" ) h16 ] "::" h16 IPV6ADDRESS9$ = subexp(subexp(subexp(H16$ + "\\:") + "{0,6}" + H16$) + "?\\:\\:"), //[ *6( h16 ":" ) h16 ] "::" IPV6ADDRESS$ = subexp([IPV6ADDRESS1$, IPV6ADDRESS2$, IPV6ADDRESS3$, IPV6ADDRESS4$, IPV6ADDRESS5$, IPV6ADDRESS6$, IPV6ADDRESS7$, IPV6ADDRESS8$, IPV6ADDRESS9$].join("|")), ZONEID$ = subexp(subexp(UNRESERVED$$ + "|" + PCT_ENCODED$) + "+"), //RFC 6874 IPV6ADDRZ$ = subexp(IPV6ADDRESS$ + "\\%25" + ZONEID$), //RFC 6874 IPV6ADDRZ_RELAXED$ = subexp(IPV6ADDRESS$ + subexp("\\%25|\\%(?!" + HEXDIG$$ + "{2})") + ZONEID$), //RFC 6874, with relaxed parsing rules IPVFUTURE$ = subexp("[vV]" + HEXDIG$$ + "+\\." + merge(UNRESERVED$$, SUB_DELIMS$$, "[\\:]") + "+"), IP_LITERAL$ = subexp("\\[" + subexp(IPV6ADDRZ_RELAXED$ + "|" + IPV6ADDRESS$ + "|" + IPVFUTURE$) + "\\]"), //RFC 6874 REG_NAME$ = subexp(subexp(PCT_ENCODED$ + "|" + merge(UNRESERVED$$, SUB_DELIMS$$)) + "*"), HOST$ = subexp(IP_LITERAL$ + "|" + IPV4ADDRESS$ + "(?!" + REG_NAME$ + ")" + "|" + REG_NAME$), PORT$ = subexp(DIGIT$$ + "*"), AUTHORITY$ = subexp(subexp(USERINFO$ + "@") + "?" + HOST$ + subexp("\\:" + PORT$) + "?"), PCHAR$ = subexp(PCT_ENCODED$ + "|" + merge(UNRESERVED$$, SUB_DELIMS$$, "[\\:\\@]")), SEGMENT$ = subexp(PCHAR$ + "*"), SEGMENT_NZ$ = subexp(PCHAR$ + "+"), SEGMENT_NZ_NC$ = subexp(subexp(PCT_ENCODED$ + "|" + merge(UNRESERVED$$, SUB_DELIMS$$, "[\\@]")) + "+"), PATH_ABEMPTY$ = subexp(subexp("\\/" + SEGMENT$) + "*"), PATH_ABSOLUTE$ = subexp("\\/" + subexp(SEGMENT_NZ$ + PATH_ABEMPTY$) + "?"), //simplified PATH_NOSCHEME$ = subexp(SEGMENT_NZ_NC$ + PATH_ABEMPTY$), //simplified PATH_ROOTLESS$ = subexp(SEGMENT_NZ$ + PATH_ABEMPTY$), //simplified PATH_EMPTY$ = "(?!" + PCHAR$ + ")", PATH$ = subexp(PATH_ABEMPTY$ + "|" + PATH_ABSOLUTE$ + "|" + PATH_NOSCHEME$ + "|" + PATH_ROOTLESS$ + "|" + PATH_EMPTY$), QUERY$ = subexp(subexp(PCHAR$ + "|" + merge("[\\/\\?]", IPRIVATE$$)) + "*"), FRAGMENT$ = subexp(subexp(PCHAR$ + "|[\\/\\?]") + "*"), HIER_PART$ = subexp(subexp("\\/\\/" + AUTHORITY$ + PATH_ABEMPTY$) + "|" + PATH_ABSOLUTE$ + "|" + PATH_ROOTLESS$ + "|" + PATH_EMPTY$), URI$ = subexp(SCHEME$ + "\\:" + HIER_PART$ + subexp("\\?" + QUERY$) + "?" + subexp("\\#" + FRAGMENT$) + "?"), RELATIVE_PART$ = subexp(subexp("\\/\\/" + AUTHORITY$ + PATH_ABEMPTY$) + "|" + PATH_ABSOLUTE$ + "|" + PATH_NOSCHEME$ + "|" + PATH_EMPTY$), RELATIVE$ = subexp(RELATIVE_PART$ + subexp("\\?" + QUERY$) + "?" + subexp("\\#" + FRAGMENT$) + "?"), URI_REFERENCE$ = subexp(URI$ + "|" + RELATIVE$), ABSOLUTE_URI$ = subexp(SCHEME$ + "\\:" + HIER_PART$ + subexp("\\?" + QUERY$) + "?"), GENERIC_REF$ = "^(" + SCHEME$ + ")\\:" + subexp(subexp("\\/\\/(" + subexp("(" + USERINFO$ + ")@") + "?(" + HOST$ + ")" + subexp("\\:(" + PORT$ + ")") + "?)") + "?(" + PATH_ABEMPTY$ + "|" + PATH_ABSOLUTE$ + "|" + PATH_ROOTLESS$ + "|" + PATH_EMPTY$ + ")") + subexp("\\?(" + QUERY$ + ")") + "?" + subexp("\\#(" + FRAGMENT$ + ")") + "?$", RELATIVE_REF$ = "^(){0}" + subexp(subexp("\\/\\/(" + subexp("(" + USERINFO$ + ")@") + "?(" + HOST$ + ")" + subexp("\\:(" + PORT$ + ")") + "?)") + "?(" + PATH_ABEMPTY$ + "|" + PATH_ABSOLUTE$ + "|" + PATH_NOSCHEME$ + "|" + PATH_EMPTY$ + ")") + subexp("\\?(" + QUERY$ + ")") + "?" + subexp("\\#(" + FRAGMENT$ + ")") + "?$", ABSOLUTE_REF$ = "^(" + SCHEME$ + ")\\:" + subexp(subexp("\\/\\/(" + subexp("(" + USERINFO$ + ")@") + "?(" + HOST$ + ")" + subexp("\\:(" + PORT$ + ")") + "?)") + "?(" + PATH_ABEMPTY$ + "|" + PATH_ABSOLUTE$ + "|" + PATH_ROOTLESS$ + "|" + PATH_EMPTY$ + ")") + subexp("\\?(" + QUERY$ + ")") + "?$", SAMEDOC_REF$ = "^" + subexp("\\#(" + FRAGMENT$ + ")") + "?$", AUTHORITY_REF$ = "^" + subexp("(" + USERINFO$ + ")@") + "?(" + HOST$ + ")" + subexp("\\:(" + PORT$ + ")") + "?$"; return { NOT_SCHEME: new RegExp(merge("[^]", ALPHA$$, DIGIT$$, "[\\+\\-\\.]"), "g"), NOT_USERINFO: new RegExp(merge("[^\\%\\:]", UNRESERVED$$, SUB_DELIMS$$), "g"), NOT_HOST: new RegExp(merge("[^\\%\\[\\]\\:]", UNRESERVED$$, SUB_DELIMS$$), "g"), NOT_PATH: new RegExp(merge("[^\\%\\/\\:\\@]", UNRESERVED$$, SUB_DELIMS$$), "g"), NOT_PATH_NOSCHEME: new RegExp(merge("[^\\%\\/\\@]", UNRESERVED$$, SUB_DELIMS$$), "g"), NOT_QUERY: new RegExp(merge("[^\\%]", UNRESERVED$$, SUB_DELIMS$$, "[\\:\\@\\/\\?]", IPRIVATE$$), "g"), NOT_FRAGMENT: new RegExp(merge("[^\\%]", UNRESERVED$$, SUB_DELIMS$$, "[\\:\\@\\/\\?]"), "g"), ESCAPE: new RegExp(merge("[^]", UNRESERVED$$, SUB_DELIMS$$), "g"), UNRESERVED: new RegExp(UNRESERVED$$, "g"), OTHER_CHARS: new RegExp(merge("[^\\%]", UNRESERVED$$, RESERVED$$), "g"), PCT_ENCODED: new RegExp(PCT_ENCODED$, "g"), IPV4ADDRESS: new RegExp("^(" + IPV4ADDRESS$ + ")$"), IPV6ADDRESS: new RegExp("^\\[?(" + IPV6ADDRESS$ + ")" + subexp(subexp("\\%25|\\%(?!" + HEXDIG$$ + "{2})") + "(" + ZONEID$ + ")") + "?\\]?$") //RFC 6874, with relaxed parsing rules }; } var URI_PROTOCOL = buildExps(false); var IRI_PROTOCOL = buildExps(true); var slicedToArray = function () { function sliceIterator(arr, i) { var _arr = []; var _n = true; var _d = false; var _e = undefined; try { for (var _i = arr[Symbol.iterator](), _s; !(_n = (_s = _i.next()).done); _n = true) { _arr.push(_s.value); if (i && _arr.length === i) break; } } catch (err) { _d = true; _e = err; } finally { try { if (!_n && _i["return"]) _i["return"](); } finally { if (_d) throw _e; } } return _arr; } return function (arr, i) { if (Array.isArray(arr)) { return arr; } else if (Symbol.iterator in Object(arr)) { return sliceIterator(arr, i); } else { throw new TypeError("Invalid attempt to destructure non-iterable instance"); } }; }(); var toConsumableArray = function (arr) { if (Array.isArray(arr)) { for (var i = 0, arr2 = Array(arr.length); i < arr.length; i++) arr2[i] = arr[i]; return arr2; } else { return Array.from(arr); } }; /** Highest positive signed 32-bit float value */ var maxInt = 2147483647; // aka. 0x7FFFFFFF or 2^31-1 /** Bootstring parameters */ var base = 36; var tMin = 1; var tMax = 26; var skew = 38; var damp = 700; var initialBias = 72; var initialN = 128; // 0x80 var delimiter = '-'; // '\x2D' /** Regular expressions */ var regexPunycode = /^xn--/; var regexNonASCII = /[^\0-\x7E]/; // non-ASCII chars var regexSeparators = /[\x2E\u3002\uFF0E\uFF61]/g; // RFC 3490 separators /** Error messages */ var errors = { 'overflow': 'Overflow: input needs wider integers to process', 'not-basic': 'Illegal input >= 0x80 (not a basic code point)', 'invalid-input': 'Invalid input' }; /** Convenience shortcuts */ var baseMinusTMin = base - tMin; var floor = Math.floor; var stringFromCharCode = String.fromCharCode; /*--------------------------------------------------------------------------*/ /** * A generic error utility function. * @private * @param {String} type The error type. * @returns {Error} Throws a `RangeError` with the applicable error message. */ function error$1(type) { throw new RangeError(errors[type]); } /** * A generic `Array#map` utility function. * @private * @param {Array} array The array to iterate over. * @param {Function} callback The function that gets called for every array * item. * @returns {Array} A new array of values returned by the callback function. */ function map(array, fn) { var result = []; var length = array.length; while (length--) { result[length] = fn(array[length]); } return result; } /** * A simple `Array#map`-like wrapper to work with domain name strings or email * addresses. * @private * @param {String} domain The domain name or email address. * @param {Function} callback The function that gets called for every * character. * @returns {Array} A new string of characters returned by the callback * function. */ function mapDomain(string, fn) { var parts = string.split('@'); var result = ''; if (parts.length > 1) { // In email addresses, only the domain name should be punycoded. Leave // the local part (i.e. everything up to `@`) intact. result = parts[0] + '@'; string = parts[1]; } // Avoid `split(regex)` for IE8 compatibility. See #17. string = string.replace(regexSeparators, '\x2E'); var labels = string.split('.'); var encoded = map(labels, fn).join('.'); return result + encoded; } /** * Creates an array containing the numeric code points of each Unicode * character in the string. While JavaScript uses UCS-2 internally, * this function will convert a pair of surrogate halves (each of which * UCS-2 exposes as separate characters) into a single code point, * matching UTF-16. * @see `punycode.ucs2.encode` * @see * @memberOf punycode.ucs2 * @name decode * @param {String} string The Unicode input string (UCS-2). * @returns {Array} The new array of code points. */ function ucs2decode(string) { var output = []; var counter = 0; var length = string.length; while (counter < length) { var value = string.charCodeAt(counter++); if (value >= 0xD800 && value <= 0xDBFF && counter < length) { // It's a high surrogate, and there is a next character. var extra = string.charCodeAt(counter++); if ((extra & 0xFC00) == 0xDC00) { // Low surrogate. output.push(((value & 0x3FF) << 10) + (extra & 0x3FF) + 0x10000); } else { // It's an unmatched surrogate; only append this code unit, in case the // next code unit is the high surrogate of a surrogate pair. output.push(value); counter--; } } else { output.push(value); } } return output; } /** * Creates a string based on an array of numeric code points. * @see `punycode.ucs2.decode` * @memberOf punycode.ucs2 * @name encode * @param {Array} codePoints The array of numeric code points. * @returns {String} The new Unicode string (UCS-2). */ var ucs2encode = function ucs2encode(array) { return String.fromCodePoint.apply(String, toConsumableArray(array)); }; /** * Converts a basic code point into a digit/integer. * @see `digitToBasic()` * @private * @param {Number} codePoint The basic numeric code point value. * @returns {Number} The numeric value of a basic code point (for use in * representing integers) in the range `0` to `base - 1`, or `base` if * the code point does not represent a value. */ var basicToDigit = function basicToDigit(codePoint) { if (codePoint - 0x30 < 0x0A) { return codePoint - 0x16; } if (codePoint - 0x41 < 0x1A) { return codePoint - 0x41; } if (codePoint - 0x61 < 0x1A) { return codePoint - 0x61; } return base; }; /** * Converts a digit/integer into a basic code point. * @see `basicToDigit()` * @private * @param {Number} digit The numeric value of a basic code point. * @returns {Number} The basic code point whose value (when used for * representing integers) is `digit`, which needs to be in the range * `0` to `base - 1`. If `flag` is non-zero, the uppercase form is * used; else, the lowercase form is used. The behavior is undefined * if `flag` is non-zero and `digit` has no uppercase form. */ var digitToBasic = function digitToBasic(digit, flag) { // 0..25 map to ASCII a..z or A..Z // 26..35 map to ASCII 0..9 return digit + 22 + 75 * (digit < 26) - ((flag != 0) << 5); }; /** * Bias adaptation function as per section 3.4 of RFC 3492. * https://tools.ietf.org/html/rfc3492#section-3.4 * @private */ var adapt = function adapt(delta, numPoints, firstTime) { var k = 0; delta = firstTime ? floor(delta / damp) : delta >> 1; delta += floor(delta / numPoints); for (; /* no initialization */delta > baseMinusTMin * tMax >> 1; k += base) { delta = floor(delta / baseMinusTMin); } return floor(k + (baseMinusTMin + 1) * delta / (delta + skew)); }; /** * Converts a Punycode string of ASCII-only symbols to a string of Unicode * symbols. * @memberOf punycode * @param {String} input The Punycode string of ASCII-only symbols. * @returns {String} The resulting string of Unicode symbols. */ var decode = function decode(input) { // Don't use UCS-2. var output = []; var inputLength = input.length; var i = 0; var n = initialN; var bias = initialBias; // Handle the basic code points: let `basic` be the number of input code // points before the last delimiter, or `0` if there is none, then copy // the first basic code points to the output. var basic = input.lastIndexOf(delimiter); if (basic < 0) { basic = 0; } for (var j = 0; j < basic; ++j) { // if it's not a basic code point if (input.charCodeAt(j) >= 0x80) { error$1('not-basic'); } output.push(input.charCodeAt(j)); } // Main decoding loop: start just after the last delimiter if any basic code // points were copied; start at the beginning otherwise. for (var index = basic > 0 ? basic + 1 : 0; index < inputLength;) /* no final expression */{ // `index` is the index of the next character to be consumed. // Decode a generalized variable-length integer into `delta`, // which gets added to `i`. The overflow checking is easier // if we increase `i` as we go, then subtract off its starting // value at the end to obtain `delta`. var oldi = i; for (var w = 1, k = base;; /* no condition */k += base) { if (index >= inputLength) { error$1('invalid-input'); } var digit = basicToDigit(input.charCodeAt(index++)); if (digit >= base || digit > floor((maxInt - i) / w)) { error$1('overflow'); } i += digit * w; var t = k <= bias ? tMin : k >= bias + tMax ? tMax : k - bias; if (digit < t) { break; } var baseMinusT = base - t; if (w > floor(maxInt / baseMinusT)) { error$1('overflow'); } w *= baseMinusT; } var out = output.length + 1; bias = adapt(i - oldi, out, oldi == 0); // `i` was supposed to wrap around from `out` to `0`, // incrementing `n` each time, so we'll fix that now: if (floor(i / out) > maxInt - n) { error$1('overflow'); } n += floor(i / out); i %= out; // Insert `n` at position `i` of the output. output.splice(i++, 0, n); } return String.fromCodePoint.apply(String, output); }; /** * Converts a string of Unicode symbols (e.g. a domain name label) to a * Punycode string of ASCII-only symbols. * @memberOf punycode * @param {String} input The string of Unicode symbols. * @returns {String} The resulting Punycode string of ASCII-only symbols. */ var encode = function encode(input) { var output = []; // Convert the input in UCS-2 to an array of Unicode code points. input = ucs2decode(input); // Cache the length. var inputLength = input.length; // Initialize the state. var n = initialN; var delta = 0; var bias = initialBias; // Handle the basic code points. var _iteratorNormalCompletion = true; var _didIteratorError = false; var _iteratorError = undefined; try { for (var _iterator = input[Symbol.iterator](), _step; !(_iteratorNormalCompletion = (_step = _iterator.next()).done); _iteratorNormalCompletion = true) { var _currentValue2 = _step.value; if (_currentValue2 < 0x80) { output.push(stringFromCharCode(_currentValue2)); } } } catch (err) { _didIteratorError = true; _iteratorError = err; } finally { try { if (!_iteratorNormalCompletion && _iterator.return) { _iterator.return(); } } finally { if (_didIteratorError) { throw _iteratorError; } } } var basicLength = output.length; var handledCPCount = basicLength; // `handledCPCount` is the number of code points that have been handled; // `basicLength` is the number of basic code points. // Finish the basic string with a delimiter unless it's empty. if (basicLength) { output.push(delimiter); } // Main encoding loop: while (handledCPCount < inputLength) { // All non-basic code points < n have been handled already. Find the next // larger one: var m = maxInt; var _iteratorNormalCompletion2 = true; var _didIteratorError2 = false; var _iteratorError2 = undefined; try { for (var _iterator2 = input[Symbol.iterator](), _step2; !(_iteratorNormalCompletion2 = (_step2 = _iterator2.next()).done); _iteratorNormalCompletion2 = true) { var currentValue = _step2.value; if (currentValue >= n && currentValue < m) { m = currentValue; } } // Increase `delta` enough to advance the decoder's state to , // but guard against overflow. } catch (err) { _didIteratorError2 = true; _iteratorError2 = err; } finally { try { if (!_iteratorNormalCompletion2 && _iterator2.return) { _iterator2.return(); } } finally { if (_didIteratorError2) { throw _iteratorError2; } } } var handledCPCountPlusOne = handledCPCount + 1; if (m - n > floor((maxInt - delta) / handledCPCountPlusOne)) { error$1('overflow'); } delta += (m - n) * handledCPCountPlusOne; n = m; var _iteratorNormalCompletion3 = true; var _didIteratorError3 = false; var _iteratorError3 = undefined; try { for (var _iterator3 = input[Symbol.iterator](), _step3; !(_iteratorNormalCompletion3 = (_step3 = _iterator3.next()).done); _iteratorNormalCompletion3 = true) { var _currentValue = _step3.value; if (_currentValue < n && ++delta > maxInt) { error$1('overflow'); } if (_currentValue == n) { // Represent delta as a generalized variable-length integer. var q = delta; for (var k = base;; /* no condition */k += base) { var t = k <= bias ? tMin : k >= bias + tMax ? tMax : k - bias; if (q < t) { break; } var qMinusT = q - t; var baseMinusT = base - t; output.push(stringFromCharCode(digitToBasic(t + qMinusT % baseMinusT, 0))); q = floor(qMinusT / baseMinusT); } output.push(stringFromCharCode(digitToBasic(q, 0))); bias = adapt(delta, handledCPCountPlusOne, handledCPCount == basicLength); delta = 0; ++handledCPCount; } } } catch (err) { _didIteratorError3 = true; _iteratorError3 = err; } finally { try { if (!_iteratorNormalCompletion3 && _iterator3.return) { _iterator3.return(); } } finally { if (_didIteratorError3) { throw _iteratorError3; } } } ++delta; ++n; } return output.join(''); }; /** * Converts a Punycode string representing a domain name or an email address * to Unicode. Only the Punycoded parts of the input will be converted, i.e. * it doesn't matter if you call it on a string that has already been * converted to Unicode. * @memberOf punycode * @param {String} input The Punycoded domain name or email address to * convert to Unicode. * @returns {String} The Unicode representation of the given Punycode * string. */ var toUnicode = function toUnicode(input) { return mapDomain(input, function (string) { return regexPunycode.test(string) ? decode(string.slice(4).toLowerCase()) : string; }); }; /** * Converts a Unicode string representing a domain name or an email address to * Punycode. Only the non-ASCII parts of the domain name will be converted, * i.e. it doesn't matter if you call it with a domain that's already in * ASCII. * @memberOf punycode * @param {String} input The domain name or email address to convert, as a * Unicode string. * @returns {String} The Punycode representation of the given domain name or * email address. */ var toASCII = function toASCII(input) { return mapDomain(input, function (string) { return regexNonASCII.test(string) ? 'xn--' + encode(string) : string; }); }; /*--------------------------------------------------------------------------*/ /** Define the public API */ var punycode = { /** * A string representing the current Punycode.js version number. * @memberOf punycode * @type String */ 'version': '2.1.0', /** * An object of methods to convert from JavaScript's internal character * representation (UCS-2) to Unicode code points, and back. * @see * @memberOf punycode * @type Object */ 'ucs2': { 'decode': ucs2decode, 'encode': ucs2encode }, 'decode': decode, 'encode': encode, 'toASCII': toASCII, 'toUnicode': toUnicode }; /** * URI.js * * @fileoverview An RFC 3986 compliant, scheme extendable URI parsing/validating/resolving library for JavaScript. * @author Gary Court * @see http://github.com/garycourt/uri-js */ /** * Copyright 2011 Gary Court. All rights reserved. * * Redistribution and use in source and binary forms, with or without modification, are * permitted provided that the following conditions are met: * * 1. Redistributions of source code must retain the above copyright notice, this list of * conditions and the following disclaimer. * * 2. Redistributions in binary form must reproduce the above copyright notice, this list * of conditions and the following disclaimer in the documentation and/or other materials * provided with the distribution. * * THIS SOFTWARE IS PROVIDED BY GARY COURT ``AS IS'' AND ANY EXPRESS OR IMPLIED * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND * FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL GARY COURT OR * CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR * SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON * ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF * ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. * * The views and conclusions contained in the software and documentation are those of the * authors and should not be interpreted as representing official policies, either expressed * or implied, of Gary Court. */ var SCHEMES = {}; function pctEncChar(chr) { var c = chr.charCodeAt(0); var e = void 0; if (c < 16) e = "%0" + c.toString(16).toUpperCase();else if (c < 128) e = "%" + c.toString(16).toUpperCase();else if (c < 2048) e = "%" + (c >> 6 | 192).toString(16).toUpperCase() + "%" + (c & 63 | 128).toString(16).toUpperCase();else e = "%" + (c >> 12 | 224).toString(16).toUpperCase() + "%" + (c >> 6 & 63 | 128).toString(16).toUpperCase() + "%" + (c & 63 | 128).toString(16).toUpperCase(); return e; } function pctDecChars(str) { var newStr = ""; var i = 0; var il = str.length; while (i < il) { var c = parseInt(str.substr(i + 1, 2), 16); if (c < 128) { newStr += String.fromCharCode(c); i += 3; } else if (c >= 194 && c < 224) { if (il - i >= 6) { var c2 = parseInt(str.substr(i + 4, 2), 16); newStr += String.fromCharCode((c & 31) << 6 | c2 & 63); } else { newStr += str.substr(i, 6); } i += 6; } else if (c >= 224) { if (il - i >= 9) { var _c = parseInt(str.substr(i + 4, 2), 16); var c3 = parseInt(str.substr(i + 7, 2), 16); newStr += String.fromCharCode((c & 15) << 12 | (_c & 63) << 6 | c3 & 63); } else { newStr += str.substr(i, 9); } i += 9; } else { newStr += str.substr(i, 3); i += 3; } } return newStr; } function _normalizeComponentEncoding(components, protocol) { function decodeUnreserved(str) { var decStr = pctDecChars(str); return !decStr.match(protocol.UNRESERVED) ? str : decStr; } if (components.scheme) components.scheme = String(components.scheme).replace(protocol.PCT_ENCODED, decodeUnreserved).toLowerCase().replace(protocol.NOT_SCHEME, ""); if (components.userinfo !== undefined) components.userinfo = String(components.userinfo).replace(protocol.PCT_ENCODED, decodeUnreserved).replace(protocol.NOT_USERINFO, pctEncChar).replace(protocol.PCT_ENCODED, toUpperCase); if (components.host !== undefined) components.host = String(components.host).replace(protocol.PCT_ENCODED, decodeUnreserved).toLowerCase().replace(protocol.NOT_HOST, pctEncChar).replace(protocol.PCT_ENCODED, toUpperCase); if (components.path !== undefined) components.path = String(components.path).replace(protocol.PCT_ENCODED, decodeUnreserved).replace(components.scheme ? protocol.NOT_PATH : protocol.NOT_PATH_NOSCHEME, pctEncChar).replace(protocol.PCT_ENCODED, toUpperCase); if (components.query !== undefined) components.query = String(components.query).replace(protocol.PCT_ENCODED, decodeUnreserved).replace(protocol.NOT_QUERY, pctEncChar).replace(protocol.PCT_ENCODED, toUpperCase); if (components.fragment !== undefined) components.fragment = String(components.fragment).replace(protocol.PCT_ENCODED, decodeUnreserved).replace(protocol.NOT_FRAGMENT, pctEncChar).replace(protocol.PCT_ENCODED, toUpperCase); return components; } function _stripLeadingZeros(str) { return str.replace(/^0*(.*)/, "$1") || "0"; } function _normalizeIPv4(host, protocol) { var matches = host.match(protocol.IPV4ADDRESS) || []; var _matches = slicedToArray(matches, 2), address = _matches[1]; if (address) { return address.split(".").map(_stripLeadingZeros).join("."); } else { return host; } } function _normalizeIPv6(host, protocol) { var matches = host.match(protocol.IPV6ADDRESS) || []; var _matches2 = slicedToArray(matches, 3), address = _matches2[1], zone = _matches2[2]; if (address) { var _address$toLowerCase$ = address.toLowerCase().split('::').reverse(), _address$toLowerCase$2 = slicedToArray(_address$toLowerCase$, 2), last = _address$toLowerCase$2[0], first = _address$toLowerCase$2[1]; var firstFields = first ? first.split(":").map(_stripLeadingZeros) : []; var lastFields = last.split(":").map(_stripLeadingZeros); var isLastFieldIPv4Address = protocol.IPV4ADDRESS.test(lastFields[lastFields.length - 1]); var fieldCount = isLastFieldIPv4Address ? 7 : 8; var lastFieldsStart = lastFields.length - fieldCount; var fields = Array(fieldCount); for (var x = 0; x < fieldCount; ++x) { fields[x] = firstFields[x] || lastFields[lastFieldsStart + x] || ''; } if (isLastFieldIPv4Address) { fields[fieldCount - 1] = _normalizeIPv4(fields[fieldCount - 1], protocol); } var allZeroFields = fields.reduce(function (acc, field, index) { if (!field || field === "0") { var lastLongest = acc[acc.length - 1]; if (lastLongest && lastLongest.index + lastLongest.length === index) { lastLongest.length++; } else { acc.push({ index: index, length: 1 }); } } return acc; }, []); var longestZeroFields = allZeroFields.sort(function (a, b) { return b.length - a.length; })[0]; var newHost = void 0; if (longestZeroFields && longestZeroFields.length > 1) { var newFirst = fields.slice(0, longestZeroFields.index); var newLast = fields.slice(longestZeroFields.index + longestZeroFields.length); newHost = newFirst.join(":") + "::" + newLast.join(":"); } else { newHost = fields.join(":"); } if (zone) { newHost += "%" + zone; } return newHost; } else { return host; } } var URI_PARSE = /^(?:([^:\/?#]+):)?(?:\/\/((?:([^\/?#@]*)@)?(\[[^\/?#\]]+\]|[^\/?#:]*)(?:\:(\d*))?))?([^?#]*)(?:\?([^#]*))?(?:#((?:.|\n|\r)*))?/i; var NO_MATCH_IS_UNDEFINED = "".match(/(){0}/)[1] === undefined; function parse(uriString) { var options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {}; var components = {}; var protocol = options.iri !== false ? IRI_PROTOCOL : URI_PROTOCOL; if (options.reference === "suffix") uriString = (options.scheme ? options.scheme + ":" : "") + "//" + uriString; var matches = uriString.match(URI_PARSE); if (matches) { if (NO_MATCH_IS_UNDEFINED) { //store each component components.scheme = matches[1]; components.userinfo = matches[3]; components.host = matches[4]; components.port = parseInt(matches[5], 10); components.path = matches[6] || ""; components.query = matches[7]; components.fragment = matches[8]; //fix port number if (isNaN(components.port)) { components.port = matches[5]; } } else { //IE FIX for improper RegExp matching //store each component components.scheme = matches[1] || undefined; components.userinfo = uriString.indexOf("@") !== -1 ? matches[3] : undefined; components.host = uriString.indexOf("//") !== -1 ? matches[4] : undefined; components.port = parseInt(matches[5], 10); components.path = matches[6] || ""; components.query = uriString.indexOf("?") !== -1 ? matches[7] : undefined; components.fragment = uriString.indexOf("#") !== -1 ? matches[8] : undefined; //fix port number if (isNaN(components.port)) { components.port = uriString.match(/\/\/(?:.|\n)*\:(?:\/|\?|\#|$)/) ? matches[4] : undefined; } } if (components.host) { //normalize IP hosts components.host = _normalizeIPv6(_normalizeIPv4(components.host, protocol), protocol); } //determine reference type if (components.scheme === undefined && components.userinfo === undefined && components.host === undefined && components.port === undefined && !components.path && components.query === undefined) { components.reference = "same-document"; } else if (components.scheme === undefined) { components.reference = "relative"; } else if (components.fragment === undefined) { components.reference = "absolute"; } else { components.reference = "uri"; } //check for reference errors if (options.reference && options.reference !== "suffix" && options.reference !== components.reference) { components.error = components.error || "URI is not a " + options.reference + " reference."; } //find scheme handler var schemeHandler = SCHEMES[(options.scheme || components.scheme || "").toLowerCase()]; //check if scheme can't handle IRIs if (!options.unicodeSupport && (!schemeHandler || !schemeHandler.unicodeSupport)) { //if host component is a domain name if (components.host && (options.domainHost || schemeHandler && schemeHandler.domainHost)) { //convert Unicode IDN -> ASCII IDN try { components.host = punycode.toASCII(components.host.replace(protocol.PCT_ENCODED, pctDecChars).toLowerCase()); } catch (e) { components.error = components.error || "Host's domain name can not be converted to ASCII via punycode: " + e; } } //convert IRI -> URI _normalizeComponentEncoding(components, URI_PROTOCOL); } else { //normalize encodings _normalizeComponentEncoding(components, protocol); } //perform scheme specific parsing if (schemeHandler && schemeHandler.parse) { schemeHandler.parse(components, options); } } else { components.error = components.error || "URI can not be parsed."; } return components; } function _recomposeAuthority(components, options) { var protocol = options.iri !== false ? IRI_PROTOCOL : URI_PROTOCOL; var uriTokens = []; if (components.userinfo !== undefined) { uriTokens.push(components.userinfo); uriTokens.push("@"); } if (components.host !== undefined) { //normalize IP hosts, add brackets and escape zone separator for IPv6 uriTokens.push(_normalizeIPv6(_normalizeIPv4(String(components.host), protocol), protocol).replace(protocol.IPV6ADDRESS, function (_, $1, $2) { return "[" + $1 + ($2 ? "%25" + $2 : "") + "]"; })); } if (typeof components.port === "number") { uriTokens.push(":"); uriTokens.push(components.port.toString(10)); } return uriTokens.length ? uriTokens.join("") : undefined; } var RDS1 = /^\.\.?\//; var RDS2 = /^\/\.(\/|$)/; var RDS3 = /^\/\.\.(\/|$)/; var RDS5 = /^\/?(?:.|\n)*?(?=\/|$)/; function removeDotSegments(input) { var output = []; while (input.length) { if (input.match(RDS1)) { input = input.replace(RDS1, ""); } else if (input.match(RDS2)) { input = input.replace(RDS2, "/"); } else if (input.match(RDS3)) { input = input.replace(RDS3, "/"); output.pop(); } else if (input === "." || input === "..") { input = ""; } else { var im = input.match(RDS5); if (im) { var s = im[0]; input = input.slice(s.length); output.push(s); } else { throw new Error("Unexpected dot segment condition"); } } } return output.join(""); } function serialize(components) { var options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {}; var protocol = options.iri ? IRI_PROTOCOL : URI_PROTOCOL; var uriTokens = []; //find scheme handler var schemeHandler = SCHEMES[(options.scheme || components.scheme || "").toLowerCase()]; //perform scheme specific serialization if (schemeHandler && schemeHandler.serialize) schemeHandler.serialize(components, options); if (components.host) { //if host component is an IPv6 address if (protocol.IPV6ADDRESS.test(components.host)) {} //TODO: normalize IPv6 address as per RFC 5952 //if host component is a domain name else if (options.domainHost || schemeHandler && schemeHandler.domainHost) { //convert IDN via punycode try { components.host = !options.iri ? punycode.toASCII(components.host.replace(protocol.PCT_ENCODED, pctDecChars).toLowerCase()) : punycode.toUnicode(components.host); } catch (e) { components.error = components.error || "Host's domain name can not be converted to " + (!options.iri ? "ASCII" : "Unicode") + " via punycode: " + e; } } } //normalize encoding _normalizeComponentEncoding(components, protocol); if (options.reference !== "suffix" && components.scheme) { uriTokens.push(components.scheme); uriTokens.push(":"); } var authority = _recomposeAuthority(components, options); if (authority !== undefined) { if (options.reference !== "suffix") { uriTokens.push("//"); } uriTokens.push(authority); if (components.path && components.path.charAt(0) !== "/") { uriTokens.push("/"); } } if (components.path !== undefined) { var s = components.path; if (!options.absolutePath && (!schemeHandler || !schemeHandler.absolutePath)) { s = removeDotSegments(s); } if (authority === undefined) { s = s.replace(/^\/\//, "/%2F"); //don't allow the path to start with "//" } uriTokens.push(s); } if (components.query !== undefined) { uriTokens.push("?"); uriTokens.push(components.query); } if (components.fragment !== undefined) { uriTokens.push("#"); uriTokens.push(components.fragment); } return uriTokens.join(""); //merge tokens into a string } function resolveComponents(base, relative) { var options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {}; var skipNormalization = arguments[3]; var target = {}; if (!skipNormalization) { base = parse(serialize(base, options), options); //normalize base components relative = parse(serialize(relative, options), options); //normalize relative components } options = options || {}; if (!options.tolerant && relative.scheme) { target.scheme = relative.scheme; //target.authority = relative.authority; target.userinfo = relative.userinfo; target.host = relative.host; target.port = relative.port; target.path = removeDotSegments(relative.path || ""); target.query = relative.query; } else { if (relative.userinfo !== undefined || relative.host !== undefined || relative.port !== undefined) { //target.authority = relative.authority; target.userinfo = relative.userinfo; target.host = relative.host; target.port = relative.port; target.path = removeDotSegments(relative.path || ""); target.query = relative.query; } else { if (!relative.path) { target.path = base.path; if (relative.query !== undefined) { target.query = relative.query; } else { target.query = base.query; } } else { if (relative.path.charAt(0) === "/") { target.path = removeDotSegments(relative.path); } else { if ((base.userinfo !== undefined || base.host !== undefined || base.port !== undefined) && !base.path) { target.path = "/" + relative.path; } else if (!base.path) { target.path = relative.path; } else { target.path = base.path.slice(0, base.path.lastIndexOf("/") + 1) + relative.path; } target.path = removeDotSegments(target.path); } target.query = relative.query; } //target.authority = base.authority; target.userinfo = base.userinfo; target.host = base.host; target.port = base.port; } target.scheme = base.scheme; } target.fragment = relative.fragment; return target; } function resolve(baseURI, relativeURI, options) { var schemelessOptions = assign({ scheme: 'null' }, options); return serialize(resolveComponents(parse(baseURI, schemelessOptions), parse(relativeURI, schemelessOptions), schemelessOptions, true), schemelessOptions); } function normalize(uri, options) { if (typeof uri === "string") { uri = serialize(parse(uri, options), options); } else if (typeOf(uri) === "object") { uri = parse(serialize(uri, options), options); } return uri; } function equal(uriA, uriB, options) { if (typeof uriA === "string") { uriA = serialize(parse(uriA, options), options); } else if (typeOf(uriA) === "object") { uriA = serialize(uriA, options); } if (typeof uriB === "string") { uriB = serialize(parse(uriB, options), options); } else if (typeOf(uriB) === "object") { uriB = serialize(uriB, options); } return uriA === uriB; } function escapeComponent(str, options) { return str && str.toString().replace(!options || !options.iri ? URI_PROTOCOL.ESCAPE : IRI_PROTOCOL.ESCAPE, pctEncChar); } function unescapeComponent(str, options) { return str && str.toString().replace(!options || !options.iri ? URI_PROTOCOL.PCT_ENCODED : IRI_PROTOCOL.PCT_ENCODED, pctDecChars); } var handler = { scheme: "http", domainHost: true, parse: function parse(components, options) { //report missing host if (!components.host) { components.error = components.error || "HTTP URIs must have a host."; } return components; }, serialize: function serialize(components, options) { //normalize the default port if (components.port === (String(components.scheme).toLowerCase() !== "https" ? 80 : 443) || components.port === "") { components.port = undefined; } //normalize the empty path if (!components.path) { components.path = "/"; } //NOTE: We do not parse query strings for HTTP URIs //as WWW Form Url Encoded query strings are part of the HTML4+ spec, //and not the HTTP spec. return components; } }; var handler$1 = { scheme: "https", domainHost: handler.domainHost, parse: handler.parse, serialize: handler.serialize }; var O = {}; var isIRI = true; //RFC 3986 var UNRESERVED$$ = "[A-Za-z0-9\\-\\.\\_\\~" + (isIRI ? "\\xA0-\\u200D\\u2010-\\u2029\\u202F-\\uD7FF\\uF900-\\uFDCF\\uFDF0-\\uFFEF" : "") + "]"; var HEXDIG$$ = "[0-9A-Fa-f]"; //case-insensitive var PCT_ENCODED$ = subexp(subexp("%[EFef]" + HEXDIG$$ + "%" + HEXDIG$$ + HEXDIG$$ + "%" + HEXDIG$$ + HEXDIG$$) + "|" + subexp("%[89A-Fa-f]" + HEXDIG$$ + "%" + HEXDIG$$ + HEXDIG$$) + "|" + subexp("%" + HEXDIG$$ + HEXDIG$$)); //expanded //RFC 5322, except these symbols as per RFC 6068: @ : / ? # [ ] & ; = //const ATEXT$$ = "[A-Za-z0-9\\!\\#\\$\\%\\&\\'\\*\\+\\-\\/\\=\\?\\^\\_\\`\\{\\|\\}\\~]"; //const WSP$$ = "[\\x20\\x09]"; //const OBS_QTEXT$$ = "[\\x01-\\x08\\x0B\\x0C\\x0E-\\x1F\\x7F]"; //(%d1-8 / %d11-12 / %d14-31 / %d127) //const QTEXT$$ = merge("[\\x21\\x23-\\x5B\\x5D-\\x7E]", OBS_QTEXT$$); //%d33 / %d35-91 / %d93-126 / obs-qtext //const VCHAR$$ = "[\\x21-\\x7E]"; //const WSP$$ = "[\\x20\\x09]"; //const OBS_QP$ = subexp("\\\\" + merge("[\\x00\\x0D\\x0A]", OBS_QTEXT$$)); //%d0 / CR / LF / obs-qtext //const FWS$ = subexp(subexp(WSP$$ + "*" + "\\x0D\\x0A") + "?" + WSP$$ + "+"); //const QUOTED_PAIR$ = subexp(subexp("\\\\" + subexp(VCHAR$$ + "|" + WSP$$)) + "|" + OBS_QP$); //const QUOTED_STRING$ = subexp('\\"' + subexp(FWS$ + "?" + QCONTENT$) + "*" + FWS$ + "?" + '\\"'); var ATEXT$$ = "[A-Za-z0-9\\!\\$\\%\\'\\*\\+\\-\\^\\_\\`\\{\\|\\}\\~]"; var QTEXT$$ = "[\\!\\$\\%\\'\\(\\)\\*\\+\\,\\-\\.0-9\\<\\>A-Z\\x5E-\\x7E]"; var VCHAR$$ = merge(QTEXT$$, "[\\\"\\\\]"); var SOME_DELIMS$$ = "[\\!\\$\\'\\(\\)\\*\\+\\,\\;\\:\\@]"; var UNRESERVED = new RegExp(UNRESERVED$$, "g"); var PCT_ENCODED = new RegExp(PCT_ENCODED$, "g"); var NOT_LOCAL_PART = new RegExp(merge("[^]", ATEXT$$, "[\\.]", '[\\"]', VCHAR$$), "g"); var NOT_HFNAME = new RegExp(merge("[^]", UNRESERVED$$, SOME_DELIMS$$), "g"); var NOT_HFVALUE = NOT_HFNAME; function decodeUnreserved(str) { var decStr = pctDecChars(str); return !decStr.match(UNRESERVED) ? str : decStr; } var handler$2 = { scheme: "mailto", parse: function parse$$1(components, options) { var mailtoComponents = components; var to = mailtoComponents.to = mailtoComponents.path ? mailtoComponents.path.split(",") : []; mailtoComponents.path = undefined; if (mailtoComponents.query) { var unknownHeaders = false; var headers = {}; var hfields = mailtoComponents.query.split("&"); for (var x = 0, xl = hfields.length; x < xl; ++x) { var hfield = hfields[x].split("="); switch (hfield[0]) { case "to": var toAddrs = hfield[1].split(","); for (var _x = 0, _xl = toAddrs.length; _x < _xl; ++_x) { to.push(toAddrs[_x]); } break; case "subject": mailtoComponents.subject = unescapeComponent(hfield[1], options); break; case "body": mailtoComponents.body = unescapeComponent(hfield[1], options); break; default: unknownHeaders = true; headers[unescapeComponent(hfield[0], options)] = unescapeComponent(hfield[1], options); break; } } if (unknownHeaders) mailtoComponents.headers = headers; } mailtoComponents.query = undefined; for (var _x2 = 0, _xl2 = to.length; _x2 < _xl2; ++_x2) { var addr = to[_x2].split("@"); addr[0] = unescapeComponent(addr[0]); if (!options.unicodeSupport) { //convert Unicode IDN -> ASCII IDN try { addr[1] = punycode.toASCII(unescapeComponent(addr[1], options).toLowerCase()); } catch (e) { mailtoComponents.error = mailtoComponents.error || "Email address's domain name can not be converted to ASCII via punycode: " + e; } } else { addr[1] = unescapeComponent(addr[1], options).toLowerCase(); } to[_x2] = addr.join("@"); } return mailtoComponents; }, serialize: function serialize$$1(mailtoComponents, options) { var components = mailtoComponents; var to = toArray(mailtoComponents.to); if (to) { for (var x = 0, xl = to.length; x < xl; ++x) { var toAddr = String(to[x]); var atIdx = toAddr.lastIndexOf("@"); var localPart = toAddr.slice(0, atIdx).replace(PCT_ENCODED, decodeUnreserved).replace(PCT_ENCODED, toUpperCase).replace(NOT_LOCAL_PART, pctEncChar); var domain = toAddr.slice(atIdx + 1); //convert IDN via punycode try { domain = !options.iri ? punycode.toASCII(unescapeComponent(domain, options).toLowerCase()) : punycode.toUnicode(domain); } catch (e) { components.error = components.error || "Email address's domain name can not be converted to " + (!options.iri ? "ASCII" : "Unicode") + " via punycode: " + e; } to[x] = localPart + "@" + domain; } components.path = to.join(","); } var headers = mailtoComponents.headers = mailtoComponents.headers || {}; if (mailtoComponents.subject) headers["subject"] = mailtoComponents.subject; if (mailtoComponents.body) headers["body"] = mailtoComponents.body; var fields = []; for (var name in headers) { if (headers[name] !== O[name]) { fields.push(name.replace(PCT_ENCODED, decodeUnreserved).replace(PCT_ENCODED, toUpperCase).replace(NOT_HFNAME, pctEncChar) + "=" + headers[name].replace(PCT_ENCODED, decodeUnreserved).replace(PCT_ENCODED, toUpperCase).replace(NOT_HFVALUE, pctEncChar)); } } if (fields.length) { components.query = fields.join("&"); } return components; } }; var URN_PARSE = /^([^\:]+)\:(.*)/; //RFC 2141 var handler$3 = { scheme: "urn", parse: function parse$$1(components, options) { var matches = components.path && components.path.match(URN_PARSE); var urnComponents = components; if (matches) { var scheme = options.scheme || urnComponents.scheme || "urn"; var nid = matches[1].toLowerCase(); var nss = matches[2]; var urnScheme = scheme + ":" + (options.nid || nid); var schemeHandler = SCHEMES[urnScheme]; urnComponents.nid = nid; urnComponents.nss = nss; urnComponents.path = undefined; if (schemeHandler) { urnComponents = schemeHandler.parse(urnComponents, options); } } else { urnComponents.error = urnComponents.error || "URN can not be parsed."; } return urnComponents; }, serialize: function serialize$$1(urnComponents, options) { var scheme = options.scheme || urnComponents.scheme || "urn"; var nid = urnComponents.nid; var urnScheme = scheme + ":" + (options.nid || nid); var schemeHandler = SCHEMES[urnScheme]; if (schemeHandler) { urnComponents = schemeHandler.serialize(urnComponents, options); } var uriComponents = urnComponents; var nss = urnComponents.nss; uriComponents.path = (nid || options.nid) + ":" + nss; return uriComponents; } }; var UUID = /^[0-9A-Fa-f]{8}(?:\-[0-9A-Fa-f]{4}){3}\-[0-9A-Fa-f]{12}$/; //RFC 4122 var handler$4 = { scheme: "urn:uuid", parse: function parse(urnComponents, options) { var uuidComponents = urnComponents; uuidComponents.uuid = uuidComponents.nss; uuidComponents.nss = undefined; if (!options.tolerant && (!uuidComponents.uuid || !uuidComponents.uuid.match(UUID))) { uuidComponents.error = uuidComponents.error || "UUID is not valid."; } return uuidComponents; }, serialize: function serialize(uuidComponents, options) { var urnComponents = uuidComponents; //normalize UUID urnComponents.nss = (uuidComponents.uuid || "").toLowerCase(); return urnComponents; } }; SCHEMES[handler.scheme] = handler; SCHEMES[handler$1.scheme] = handler$1; SCHEMES[handler$2.scheme] = handler$2; SCHEMES[handler$3.scheme] = handler$3; SCHEMES[handler$4.scheme] = handler$4; exports.SCHEMES = SCHEMES; exports.pctEncChar = pctEncChar; exports.pctDecChars = pctDecChars; exports.parse = parse; exports.removeDotSegments = removeDotSegments; exports.serialize = serialize; exports.resolveComponents = resolveComponents; exports.resolve = resolve; exports.normalize = normalize; exports.equal = equal; exports.escapeComponent = escapeComponent; exports.unescapeComponent = unescapeComponent; Object.defineProperty(exports, '__esModule', { value: true }); }))); //# sourceMappingURL=uri.all.js.map /***/ }), /***/ 855: /***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; module.exports = { copy: copy, checkDataType: checkDataType, checkDataTypes: checkDataTypes, coerceToTypes: coerceToTypes, toHash: toHash, getProperty: getProperty, escapeQuotes: escapeQuotes, equal: __webpack_require__(832), ucs2length: __webpack_require__(691), varOccurences: varOccurences, varReplace: varReplace, cleanUpCode: cleanUpCode, finalCleanUpCode: finalCleanUpCode, schemaHasRules: schemaHasRules, schemaHasRulesExcept: schemaHasRulesExcept, schemaUnknownRules: schemaUnknownRules, toQuotedString: toQuotedString, getPathExpr: getPathExpr, getPath: getPath, getData: getData, unescapeFragment: unescapeFragment, unescapeJsonPointer: unescapeJsonPointer, escapeFragment: escapeFragment, escapeJsonPointer: escapeJsonPointer }; function copy(o, to) { to = to || {}; for (var key in o) to[key] = o[key]; return to; } function checkDataType(dataType, data, negate) { var EQUAL = negate ? ' !== ' : ' === ' , AND = negate ? ' || ' : ' && ' , OK = negate ? '!' : '' , NOT = negate ? '' : '!'; switch (dataType) { case 'null': return data + EQUAL + 'null'; case 'array': return OK + 'Array.isArray(' + data + ')'; case 'object': return '(' + OK + data + AND + 'typeof ' + data + EQUAL + '"object"' + AND + NOT + 'Array.isArray(' + data + '))'; case 'integer': return '(typeof ' + data + EQUAL + '"number"' + AND + NOT + '(' + data + ' % 1)' + AND + data + EQUAL + data + ')'; default: return 'typeof ' + data + EQUAL + '"' + dataType + '"'; } } function checkDataTypes(dataTypes, data) { switch (dataTypes.length) { case 1: return checkDataType(dataTypes[0], data, true); default: var code = ''; var types = toHash(dataTypes); if (types.array && types.object) { code = types.null ? '(': '(!' + data + ' || '; code += 'typeof ' + data + ' !== "object")'; delete types.null; delete types.array; delete types.object; } if (types.number) delete types.integer; for (var t in types) code += (code ? ' && ' : '' ) + checkDataType(t, data, true); return code; } } var COERCE_TO_TYPES = toHash([ 'string', 'number', 'integer', 'boolean', 'null' ]); function coerceToTypes(optionCoerceTypes, dataTypes) { if (Array.isArray(dataTypes)) { var types = []; for (var i=0; i= lvl) throw new Error('Cannot access property/index ' + up + ' levels up, current level is ' + lvl); return paths[lvl - up]; } if (up > lvl) throw new Error('Cannot access data ' + up + ' levels up, current level is ' + lvl); data = 'data' + ((lvl - up) || ''); if (!jsonPointer) return data; } var expr = data; var segments = jsonPointer.split('/'); for (var i=0; i 0 : it.util.schemaHasRules($propertySch, it.RULES.all)))) { $required[$required.length] = $property; } } } } else { var $required = $schema; } } if ($isData || $required.length) { var $currentErrorPath = it.errorPath, $loopRequired = $isData || $required.length >= it.opts.loopRequired, $ownProperties = it.opts.ownProperties; if ($breakOnError) { out += ' var missing' + ($lvl) + '; '; if ($loopRequired) { if (!$isData) { out += ' var ' + ($vSchema) + ' = validate.schema' + ($schemaPath) + '; '; } var $i = 'i' + $lvl, $propertyPath = 'schema' + $lvl + '[' + $i + ']', $missingProperty = '\' + ' + $propertyPath + ' + \''; if (it.opts._errorDataPathProperty) { it.errorPath = it.util.getPathExpr($currentErrorPath, $propertyPath, it.opts.jsonPointers); } out += ' var ' + ($valid) + ' = true; '; if ($isData) { out += ' if (schema' + ($lvl) + ' === undefined) ' + ($valid) + ' = true; else if (!Array.isArray(schema' + ($lvl) + ')) ' + ($valid) + ' = false; else {'; } out += ' for (var ' + ($i) + ' = 0; ' + ($i) + ' < ' + ($vSchema) + '.length; ' + ($i) + '++) { ' + ($valid) + ' = ' + ($data) + '[' + ($vSchema) + '[' + ($i) + ']] !== undefined '; if ($ownProperties) { out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', ' + ($vSchema) + '[' + ($i) + ']) '; } out += '; if (!' + ($valid) + ') break; } '; if ($isData) { out += ' } '; } out += ' if (!' + ($valid) + ') { '; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; if (it.opts.messages !== false) { out += ' , message: \''; if (it.opts._errorDataPathProperty) { out += 'is a required property'; } else { out += 'should have required property \\\'' + ($missingProperty) + '\\\''; } out += '\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } out += ' } else { '; } else { out += ' if ( '; var arr2 = $required; if (arr2) { var $propertyKey, $i = -1, l2 = arr2.length - 1; while ($i < l2) { $propertyKey = arr2[$i += 1]; if ($i) { out += ' || '; } var $prop = it.util.getProperty($propertyKey), $useData = $data + $prop; out += ' ( ( ' + ($useData) + ' === undefined '; if ($ownProperties) { out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; } out += ') && (missing' + ($lvl) + ' = ' + (it.util.toQuotedString(it.opts.jsonPointers ? $propertyKey : $prop)) + ') ) '; } } out += ') { '; var $propertyPath = 'missing' + $lvl, $missingProperty = '\' + ' + $propertyPath + ' + \''; if (it.opts._errorDataPathProperty) { it.errorPath = it.opts.jsonPointers ? it.util.getPathExpr($currentErrorPath, $propertyPath, true) : $currentErrorPath + ' + ' + $propertyPath; } var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; if (it.opts.messages !== false) { out += ' , message: \''; if (it.opts._errorDataPathProperty) { out += 'is a required property'; } else { out += 'should have required property \\\'' + ($missingProperty) + '\\\''; } out += '\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } out += ' } else { '; } } else { if ($loopRequired) { if (!$isData) { out += ' var ' + ($vSchema) + ' = validate.schema' + ($schemaPath) + '; '; } var $i = 'i' + $lvl, $propertyPath = 'schema' + $lvl + '[' + $i + ']', $missingProperty = '\' + ' + $propertyPath + ' + \''; if (it.opts._errorDataPathProperty) { it.errorPath = it.util.getPathExpr($currentErrorPath, $propertyPath, it.opts.jsonPointers); } if ($isData) { out += ' if (' + ($vSchema) + ' && !Array.isArray(' + ($vSchema) + ')) { var err = '; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; if (it.opts.messages !== false) { out += ' , message: \''; if (it.opts._errorDataPathProperty) { out += 'is a required property'; } else { out += 'should have required property \\\'' + ($missingProperty) + '\\\''; } out += '\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } else if (' + ($vSchema) + ' !== undefined) { '; } out += ' for (var ' + ($i) + ' = 0; ' + ($i) + ' < ' + ($vSchema) + '.length; ' + ($i) + '++) { if (' + ($data) + '[' + ($vSchema) + '[' + ($i) + ']] === undefined '; if ($ownProperties) { out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', ' + ($vSchema) + '[' + ($i) + ']) '; } out += ') { var err = '; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; if (it.opts.messages !== false) { out += ' , message: \''; if (it.opts._errorDataPathProperty) { out += 'is a required property'; } else { out += 'should have required property \\\'' + ($missingProperty) + '\\\''; } out += '\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } } '; if ($isData) { out += ' } '; } } else { var arr3 = $required; if (arr3) { var $propertyKey, i3 = -1, l3 = arr3.length - 1; while (i3 < l3) { $propertyKey = arr3[i3 += 1]; var $prop = it.util.getProperty($propertyKey), $missingProperty = it.util.escapeQuotes($propertyKey), $useData = $data + $prop; if (it.opts._errorDataPathProperty) { it.errorPath = it.util.getPath($currentErrorPath, $propertyKey, it.opts.jsonPointers); } out += ' if ( ' + ($useData) + ' === undefined '; if ($ownProperties) { out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; } out += ') { var err = '; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; if (it.opts.messages !== false) { out += ' , message: \''; if (it.opts._errorDataPathProperty) { out += 'is a required property'; } else { out += 'should have required property \\\'' + ($missingProperty) + '\\\''; } out += '\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } '; } } } } it.errorPath = $currentErrorPath; } else if ($breakOnError) { out += ' if (true) {'; } return out; } /***/ }), /***/ 866: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2017 Joyent, Inc. module.exports = { read: read, verify: verify, sign: sign, signAsync: signAsync, write: write }; var assert = __webpack_require__(477); var asn1 = __webpack_require__(62); var Buffer = __webpack_require__(215).Buffer; var algs = __webpack_require__(98); var utils = __webpack_require__(270); var Key = __webpack_require__(852); var PrivateKey = __webpack_require__(502); var pem = __webpack_require__(268); var Identity = __webpack_require__(378); var Signature = __webpack_require__(575); var Certificate = __webpack_require__(752); var pkcs8 = __webpack_require__(707); /* * This file is based on RFC5280 (X.509). */ /* Helper to read in a single mpint */ function readMPInt(der, nm) { assert.strictEqual(der.peek(), asn1.Ber.Integer, nm + ' is not an Integer'); return (utils.mpNormalize(der.readString(asn1.Ber.Integer, true))); } function verify(cert, key) { var sig = cert.signatures.x509; assert.object(sig, 'x509 signature'); var algParts = sig.algo.split('-'); if (algParts[0] !== key.type) return (false); var blob = sig.cache; if (blob === undefined) { var der = new asn1.BerWriter(); writeTBSCert(cert, der); blob = der.buffer; } var verifier = key.createVerify(algParts[1]); verifier.write(blob); return (verifier.verify(sig.signature)); } function Local(i) { return (asn1.Ber.Context | asn1.Ber.Constructor | i); } function Context(i) { return (asn1.Ber.Context | i); } var SIGN_ALGS = { 'rsa-md5': '1.2.840.113549.1.1.4', 'rsa-sha1': '1.2.840.113549.1.1.5', 'rsa-sha256': '1.2.840.113549.1.1.11', 'rsa-sha384': '1.2.840.113549.1.1.12', 'rsa-sha512': '1.2.840.113549.1.1.13', 'dsa-sha1': '1.2.840.10040.4.3', 'dsa-sha256': '2.16.840.1.101.3.4.3.2', 'ecdsa-sha1': '1.2.840.10045.4.1', 'ecdsa-sha256': '1.2.840.10045.4.3.2', 'ecdsa-sha384': '1.2.840.10045.4.3.3', 'ecdsa-sha512': '1.2.840.10045.4.3.4', 'ed25519-sha512': '1.3.101.112' }; Object.keys(SIGN_ALGS).forEach(function (k) { SIGN_ALGS[SIGN_ALGS[k]] = k; }); SIGN_ALGS['1.3.14.3.2.3'] = 'rsa-md5'; SIGN_ALGS['1.3.14.3.2.29'] = 'rsa-sha1'; var EXTS = { 'issuerKeyId': '2.5.29.35', 'altName': '2.5.29.17', 'basicConstraints': '2.5.29.19', 'keyUsage': '2.5.29.15', 'extKeyUsage': '2.5.29.37' }; function read(buf, options) { if (typeof (buf) === 'string') { buf = Buffer.from(buf, 'binary'); } assert.buffer(buf, 'buf'); var der = new asn1.BerReader(buf); der.readSequence(); if (Math.abs(der.length - der.remain) > 1) { throw (new Error('DER sequence does not contain whole byte ' + 'stream')); } var tbsStart = der.offset; der.readSequence(); var sigOffset = der.offset + der.length; var tbsEnd = sigOffset; if (der.peek() === Local(0)) { der.readSequence(Local(0)); var version = der.readInt(); assert.ok(version <= 3, 'only x.509 versions up to v3 supported'); } var cert = {}; cert.signatures = {}; var sig = (cert.signatures.x509 = {}); sig.extras = {}; cert.serial = readMPInt(der, 'serial'); der.readSequence(); var after = der.offset + der.length; var certAlgOid = der.readOID(); var certAlg = SIGN_ALGS[certAlgOid]; if (certAlg === undefined) throw (new Error('unknown signature algorithm ' + certAlgOid)); der._offset = after; cert.issuer = Identity.parseAsn1(der); der.readSequence(); cert.validFrom = readDate(der); cert.validUntil = readDate(der); cert.subjects = [Identity.parseAsn1(der)]; der.readSequence(); after = der.offset + der.length; cert.subjectKey = pkcs8.readPkcs8(undefined, 'public', der); der._offset = after; /* issuerUniqueID */ if (der.peek() === Local(1)) { der.readSequence(Local(1)); sig.extras.issuerUniqueID = buf.slice(der.offset, der.offset + der.length); der._offset += der.length; } /* subjectUniqueID */ if (der.peek() === Local(2)) { der.readSequence(Local(2)); sig.extras.subjectUniqueID = buf.slice(der.offset, der.offset + der.length); der._offset += der.length; } /* extensions */ if (der.peek() === Local(3)) { der.readSequence(Local(3)); var extEnd = der.offset + der.length; der.readSequence(); while (der.offset < extEnd) readExtension(cert, buf, der); assert.strictEqual(der.offset, extEnd); } assert.strictEqual(der.offset, sigOffset); der.readSequence(); after = der.offset + der.length; var sigAlgOid = der.readOID(); var sigAlg = SIGN_ALGS[sigAlgOid]; if (sigAlg === undefined) throw (new Error('unknown signature algorithm ' + sigAlgOid)); der._offset = after; var sigData = der.readString(asn1.Ber.BitString, true); if (sigData[0] === 0) sigData = sigData.slice(1); var algParts = sigAlg.split('-'); sig.signature = Signature.parse(sigData, algParts[0], 'asn1'); sig.signature.hashAlgorithm = algParts[1]; sig.algo = sigAlg; sig.cache = buf.slice(tbsStart, tbsEnd); return (new Certificate(cert)); } function readDate(der) { if (der.peek() === asn1.Ber.UTCTime) { return (utcTimeToDate(der.readString(asn1.Ber.UTCTime))); } else if (der.peek() === asn1.Ber.GeneralizedTime) { return (gTimeToDate(der.readString(asn1.Ber.GeneralizedTime))); } else { throw (new Error('Unsupported date format')); } } function writeDate(der, date) { if (date.getUTCFullYear() >= 2050 || date.getUTCFullYear() < 1950) { der.writeString(dateToGTime(date), asn1.Ber.GeneralizedTime); } else { der.writeString(dateToUTCTime(date), asn1.Ber.UTCTime); } } /* RFC5280, section 4.2.1.6 (GeneralName type) */ var ALTNAME = { OtherName: Local(0), RFC822Name: Context(1), DNSName: Context(2), X400Address: Local(3), DirectoryName: Local(4), EDIPartyName: Local(5), URI: Context(6), IPAddress: Context(7), OID: Context(8) }; /* RFC5280, section 4.2.1.12 (KeyPurposeId) */ var EXTPURPOSE = { 'serverAuth': '1.3.6.1.5.5.7.3.1', 'clientAuth': '1.3.6.1.5.5.7.3.2', 'codeSigning': '1.3.6.1.5.5.7.3.3', /* See https://github.com/joyent/oid-docs/blob/master/root.md */ 'joyentDocker': '1.3.6.1.4.1.38678.1.4.1', 'joyentCmon': '1.3.6.1.4.1.38678.1.4.2' }; var EXTPURPOSE_REV = {}; Object.keys(EXTPURPOSE).forEach(function (k) { EXTPURPOSE_REV[EXTPURPOSE[k]] = k; }); var KEYUSEBITS = [ 'signature', 'identity', 'keyEncryption', 'encryption', 'keyAgreement', 'ca', 'crl' ]; function readExtension(cert, buf, der) { der.readSequence(); var after = der.offset + der.length; var extId = der.readOID(); var id; var sig = cert.signatures.x509; if (!sig.extras.exts) sig.extras.exts = []; var critical; if (der.peek() === asn1.Ber.Boolean) critical = der.readBoolean(); switch (extId) { case (EXTS.basicConstraints): der.readSequence(asn1.Ber.OctetString); der.readSequence(); var bcEnd = der.offset + der.length; var ca = false; if (der.peek() === asn1.Ber.Boolean) ca = der.readBoolean(); if (cert.purposes === undefined) cert.purposes = []; if (ca === true) cert.purposes.push('ca'); var bc = { oid: extId, critical: critical }; if (der.offset < bcEnd && der.peek() === asn1.Ber.Integer) bc.pathLen = der.readInt(); sig.extras.exts.push(bc); break; case (EXTS.extKeyUsage): der.readSequence(asn1.Ber.OctetString); der.readSequence(); if (cert.purposes === undefined) cert.purposes = []; var ekEnd = der.offset + der.length; while (der.offset < ekEnd) { var oid = der.readOID(); cert.purposes.push(EXTPURPOSE_REV[oid] || oid); } /* * This is a bit of a hack: in the case where we have a cert * that's only allowed to do serverAuth or clientAuth (and not * the other), we want to make sure all our Subjects are of * the right type. But we already parsed our Subjects and * decided if they were hosts or users earlier (since it appears * first in the cert). * * So we go through and mutate them into the right kind here if * it doesn't match. This might not be hugely beneficial, as it * seems that single-purpose certs are not often seen in the * wild. */ if (cert.purposes.indexOf('serverAuth') !== -1 && cert.purposes.indexOf('clientAuth') === -1) { cert.subjects.forEach(function (ide) { if (ide.type !== 'host') { ide.type = 'host'; ide.hostname = ide.uid || ide.email || ide.components[0].value; } }); } else if (cert.purposes.indexOf('clientAuth') !== -1 && cert.purposes.indexOf('serverAuth') === -1) { cert.subjects.forEach(function (ide) { if (ide.type !== 'user') { ide.type = 'user'; ide.uid = ide.hostname || ide.email || ide.components[0].value; } }); } sig.extras.exts.push({ oid: extId, critical: critical }); break; case (EXTS.keyUsage): der.readSequence(asn1.Ber.OctetString); var bits = der.readString(asn1.Ber.BitString, true); var setBits = readBitField(bits, KEYUSEBITS); setBits.forEach(function (bit) { if (cert.purposes === undefined) cert.purposes = []; if (cert.purposes.indexOf(bit) === -1) cert.purposes.push(bit); }); sig.extras.exts.push({ oid: extId, critical: critical, bits: bits }); break; case (EXTS.altName): der.readSequence(asn1.Ber.OctetString); der.readSequence(); var aeEnd = der.offset + der.length; while (der.offset < aeEnd) { switch (der.peek()) { case ALTNAME.OtherName: case ALTNAME.EDIPartyName: der.readSequence(); der._offset += der.length; break; case ALTNAME.OID: der.readOID(ALTNAME.OID); break; case ALTNAME.RFC822Name: /* RFC822 specifies email addresses */ var email = der.readString(ALTNAME.RFC822Name); id = Identity.forEmail(email); if (!cert.subjects[0].equals(id)) cert.subjects.push(id); break; case ALTNAME.DirectoryName: der.readSequence(ALTNAME.DirectoryName); id = Identity.parseAsn1(der); if (!cert.subjects[0].equals(id)) cert.subjects.push(id); break; case ALTNAME.DNSName: var host = der.readString( ALTNAME.DNSName); id = Identity.forHost(host); if (!cert.subjects[0].equals(id)) cert.subjects.push(id); break; default: der.readString(der.peek()); break; } } sig.extras.exts.push({ oid: extId, critical: critical }); break; default: sig.extras.exts.push({ oid: extId, critical: critical, data: der.readString(asn1.Ber.OctetString, true) }); break; } der._offset = after; } var UTCTIME_RE = /^([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})?Z$/; function utcTimeToDate(t) { var m = t.match(UTCTIME_RE); assert.ok(m, 'timestamps must be in UTC'); var d = new Date(); var thisYear = d.getUTCFullYear(); var century = Math.floor(thisYear / 100) * 100; var year = parseInt(m[1], 10); if (thisYear % 100 < 50 && year >= 60) year += (century - 1); else year += century; d.setUTCFullYear(year, parseInt(m[2], 10) - 1, parseInt(m[3], 10)); d.setUTCHours(parseInt(m[4], 10), parseInt(m[5], 10)); if (m[6] && m[6].length > 0) d.setUTCSeconds(parseInt(m[6], 10)); return (d); } var GTIME_RE = /^([0-9]{4})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})?Z$/; function gTimeToDate(t) { var m = t.match(GTIME_RE); assert.ok(m); var d = new Date(); d.setUTCFullYear(parseInt(m[1], 10), parseInt(m[2], 10) - 1, parseInt(m[3], 10)); d.setUTCHours(parseInt(m[4], 10), parseInt(m[5], 10)); if (m[6] && m[6].length > 0) d.setUTCSeconds(parseInt(m[6], 10)); return (d); } function zeroPad(n, m) { if (m === undefined) m = 2; var s = '' + n; while (s.length < m) s = '0' + s; return (s); } function dateToUTCTime(d) { var s = ''; s += zeroPad(d.getUTCFullYear() % 100); s += zeroPad(d.getUTCMonth() + 1); s += zeroPad(d.getUTCDate()); s += zeroPad(d.getUTCHours()); s += zeroPad(d.getUTCMinutes()); s += zeroPad(d.getUTCSeconds()); s += 'Z'; return (s); } function dateToGTime(d) { var s = ''; s += zeroPad(d.getUTCFullYear(), 4); s += zeroPad(d.getUTCMonth() + 1); s += zeroPad(d.getUTCDate()); s += zeroPad(d.getUTCHours()); s += zeroPad(d.getUTCMinutes()); s += zeroPad(d.getUTCSeconds()); s += 'Z'; return (s); } function sign(cert, key) { if (cert.signatures.x509 === undefined) cert.signatures.x509 = {}; var sig = cert.signatures.x509; sig.algo = key.type + '-' + key.defaultHashAlgorithm(); if (SIGN_ALGS[sig.algo] === undefined) return (false); var der = new asn1.BerWriter(); writeTBSCert(cert, der); var blob = der.buffer; sig.cache = blob; var signer = key.createSign(); signer.write(blob); cert.signatures.x509.signature = signer.sign(); return (true); } function signAsync(cert, signer, done) { if (cert.signatures.x509 === undefined) cert.signatures.x509 = {}; var sig = cert.signatures.x509; var der = new asn1.BerWriter(); writeTBSCert(cert, der); var blob = der.buffer; sig.cache = blob; signer(blob, function (err, signature) { if (err) { done(err); return; } sig.algo = signature.type + '-' + signature.hashAlgorithm; if (SIGN_ALGS[sig.algo] === undefined) { done(new Error('Invalid signing algorithm "' + sig.algo + '"')); return; } sig.signature = signature; done(); }); } function write(cert, options) { var sig = cert.signatures.x509; assert.object(sig, 'x509 signature'); var der = new asn1.BerWriter(); der.startSequence(); if (sig.cache) { der._ensure(sig.cache.length); sig.cache.copy(der._buf, der._offset); der._offset += sig.cache.length; } else { writeTBSCert(cert, der); } der.startSequence(); der.writeOID(SIGN_ALGS[sig.algo]); if (sig.algo.match(/^rsa-/)) der.writeNull(); der.endSequence(); var sigData = sig.signature.toBuffer('asn1'); var data = Buffer.alloc(sigData.length + 1); data[0] = 0; sigData.copy(data, 1); der.writeBuffer(data, asn1.Ber.BitString); der.endSequence(); return (der.buffer); } function writeTBSCert(cert, der) { var sig = cert.signatures.x509; assert.object(sig, 'x509 signature'); der.startSequence(); der.startSequence(Local(0)); der.writeInt(2); der.endSequence(); der.writeBuffer(utils.mpNormalize(cert.serial), asn1.Ber.Integer); der.startSequence(); der.writeOID(SIGN_ALGS[sig.algo]); if (sig.algo.match(/^rsa-/)) der.writeNull(); der.endSequence(); cert.issuer.toAsn1(der); der.startSequence(); writeDate(der, cert.validFrom); writeDate(der, cert.validUntil); der.endSequence(); var subject = cert.subjects[0]; var altNames = cert.subjects.slice(1); subject.toAsn1(der); pkcs8.writePkcs8(der, cert.subjectKey); if (sig.extras && sig.extras.issuerUniqueID) { der.writeBuffer(sig.extras.issuerUniqueID, Local(1)); } if (sig.extras && sig.extras.subjectUniqueID) { der.writeBuffer(sig.extras.subjectUniqueID, Local(2)); } if (altNames.length > 0 || subject.type === 'host' || (cert.purposes !== undefined && cert.purposes.length > 0) || (sig.extras && sig.extras.exts)) { der.startSequence(Local(3)); der.startSequence(); var exts = []; if (cert.purposes !== undefined && cert.purposes.length > 0) { exts.push({ oid: EXTS.basicConstraints, critical: true }); exts.push({ oid: EXTS.keyUsage, critical: true }); exts.push({ oid: EXTS.extKeyUsage, critical: true }); } exts.push({ oid: EXTS.altName }); if (sig.extras && sig.extras.exts) exts = sig.extras.exts; for (var i = 0; i < exts.length; ++i) { der.startSequence(); der.writeOID(exts[i].oid); if (exts[i].critical !== undefined) der.writeBoolean(exts[i].critical); if (exts[i].oid === EXTS.altName) { der.startSequence(asn1.Ber.OctetString); der.startSequence(); if (subject.type === 'host') { der.writeString(subject.hostname, Context(2)); } for (var j = 0; j < altNames.length; ++j) { if (altNames[j].type === 'host') { der.writeString( altNames[j].hostname, ALTNAME.DNSName); } else if (altNames[j].type === 'email') { der.writeString( altNames[j].email, ALTNAME.RFC822Name); } else { /* * Encode anything else as a * DN style name for now. */ der.startSequence( ALTNAME.DirectoryName); altNames[j].toAsn1(der); der.endSequence(); } } der.endSequence(); der.endSequence(); } else if (exts[i].oid === EXTS.basicConstraints) { der.startSequence(asn1.Ber.OctetString); der.startSequence(); var ca = (cert.purposes.indexOf('ca') !== -1); var pathLen = exts[i].pathLen; der.writeBoolean(ca); if (pathLen !== undefined) der.writeInt(pathLen); der.endSequence(); der.endSequence(); } else if (exts[i].oid === EXTS.extKeyUsage) { der.startSequence(asn1.Ber.OctetString); der.startSequence(); cert.purposes.forEach(function (purpose) { if (purpose === 'ca') return; if (KEYUSEBITS.indexOf(purpose) !== -1) return; var oid = purpose; if (EXTPURPOSE[purpose] !== undefined) oid = EXTPURPOSE[purpose]; der.writeOID(oid); }); der.endSequence(); der.endSequence(); } else if (exts[i].oid === EXTS.keyUsage) { der.startSequence(asn1.Ber.OctetString); /* * If we parsed this certificate from a byte * stream (i.e. we didn't generate it in sshpk) * then we'll have a ".bits" property on the * ext with the original raw byte contents. * * If we have this, use it here instead of * regenerating it. This guarantees we output * the same data we parsed, so signatures still * validate. */ if (exts[i].bits !== undefined) { der.writeBuffer(exts[i].bits, asn1.Ber.BitString); } else { var bits = writeBitField(cert.purposes, KEYUSEBITS); der.writeBuffer(bits, asn1.Ber.BitString); } der.endSequence(); } else { der.writeBuffer(exts[i].data, asn1.Ber.OctetString); } der.endSequence(); } der.endSequence(); der.endSequence(); } der.endSequence(); } /* * Reads an ASN.1 BER bitfield out of the Buffer produced by doing * `BerReader#readString(asn1.Ber.BitString)`. That function gives us the raw * contents of the BitString tag, which is a count of unused bits followed by * the bits as a right-padded byte string. * * `bits` is the Buffer, `bitIndex` should contain an array of string names * for the bits in the string, ordered starting with bit #0 in the ASN.1 spec. * * Returns an array of Strings, the names of the bits that were set to 1. */ function readBitField(bits, bitIndex) { var bitLen = 8 * (bits.length - 1) - bits[0]; var setBits = {}; for (var i = 0; i < bitLen; ++i) { var byteN = 1 + Math.floor(i / 8); var bit = 7 - (i % 8); var mask = 1 << bit; var bitVal = ((bits[byteN] & mask) !== 0); var name = bitIndex[i]; if (bitVal && typeof (name) === 'string') { setBits[name] = true; } } return (Object.keys(setBits)); } /* * `setBits` is an array of strings, containing the names for each bit that * sould be set to 1. `bitIndex` is same as in `readBitField()`. * * Returns a Buffer, ready to be written out with `BerWriter#writeString()`. */ function writeBitField(setBits, bitIndex) { var bitLen = bitIndex.length; var blen = Math.ceil(bitLen / 8); var unused = blen * 8 - bitLen; var bits = Buffer.alloc(1 + blen); // zero-filled bits[0] = unused; for (var i = 0; i < bitLen; ++i) { var byteN = 1 + Math.floor(i / 8); var bit = 7 - (i % 8); var mask = 1 << bit; var name = bitIndex[i]; if (name === undefined) continue; var bitVal = (setBits.indexOf(name) !== -1); if (bitVal) { bits[byteN] |= mask; } } return (bits); } /***/ }), /***/ 867: /***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; var URI = __webpack_require__(853) , equal = __webpack_require__(832) , util = __webpack_require__(855) , SchemaObject = __webpack_require__(955) , traverse = __webpack_require__(340); module.exports = resolve; resolve.normalizeId = normalizeId; resolve.fullPath = getFullPath; resolve.url = resolveUrl; resolve.ids = resolveIds; resolve.inlineRef = inlineRef; resolve.schema = resolveSchema; /** * [resolve and compile the references ($ref)] * @this Ajv * @param {Function} compile reference to schema compilation funciton (localCompile) * @param {Object} root object with information about the root schema for the current schema * @param {String} ref reference to resolve * @return {Object|Function} schema object (if the schema can be inlined) or validation function */ function resolve(compile, root, ref) { /* jshint validthis: true */ var refVal = this._refs[ref]; if (typeof refVal == 'string') { if (this._refs[refVal]) refVal = this._refs[refVal]; else return resolve.call(this, compile, root, refVal); } refVal = refVal || this._schemas[ref]; if (refVal instanceof SchemaObject) { return inlineRef(refVal.schema, this._opts.inlineRefs) ? refVal.schema : refVal.validate || this._compile(refVal); } var res = resolveSchema.call(this, root, ref); var schema, v, baseId; if (res) { schema = res.schema; root = res.root; baseId = res.baseId; } if (schema instanceof SchemaObject) { v = schema.validate || compile.call(this, schema.schema, root, undefined, baseId); } else if (schema !== undefined) { v = inlineRef(schema, this._opts.inlineRefs) ? schema : compile.call(this, schema, root, undefined, baseId); } return v; } /** * Resolve schema, its root and baseId * @this Ajv * @param {Object} root root object with properties schema, refVal, refs * @param {String} ref reference to resolve * @return {Object} object with properties schema, root, baseId */ function resolveSchema(root, ref) { /* jshint validthis: true */ var p = URI.parse(ref) , refPath = _getFullPath(p) , baseId = getFullPath(this._getId(root.schema)); if (Object.keys(root.schema).length === 0 || refPath !== baseId) { var id = normalizeId(refPath); var refVal = this._refs[id]; if (typeof refVal == 'string') { return resolveRecursive.call(this, root, refVal, p); } else if (refVal instanceof SchemaObject) { if (!refVal.validate) this._compile(refVal); root = refVal; } else { refVal = this._schemas[id]; if (refVal instanceof SchemaObject) { if (!refVal.validate) this._compile(refVal); if (id == normalizeId(ref)) return { schema: refVal, root: root, baseId: baseId }; root = refVal; } else { return; } } if (!root.schema) return; baseId = getFullPath(this._getId(root.schema)); } return getJsonPointer.call(this, p, baseId, root.schema, root); } /* @this Ajv */ function resolveRecursive(root, ref, parsedRef) { /* jshint validthis: true */ var res = resolveSchema.call(this, root, ref); if (res) { var schema = res.schema; var baseId = res.baseId; root = res.root; var id = this._getId(schema); if (id) baseId = resolveUrl(baseId, id); return getJsonPointer.call(this, parsedRef, baseId, schema, root); } } var PREVENT_SCOPE_CHANGE = util.toHash(['properties', 'patternProperties', 'enum', 'dependencies', 'definitions']); /* @this Ajv */ function getJsonPointer(parsedRef, baseId, schema, root) { /* jshint validthis: true */ parsedRef.fragment = parsedRef.fragment || ''; if (parsedRef.fragment.slice(0,1) != '/') return; var parts = parsedRef.fragment.split('/'); for (var i = 1; i < parts.length; i++) { var part = parts[i]; if (part) { part = util.unescapeFragment(part); schema = schema[part]; if (schema === undefined) break; var id; if (!PREVENT_SCOPE_CHANGE[part]) { id = this._getId(schema); if (id) baseId = resolveUrl(baseId, id); if (schema.$ref) { var $ref = resolveUrl(baseId, schema.$ref); var res = resolveSchema.call(this, root, $ref); if (res) { schema = res.schema; root = res.root; baseId = res.baseId; } } } } } if (schema !== undefined && schema !== root.schema) return { schema: schema, root: root, baseId: baseId }; } var SIMPLE_INLINED = util.toHash([ 'type', 'format', 'pattern', 'maxLength', 'minLength', 'maxProperties', 'minProperties', 'maxItems', 'minItems', 'maximum', 'minimum', 'uniqueItems', 'multipleOf', 'required', 'enum' ]); function inlineRef(schema, limit) { if (limit === false) return false; if (limit === undefined || limit === true) return checkNoRef(schema); else if (limit) return countKeys(schema) <= limit; } function checkNoRef(schema) { var item; if (Array.isArray(schema)) { for (var i=0; i%\\^`{|}]|%[0-9a-f]{2})|\{[+#./;?&=,!@|]?(?:[a-z0-9_]|%[0-9a-f]{2})+(?::[1-9][0-9]{0,3}|\*)?(?:,(?:[a-z0-9_]|%[0-9a-f]{2})+(?::[1-9][0-9]{0,3}|\*)?)*\})*$/i; // For the source: https://gist.github.com/dperini/729294 // For test cases: https://mathiasbynens.be/demo/url-regex // @todo Delete current URL in favour of the commented out URL rule when this issue is fixed https://github.com/eslint/eslint/issues/7983. // var URL = /^(?:(?:https?|ftp):\/\/)(?:\S+(?::\S*)?@)?(?:(?!10(?:\.\d{1,3}){3})(?!127(?:\.\d{1,3}){3})(?!169\.254(?:\.\d{1,3}){2})(?!192\.168(?:\.\d{1,3}){2})(?!172\.(?:1[6-9]|2\d|3[0-1])(?:\.\d{1,3}){2})(?:[1-9]\d?|1\d\d|2[01]\d|22[0-3])(?:\.(?:1?\d{1,2}|2[0-4]\d|25[0-5])){2}(?:\.(?:[1-9]\d?|1\d\d|2[0-4]\d|25[0-4]))|(?:(?:[a-z\u{00a1}-\u{ffff}0-9]+-?)*[a-z\u{00a1}-\u{ffff}0-9]+)(?:\.(?:[a-z\u{00a1}-\u{ffff}0-9]+-?)*[a-z\u{00a1}-\u{ffff}0-9]+)*(?:\.(?:[a-z\u{00a1}-\u{ffff}]{2,})))(?::\d{2,5})?(?:\/[^\s]*)?$/iu; var URL = /^(?:(?:http[s\u017F]?|ftp):\/\/)(?:(?:[\0-\x08\x0E-\x1F!-\x9F\xA1-\u167F\u1681-\u1FFF\u200B-\u2027\u202A-\u202E\u2030-\u205E\u2060-\u2FFF\u3001-\uD7FF\uE000-\uFEFE\uFF00-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+(?::(?:[\0-\x08\x0E-\x1F!-\x9F\xA1-\u167F\u1681-\u1FFF\u200B-\u2027\u202A-\u202E\u2030-\u205E\u2060-\u2FFF\u3001-\uD7FF\uE000-\uFEFE\uFF00-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])*)?@)?(?:(?!10(?:\.[0-9]{1,3}){3})(?!127(?:\.[0-9]{1,3}){3})(?!169\.254(?:\.[0-9]{1,3}){2})(?!192\.168(?:\.[0-9]{1,3}){2})(?!172\.(?:1[6-9]|2[0-9]|3[01])(?:\.[0-9]{1,3}){2})(?:[1-9][0-9]?|1[0-9][0-9]|2[01][0-9]|22[0-3])(?:\.(?:1?[0-9]{1,2}|2[0-4][0-9]|25[0-5])){2}(?:\.(?:[1-9][0-9]?|1[0-9][0-9]|2[0-4][0-9]|25[0-4]))|(?:(?:(?:[0-9KSa-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+-?)*(?:[0-9KSa-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+)(?:\.(?:(?:[0-9KSa-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+-?)*(?:[0-9KSa-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+)*(?:\.(?:(?:[KSa-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF]){2,})))(?::[0-9]{2,5})?(?:\/(?:[\0-\x08\x0E-\x1F!-\x9F\xA1-\u167F\u1681-\u1FFF\u200B-\u2027\u202A-\u202E\u2030-\u205E\u2060-\u2FFF\u3001-\uD7FF\uE000-\uFEFE\uFF00-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])*)?$/i; var UUID = /^(?:urn:uuid:)?[0-9a-f]{8}-(?:[0-9a-f]{4}-){3}[0-9a-f]{12}$/i; var JSON_POINTER = /^(?:\/(?:[^~/]|~0|~1)*)*$/; var JSON_POINTER_URI_FRAGMENT = /^#(?:\/(?:[a-z0-9_\-.!$&'()*+,;:=@]|%[0-9a-f]{2}|~0|~1)*)*$/i; var RELATIVE_JSON_POINTER = /^(?:0|[1-9][0-9]*)(?:#|(?:\/(?:[^~/]|~0|~1)*)*)$/; module.exports = formats; function formats(mode) { mode = mode == 'full' ? 'full' : 'fast'; return util.copy(formats[mode]); } formats.fast = { // date: http://tools.ietf.org/html/rfc3339#section-5.6 date: /^\d\d\d\d-[0-1]\d-[0-3]\d$/, // date-time: http://tools.ietf.org/html/rfc3339#section-5.6 time: /^(?:[0-2]\d:[0-5]\d:[0-5]\d|23:59:60)(?:\.\d+)?(?:z|[+-]\d\d(?::?\d\d)?)?$/i, 'date-time': /^\d\d\d\d-[0-1]\d-[0-3]\d[t\s](?:[0-2]\d:[0-5]\d:[0-5]\d|23:59:60)(?:\.\d+)?(?:z|[+-]\d\d(?::?\d\d)?)$/i, // uri: https://github.com/mafintosh/is-my-json-valid/blob/master/formats.js uri: /^(?:[a-z][a-z0-9+-.]*:)(?:\/?\/)?[^\s]*$/i, 'uri-reference': /^(?:(?:[a-z][a-z0-9+-.]*:)?\/?\/)?(?:[^\\\s#][^\s#]*)?(?:#[^\\\s]*)?$/i, 'uri-template': URITEMPLATE, url: URL, // email (sources from jsen validator): // http://stackoverflow.com/questions/201323/using-a-regular-expression-to-validate-an-email-address#answer-8829363 // http://www.w3.org/TR/html5/forms.html#valid-e-mail-address (search for 'willful violation') email: /^[a-z0-9.!#$%&'*+/=?^_`{|}~-]+@[a-z0-9](?:[a-z0-9-]{0,61}[a-z0-9])?(?:\.[a-z0-9](?:[a-z0-9-]{0,61}[a-z0-9])?)*$/i, hostname: HOSTNAME, // optimized https://www.safaribooksonline.com/library/view/regular-expressions-cookbook/9780596802837/ch07s16.html ipv4: /^(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?)$/, // optimized http://stackoverflow.com/questions/53497/regular-expression-that-matches-valid-ipv6-addresses ipv6: /^\s*(?:(?:(?:[0-9a-f]{1,4}:){7}(?:[0-9a-f]{1,4}|:))|(?:(?:[0-9a-f]{1,4}:){6}(?::[0-9a-f]{1,4}|(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){5}(?:(?:(?::[0-9a-f]{1,4}){1,2})|:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){4}(?:(?:(?::[0-9a-f]{1,4}){1,3})|(?:(?::[0-9a-f]{1,4})?:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){3}(?:(?:(?::[0-9a-f]{1,4}){1,4})|(?:(?::[0-9a-f]{1,4}){0,2}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){2}(?:(?:(?::[0-9a-f]{1,4}){1,5})|(?:(?::[0-9a-f]{1,4}){0,3}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){1}(?:(?:(?::[0-9a-f]{1,4}){1,6})|(?:(?::[0-9a-f]{1,4}){0,4}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?::(?:(?:(?::[0-9a-f]{1,4}){1,7})|(?:(?::[0-9a-f]{1,4}){0,5}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:)))(?:%.+)?\s*$/i, regex: regex, // uuid: http://tools.ietf.org/html/rfc4122 uuid: UUID, // JSON-pointer: https://tools.ietf.org/html/rfc6901 // uri fragment: https://tools.ietf.org/html/rfc3986#appendix-A 'json-pointer': JSON_POINTER, 'json-pointer-uri-fragment': JSON_POINTER_URI_FRAGMENT, // relative JSON-pointer: http://tools.ietf.org/html/draft-luff-relative-json-pointer-00 'relative-json-pointer': RELATIVE_JSON_POINTER }; formats.full = { date: date, time: time, 'date-time': date_time, uri: uri, 'uri-reference': URIREF, 'uri-template': URITEMPLATE, url: URL, email: /^[a-z0-9!#$%&'*+/=?^_`{|}~-]+(?:\.[a-z0-9!#$%&'*+/=?^_`{|}~-]+)*@(?:[a-z0-9](?:[a-z0-9-]*[a-z0-9])?\.)+[a-z0-9](?:[a-z0-9-]*[a-z0-9])?$/i, hostname: HOSTNAME, ipv4: /^(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?)$/, ipv6: /^\s*(?:(?:(?:[0-9a-f]{1,4}:){7}(?:[0-9a-f]{1,4}|:))|(?:(?:[0-9a-f]{1,4}:){6}(?::[0-9a-f]{1,4}|(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){5}(?:(?:(?::[0-9a-f]{1,4}){1,2})|:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){4}(?:(?:(?::[0-9a-f]{1,4}){1,3})|(?:(?::[0-9a-f]{1,4})?:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){3}(?:(?:(?::[0-9a-f]{1,4}){1,4})|(?:(?::[0-9a-f]{1,4}){0,2}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){2}(?:(?:(?::[0-9a-f]{1,4}){1,5})|(?:(?::[0-9a-f]{1,4}){0,3}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){1}(?:(?:(?::[0-9a-f]{1,4}){1,6})|(?:(?::[0-9a-f]{1,4}){0,4}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?::(?:(?:(?::[0-9a-f]{1,4}){1,7})|(?:(?::[0-9a-f]{1,4}){0,5}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:)))(?:%.+)?\s*$/i, regex: regex, uuid: UUID, 'json-pointer': JSON_POINTER, 'json-pointer-uri-fragment': JSON_POINTER_URI_FRAGMENT, 'relative-json-pointer': RELATIVE_JSON_POINTER }; function isLeapYear(year) { // https://tools.ietf.org/html/rfc3339#appendix-C return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0); } function date(str) { // full-date from http://tools.ietf.org/html/rfc3339#section-5.6 var matches = str.match(DATE); if (!matches) return false; var year = +matches[1]; var month = +matches[2]; var day = +matches[3]; return month >= 1 && month <= 12 && day >= 1 && day <= (month == 2 && isLeapYear(year) ? 29 : DAYS[month]); } function time(str, full) { var matches = str.match(TIME); if (!matches) return false; var hour = matches[1]; var minute = matches[2]; var second = matches[3]; var timeZone = matches[5]; return ((hour <= 23 && minute <= 59 && second <= 59) || (hour == 23 && minute == 59 && second == 60)) && (!full || timeZone); } var DATE_TIME_SEPARATOR = /t|\s/i; function date_time(str) { // http://tools.ietf.org/html/rfc3339#section-5.6 var dateTime = str.split(DATE_TIME_SEPARATOR); return dateTime.length == 2 && date(dateTime[0]) && time(dateTime[1], true); } var NOT_URI_FRAGMENT = /\/|:/; function uri(str) { // http://jmrware.com/articles/2009/uri_regexp/URI_regex.html + optional protocol + required "." return NOT_URI_FRAGMENT.test(str) && URI.test(str); } var Z_ANCHOR = /[^\\]\\Z/; function regex(str) { if (Z_ANCHOR.test(str)) return false; try { new RegExp(str); return true; } catch(e) { return false; } } /***/ }), /***/ 883: /***/ (function(module) { module.exports = {"$id":"header.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["name","value"],"properties":{"name":{"type":"string"},"value":{"type":"string"},"comment":{"type":"string"}}}; /***/ }), /***/ 886: /***/ (function(__unusedmodule, exports, __webpack_require__) { var crypto = __webpack_require__(417); var BigInteger = __webpack_require__(242).BigInteger; var ECPointFp = __webpack_require__(729).ECPointFp; var Buffer = __webpack_require__(215).Buffer; exports.ECCurves = __webpack_require__(959); // zero prepad function unstupid(hex,len) { return (hex.length >= len) ? hex : unstupid("0"+hex,len); } exports.ECKey = function(curve, key, isPublic) { var priv; var c = curve(); var n = c.getN(); var bytes = Math.floor(n.bitLength()/8); if(key) { if(isPublic) { var curve = c.getCurve(); // var x = key.slice(1,bytes+1); // skip the 04 for uncompressed format // var y = key.slice(bytes+1); // this.P = new ECPointFp(curve, // curve.fromBigInteger(new BigInteger(x.toString("hex"), 16)), // curve.fromBigInteger(new BigInteger(y.toString("hex"), 16))); this.P = curve.decodePointHex(key.toString("hex")); }else{ if(key.length != bytes) return false; priv = new BigInteger(key.toString("hex"), 16); } }else{ var n1 = n.subtract(BigInteger.ONE); var r = new BigInteger(crypto.randomBytes(n.bitLength())); priv = r.mod(n1).add(BigInteger.ONE); this.P = c.getG().multiply(priv); } if(this.P) { // var pubhex = unstupid(this.P.getX().toBigInteger().toString(16),bytes*2)+unstupid(this.P.getY().toBigInteger().toString(16),bytes*2); // this.PublicKey = Buffer.from("04"+pubhex,"hex"); this.PublicKey = Buffer.from(c.getCurve().encodeCompressedPointHex(this.P),"hex"); } if(priv) { this.PrivateKey = Buffer.from(unstupid(priv.toString(16),bytes*2),"hex"); this.deriveSharedSecret = function(key) { if(!key || !key.P) return false; var S = key.P.multiply(priv); return Buffer.from(unstupid(S.getX().toBigInteger().toString(16),bytes*2),"hex"); } } } /***/ }), /***/ 887: /***/ (function(__unusedmodule, exports, __webpack_require__) { /* * extsprintf.js: extended POSIX-style sprintf */ var mod_assert = __webpack_require__(357); var mod_util = __webpack_require__(669); /* * Public interface */ exports.sprintf = jsSprintf; exports.printf = jsPrintf; exports.fprintf = jsFprintf; /* * Stripped down version of s[n]printf(3c). We make a best effort to throw an * exception when given a format string we don't understand, rather than * ignoring it, so that we won't break existing programs if/when we go implement * the rest of this. * * This implementation currently supports specifying * - field alignment ('-' flag), * - zero-pad ('0' flag) * - always show numeric sign ('+' flag), * - field width * - conversions for strings, decimal integers, and floats (numbers). * - argument size specifiers. These are all accepted but ignored, since * Javascript has no notion of the physical size of an argument. * * Everything else is currently unsupported, most notably precision, unsigned * numbers, non-decimal numbers, and characters. */ function jsSprintf(ofmt) { var regex = [ '([^%]*)', /* normal text */ '%', /* start of format */ '([\'\\-+ #0]*?)', /* flags (optional) */ '([1-9]\\d*)?', /* width (optional) */ '(\\.([1-9]\\d*))?', /* precision (optional) */ '[lhjztL]*?', /* length mods (ignored) */ '([diouxXfFeEgGaAcCsSp%jr])' /* conversion */ ].join(''); var re = new RegExp(regex); /* variadic arguments used to fill in conversion specifiers */ var args = Array.prototype.slice.call(arguments, 1); /* remaining format string */ var fmt = ofmt; /* components of the current conversion specifier */ var flags, width, precision, conversion; var left, pad, sign, arg, match; /* return value */ var ret = ''; /* current variadic argument (1-based) */ var argn = 1; /* 0-based position in the format string that we've read */ var posn = 0; /* 1-based position in the format string of the current conversion */ var convposn; /* current conversion specifier */ var curconv; mod_assert.equal('string', typeof (fmt), 'first argument must be a format string'); while ((match = re.exec(fmt)) !== null) { ret += match[1]; fmt = fmt.substring(match[0].length); /* * Update flags related to the current conversion specifier's * position so that we can report clear error messages. */ curconv = match[0].substring(match[1].length); convposn = posn + match[1].length + 1; posn += match[0].length; flags = match[2] || ''; width = match[3] || 0; precision = match[4] || ''; conversion = match[6]; left = false; sign = false; pad = ' '; if (conversion == '%') { ret += '%'; continue; } if (args.length === 0) { throw (jsError(ofmt, convposn, curconv, 'has no matching argument ' + '(too few arguments passed)')); } arg = args.shift(); argn++; if (flags.match(/[\' #]/)) { throw (jsError(ofmt, convposn, curconv, 'uses unsupported flags')); } if (precision.length > 0) { throw (jsError(ofmt, convposn, curconv, 'uses non-zero precision (not supported)')); } if (flags.match(/-/)) left = true; if (flags.match(/0/)) pad = '0'; if (flags.match(/\+/)) sign = true; switch (conversion) { case 's': if (arg === undefined || arg === null) { throw (jsError(ofmt, convposn, curconv, 'attempted to print undefined or null ' + 'as a string (argument ' + argn + ' to ' + 'sprintf)')); } ret += doPad(pad, width, left, arg.toString()); break; case 'd': arg = Math.floor(arg); /*jsl:fallthru*/ case 'f': sign = sign && arg > 0 ? '+' : ''; ret += sign + doPad(pad, width, left, arg.toString()); break; case 'x': ret += doPad(pad, width, left, arg.toString(16)); break; case 'j': /* non-standard */ if (width === 0) width = 10; ret += mod_util.inspect(arg, false, width); break; case 'r': /* non-standard */ ret += dumpException(arg); break; default: throw (jsError(ofmt, convposn, curconv, 'is not supported')); } } ret += fmt; return (ret); } function jsError(fmtstr, convposn, curconv, reason) { mod_assert.equal(typeof (fmtstr), 'string'); mod_assert.equal(typeof (curconv), 'string'); mod_assert.equal(typeof (convposn), 'number'); mod_assert.equal(typeof (reason), 'string'); return (new Error('format string "' + fmtstr + '": conversion specifier "' + curconv + '" at character ' + convposn + ' ' + reason)); } function jsPrintf() { var args = Array.prototype.slice.call(arguments); args.unshift(process.stdout); jsFprintf.apply(null, args); } function jsFprintf(stream) { var args = Array.prototype.slice.call(arguments, 1); return (stream.write(jsSprintf.apply(this, args))); } function doPad(chr, width, left, str) { var ret = str; while (ret.length < width) { if (left) ret += chr; else ret = chr + ret; } return (ret); } /* * This function dumps long stack traces for exceptions having a cause() method. * See node-verror for an example. */ function dumpException(ex) { var ret; if (!(ex instanceof Error)) throw (new Error(jsSprintf('invalid type for %%r: %j', ex))); /* Note that V8 prepends "ex.stack" with ex.toString(). */ ret = 'EXCEPTION: ' + ex.constructor.name + ': ' + ex.stack; if (ex.cause && typeof (ex.cause) === 'function') { var cex = ex.cause(); if (cex) { ret += '\nCaused by: ' + dumpException(cex); } } return (ret); } /***/ }), /***/ 890: /***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; var MissingRefError = __webpack_require__(844).MissingRef; module.exports = compileAsync; /** * Creates validating function for passed schema with asynchronous loading of missing schemas. * `loadSchema` option should be a function that accepts schema uri and returns promise that resolves with the schema. * @this Ajv * @param {Object} schema schema object * @param {Boolean} meta optional true to compile meta-schema; this parameter can be skipped * @param {Function} callback an optional node-style callback, it is called with 2 parameters: error (or null) and validating function. * @return {Promise} promise that resolves with a validating function. */ function compileAsync(schema, meta, callback) { /* eslint no-shadow: 0 */ /* global Promise */ /* jshint validthis: true */ var self = this; if (typeof this._opts.loadSchema != 'function') throw new Error('options.loadSchema should be a function'); if (typeof meta == 'function') { callback = meta; meta = undefined; } var p = loadMetaSchemaOf(schema).then(function () { var schemaObj = self._addSchema(schema, undefined, meta); return schemaObj.validate || _compileAsync(schemaObj); }); if (callback) { p.then( function(v) { callback(null, v); }, callback ); } return p; function loadMetaSchemaOf(sch) { var $schema = sch.$schema; return $schema && !self.getSchema($schema) ? compileAsync.call(self, { $ref: $schema }, true) : Promise.resolve(); } function _compileAsync(schemaObj) { try { return self._compile(schemaObj); } catch(e) { if (e instanceof MissingRefError) return loadMissingSchema(e); throw e; } function loadMissingSchema(e) { var ref = e.missingSchema; if (added(ref)) throw new Error('Schema ' + ref + ' is loaded but ' + e.missingRef + ' cannot be resolved'); var schemaPromise = self._loadingSchemas[ref]; if (!schemaPromise) { schemaPromise = self._loadingSchemas[ref] = self._opts.loadSchema(ref); schemaPromise.then(removePromise, removePromise); } return schemaPromise.then(function (sch) { if (!added(ref)) { return loadMetaSchemaOf(sch).then(function () { if (!added(ref)) self.addSchema(sch, ref, undefined, meta); }); } }).then(function() { return _compileAsync(schemaObj); }); function removePromise() { delete self._loadingSchemas[ref]; } function added(ref) { return self._refs[ref] || self._schemas[ref]; } } } } /***/ }), /***/ 892: /***/ (function(module, __unusedexports, __webpack_require__) { var iterate = __webpack_require__(157) , initState = __webpack_require__(147) , terminator = __webpack_require__(939) ; // Public API module.exports = serialOrdered; // sorting helpers module.exports.ascending = ascending; module.exports.descending = descending; /** * Runs iterator over provided sorted array elements in series * * @param {array|object} list - array or object (named list) to iterate over * @param {function} iterator - iterator to run * @param {function} sortMethod - custom sort function * @param {function} callback - invoked when all elements processed * @returns {function} - jobs terminator */ function serialOrdered(list, iterator, sortMethod, callback) { var state = initState(list, sortMethod); iterate(list, iterator, state, function iteratorHandler(error, result) { if (error) { callback(error, result); return; } state.index++; // are we there yet? if (state.index < (state['keyedList'] || list).length) { iterate(list, iterator, state, iteratorHandler); return; } // done here callback(null, state.results); }); return terminator.bind(state, callback); } /* * -- Sort methods */ /** * sort helper to sort array elements in ascending order * * @param {mixed} a - an item to compare * @param {mixed} b - an item to compare * @returns {number} - comparison result */ function ascending(a, b) { return a < b ? -1 : a > b ? 1 : 0; } /** * sort helper to sort array elements in descending order * * @param {mixed} a - an item to compare * @param {mixed} b - an item to compare * @returns {number} - comparison result */ function descending(a, b) { return -1 * ascending(a, b); } /***/ }), /***/ 893: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2017 Joyent, Inc. module.exports = { read: read, verify: verify, sign: sign, signAsync: signAsync, write: write, /* Internal private API */ fromBuffer: fromBuffer, toBuffer: toBuffer }; var assert = __webpack_require__(477); var SSHBuffer = __webpack_require__(940); var crypto = __webpack_require__(417); var Buffer = __webpack_require__(215).Buffer; var algs = __webpack_require__(98); var Key = __webpack_require__(852); var PrivateKey = __webpack_require__(502); var Identity = __webpack_require__(378); var rfc4253 = __webpack_require__(538); var Signature = __webpack_require__(575); var utils = __webpack_require__(270); var Certificate = __webpack_require__(752); function verify(cert, key) { /* * We always give an issuerKey, so if our verify() is being called then * there was no signature. Return false. */ return (false); } var TYPES = { 'user': 1, 'host': 2 }; Object.keys(TYPES).forEach(function (k) { TYPES[TYPES[k]] = k; }); var ECDSA_ALGO = /^ecdsa-sha2-([^@-]+)-cert-v01@openssh.com$/; function read(buf, options) { if (Buffer.isBuffer(buf)) buf = buf.toString('ascii'); var parts = buf.trim().split(/[ \t\n]+/g); if (parts.length < 2 || parts.length > 3) throw (new Error('Not a valid SSH certificate line')); var algo = parts[0]; var data = parts[1]; data = Buffer.from(data, 'base64'); return (fromBuffer(data, algo)); } function fromBuffer(data, algo, partial) { var sshbuf = new SSHBuffer({ buffer: data }); var innerAlgo = sshbuf.readString(); if (algo !== undefined && innerAlgo !== algo) throw (new Error('SSH certificate algorithm mismatch')); if (algo === undefined) algo = innerAlgo; var cert = {}; cert.signatures = {}; cert.signatures.openssh = {}; cert.signatures.openssh.nonce = sshbuf.readBuffer(); var key = {}; var parts = (key.parts = []); key.type = getAlg(algo); var partCount = algs.info[key.type].parts.length; while (parts.length < partCount) parts.push(sshbuf.readPart()); assert.ok(parts.length >= 1, 'key must have at least one part'); var algInfo = algs.info[key.type]; if (key.type === 'ecdsa') { var res = ECDSA_ALGO.exec(algo); assert.ok(res !== null); assert.strictEqual(res[1], parts[0].data.toString()); } for (var i = 0; i < algInfo.parts.length; ++i) { parts[i].name = algInfo.parts[i]; if (parts[i].name !== 'curve' && algInfo.normalize !== false) { var p = parts[i]; p.data = utils.mpNormalize(p.data); } } cert.subjectKey = new Key(key); cert.serial = sshbuf.readInt64(); var type = TYPES[sshbuf.readInt()]; assert.string(type, 'valid cert type'); cert.signatures.openssh.keyId = sshbuf.readString(); var principals = []; var pbuf = sshbuf.readBuffer(); var psshbuf = new SSHBuffer({ buffer: pbuf }); while (!psshbuf.atEnd()) principals.push(psshbuf.readString()); if (principals.length === 0) principals = ['*']; cert.subjects = principals.map(function (pr) { if (type === 'user') return (Identity.forUser(pr)); else if (type === 'host') return (Identity.forHost(pr)); throw (new Error('Unknown identity type ' + type)); }); cert.validFrom = int64ToDate(sshbuf.readInt64()); cert.validUntil = int64ToDate(sshbuf.readInt64()); var exts = []; var extbuf = new SSHBuffer({ buffer: sshbuf.readBuffer() }); var ext; while (!extbuf.atEnd()) { ext = { critical: true }; ext.name = extbuf.readString(); ext.data = extbuf.readBuffer(); exts.push(ext); } extbuf = new SSHBuffer({ buffer: sshbuf.readBuffer() }); while (!extbuf.atEnd()) { ext = { critical: false }; ext.name = extbuf.readString(); ext.data = extbuf.readBuffer(); exts.push(ext); } cert.signatures.openssh.exts = exts; /* reserved */ sshbuf.readBuffer(); var signingKeyBuf = sshbuf.readBuffer(); cert.issuerKey = rfc4253.read(signingKeyBuf); /* * OpenSSH certs don't give the identity of the issuer, just their * public key. So, we use an Identity that matches anything. The * isSignedBy() function will later tell you if the key matches. */ cert.issuer = Identity.forHost('**'); var sigBuf = sshbuf.readBuffer(); cert.signatures.openssh.signature = Signature.parse(sigBuf, cert.issuerKey.type, 'ssh'); if (partial !== undefined) { partial.remainder = sshbuf.remainder(); partial.consumed = sshbuf._offset; } return (new Certificate(cert)); } function int64ToDate(buf) { var i = buf.readUInt32BE(0) * 4294967296; i += buf.readUInt32BE(4); var d = new Date(); d.setTime(i * 1000); d.sourceInt64 = buf; return (d); } function dateToInt64(date) { if (date.sourceInt64 !== undefined) return (date.sourceInt64); var i = Math.round(date.getTime() / 1000); var upper = Math.floor(i / 4294967296); var lower = Math.floor(i % 4294967296); var buf = Buffer.alloc(8); buf.writeUInt32BE(upper, 0); buf.writeUInt32BE(lower, 4); return (buf); } function sign(cert, key) { if (cert.signatures.openssh === undefined) cert.signatures.openssh = {}; try { var blob = toBuffer(cert, true); } catch (e) { delete (cert.signatures.openssh); return (false); } var sig = cert.signatures.openssh; var hashAlgo = undefined; if (key.type === 'rsa' || key.type === 'dsa') hashAlgo = 'sha1'; var signer = key.createSign(hashAlgo); signer.write(blob); sig.signature = signer.sign(); return (true); } function signAsync(cert, signer, done) { if (cert.signatures.openssh === undefined) cert.signatures.openssh = {}; try { var blob = toBuffer(cert, true); } catch (e) { delete (cert.signatures.openssh); done(e); return; } var sig = cert.signatures.openssh; signer(blob, function (err, signature) { if (err) { done(err); return; } try { /* * This will throw if the signature isn't of a * type/algo that can be used for SSH. */ signature.toBuffer('ssh'); } catch (e) { done(e); return; } sig.signature = signature; done(); }); } function write(cert, options) { if (options === undefined) options = {}; var blob = toBuffer(cert); var out = getCertType(cert.subjectKey) + ' ' + blob.toString('base64'); if (options.comment) out = out + ' ' + options.comment; return (out); } function toBuffer(cert, noSig) { assert.object(cert.signatures.openssh, 'signature for openssh format'); var sig = cert.signatures.openssh; if (sig.nonce === undefined) sig.nonce = crypto.randomBytes(16); var buf = new SSHBuffer({}); buf.writeString(getCertType(cert.subjectKey)); buf.writeBuffer(sig.nonce); var key = cert.subjectKey; var algInfo = algs.info[key.type]; algInfo.parts.forEach(function (part) { buf.writePart(key.part[part]); }); buf.writeInt64(cert.serial); var type = cert.subjects[0].type; assert.notStrictEqual(type, 'unknown'); cert.subjects.forEach(function (id) { assert.strictEqual(id.type, type); }); type = TYPES[type]; buf.writeInt(type); if (sig.keyId === undefined) { sig.keyId = cert.subjects[0].type + '_' + (cert.subjects[0].uid || cert.subjects[0].hostname); } buf.writeString(sig.keyId); var sub = new SSHBuffer({}); cert.subjects.forEach(function (id) { if (type === TYPES.host) sub.writeString(id.hostname); else if (type === TYPES.user) sub.writeString(id.uid); }); buf.writeBuffer(sub.toBuffer()); buf.writeInt64(dateToInt64(cert.validFrom)); buf.writeInt64(dateToInt64(cert.validUntil)); var exts = sig.exts; if (exts === undefined) exts = []; var extbuf = new SSHBuffer({}); exts.forEach(function (ext) { if (ext.critical !== true) return; extbuf.writeString(ext.name); extbuf.writeBuffer(ext.data); }); buf.writeBuffer(extbuf.toBuffer()); extbuf = new SSHBuffer({}); exts.forEach(function (ext) { if (ext.critical === true) return; extbuf.writeString(ext.name); extbuf.writeBuffer(ext.data); }); buf.writeBuffer(extbuf.toBuffer()); /* reserved */ buf.writeBuffer(Buffer.alloc(0)); sub = rfc4253.write(cert.issuerKey); buf.writeBuffer(sub); if (!noSig) buf.writeBuffer(sig.signature.toBuffer('ssh')); return (buf.toBuffer()); } function getAlg(certType) { if (certType === 'ssh-rsa-cert-v01@openssh.com') return ('rsa'); if (certType === 'ssh-dss-cert-v01@openssh.com') return ('dsa'); if (certType.match(ECDSA_ALGO)) return ('ecdsa'); if (certType === 'ssh-ed25519-cert-v01@openssh.com') return ('ed25519'); throw (new Error('Unsupported cert type ' + certType)); } function getCertType(key) { if (key.type === 'rsa') return ('ssh-rsa-cert-v01@openssh.com'); if (key.type === 'dsa') return ('ssh-dss-cert-v01@openssh.com'); if (key.type === 'ecdsa') return ('ecdsa-sha2-' + key.curve + '-cert-v01@openssh.com'); if (key.type === 'ed25519') return ('ssh-ed25519-cert-v01@openssh.com'); throw (new Error('Unsupported key type ' + key.type)); } /***/ }), /***/ 894: /***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; //all requires must be explicit because browserify won't work with dynamic requires module.exports = { '$ref': __webpack_require__(266), allOf: __webpack_require__(107), anyOf: __webpack_require__(902), '$comment': __webpack_require__(28), const: __webpack_require__(662), contains: __webpack_require__(154), dependencies: __webpack_require__(233), 'enum': __webpack_require__(281), format: __webpack_require__(687), 'if': __webpack_require__(479), items: __webpack_require__(643), maximum: __webpack_require__(341), minimum: __webpack_require__(341), maxItems: __webpack_require__(85), minItems: __webpack_require__(85), maxLength: __webpack_require__(772), minLength: __webpack_require__(772), maxProperties: __webpack_require__(560), minProperties: __webpack_require__(560), multipleOf: __webpack_require__(397), not: __webpack_require__(673), oneOf: __webpack_require__(653), pattern: __webpack_require__(542), properties: __webpack_require__(343), propertyNames: __webpack_require__(35), required: __webpack_require__(858), uniqueItems: __webpack_require__(899), validate: __webpack_require__(967) }; /***/ }), /***/ 897: /***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; var utils = __webpack_require__(581); var formats = __webpack_require__(13); var arrayPrefixGenerators = { brackets: function brackets(prefix) { // eslint-disable-line func-name-matching return prefix + '[]'; }, indices: function indices(prefix, key) { // eslint-disable-line func-name-matching return prefix + '[' + key + ']'; }, repeat: function repeat(prefix) { // eslint-disable-line func-name-matching return prefix; } }; var toISO = Date.prototype.toISOString; var defaults = { delimiter: '&', encode: true, encoder: utils.encode, encodeValuesOnly: false, serializeDate: function serializeDate(date) { // eslint-disable-line func-name-matching return toISO.call(date); }, skipNulls: false, strictNullHandling: false }; var stringify = function stringify( // eslint-disable-line func-name-matching object, prefix, generateArrayPrefix, strictNullHandling, skipNulls, encoder, filter, sort, allowDots, serializeDate, formatter, encodeValuesOnly ) { var obj = object; if (typeof filter === 'function') { obj = filter(prefix, obj); } else if (obj instanceof Date) { obj = serializeDate(obj); } else if (obj === null) { if (strictNullHandling) { return encoder && !encodeValuesOnly ? encoder(prefix, defaults.encoder) : prefix; } obj = ''; } if (typeof obj === 'string' || typeof obj === 'number' || typeof obj === 'boolean' || utils.isBuffer(obj)) { if (encoder) { var keyValue = encodeValuesOnly ? prefix : encoder(prefix, defaults.encoder); return [formatter(keyValue) + '=' + formatter(encoder(obj, defaults.encoder))]; } return [formatter(prefix) + '=' + formatter(String(obj))]; } var values = []; if (typeof obj === 'undefined') { return values; } var objKeys; if (Array.isArray(filter)) { objKeys = filter; } else { var keys = Object.keys(obj); objKeys = sort ? keys.sort(sort) : keys; } for (var i = 0; i < objKeys.length; ++i) { var key = objKeys[i]; if (skipNulls && obj[key] === null) { continue; } if (Array.isArray(obj)) { values = values.concat(stringify( obj[key], generateArrayPrefix(prefix, key), generateArrayPrefix, strictNullHandling, skipNulls, encoder, filter, sort, allowDots, serializeDate, formatter, encodeValuesOnly )); } else { values = values.concat(stringify( obj[key], prefix + (allowDots ? '.' + key : '[' + key + ']'), generateArrayPrefix, strictNullHandling, skipNulls, encoder, filter, sort, allowDots, serializeDate, formatter, encodeValuesOnly )); } } return values; }; module.exports = function (object, opts) { var obj = object; var options = opts ? utils.assign({}, opts) : {}; if (options.encoder !== null && options.encoder !== undefined && typeof options.encoder !== 'function') { throw new TypeError('Encoder has to be a function.'); } var delimiter = typeof options.delimiter === 'undefined' ? defaults.delimiter : options.delimiter; var strictNullHandling = typeof options.strictNullHandling === 'boolean' ? options.strictNullHandling : defaults.strictNullHandling; var skipNulls = typeof options.skipNulls === 'boolean' ? options.skipNulls : defaults.skipNulls; var encode = typeof options.encode === 'boolean' ? options.encode : defaults.encode; var encoder = typeof options.encoder === 'function' ? options.encoder : defaults.encoder; var sort = typeof options.sort === 'function' ? options.sort : null; var allowDots = typeof options.allowDots === 'undefined' ? false : options.allowDots; var serializeDate = typeof options.serializeDate === 'function' ? options.serializeDate : defaults.serializeDate; var encodeValuesOnly = typeof options.encodeValuesOnly === 'boolean' ? options.encodeValuesOnly : defaults.encodeValuesOnly; if (typeof options.format === 'undefined') { options.format = formats['default']; } else if (!Object.prototype.hasOwnProperty.call(formats.formatters, options.format)) { throw new TypeError('Unknown format option provided.'); } var formatter = formats.formatters[options.format]; var objKeys; var filter; if (typeof options.filter === 'function') { filter = options.filter; obj = filter('', obj); } else if (Array.isArray(options.filter)) { filter = options.filter; objKeys = filter; } var keys = []; if (typeof obj !== 'object' || obj === null) { return ''; } var arrayFormat; if (options.arrayFormat in arrayPrefixGenerators) { arrayFormat = options.arrayFormat; } else if ('indices' in options) { arrayFormat = options.indices ? 'indices' : 'repeat'; } else { arrayFormat = 'indices'; } var generateArrayPrefix = arrayPrefixGenerators[arrayFormat]; if (!objKeys) { objKeys = Object.keys(obj); } if (sort) { objKeys.sort(sort); } for (var i = 0; i < objKeys.length; ++i) { var key = objKeys[i]; if (skipNulls && obj[key] === null) { continue; } keys = keys.concat(stringify( obj[key], key, generateArrayPrefix, strictNullHandling, skipNulls, encode ? encoder : null, filter, sort, allowDots, serializeDate, formatter, encodeValuesOnly )); } var joined = keys.join(delimiter); var prefix = options.addQueryPrefix === true ? '?' : ''; return joined.length > 0 ? prefix + joined : ''; }; /***/ }), /***/ 899: /***/ (function(module) { "use strict"; module.exports = function generate_uniqueItems(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $data = 'data' + ($dataLvl || ''); var $valid = 'valid' + $lvl; var $isData = it.opts.$data && $schema && $schema.$data, $schemaValue; if ($isData) { out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; $schemaValue = 'schema' + $lvl; } else { $schemaValue = $schema; } if (($schema || $isData) && it.opts.uniqueItems !== false) { if ($isData) { out += ' var ' + ($valid) + '; if (' + ($schemaValue) + ' === false || ' + ($schemaValue) + ' === undefined) ' + ($valid) + ' = true; else if (typeof ' + ($schemaValue) + ' != \'boolean\') ' + ($valid) + ' = false; else { '; } out += ' var i = ' + ($data) + '.length , ' + ($valid) + ' = true , j; if (i > 1) { '; var $itemType = it.schema.items && it.schema.items.type, $typeIsArray = Array.isArray($itemType); if (!$itemType || $itemType == 'object' || $itemType == 'array' || ($typeIsArray && ($itemType.indexOf('object') >= 0 || $itemType.indexOf('array') >= 0))) { out += ' outer: for (;i--;) { for (j = i; j--;) { if (equal(' + ($data) + '[i], ' + ($data) + '[j])) { ' + ($valid) + ' = false; break outer; } } } '; } else { out += ' var itemIndices = {}, item; for (;i--;) { var item = ' + ($data) + '[i]; '; var $method = 'checkDataType' + ($typeIsArray ? 's' : ''); out += ' if (' + (it.util[$method]($itemType, 'item', true)) + ') continue; '; if ($typeIsArray) { out += ' if (typeof item == \'string\') item = \'"\' + item; '; } out += ' if (typeof itemIndices[item] == \'number\') { ' + ($valid) + ' = false; j = itemIndices[item]; break; } itemIndices[item] = i; } '; } out += ' } '; if ($isData) { out += ' } '; } out += ' if (!' + ($valid) + ') { '; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('uniqueItems') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { i: i, j: j } '; if (it.opts.messages !== false) { out += ' , message: \'should NOT have duplicate items (items ## \' + j + \' and \' + i + \' are identical)\' '; } if (it.opts.verbose) { out += ' , schema: '; if ($isData) { out += 'validate.schema' + ($schemaPath); } else { out += '' + ($schema); } out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } out += ' } '; if ($breakOnError) { out += ' else { '; } } else { if ($breakOnError) { out += ' if (true) { '; } } return out; } /***/ }), /***/ 902: /***/ (function(module) { "use strict"; module.exports = function generate_anyOf(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $data = 'data' + ($dataLvl || ''); var $valid = 'valid' + $lvl; var $errs = 'errs__' + $lvl; var $it = it.util.copy(it); var $closingBraces = ''; $it.level++; var $nextValid = 'valid' + $it.level; var $noEmptySchema = $schema.every(function($sch) { return (it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all)); }); if ($noEmptySchema) { var $currentBaseId = $it.baseId; out += ' var ' + ($errs) + ' = errors; var ' + ($valid) + ' = false; '; var $wasComposite = it.compositeRule; it.compositeRule = $it.compositeRule = true; var arr1 = $schema; if (arr1) { var $sch, $i = -1, l1 = arr1.length - 1; while ($i < l1) { $sch = arr1[$i += 1]; $it.schema = $sch; $it.schemaPath = $schemaPath + '[' + $i + ']'; $it.errSchemaPath = $errSchemaPath + '/' + $i; out += ' ' + (it.validate($it)) + ' '; $it.baseId = $currentBaseId; out += ' ' + ($valid) + ' = ' + ($valid) + ' || ' + ($nextValid) + '; if (!' + ($valid) + ') { '; $closingBraces += '}'; } } it.compositeRule = $it.compositeRule = $wasComposite; out += ' ' + ($closingBraces) + ' if (!' + ($valid) + ') { var err = '; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ('anyOf') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; if (it.opts.messages !== false) { out += ' , message: \'should match some schema in anyOf\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError(vErrors); '; } else { out += ' validate.errors = vErrors; return false; '; } } out += ' } else { errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } '; if (it.opts.allErrors) { out += ' } '; } out = it.util.cleanUpCode(out); } else { if ($breakOnError) { out += ' if (true) { '; } } return out; } /***/ }), /***/ 909: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2012 Joyent, Inc. All rights reserved. var assert = __webpack_require__(477); var sshpk = __webpack_require__(650); var util = __webpack_require__(669); var HASH_ALGOS = { 'sha1': true, 'sha256': true, 'sha512': true }; var PK_ALGOS = { 'rsa': true, 'dsa': true, 'ecdsa': true }; function HttpSignatureError(message, caller) { if (Error.captureStackTrace) Error.captureStackTrace(this, caller || HttpSignatureError); this.message = message; this.name = caller.name; } util.inherits(HttpSignatureError, Error); function InvalidAlgorithmError(message) { HttpSignatureError.call(this, message, InvalidAlgorithmError); } util.inherits(InvalidAlgorithmError, HttpSignatureError); function validateAlgorithm(algorithm) { var alg = algorithm.toLowerCase().split('-'); if (alg.length !== 2) { throw (new InvalidAlgorithmError(alg[0].toUpperCase() + ' is not a ' + 'valid algorithm')); } if (alg[0] !== 'hmac' && !PK_ALGOS[alg[0]]) { throw (new InvalidAlgorithmError(alg[0].toUpperCase() + ' type keys ' + 'are not supported')); } if (!HASH_ALGOS[alg[1]]) { throw (new InvalidAlgorithmError(alg[1].toUpperCase() + ' is not a ' + 'supported hash algorithm')); } return (alg); } ///--- API module.exports = { HASH_ALGOS: HASH_ALGOS, PK_ALGOS: PK_ALGOS, HttpSignatureError: HttpSignatureError, InvalidAlgorithmError: InvalidAlgorithmError, validateAlgorithm: validateAlgorithm, /** * Converts an OpenSSH public key (rsa only) to a PKCS#8 PEM file. * * The intent of this module is to interoperate with OpenSSL only, * specifically the node crypto module's `verify` method. * * @param {String} key an OpenSSH public key. * @return {String} PEM encoded form of the RSA public key. * @throws {TypeError} on bad input. * @throws {Error} on invalid ssh key formatted data. */ sshKeyToPEM: function sshKeyToPEM(key) { assert.string(key, 'ssh_key'); var k = sshpk.parseKey(key, 'ssh'); return (k.toString('pem')); }, /** * Generates an OpenSSH fingerprint from an ssh public key. * * @param {String} key an OpenSSH public key. * @return {String} key fingerprint. * @throws {TypeError} on bad input. * @throws {Error} if what you passed doesn't look like an ssh public key. */ fingerprint: function fingerprint(key) { assert.string(key, 'ssh_key'); var k = sshpk.parseKey(key, 'ssh'); return (k.fingerprint('md5').toString('hex')); }, /** * Converts a PKGCS#8 PEM file to an OpenSSH public key (rsa) * * The reverse of the above function. */ pemToRsaSSHKey: function pemToRsaSSHKey(pem, comment) { assert.equal('string', typeof (pem), 'typeof pem'); var k = sshpk.parseKey(pem, 'pem'); k.comment = comment; return (k.toString('ssh')); } }; /***/ }), /***/ 919: /***/ (function(module) { module.exports = {"$id":"entry.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","optional":true,"required":["startedDateTime","time","request","response","cache","timings"],"properties":{"pageref":{"type":"string"},"startedDateTime":{"type":"string","format":"date-time","pattern":"^(\\d{4})(-)?(\\d\\d)(-)?(\\d\\d)(T)?(\\d\\d)(:)?(\\d\\d)(:)?(\\d\\d)(\\.\\d+)?(Z|([+-])(\\d\\d)(:)?(\\d\\d))"},"time":{"type":"number","min":0},"request":{"$ref":"request.json#"},"response":{"$ref":"response.json#"},"cache":{"$ref":"cache.json#"},"timings":{"$ref":"timings.json#"},"serverIPAddress":{"type":"string","oneOf":[{"format":"ipv4"},{"format":"ipv6"}]},"connection":{"type":"string"},"comment":{"type":"string"}}}; /***/ }), /***/ 921: /***/ (function(module) { "use strict"; var Cache = module.exports = function Cache() { this._cache = {}; }; Cache.prototype.put = function Cache_put(key, value) { this._cache[key] = value; }; Cache.prototype.get = function Cache_get(key) { return this._cache[key]; }; Cache.prototype.del = function Cache_del(key) { delete this._cache[key]; }; Cache.prototype.clear = function Cache_clear() { this._cache = {}; }; /***/ }), /***/ 928: /***/ (function(module, __unusedexports, __webpack_require__) { var CombinedStream = __webpack_require__(547); var util = __webpack_require__(669); var path = __webpack_require__(622); var http = __webpack_require__(605); var https = __webpack_require__(211); var parseUrl = __webpack_require__(835).parse; var fs = __webpack_require__(747); var mime = __webpack_require__(779); var asynckit = __webpack_require__(334); var populate = __webpack_require__(69); // Public API module.exports = FormData; // make it a Stream util.inherits(FormData, CombinedStream); /** * Create readable "multipart/form-data" streams. * Can be used to submit forms * and file uploads to other web applications. * * @constructor * @param {Object} options - Properties to be added/overriden for FormData and CombinedStream */ function FormData(options) { if (!(this instanceof FormData)) { return new FormData(); } this._overheadLength = 0; this._valueLength = 0; this._valuesToMeasure = []; CombinedStream.call(this); options = options || {}; for (var option in options) { this[option] = options[option]; } } FormData.LINE_BREAK = '\r\n'; FormData.DEFAULT_CONTENT_TYPE = 'application/octet-stream'; FormData.prototype.append = function(field, value, options) { options = options || {}; // allow filename as single option if (typeof options == 'string') { options = {filename: options}; } var append = CombinedStream.prototype.append.bind(this); // all that streamy business can't handle numbers if (typeof value == 'number') { value = '' + value; } // https://github.com/felixge/node-form-data/issues/38 if (util.isArray(value)) { // Please convert your array into string // the way web server expects it this._error(new Error('Arrays are not supported.')); return; } var header = this._multiPartHeader(field, value, options); var footer = this._multiPartFooter(); append(header); append(value); append(footer); // pass along options.knownLength this._trackLength(header, value, options); }; FormData.prototype._trackLength = function(header, value, options) { var valueLength = 0; // used w/ getLengthSync(), when length is known. // e.g. for streaming directly from a remote server, // w/ a known file a size, and not wanting to wait for // incoming file to finish to get its size. if (options.knownLength != null) { valueLength += +options.knownLength; } else if (Buffer.isBuffer(value)) { valueLength = value.length; } else if (typeof value === 'string') { valueLength = Buffer.byteLength(value); } this._valueLength += valueLength; // @check why add CRLF? does this account for custom/multiple CRLFs? this._overheadLength += Buffer.byteLength(header) + FormData.LINE_BREAK.length; // empty or either doesn't have path or not an http response if (!value || ( !value.path && !(value.readable && value.hasOwnProperty('httpVersion')) )) { return; } // no need to bother with the length if (!options.knownLength) { this._valuesToMeasure.push(value); } }; FormData.prototype._lengthRetriever = function(value, callback) { if (value.hasOwnProperty('fd')) { // take read range into a account // `end` = Infinity –> read file till the end // // TODO: Looks like there is bug in Node fs.createReadStream // it doesn't respect `end` options without `start` options // Fix it when node fixes it. // https://github.com/joyent/node/issues/7819 if (value.end != undefined && value.end != Infinity && value.start != undefined) { // when end specified // no need to calculate range // inclusive, starts with 0 callback(null, value.end + 1 - (value.start ? value.start : 0)); // not that fast snoopy } else { // still need to fetch file size from fs fs.stat(value.path, function(err, stat) { var fileSize; if (err) { callback(err); return; } // update final size based on the range options fileSize = stat.size - (value.start ? value.start : 0); callback(null, fileSize); }); } // or http response } else if (value.hasOwnProperty('httpVersion')) { callback(null, +value.headers['content-length']); // or request stream http://github.com/mikeal/request } else if (value.hasOwnProperty('httpModule')) { // wait till response come back value.on('response', function(response) { value.pause(); callback(null, +response.headers['content-length']); }); value.resume(); // something else } else { callback('Unknown stream'); } }; FormData.prototype._multiPartHeader = function(field, value, options) { // custom header specified (as string)? // it becomes responsible for boundary // (e.g. to handle extra CRLFs on .NET servers) if (typeof options.header == 'string') { return options.header; } var contentDisposition = this._getContentDisposition(value, options); var contentType = this._getContentType(value, options); var contents = ''; var headers = { // add custom disposition as third element or keep it two elements if not 'Content-Disposition': ['form-data', 'name="' + field + '"'].concat(contentDisposition || []), // if no content type. allow it to be empty array 'Content-Type': [].concat(contentType || []) }; // allow custom headers. if (typeof options.header == 'object') { populate(headers, options.header); } var header; for (var prop in headers) { if (!headers.hasOwnProperty(prop)) continue; header = headers[prop]; // skip nullish headers. if (header == null) { continue; } // convert all headers to arrays. if (!Array.isArray(header)) { header = [header]; } // add non-empty headers. if (header.length) { contents += prop + ': ' + header.join('; ') + FormData.LINE_BREAK; } } return '--' + this.getBoundary() + FormData.LINE_BREAK + contents + FormData.LINE_BREAK; }; FormData.prototype._getContentDisposition = function(value, options) { var filename , contentDisposition ; if (typeof options.filepath === 'string') { // custom filepath for relative paths filename = path.normalize(options.filepath).replace(/\\/g, '/'); } else if (options.filename || value.name || value.path) { // custom filename take precedence // formidable and the browser add a name property // fs- and request- streams have path property filename = path.basename(options.filename || value.name || value.path); } else if (value.readable && value.hasOwnProperty('httpVersion')) { // or try http response filename = path.basename(value.client._httpMessage.path); } if (filename) { contentDisposition = 'filename="' + filename + '"'; } return contentDisposition; }; FormData.prototype._getContentType = function(value, options) { // use custom content-type above all var contentType = options.contentType; // or try `name` from formidable, browser if (!contentType && value.name) { contentType = mime.lookup(value.name); } // or try `path` from fs-, request- streams if (!contentType && value.path) { contentType = mime.lookup(value.path); } // or if it's http-reponse if (!contentType && value.readable && value.hasOwnProperty('httpVersion')) { contentType = value.headers['content-type']; } // or guess it from the filepath or filename if (!contentType && (options.filepath || options.filename)) { contentType = mime.lookup(options.filepath || options.filename); } // fallback to the default content type if `value` is not simple value if (!contentType && typeof value == 'object') { contentType = FormData.DEFAULT_CONTENT_TYPE; } return contentType; }; FormData.prototype._multiPartFooter = function() { return function(next) { var footer = FormData.LINE_BREAK; var lastPart = (this._streams.length === 0); if (lastPart) { footer += this._lastBoundary(); } next(footer); }.bind(this); }; FormData.prototype._lastBoundary = function() { return '--' + this.getBoundary() + '--' + FormData.LINE_BREAK; }; FormData.prototype.getHeaders = function(userHeaders) { var header; var formHeaders = { 'content-type': 'multipart/form-data; boundary=' + this.getBoundary() }; for (header in userHeaders) { if (userHeaders.hasOwnProperty(header)) { formHeaders[header.toLowerCase()] = userHeaders[header]; } } return formHeaders; }; FormData.prototype.getBoundary = function() { if (!this._boundary) { this._generateBoundary(); } return this._boundary; }; FormData.prototype._generateBoundary = function() { // This generates a 50 character boundary similar to those used by Firefox. // They are optimized for boyer-moore parsing. var boundary = '--------------------------'; for (var i = 0; i < 24; i++) { boundary += Math.floor(Math.random() * 10).toString(16); } this._boundary = boundary; }; // Note: getLengthSync DOESN'T calculate streams length // As workaround one can calculate file size manually // and add it as knownLength option FormData.prototype.getLengthSync = function() { var knownLength = this._overheadLength + this._valueLength; // Don't get confused, there are 3 "internal" streams for each keyval pair // so it basically checks if there is any value added to the form if (this._streams.length) { knownLength += this._lastBoundary().length; } // https://github.com/form-data/form-data/issues/40 if (!this.hasKnownLength()) { // Some async length retrievers are present // therefore synchronous length calculation is false. // Please use getLength(callback) to get proper length this._error(new Error('Cannot calculate proper length in synchronous way.')); } return knownLength; }; // Public API to check if length of added values is known // https://github.com/form-data/form-data/issues/196 // https://github.com/form-data/form-data/issues/262 FormData.prototype.hasKnownLength = function() { var hasKnownLength = true; if (this._valuesToMeasure.length) { hasKnownLength = false; } return hasKnownLength; }; FormData.prototype.getLength = function(cb) { var knownLength = this._overheadLength + this._valueLength; if (this._streams.length) { knownLength += this._lastBoundary().length; } if (!this._valuesToMeasure.length) { process.nextTick(cb.bind(this, null, knownLength)); return; } asynckit.parallel(this._valuesToMeasure, this._lengthRetriever, function(err, values) { if (err) { cb(err); return; } values.forEach(function(length) { knownLength += length; }); cb(null, knownLength); }); }; FormData.prototype.submit = function(params, cb) { var request , options , defaults = {method: 'post'} ; // parse provided url if it's string // or treat it as options object if (typeof params == 'string') { params = parseUrl(params); options = populate({ port: params.port, path: params.pathname, host: params.hostname, protocol: params.protocol }, defaults); // use custom params } else { options = populate(params, defaults); // if no port provided use default one if (!options.port) { options.port = options.protocol == 'https:' ? 443 : 80; } } // put that good code in getHeaders to some use options.headers = this.getHeaders(params.headers); // https if specified, fallback to http in any other case if (options.protocol == 'https:') { request = https.request(options); } else { request = http.request(options); } // get content length and fire away this.getLength(function(err, length) { if (err) { this._error(err); return; } // add content length request.setHeader('Content-Length', length); this.pipe(request); if (cb) { request.on('error', cb); request.on('response', cb.bind(this, null)); } }.bind(this)); return request; }; FormData.prototype._error = function(err) { if (!this.error) { this.error = err; this.pause(); this.emit('error', err); } }; FormData.prototype.toString = function () { return '[object FormData]'; }; /***/ }), /***/ 939: /***/ (function(module, __unusedexports, __webpack_require__) { var abort = __webpack_require__(566) , async = __webpack_require__(751) ; // API module.exports = terminator; /** * Terminates jobs in the attached state context * * @this AsyncKitState# * @param {function} callback - final callback to invoke after termination */ function terminator(callback) { if (!Object.keys(this.jobs).length) { return; } // fast forward iteration index this.index = this.size; // abort jobs abort(this); // send back results we have so far async(callback)(null, this.results); } /***/ }), /***/ 940: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2015 Joyent, Inc. module.exports = SSHBuffer; var assert = __webpack_require__(477); var Buffer = __webpack_require__(215).Buffer; function SSHBuffer(opts) { assert.object(opts, 'options'); if (opts.buffer !== undefined) assert.buffer(opts.buffer, 'options.buffer'); this._size = opts.buffer ? opts.buffer.length : 1024; this._buffer = opts.buffer || Buffer.alloc(this._size); this._offset = 0; } SSHBuffer.prototype.toBuffer = function () { return (this._buffer.slice(0, this._offset)); }; SSHBuffer.prototype.atEnd = function () { return (this._offset >= this._buffer.length); }; SSHBuffer.prototype.remainder = function () { return (this._buffer.slice(this._offset)); }; SSHBuffer.prototype.skip = function (n) { this._offset += n; }; SSHBuffer.prototype.expand = function () { this._size *= 2; var buf = Buffer.alloc(this._size); this._buffer.copy(buf, 0); this._buffer = buf; }; SSHBuffer.prototype.readPart = function () { return ({data: this.readBuffer()}); }; SSHBuffer.prototype.readBuffer = function () { var len = this._buffer.readUInt32BE(this._offset); this._offset += 4; assert.ok(this._offset + len <= this._buffer.length, 'length out of bounds at +0x' + this._offset.toString(16) + ' (data truncated?)'); var buf = this._buffer.slice(this._offset, this._offset + len); this._offset += len; return (buf); }; SSHBuffer.prototype.readString = function () { return (this.readBuffer().toString()); }; SSHBuffer.prototype.readCString = function () { var offset = this._offset; while (offset < this._buffer.length && this._buffer[offset] !== 0x00) offset++; assert.ok(offset < this._buffer.length, 'c string does not terminate'); var str = this._buffer.slice(this._offset, offset).toString(); this._offset = offset + 1; return (str); }; SSHBuffer.prototype.readInt = function () { var v = this._buffer.readUInt32BE(this._offset); this._offset += 4; return (v); }; SSHBuffer.prototype.readInt64 = function () { assert.ok(this._offset + 8 < this._buffer.length, 'buffer not long enough to read Int64'); var v = this._buffer.slice(this._offset, this._offset + 8); this._offset += 8; return (v); }; SSHBuffer.prototype.readChar = function () { var v = this._buffer[this._offset++]; return (v); }; SSHBuffer.prototype.writeBuffer = function (buf) { while (this._offset + 4 + buf.length > this._size) this.expand(); this._buffer.writeUInt32BE(buf.length, this._offset); this._offset += 4; buf.copy(this._buffer, this._offset); this._offset += buf.length; }; SSHBuffer.prototype.writeString = function (str) { this.writeBuffer(Buffer.from(str, 'utf8')); }; SSHBuffer.prototype.writeCString = function (str) { while (this._offset + 1 + str.length > this._size) this.expand(); this._buffer.write(str, this._offset); this._offset += str.length; this._buffer[this._offset++] = 0; }; SSHBuffer.prototype.writeInt = function (v) { while (this._offset + 4 > this._size) this.expand(); this._buffer.writeUInt32BE(v, this._offset); this._offset += 4; }; SSHBuffer.prototype.writeInt64 = function (v) { assert.buffer(v, 'value'); if (v.length > 8) { var lead = v.slice(0, v.length - 8); for (var i = 0; i < lead.length; ++i) { assert.strictEqual(lead[i], 0, 'must fit in 64 bits of precision'); } v = v.slice(v.length - 8, v.length); } while (this._offset + 8 > this._size) this.expand(); v.copy(this._buffer, this._offset); this._offset += 8; }; SSHBuffer.prototype.writeChar = function (v) { while (this._offset + 1 > this._size) this.expand(); this._buffer[this._offset++] = v; }; SSHBuffer.prototype.writePart = function (p) { this.writeBuffer(p.data); }; SSHBuffer.prototype.write = function (buf) { while (this._offset + buf.length > this._size) this.expand(); buf.copy(this._buffer, this._offset); this._offset += buf.length; }; /***/ }), /***/ 942: /***/ (function(module, __unusedexports, __webpack_require__) { /*! * Copyright 2010 LearnBoost * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ /** * Module dependencies. */ var crypto = __webpack_require__(417) , parse = __webpack_require__(835).parse ; /** * Valid keys. */ var keys = [ 'acl' , 'location' , 'logging' , 'notification' , 'partNumber' , 'policy' , 'requestPayment' , 'torrent' , 'uploadId' , 'uploads' , 'versionId' , 'versioning' , 'versions' , 'website' ] /** * Return an "Authorization" header value with the given `options` * in the form of "AWS :" * * @param {Object} options * @return {String} * @api private */ function authorization (options) { return 'AWS ' + options.key + ':' + sign(options) } module.exports = authorization module.exports.authorization = authorization /** * Simple HMAC-SHA1 Wrapper * * @param {Object} options * @return {String} * @api private */ function hmacSha1 (options) { return crypto.createHmac('sha1', options.secret).update(options.message).digest('base64') } module.exports.hmacSha1 = hmacSha1 /** * Create a base64 sha1 HMAC for `options`. * * @param {Object} options * @return {String} * @api private */ function sign (options) { options.message = stringToSign(options) return hmacSha1(options) } module.exports.sign = sign /** * Create a base64 sha1 HMAC for `options`. * * Specifically to be used with S3 presigned URLs * * @param {Object} options * @return {String} * @api private */ function signQuery (options) { options.message = queryStringToSign(options) return hmacSha1(options) } module.exports.signQuery= signQuery /** * Return a string for sign() with the given `options`. * * Spec: * * \n * \n * \n * \n * [headers\n] * * * @param {Object} options * @return {String} * @api private */ function stringToSign (options) { var headers = options.amazonHeaders || '' if (headers) headers += '\n' var r = [ options.verb , options.md5 , options.contentType , options.date ? options.date.toUTCString() : '' , headers + options.resource ] return r.join('\n') } module.exports.stringToSign = stringToSign /** * Return a string for sign() with the given `options`, but is meant exclusively * for S3 presigned URLs * * Spec: * * \n * * * @param {Object} options * @return {String} * @api private */ function queryStringToSign (options){ return 'GET\n\n\n' + options.date + '\n' + options.resource } module.exports.queryStringToSign = queryStringToSign /** * Perform the following: * * - ignore non-amazon headers * - lowercase fields * - sort lexicographically * - trim whitespace between ":" * - join with newline * * @param {Object} headers * @return {String} * @api private */ function canonicalizeHeaders (headers) { var buf = [] , fields = Object.keys(headers) ; for (var i = 0, len = fields.length; i < len; ++i) { var field = fields[i] , val = headers[field] , field = field.toLowerCase() ; if (0 !== field.indexOf('x-amz')) continue buf.push(field + ':' + val) } return buf.sort().join('\n') } module.exports.canonicalizeHeaders = canonicalizeHeaders /** * Perform the following: * * - ignore non sub-resources * - sort lexicographically * * @param {String} resource * @return {String} * @api private */ function canonicalizeResource (resource) { var url = parse(resource, true) , path = url.pathname , buf = [] ; Object.keys(url.query).forEach(function(key){ if (!~keys.indexOf(key)) return var val = '' == url.query[key] ? '' : '=' + encodeURIComponent(url.query[key]) buf.push(key + val) }) return path + (buf.length ? '?' + buf.sort().join('&') : '') } module.exports.canonicalizeResource = canonicalizeResource /***/ }), /***/ 944: /***/ (function(module) { module.exports = isTypedArray isTypedArray.strict = isStrictTypedArray isTypedArray.loose = isLooseTypedArray var toString = Object.prototype.toString var names = { '[object Int8Array]': true , '[object Int16Array]': true , '[object Int32Array]': true , '[object Uint8Array]': true , '[object Uint8ClampedArray]': true , '[object Uint16Array]': true , '[object Uint32Array]': true , '[object Float32Array]': true , '[object Float64Array]': true } function isTypedArray(arr) { return ( isStrictTypedArray(arr) || isLooseTypedArray(arr) ) } function isStrictTypedArray(arr) { return ( arr instanceof Int8Array || arr instanceof Int16Array || arr instanceof Int32Array || arr instanceof Uint8Array || arr instanceof Uint8ClampedArray || arr instanceof Uint16Array || arr instanceof Uint32Array || arr instanceof Float32Array || arr instanceof Float64Array ) } function isLooseTypedArray(arr) { return names[toString.call(arr)] } /***/ }), /***/ 952: /***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; var metaSchema = __webpack_require__(522); module.exports = { $id: 'https://github.com/epoberezkin/ajv/blob/master/lib/definition_schema.js', definitions: { simpleTypes: metaSchema.definitions.simpleTypes }, type: 'object', dependencies: { schema: ['validate'], $data: ['validate'], statements: ['inline'], valid: {not: {required: ['macro']}} }, properties: { type: metaSchema.properties.type, schema: {type: 'boolean'}, statements: {type: 'boolean'}, dependencies: { type: 'array', items: {type: 'string'} }, metaSchema: {type: 'object'}, modifying: {type: 'boolean'}, valid: {type: 'boolean'}, $data: {type: 'boolean'}, async: {type: 'boolean'}, errors: { anyOf: [ {type: 'boolean'}, {const: 'full'} ] } } }; /***/ }), /***/ 955: /***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; var util = __webpack_require__(855); module.exports = SchemaObject; function SchemaObject(obj) { util.copy(obj, this); } /***/ }), /***/ 956: /***/ (function(module, __unusedexports, __webpack_require__) { /* * verror.js: richer JavaScript errors */ var mod_assertplus = __webpack_require__(477); var mod_util = __webpack_require__(669); var mod_extsprintf = __webpack_require__(887); var mod_isError = __webpack_require__(286).isError; var sprintf = mod_extsprintf.sprintf; /* * Public interface */ /* So you can 'var VError = require('verror')' */ module.exports = VError; /* For compatibility */ VError.VError = VError; /* Other exported classes */ VError.SError = SError; VError.WError = WError; VError.MultiError = MultiError; /* * Common function used to parse constructor arguments for VError, WError, and * SError. Named arguments to this function: * * strict force strict interpretation of sprintf arguments, even * if the options in "argv" don't say so * * argv error's constructor arguments, which are to be * interpreted as described in README.md. For quick * reference, "argv" has one of the following forms: * * [ sprintf_args... ] (argv[0] is a string) * [ cause, sprintf_args... ] (argv[0] is an Error) * [ options, sprintf_args... ] (argv[0] is an object) * * This function normalizes these forms, producing an object with the following * properties: * * options equivalent to "options" in third form. This will never * be a direct reference to what the caller passed in * (i.e., it may be a shallow copy), so it can be freely * modified. * * shortmessage result of sprintf(sprintf_args), taking options.strict * into account as described in README.md. */ function parseConstructorArguments(args) { var argv, options, sprintf_args, shortmessage, k; mod_assertplus.object(args, 'args'); mod_assertplus.bool(args.strict, 'args.strict'); mod_assertplus.array(args.argv, 'args.argv'); argv = args.argv; /* * First, figure out which form of invocation we've been given. */ if (argv.length === 0) { options = {}; sprintf_args = []; } else if (mod_isError(argv[0])) { options = { 'cause': argv[0] }; sprintf_args = argv.slice(1); } else if (typeof (argv[0]) === 'object') { options = {}; for (k in argv[0]) { options[k] = argv[0][k]; } sprintf_args = argv.slice(1); } else { mod_assertplus.string(argv[0], 'first argument to VError, SError, or WError ' + 'constructor must be a string, object, or Error'); options = {}; sprintf_args = argv; } /* * Now construct the error's message. * * extsprintf (which we invoke here with our caller's arguments in order * to construct this Error's message) is strict in its interpretation of * values to be processed by the "%s" specifier. The value passed to * extsprintf must actually be a string or something convertible to a * String using .toString(). Passing other values (notably "null" and * "undefined") is considered a programmer error. The assumption is * that if you actually want to print the string "null" or "undefined", * then that's easy to do that when you're calling extsprintf; on the * other hand, if you did NOT want that (i.e., there's actually a bug * where the program assumes some variable is non-null and tries to * print it, which might happen when constructing a packet or file in * some specific format), then it's better to stop immediately than * produce bogus output. * * However, sometimes the bug is only in the code calling VError, and a * programmer might prefer to have the error message contain "null" or * "undefined" rather than have the bug in the error path crash the * program (making the first bug harder to identify). For that reason, * by default VError converts "null" or "undefined" arguments to their * string representations and passes those to extsprintf. Programmers * desiring the strict behavior can use the SError class or pass the * "strict" option to the VError constructor. */ mod_assertplus.object(options); if (!options.strict && !args.strict) { sprintf_args = sprintf_args.map(function (a) { return (a === null ? 'null' : a === undefined ? 'undefined' : a); }); } if (sprintf_args.length === 0) { shortmessage = ''; } else { shortmessage = sprintf.apply(null, sprintf_args); } return ({ 'options': options, 'shortmessage': shortmessage }); } /* * See README.md for reference documentation. */ function VError() { var args, obj, parsed, cause, ctor, message, k; args = Array.prototype.slice.call(arguments, 0); /* * This is a regrettable pattern, but JavaScript's built-in Error class * is defined to work this way, so we allow the constructor to be called * without "new". */ if (!(this instanceof VError)) { obj = Object.create(VError.prototype); VError.apply(obj, arguments); return (obj); } /* * For convenience and backwards compatibility, we support several * different calling forms. Normalize them here. */ parsed = parseConstructorArguments({ 'argv': args, 'strict': false }); /* * If we've been given a name, apply it now. */ if (parsed.options.name) { mod_assertplus.string(parsed.options.name, 'error\'s "name" must be a string'); this.name = parsed.options.name; } /* * For debugging, we keep track of the original short message (attached * this Error particularly) separately from the complete message (which * includes the messages of our cause chain). */ this.jse_shortmsg = parsed.shortmessage; message = parsed.shortmessage; /* * If we've been given a cause, record a reference to it and update our * message appropriately. */ cause = parsed.options.cause; if (cause) { mod_assertplus.ok(mod_isError(cause), 'cause is not an Error'); this.jse_cause = cause; if (!parsed.options.skipCauseMessage) { message += ': ' + cause.message; } } /* * If we've been given an object with properties, shallow-copy that * here. We don't want to use a deep copy in case there are non-plain * objects here, but we don't want to use the original object in case * the caller modifies it later. */ this.jse_info = {}; if (parsed.options.info) { for (k in parsed.options.info) { this.jse_info[k] = parsed.options.info[k]; } } this.message = message; Error.call(this, message); if (Error.captureStackTrace) { ctor = parsed.options.constructorOpt || this.constructor; Error.captureStackTrace(this, ctor); } return (this); } mod_util.inherits(VError, Error); VError.prototype.name = 'VError'; VError.prototype.toString = function ve_toString() { var str = (this.hasOwnProperty('name') && this.name || this.constructor.name || this.constructor.prototype.name); if (this.message) str += ': ' + this.message; return (str); }; /* * This method is provided for compatibility. New callers should use * VError.cause() instead. That method also uses the saner `null` return value * when there is no cause. */ VError.prototype.cause = function ve_cause() { var cause = VError.cause(this); return (cause === null ? undefined : cause); }; /* * Static methods * * These class-level methods are provided so that callers can use them on * instances of Errors that are not VErrors. New interfaces should be provided * only using static methods to eliminate the class of programming mistake where * people fail to check whether the Error object has the corresponding methods. */ VError.cause = function (err) { mod_assertplus.ok(mod_isError(err), 'err must be an Error'); return (mod_isError(err.jse_cause) ? err.jse_cause : null); }; VError.info = function (err) { var rv, cause, k; mod_assertplus.ok(mod_isError(err), 'err must be an Error'); cause = VError.cause(err); if (cause !== null) { rv = VError.info(cause); } else { rv = {}; } if (typeof (err.jse_info) == 'object' && err.jse_info !== null) { for (k in err.jse_info) { rv[k] = err.jse_info[k]; } } return (rv); }; VError.findCauseByName = function (err, name) { var cause; mod_assertplus.ok(mod_isError(err), 'err must be an Error'); mod_assertplus.string(name, 'name'); mod_assertplus.ok(name.length > 0, 'name cannot be empty'); for (cause = err; cause !== null; cause = VError.cause(cause)) { mod_assertplus.ok(mod_isError(cause)); if (cause.name == name) { return (cause); } } return (null); }; VError.hasCauseWithName = function (err, name) { return (VError.findCauseByName(err, name) !== null); }; VError.fullStack = function (err) { mod_assertplus.ok(mod_isError(err), 'err must be an Error'); var cause = VError.cause(err); if (cause) { return (err.stack + '\ncaused by: ' + VError.fullStack(cause)); } return (err.stack); }; VError.errorFromList = function (errors) { mod_assertplus.arrayOfObject(errors, 'errors'); if (errors.length === 0) { return (null); } errors.forEach(function (e) { mod_assertplus.ok(mod_isError(e)); }); if (errors.length == 1) { return (errors[0]); } return (new MultiError(errors)); }; VError.errorForEach = function (err, func) { mod_assertplus.ok(mod_isError(err), 'err must be an Error'); mod_assertplus.func(func, 'func'); if (err instanceof MultiError) { err.errors().forEach(function iterError(e) { func(e); }); } else { func(err); } }; /* * SError is like VError, but stricter about types. You cannot pass "null" or * "undefined" as string arguments to the formatter. */ function SError() { var args, obj, parsed, options; args = Array.prototype.slice.call(arguments, 0); if (!(this instanceof SError)) { obj = Object.create(SError.prototype); SError.apply(obj, arguments); return (obj); } parsed = parseConstructorArguments({ 'argv': args, 'strict': true }); options = parsed.options; VError.call(this, options, '%s', parsed.shortmessage); return (this); } /* * We don't bother setting SError.prototype.name because once constructed, * SErrors are just like VErrors. */ mod_util.inherits(SError, VError); /* * Represents a collection of errors for the purpose of consumers that generally * only deal with one error. Callers can extract the individual errors * contained in this object, but may also just treat it as a normal single * error, in which case a summary message will be printed. */ function MultiError(errors) { mod_assertplus.array(errors, 'list of errors'); mod_assertplus.ok(errors.length > 0, 'must be at least one error'); this.ase_errors = errors; VError.call(this, { 'cause': errors[0] }, 'first of %d error%s', errors.length, errors.length == 1 ? '' : 's'); } mod_util.inherits(MultiError, VError); MultiError.prototype.name = 'MultiError'; MultiError.prototype.errors = function me_errors() { return (this.ase_errors.slice(0)); }; /* * See README.md for reference details. */ function WError() { var args, obj, parsed, options; args = Array.prototype.slice.call(arguments, 0); if (!(this instanceof WError)) { obj = Object.create(WError.prototype); WError.apply(obj, args); return (obj); } parsed = parseConstructorArguments({ 'argv': args, 'strict': false }); options = parsed.options; options['skipCauseMessage'] = true; VError.call(this, options, '%s', parsed.shortmessage); return (this); } mod_util.inherits(WError, VError); WError.prototype.name = 'WError'; WError.prototype.toString = function we_toString() { var str = (this.hasOwnProperty('name') && this.name || this.constructor.name || this.constructor.prototype.name); if (this.message) str += ': ' + this.message; if (this.jse_cause && this.jse_cause.message) str += '; caused by ' + this.jse_cause.toString(); return (str); }; /* * For purely historical reasons, WError's cause() function allows you to set * the cause. */ WError.prototype.cause = function we_cause(c) { if (mod_isError(c)) this.jse_cause = c; return (this.jse_cause); }; /***/ }), /***/ 959: /***/ (function(module, __unusedexports, __webpack_require__) { // Named EC curves // Requires ec.js, jsbn.js, and jsbn2.js var BigInteger = __webpack_require__(242).BigInteger var ECCurveFp = __webpack_require__(729).ECCurveFp // ---------------- // X9ECParameters // constructor function X9ECParameters(curve,g,n,h) { this.curve = curve; this.g = g; this.n = n; this.h = h; } function x9getCurve() { return this.curve; } function x9getG() { return this.g; } function x9getN() { return this.n; } function x9getH() { return this.h; } X9ECParameters.prototype.getCurve = x9getCurve; X9ECParameters.prototype.getG = x9getG; X9ECParameters.prototype.getN = x9getN; X9ECParameters.prototype.getH = x9getH; // ---------------- // SECNamedCurves function fromHex(s) { return new BigInteger(s, 16); } function secp128r1() { // p = 2^128 - 2^97 - 1 var p = fromHex("FFFFFFFDFFFFFFFFFFFFFFFFFFFFFFFF"); var a = fromHex("FFFFFFFDFFFFFFFFFFFFFFFFFFFFFFFC"); var b = fromHex("E87579C11079F43DD824993C2CEE5ED3"); //byte[] S = Hex.decode("000E0D4D696E6768756151750CC03A4473D03679"); var n = fromHex("FFFFFFFE0000000075A30D1B9038A115"); var h = BigInteger.ONE; var curve = new ECCurveFp(p, a, b); var G = curve.decodePointHex("04" + "161FF7528B899B2D0C28607CA52C5B86" + "CF5AC8395BAFEB13C02DA292DDED7A83"); return new X9ECParameters(curve, G, n, h); } function secp160k1() { // p = 2^160 - 2^32 - 2^14 - 2^12 - 2^9 - 2^8 - 2^7 - 2^3 - 2^2 - 1 var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFAC73"); var a = BigInteger.ZERO; var b = fromHex("7"); //byte[] S = null; var n = fromHex("0100000000000000000001B8FA16DFAB9ACA16B6B3"); var h = BigInteger.ONE; var curve = new ECCurveFp(p, a, b); var G = curve.decodePointHex("04" + "3B4C382CE37AA192A4019E763036F4F5DD4D7EBB" + "938CF935318FDCED6BC28286531733C3F03C4FEE"); return new X9ECParameters(curve, G, n, h); } function secp160r1() { // p = 2^160 - 2^31 - 1 var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFFFF"); var a = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFFFC"); var b = fromHex("1C97BEFC54BD7A8B65ACF89F81D4D4ADC565FA45"); //byte[] S = Hex.decode("1053CDE42C14D696E67687561517533BF3F83345"); var n = fromHex("0100000000000000000001F4C8F927AED3CA752257"); var h = BigInteger.ONE; var curve = new ECCurveFp(p, a, b); var G = curve.decodePointHex("04" + "4A96B5688EF573284664698968C38BB913CBFC82" + "23A628553168947D59DCC912042351377AC5FB32"); return new X9ECParameters(curve, G, n, h); } function secp192k1() { // p = 2^192 - 2^32 - 2^12 - 2^8 - 2^7 - 2^6 - 2^3 - 1 var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFEE37"); var a = BigInteger.ZERO; var b = fromHex("3"); //byte[] S = null; var n = fromHex("FFFFFFFFFFFFFFFFFFFFFFFE26F2FC170F69466A74DEFD8D"); var h = BigInteger.ONE; var curve = new ECCurveFp(p, a, b); var G = curve.decodePointHex("04" + "DB4FF10EC057E9AE26B07D0280B7F4341DA5D1B1EAE06C7D" + "9B2F2F6D9C5628A7844163D015BE86344082AA88D95E2F9D"); return new X9ECParameters(curve, G, n, h); } function secp192r1() { // p = 2^192 - 2^64 - 1 var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFF"); var a = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFC"); var b = fromHex("64210519E59C80E70FA7E9AB72243049FEB8DEECC146B9B1"); //byte[] S = Hex.decode("3045AE6FC8422F64ED579528D38120EAE12196D5"); var n = fromHex("FFFFFFFFFFFFFFFFFFFFFFFF99DEF836146BC9B1B4D22831"); var h = BigInteger.ONE; var curve = new ECCurveFp(p, a, b); var G = curve.decodePointHex("04" + "188DA80EB03090F67CBF20EB43A18800F4FF0AFD82FF1012" + "07192B95FFC8DA78631011ED6B24CDD573F977A11E794811"); return new X9ECParameters(curve, G, n, h); } function secp224r1() { // p = 2^224 - 2^96 + 1 var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF000000000000000000000001"); var a = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFFFFFFFFFE"); var b = fromHex("B4050A850C04B3ABF54132565044B0B7D7BFD8BA270B39432355FFB4"); //byte[] S = Hex.decode("BD71344799D5C7FCDC45B59FA3B9AB8F6A948BC5"); var n = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFF16A2E0B8F03E13DD29455C5C2A3D"); var h = BigInteger.ONE; var curve = new ECCurveFp(p, a, b); var G = curve.decodePointHex("04" + "B70E0CBD6BB4BF7F321390B94A03C1D356C21122343280D6115C1D21" + "BD376388B5F723FB4C22DFE6CD4375A05A07476444D5819985007E34"); return new X9ECParameters(curve, G, n, h); } function secp256r1() { // p = 2^224 (2^32 - 1) + 2^192 + 2^96 - 1 var p = fromHex("FFFFFFFF00000001000000000000000000000000FFFFFFFFFFFFFFFFFFFFFFFF"); var a = fromHex("FFFFFFFF00000001000000000000000000000000FFFFFFFFFFFFFFFFFFFFFFFC"); var b = fromHex("5AC635D8AA3A93E7B3EBBD55769886BC651D06B0CC53B0F63BCE3C3E27D2604B"); //byte[] S = Hex.decode("C49D360886E704936A6678E1139D26B7819F7E90"); var n = fromHex("FFFFFFFF00000000FFFFFFFFFFFFFFFFBCE6FAADA7179E84F3B9CAC2FC632551"); var h = BigInteger.ONE; var curve = new ECCurveFp(p, a, b); var G = curve.decodePointHex("04" + "6B17D1F2E12C4247F8BCE6E563A440F277037D812DEB33A0F4A13945D898C296" + "4FE342E2FE1A7F9B8EE7EB4A7C0F9E162BCE33576B315ECECBB6406837BF51F5"); return new X9ECParameters(curve, G, n, h); } // TODO: make this into a proper hashtable function getSECCurveByName(name) { if(name == "secp128r1") return secp128r1(); if(name == "secp160k1") return secp160k1(); if(name == "secp160r1") return secp160r1(); if(name == "secp192k1") return secp192k1(); if(name == "secp192r1") return secp192r1(); if(name == "secp224r1") return secp224r1(); if(name == "secp256r1") return secp256r1(); return null; } module.exports = { "secp128r1":secp128r1, "secp160k1":secp160k1, "secp160r1":secp160r1, "secp192k1":secp192k1, "secp192r1":secp192r1, "secp224r1":secp224r1, "secp256r1":secp256r1 } /***/ }), /***/ 964: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; var crypto = __webpack_require__(417) function randomString (size) { var bits = (size + 1) * 6 var buffer = crypto.randomBytes(Math.ceil(bits / 8)) var string = buffer.toString('base64').replace(/\+/g, '-').replace(/\//g, '_').replace(/=/g, '') return string.slice(0, size) } function calculatePayloadHash (payload, algorithm, contentType) { var hash = crypto.createHash(algorithm) hash.update('hawk.1.payload\n') hash.update((contentType ? contentType.split(';')[0].trim().toLowerCase() : '') + '\n') hash.update(payload || '') hash.update('\n') return hash.digest('base64') } exports.calculateMac = function (credentials, opts) { var normalized = 'hawk.1.header\n' + opts.ts + '\n' + opts.nonce + '\n' + (opts.method || '').toUpperCase() + '\n' + opts.resource + '\n' + opts.host.toLowerCase() + '\n' + opts.port + '\n' + (opts.hash || '') + '\n' if (opts.ext) { normalized = normalized + opts.ext.replace('\\', '\\\\').replace('\n', '\\n') } normalized = normalized + '\n' if (opts.app) { normalized = normalized + opts.app + '\n' + (opts.dlg || '') + '\n' } var hmac = crypto.createHmac(credentials.algorithm, credentials.key).update(normalized) var digest = hmac.digest('base64') return digest } exports.header = function (uri, method, opts) { var timestamp = opts.timestamp || Math.floor((Date.now() + (opts.localtimeOffsetMsec || 0)) / 1000) var credentials = opts.credentials if (!credentials || !credentials.id || !credentials.key || !credentials.algorithm) { return '' } if (['sha1', 'sha256'].indexOf(credentials.algorithm) === -1) { return '' } var artifacts = { ts: timestamp, nonce: opts.nonce || randomString(6), method: method, resource: uri.pathname + (uri.search || ''), host: uri.hostname, port: uri.port || (uri.protocol === 'http:' ? 80 : 443), hash: opts.hash, ext: opts.ext, app: opts.app, dlg: opts.dlg } if (!artifacts.hash && (opts.payload || opts.payload === '')) { artifacts.hash = calculatePayloadHash(opts.payload, credentials.algorithm, opts.contentType) } var mac = exports.calculateMac(credentials, artifacts) var hasExt = artifacts.ext !== null && artifacts.ext !== undefined && artifacts.ext !== '' var header = 'Hawk id="' + credentials.id + '", ts="' + artifacts.ts + '", nonce="' + artifacts.nonce + (artifacts.hash ? '", hash="' + artifacts.hash : '') + (hasExt ? '", ext="' + artifacts.ext.replace(/\\/g, '\\\\').replace(/"/g, '\\"') : '') + '", mac="' + mac + '"' if (artifacts.app) { header = header + ', app="' + artifacts.app + (artifacts.dlg ? '", dlg="' + artifacts.dlg : '') + '"' } return header } /***/ }), /***/ 967: /***/ (function(module) { "use strict"; module.exports = function generate_validate(it, $keyword, $ruleType) { var out = ''; var $async = it.schema.$async === true, $refKeywords = it.util.schemaHasRulesExcept(it.schema, it.RULES.all, '$ref'), $id = it.self._getId(it.schema); if (it.opts.strictKeywords) { var $unknownKwd = it.util.schemaUnknownRules(it.schema, it.RULES.keywords); if ($unknownKwd) { var $keywordsMsg = 'unknown keyword: ' + $unknownKwd; if (it.opts.strictKeywords === 'log') it.logger.warn($keywordsMsg); else throw new Error($keywordsMsg); } } if (it.isTop) { out += ' var validate = '; if ($async) { it.async = true; out += 'async '; } out += 'function(data, dataPath, parentData, parentDataProperty, rootData) { \'use strict\'; '; if ($id && (it.opts.sourceCode || it.opts.processCode)) { out += ' ' + ('/\*# sourceURL=' + $id + ' */') + ' '; } } if (typeof it.schema == 'boolean' || !($refKeywords || it.schema.$ref)) { var $keyword = 'false schema'; var $lvl = it.level; var $dataLvl = it.dataLevel; var $schema = it.schema[$keyword]; var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; var $errorKeyword; var $data = 'data' + ($dataLvl || ''); var $valid = 'valid' + $lvl; if (it.schema === false) { if (it.isTop) { $breakOnError = true; } else { out += ' var ' + ($valid) + ' = false; '; } var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ($errorKeyword || 'false schema') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; if (it.opts.messages !== false) { out += ' , message: \'boolean schema is false\' '; } if (it.opts.verbose) { out += ' , schema: false , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } } else { if (it.isTop) { if ($async) { out += ' return data; '; } else { out += ' validate.errors = null; return true; '; } } else { out += ' var ' + ($valid) + ' = true; '; } } if (it.isTop) { out += ' }; return validate; '; } return out; } if (it.isTop) { var $top = it.isTop, $lvl = it.level = 0, $dataLvl = it.dataLevel = 0, $data = 'data'; it.rootId = it.resolve.fullPath(it.self._getId(it.root.schema)); it.baseId = it.baseId || it.rootId; delete it.isTop; it.dataPathArr = [undefined]; if (it.schema.default !== undefined && it.opts.useDefaults && it.opts.strictDefaults) { var $defaultMsg = 'default is ignored in the schema root'; if (it.opts.strictDefaults === 'log') it.logger.warn($defaultMsg); else throw new Error($defaultMsg); } out += ' var vErrors = null; '; out += ' var errors = 0; '; out += ' if (rootData === undefined) rootData = data; '; } else { var $lvl = it.level, $dataLvl = it.dataLevel, $data = 'data' + ($dataLvl || ''); if ($id) it.baseId = it.resolve.url(it.baseId, $id); if ($async && !it.async) throw new Error('async schema in sync schema'); out += ' var errs_' + ($lvl) + ' = errors;'; } var $valid = 'valid' + $lvl, $breakOnError = !it.opts.allErrors, $closingBraces1 = '', $closingBraces2 = ''; var $errorKeyword; var $typeSchema = it.schema.type, $typeIsArray = Array.isArray($typeSchema); if ($typeSchema && it.opts.nullable && it.schema.nullable === true) { if ($typeIsArray) { if ($typeSchema.indexOf('null') == -1) $typeSchema = $typeSchema.concat('null'); } else if ($typeSchema != 'null') { $typeSchema = [$typeSchema, 'null']; $typeIsArray = true; } } if ($typeIsArray && $typeSchema.length == 1) { $typeSchema = $typeSchema[0]; $typeIsArray = false; } if (it.schema.$ref && $refKeywords) { if (it.opts.extendRefs == 'fail') { throw new Error('$ref: validation keywords used in schema at path "' + it.errSchemaPath + '" (see option extendRefs)'); } else if (it.opts.extendRefs !== true) { $refKeywords = false; it.logger.warn('$ref: keywords ignored in schema at path "' + it.errSchemaPath + '"'); } } if (it.schema.$comment && it.opts.$comment) { out += ' ' + (it.RULES.all.$comment.code(it, '$comment')); } if ($typeSchema) { if (it.opts.coerceTypes) { var $coerceToTypes = it.util.coerceToTypes(it.opts.coerceTypes, $typeSchema); } var $rulesGroup = it.RULES.types[$typeSchema]; if ($coerceToTypes || $typeIsArray || $rulesGroup === true || ($rulesGroup && !$shouldUseGroup($rulesGroup))) { var $schemaPath = it.schemaPath + '.type', $errSchemaPath = it.errSchemaPath + '/type'; var $schemaPath = it.schemaPath + '.type', $errSchemaPath = it.errSchemaPath + '/type', $method = $typeIsArray ? 'checkDataTypes' : 'checkDataType'; out += ' if (' + (it.util[$method]($typeSchema, $data, true)) + ') { '; if ($coerceToTypes) { var $dataType = 'dataType' + $lvl, $coerced = 'coerced' + $lvl; out += ' var ' + ($dataType) + ' = typeof ' + ($data) + '; '; if (it.opts.coerceTypes == 'array') { out += ' if (' + ($dataType) + ' == \'object\' && Array.isArray(' + ($data) + ')) ' + ($dataType) + ' = \'array\'; '; } out += ' var ' + ($coerced) + ' = undefined; '; var $bracesCoercion = ''; var arr1 = $coerceToTypes; if (arr1) { var $type, $i = -1, l1 = arr1.length - 1; while ($i < l1) { $type = arr1[$i += 1]; if ($i) { out += ' if (' + ($coerced) + ' === undefined) { '; $bracesCoercion += '}'; } if (it.opts.coerceTypes == 'array' && $type != 'array') { out += ' if (' + ($dataType) + ' == \'array\' && ' + ($data) + '.length == 1) { ' + ($coerced) + ' = ' + ($data) + ' = ' + ($data) + '[0]; ' + ($dataType) + ' = typeof ' + ($data) + '; } '; } if ($type == 'string') { out += ' if (' + ($dataType) + ' == \'number\' || ' + ($dataType) + ' == \'boolean\') ' + ($coerced) + ' = \'\' + ' + ($data) + '; else if (' + ($data) + ' === null) ' + ($coerced) + ' = \'\'; '; } else if ($type == 'number' || $type == 'integer') { out += ' if (' + ($dataType) + ' == \'boolean\' || ' + ($data) + ' === null || (' + ($dataType) + ' == \'string\' && ' + ($data) + ' && ' + ($data) + ' == +' + ($data) + ' '; if ($type == 'integer') { out += ' && !(' + ($data) + ' % 1)'; } out += ')) ' + ($coerced) + ' = +' + ($data) + '; '; } else if ($type == 'boolean') { out += ' if (' + ($data) + ' === \'false\' || ' + ($data) + ' === 0 || ' + ($data) + ' === null) ' + ($coerced) + ' = false; else if (' + ($data) + ' === \'true\' || ' + ($data) + ' === 1) ' + ($coerced) + ' = true; '; } else if ($type == 'null') { out += ' if (' + ($data) + ' === \'\' || ' + ($data) + ' === 0 || ' + ($data) + ' === false) ' + ($coerced) + ' = null; '; } else if (it.opts.coerceTypes == 'array' && $type == 'array') { out += ' if (' + ($dataType) + ' == \'string\' || ' + ($dataType) + ' == \'number\' || ' + ($dataType) + ' == \'boolean\' || ' + ($data) + ' == null) ' + ($coerced) + ' = [' + ($data) + ']; '; } } } out += ' ' + ($bracesCoercion) + ' if (' + ($coerced) + ' === undefined) { '; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ($errorKeyword || 'type') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { type: \''; if ($typeIsArray) { out += '' + ($typeSchema.join(",")); } else { out += '' + ($typeSchema); } out += '\' } '; if (it.opts.messages !== false) { out += ' , message: \'should be '; if ($typeIsArray) { out += '' + ($typeSchema.join(",")); } else { out += '' + ($typeSchema); } out += '\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } out += ' } else { '; var $parentData = $dataLvl ? 'data' + (($dataLvl - 1) || '') : 'parentData', $parentDataProperty = $dataLvl ? it.dataPathArr[$dataLvl] : 'parentDataProperty'; out += ' ' + ($data) + ' = ' + ($coerced) + '; '; if (!$dataLvl) { out += 'if (' + ($parentData) + ' !== undefined)'; } out += ' ' + ($parentData) + '[' + ($parentDataProperty) + '] = ' + ($coerced) + '; } '; } else { var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ($errorKeyword || 'type') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { type: \''; if ($typeIsArray) { out += '' + ($typeSchema.join(",")); } else { out += '' + ($typeSchema); } out += '\' } '; if (it.opts.messages !== false) { out += ' , message: \'should be '; if ($typeIsArray) { out += '' + ($typeSchema.join(",")); } else { out += '' + ($typeSchema); } out += '\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } } out += ' } '; } } if (it.schema.$ref && !$refKeywords) { out += ' ' + (it.RULES.all.$ref.code(it, '$ref')) + ' '; if ($breakOnError) { out += ' } if (errors === '; if ($top) { out += '0'; } else { out += 'errs_' + ($lvl); } out += ') { '; $closingBraces2 += '}'; } } else { var arr2 = it.RULES; if (arr2) { var $rulesGroup, i2 = -1, l2 = arr2.length - 1; while (i2 < l2) { $rulesGroup = arr2[i2 += 1]; if ($shouldUseGroup($rulesGroup)) { if ($rulesGroup.type) { out += ' if (' + (it.util.checkDataType($rulesGroup.type, $data)) + ') { '; } if (it.opts.useDefaults) { if ($rulesGroup.type == 'object' && it.schema.properties) { var $schema = it.schema.properties, $schemaKeys = Object.keys($schema); var arr3 = $schemaKeys; if (arr3) { var $propertyKey, i3 = -1, l3 = arr3.length - 1; while (i3 < l3) { $propertyKey = arr3[i3 += 1]; var $sch = $schema[$propertyKey]; if ($sch.default !== undefined) { var $passData = $data + it.util.getProperty($propertyKey); if (it.compositeRule) { if (it.opts.strictDefaults) { var $defaultMsg = 'default is ignored for: ' + $passData; if (it.opts.strictDefaults === 'log') it.logger.warn($defaultMsg); else throw new Error($defaultMsg); } } else { out += ' if (' + ($passData) + ' === undefined '; if (it.opts.useDefaults == 'empty') { out += ' || ' + ($passData) + ' === null || ' + ($passData) + ' === \'\' '; } out += ' ) ' + ($passData) + ' = '; if (it.opts.useDefaults == 'shared') { out += ' ' + (it.useDefault($sch.default)) + ' '; } else { out += ' ' + (JSON.stringify($sch.default)) + ' '; } out += '; '; } } } } } else if ($rulesGroup.type == 'array' && Array.isArray(it.schema.items)) { var arr4 = it.schema.items; if (arr4) { var $sch, $i = -1, l4 = arr4.length - 1; while ($i < l4) { $sch = arr4[$i += 1]; if ($sch.default !== undefined) { var $passData = $data + '[' + $i + ']'; if (it.compositeRule) { if (it.opts.strictDefaults) { var $defaultMsg = 'default is ignored for: ' + $passData; if (it.opts.strictDefaults === 'log') it.logger.warn($defaultMsg); else throw new Error($defaultMsg); } } else { out += ' if (' + ($passData) + ' === undefined '; if (it.opts.useDefaults == 'empty') { out += ' || ' + ($passData) + ' === null || ' + ($passData) + ' === \'\' '; } out += ' ) ' + ($passData) + ' = '; if (it.opts.useDefaults == 'shared') { out += ' ' + (it.useDefault($sch.default)) + ' '; } else { out += ' ' + (JSON.stringify($sch.default)) + ' '; } out += '; '; } } } } } } var arr5 = $rulesGroup.rules; if (arr5) { var $rule, i5 = -1, l5 = arr5.length - 1; while (i5 < l5) { $rule = arr5[i5 += 1]; if ($shouldUseRule($rule)) { var $code = $rule.code(it, $rule.keyword, $rulesGroup.type); if ($code) { out += ' ' + ($code) + ' '; if ($breakOnError) { $closingBraces1 += '}'; } } } } } if ($breakOnError) { out += ' ' + ($closingBraces1) + ' '; $closingBraces1 = ''; } if ($rulesGroup.type) { out += ' } '; if ($typeSchema && $typeSchema === $rulesGroup.type && !$coerceToTypes) { out += ' else { '; var $schemaPath = it.schemaPath + '.type', $errSchemaPath = it.errSchemaPath + '/type'; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { out += ' { keyword: \'' + ($errorKeyword || 'type') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { type: \''; if ($typeIsArray) { out += '' + ($typeSchema.join(",")); } else { out += '' + ($typeSchema); } out += '\' } '; if (it.opts.messages !== false) { out += ' , message: \'should be '; if ($typeIsArray) { out += '' + ($typeSchema.join(",")); } else { out += '' + ($typeSchema); } out += '\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { out += ' {} '; } var __err = out; out = $$outStack.pop(); if (!it.compositeRule && $breakOnError) { /* istanbul ignore if */ if (it.async) { out += ' throw new ValidationError([' + (__err) + ']); '; } else { out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } out += ' } '; } } if ($breakOnError) { out += ' if (errors === '; if ($top) { out += '0'; } else { out += 'errs_' + ($lvl); } out += ') { '; $closingBraces2 += '}'; } } } } } if ($breakOnError) { out += ' ' + ($closingBraces2) + ' '; } if ($top) { if ($async) { out += ' if (errors === 0) return data; '; out += ' else throw new ValidationError(vErrors); '; } else { out += ' validate.errors = vErrors; '; out += ' return errors === 0; '; } out += ' }; return validate;'; } else { out += ' var ' + ($valid) + ' = errors === errs_' + ($lvl) + ';'; } out = it.util.cleanUpCode(out); if ($top) { out = it.util.finalCleanUpCode(out, $async); } function $shouldUseGroup($rulesGroup) { var rules = $rulesGroup.rules; for (var i = 0; i < rules.length; i++) if ($shouldUseRule(rules[i])) return true; } function $shouldUseRule($rule) { return it.schema[$rule.keyword] !== undefined || ($rule.implements && $ruleImplementsSomeKeyword($rule)); } function $ruleImplementsSomeKeyword($rule) { var impl = $rule.implements; for (var i = 0; i < impl.length; i++) if (it.schema[impl[i]] !== undefined) return true; } return out; } /***/ }), /***/ 972: /***/ (function(module, __unusedexports, __webpack_require__) { /*! * mime-db * Copyright(c) 2014 Jonathan Ong * MIT Licensed */ /** * Module exports. */ module.exports = __webpack_require__(512) /***/ }), /***/ 982: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2017 Joyent, Inc. module.exports = { read: read, write: write }; var assert = __webpack_require__(477); var Buffer = __webpack_require__(215).Buffer; var Key = __webpack_require__(852); var PrivateKey = __webpack_require__(502); var utils = __webpack_require__(270); var SSHBuffer = __webpack_require__(940); var Dhe = __webpack_require__(290); var supportedAlgos = { 'rsa-sha1' : 5, 'rsa-sha256' : 8, 'rsa-sha512' : 10, 'ecdsa-p256-sha256' : 13, 'ecdsa-p384-sha384' : 14 /* * ed25519 is hypothetically supported with id 15 * but the common tools available don't appear to be * capable of generating/using ed25519 keys */ }; var supportedAlgosById = {}; Object.keys(supportedAlgos).forEach(function (k) { supportedAlgosById[supportedAlgos[k]] = k.toUpperCase(); }); function read(buf, options) { if (typeof (buf) !== 'string') { assert.buffer(buf, 'buf'); buf = buf.toString('ascii'); } var lines = buf.split('\n'); if (lines[0].match(/^Private-key-format\: v1/)) { var algElems = lines[1].split(' '); var algoNum = parseInt(algElems[1], 10); var algoName = algElems[2]; if (!supportedAlgosById[algoNum]) throw (new Error('Unsupported algorithm: ' + algoName)); return (readDNSSECPrivateKey(algoNum, lines.slice(2))); } // skip any comment-lines var line = 0; /* JSSTYLED */ while (lines[line].match(/^\;/)) line++; // we should now have *one single* line left with our KEY on it. if ((lines[line].match(/\. IN KEY /) || lines[line].match(/\. IN DNSKEY /)) && lines[line+1].length === 0) { return (readRFC3110(lines[line])); } throw (new Error('Cannot parse dnssec key')); } function readRFC3110(keyString) { var elems = keyString.split(' '); //unused var flags = parseInt(elems[3], 10); //unused var protocol = parseInt(elems[4], 10); var algorithm = parseInt(elems[5], 10); if (!supportedAlgosById[algorithm]) throw (new Error('Unsupported algorithm: ' + algorithm)); var base64key = elems.slice(6, elems.length).join(); var keyBuffer = Buffer.from(base64key, 'base64'); if (supportedAlgosById[algorithm].match(/^RSA-/)) { // join the rest of the body into a single base64-blob var publicExponentLen = keyBuffer.readUInt8(0); if (publicExponentLen != 3 && publicExponentLen != 1) throw (new Error('Cannot parse dnssec key: ' + 'unsupported exponent length')); var publicExponent = keyBuffer.slice(1, publicExponentLen+1); publicExponent = utils.mpNormalize(publicExponent); var modulus = keyBuffer.slice(1+publicExponentLen); modulus = utils.mpNormalize(modulus); // now, make the key var rsaKey = { type: 'rsa', parts: [] }; rsaKey.parts.push({ name: 'e', data: publicExponent}); rsaKey.parts.push({ name: 'n', data: modulus}); return (new Key(rsaKey)); } if (supportedAlgosById[algorithm] === 'ECDSA-P384-SHA384' || supportedAlgosById[algorithm] === 'ECDSA-P256-SHA256') { var curve = 'nistp384'; var size = 384; if (supportedAlgosById[algorithm].match(/^ECDSA-P256-SHA256/)) { curve = 'nistp256'; size = 256; } var ecdsaKey = { type: 'ecdsa', curve: curve, size: size, parts: [ {name: 'curve', data: Buffer.from(curve) }, {name: 'Q', data: utils.ecNormalize(keyBuffer) } ] }; return (new Key(ecdsaKey)); } throw (new Error('Unsupported algorithm: ' + supportedAlgosById[algorithm])); } function elementToBuf(e) { return (Buffer.from(e.split(' ')[1], 'base64')); } function readDNSSECRSAPrivateKey(elements) { var rsaParams = {}; elements.forEach(function (element) { if (element.split(' ')[0] === 'Modulus:') rsaParams['n'] = elementToBuf(element); else if (element.split(' ')[0] === 'PublicExponent:') rsaParams['e'] = elementToBuf(element); else if (element.split(' ')[0] === 'PrivateExponent:') rsaParams['d'] = elementToBuf(element); else if (element.split(' ')[0] === 'Prime1:') rsaParams['p'] = elementToBuf(element); else if (element.split(' ')[0] === 'Prime2:') rsaParams['q'] = elementToBuf(element); else if (element.split(' ')[0] === 'Exponent1:') rsaParams['dmodp'] = elementToBuf(element); else if (element.split(' ')[0] === 'Exponent2:') rsaParams['dmodq'] = elementToBuf(element); else if (element.split(' ')[0] === 'Coefficient:') rsaParams['iqmp'] = elementToBuf(element); }); // now, make the key var key = { type: 'rsa', parts: [ { name: 'e', data: utils.mpNormalize(rsaParams['e'])}, { name: 'n', data: utils.mpNormalize(rsaParams['n'])}, { name: 'd', data: utils.mpNormalize(rsaParams['d'])}, { name: 'p', data: utils.mpNormalize(rsaParams['p'])}, { name: 'q', data: utils.mpNormalize(rsaParams['q'])}, { name: 'dmodp', data: utils.mpNormalize(rsaParams['dmodp'])}, { name: 'dmodq', data: utils.mpNormalize(rsaParams['dmodq'])}, { name: 'iqmp', data: utils.mpNormalize(rsaParams['iqmp'])} ] }; return (new PrivateKey(key)); } function readDNSSECPrivateKey(alg, elements) { if (supportedAlgosById[alg].match(/^RSA-/)) { return (readDNSSECRSAPrivateKey(elements)); } if (supportedAlgosById[alg] === 'ECDSA-P384-SHA384' || supportedAlgosById[alg] === 'ECDSA-P256-SHA256') { var d = Buffer.from(elements[0].split(' ')[1], 'base64'); var curve = 'nistp384'; var size = 384; if (supportedAlgosById[alg] === 'ECDSA-P256-SHA256') { curve = 'nistp256'; size = 256; } // DNSSEC generates the public-key on the fly (go calculate it) var publicKey = utils.publicFromPrivateECDSA(curve, d); var Q = publicKey.part['Q'].data; var ecdsaKey = { type: 'ecdsa', curve: curve, size: size, parts: [ {name: 'curve', data: Buffer.from(curve) }, {name: 'd', data: d }, {name: 'Q', data: Q } ] }; return (new PrivateKey(ecdsaKey)); } throw (new Error('Unsupported algorithm: ' + supportedAlgosById[alg])); } function dnssecTimestamp(date) { var year = date.getFullYear() + ''; //stringify var month = (date.getMonth() + 1); var timestampStr = year + month + date.getUTCDate(); timestampStr += '' + date.getUTCHours() + date.getUTCMinutes(); timestampStr += date.getUTCSeconds(); return (timestampStr); } function rsaAlgFromOptions(opts) { if (!opts || !opts.hashAlgo || opts.hashAlgo === 'sha1') return ('5 (RSASHA1)'); else if (opts.hashAlgo === 'sha256') return ('8 (RSASHA256)'); else if (opts.hashAlgo === 'sha512') return ('10 (RSASHA512)'); else throw (new Error('Unknown or unsupported hash: ' + opts.hashAlgo)); } function writeRSA(key, options) { // if we're missing parts, add them. if (!key.part.dmodp || !key.part.dmodq) { utils.addRSAMissing(key); } var out = ''; out += 'Private-key-format: v1.3\n'; out += 'Algorithm: ' + rsaAlgFromOptions(options) + '\n'; var n = utils.mpDenormalize(key.part['n'].data); out += 'Modulus: ' + n.toString('base64') + '\n'; var e = utils.mpDenormalize(key.part['e'].data); out += 'PublicExponent: ' + e.toString('base64') + '\n'; var d = utils.mpDenormalize(key.part['d'].data); out += 'PrivateExponent: ' + d.toString('base64') + '\n'; var p = utils.mpDenormalize(key.part['p'].data); out += 'Prime1: ' + p.toString('base64') + '\n'; var q = utils.mpDenormalize(key.part['q'].data); out += 'Prime2: ' + q.toString('base64') + '\n'; var dmodp = utils.mpDenormalize(key.part['dmodp'].data); out += 'Exponent1: ' + dmodp.toString('base64') + '\n'; var dmodq = utils.mpDenormalize(key.part['dmodq'].data); out += 'Exponent2: ' + dmodq.toString('base64') + '\n'; var iqmp = utils.mpDenormalize(key.part['iqmp'].data); out += 'Coefficient: ' + iqmp.toString('base64') + '\n'; // Assume that we're valid as-of now var timestamp = new Date(); out += 'Created: ' + dnssecTimestamp(timestamp) + '\n'; out += 'Publish: ' + dnssecTimestamp(timestamp) + '\n'; out += 'Activate: ' + dnssecTimestamp(timestamp) + '\n'; return (Buffer.from(out, 'ascii')); } function writeECDSA(key, options) { var out = ''; out += 'Private-key-format: v1.3\n'; if (key.curve === 'nistp256') { out += 'Algorithm: 13 (ECDSAP256SHA256)\n'; } else if (key.curve === 'nistp384') { out += 'Algorithm: 14 (ECDSAP384SHA384)\n'; } else { throw (new Error('Unsupported curve')); } var base64Key = key.part['d'].data.toString('base64'); out += 'PrivateKey: ' + base64Key + '\n'; // Assume that we're valid as-of now var timestamp = new Date(); out += 'Created: ' + dnssecTimestamp(timestamp) + '\n'; out += 'Publish: ' + dnssecTimestamp(timestamp) + '\n'; out += 'Activate: ' + dnssecTimestamp(timestamp) + '\n'; return (Buffer.from(out, 'ascii')); } function write(key, options) { if (PrivateKey.isPrivateKey(key)) { if (key.type === 'rsa') { return (writeRSA(key, options)); } else if (key.type === 'ecdsa') { return (writeECDSA(key, options)); } else { throw (new Error('Unsupported algorithm: ' + key.type)); } } else if (Key.isKey(key)) { /* * RFC3110 requires a keyname, and a keytype, which we * don't really have a mechanism for specifying such * additional metadata. */ throw (new Error('Format "dnssec" only supports ' + 'writing private keys')); } else { throw (new Error('key is not a Key or PrivateKey')); } } /***/ }), /***/ 985: /***/ (function(module) { module.exports = function(size) { return new LruCache(size) } function LruCache(size) { this.capacity = size | 0 this.map = Object.create(null) this.list = new DoublyLinkedList() } LruCache.prototype.get = function(key) { var node = this.map[key] if (node == null) return undefined this.used(node) return node.val } LruCache.prototype.set = function(key, val) { var node = this.map[key] if (node != null) { node.val = val } else { if (!this.capacity) this.prune() if (!this.capacity) return false node = new DoublyLinkedNode(key, val) this.map[key] = node this.capacity-- } this.used(node) return true } LruCache.prototype.used = function(node) { this.list.moveToFront(node) } LruCache.prototype.prune = function() { var node = this.list.pop() if (node != null) { delete this.map[node.key] this.capacity++ } } function DoublyLinkedList() { this.firstNode = null this.lastNode = null } DoublyLinkedList.prototype.moveToFront = function(node) { if (this.firstNode == node) return this.remove(node) if (this.firstNode == null) { this.firstNode = node this.lastNode = node node.prev = null node.next = null } else { node.prev = null node.next = this.firstNode node.next.prev = node this.firstNode = node } } DoublyLinkedList.prototype.pop = function() { var lastNode = this.lastNode if (lastNode != null) { this.remove(lastNode) } return lastNode } DoublyLinkedList.prototype.remove = function(node) { if (this.firstNode == node) { this.firstNode = node.next } else if (node.prev != null) { node.prev.next = node.next } if (this.lastNode == node) { this.lastNode = node.prev } else if (node.next != null) { node.next.prev = node.prev } } function DoublyLinkedNode(key, val) { this.key = key this.val = val this.prev = null this.next = null } /***/ }), /***/ 986: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } return new (P || (P = Promise))(function (resolve, reject) { function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } step((generator = generator.apply(thisArg, _arguments || [])).next()); }); }; Object.defineProperty(exports, "__esModule", { value: true }); const tr = __webpack_require__(9); /** * Exec a command. * Output will be streamed to the live console. * Returns promise with return code * * @param commandLine command to execute (can include additional args). Must be correctly escaped. * @param args optional arguments for tool. Escaping is handled by the lib. * @param options optional exec options. See ExecOptions * @returns Promise exit code */ function exec(commandLine, args, options) { return __awaiter(this, void 0, void 0, function* () { const commandArgs = tr.argStringToArray(commandLine); if (commandArgs.length === 0) { throw new Error(`Parameter 'commandLine' cannot be null or empty.`); } // Path to tool to execute should be first arg const toolPath = commandArgs[0]; args = commandArgs.slice(1).concat(args || []); const runner = new tr.ToolRunner(toolPath, args, options); return runner.exec(); }); } exports.exec = exec; //# sourceMappingURL=exec.js.map /***/ }), /***/ 993: /***/ (function(module) { module.exports = {"$id":"cache.json#","$schema":"http://json-schema.org/draft-06/schema#","properties":{"beforeRequest":{"oneOf":[{"type":"null"},{"$ref":"beforeRequest.json#"}]},"afterRequest":{"oneOf":[{"type":"null"},{"$ref":"afterRequest.json#"}]},"comment":{"type":"string"}}}; /***/ }), /***/ 998: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2011 Mark Cavage All rights reserved. var assert = __webpack_require__(357); var Buffer = __webpack_require__(215).Buffer; var ASN1 = __webpack_require__(362); var errors = __webpack_require__(584); // --- Globals var newInvalidAsn1Error = errors.newInvalidAsn1Error; var DEFAULT_OPTS = { size: 1024, growthFactor: 8 }; // --- Helpers function merge(from, to) { assert.ok(from); assert.equal(typeof (from), 'object'); assert.ok(to); assert.equal(typeof (to), 'object'); var keys = Object.getOwnPropertyNames(from); keys.forEach(function (key) { if (to[key]) return; var value = Object.getOwnPropertyDescriptor(from, key); Object.defineProperty(to, key, value); }); return to; } // --- API function Writer(options) { options = merge(DEFAULT_OPTS, options || {}); this._buf = Buffer.alloc(options.size || 1024); this._size = this._buf.length; this._offset = 0; this._options = options; // A list of offsets in the buffer where we need to insert // sequence tag/len pairs. this._seq = []; } Object.defineProperty(Writer.prototype, 'buffer', { get: function () { if (this._seq.length) throw newInvalidAsn1Error(this._seq.length + ' unended sequence(s)'); return (this._buf.slice(0, this._offset)); } }); Writer.prototype.writeByte = function (b) { if (typeof (b) !== 'number') throw new TypeError('argument must be a Number'); this._ensure(1); this._buf[this._offset++] = b; }; Writer.prototype.writeInt = function (i, tag) { if (typeof (i) !== 'number') throw new TypeError('argument must be a Number'); if (typeof (tag) !== 'number') tag = ASN1.Integer; var sz = 4; while ((((i & 0xff800000) === 0) || ((i & 0xff800000) === 0xff800000 >> 0)) && (sz > 1)) { sz--; i <<= 8; } if (sz > 4) throw newInvalidAsn1Error('BER ints cannot be > 0xffffffff'); this._ensure(2 + sz); this._buf[this._offset++] = tag; this._buf[this._offset++] = sz; while (sz-- > 0) { this._buf[this._offset++] = ((i & 0xff000000) >>> 24); i <<= 8; } }; Writer.prototype.writeNull = function () { this.writeByte(ASN1.Null); this.writeByte(0x00); }; Writer.prototype.writeEnumeration = function (i, tag) { if (typeof (i) !== 'number') throw new TypeError('argument must be a Number'); if (typeof (tag) !== 'number') tag = ASN1.Enumeration; return this.writeInt(i, tag); }; Writer.prototype.writeBoolean = function (b, tag) { if (typeof (b) !== 'boolean') throw new TypeError('argument must be a Boolean'); if (typeof (tag) !== 'number') tag = ASN1.Boolean; this._ensure(3); this._buf[this._offset++] = tag; this._buf[this._offset++] = 0x01; this._buf[this._offset++] = b ? 0xff : 0x00; }; Writer.prototype.writeString = function (s, tag) { if (typeof (s) !== 'string') throw new TypeError('argument must be a string (was: ' + typeof (s) + ')'); if (typeof (tag) !== 'number') tag = ASN1.OctetString; var len = Buffer.byteLength(s); this.writeByte(tag); this.writeLength(len); if (len) { this._ensure(len); this._buf.write(s, this._offset); this._offset += len; } }; Writer.prototype.writeBuffer = function (buf, tag) { if (typeof (tag) !== 'number') throw new TypeError('tag must be a number'); if (!Buffer.isBuffer(buf)) throw new TypeError('argument must be a buffer'); this.writeByte(tag); this.writeLength(buf.length); this._ensure(buf.length); buf.copy(this._buf, this._offset, 0, buf.length); this._offset += buf.length; }; Writer.prototype.writeStringArray = function (strings) { if ((!strings instanceof Array)) throw new TypeError('argument must be an Array[String]'); var self = this; strings.forEach(function (s) { self.writeString(s); }); }; // This is really to solve DER cases, but whatever for now Writer.prototype.writeOID = function (s, tag) { if (typeof (s) !== 'string') throw new TypeError('argument must be a string'); if (typeof (tag) !== 'number') tag = ASN1.OID; if (!/^([0-9]+\.){3,}[0-9]+$/.test(s)) throw new Error('argument is not a valid OID string'); function encodeOctet(bytes, octet) { if (octet < 128) { bytes.push(octet); } else if (octet < 16384) { bytes.push((octet >>> 7) | 0x80); bytes.push(octet & 0x7F); } else if (octet < 2097152) { bytes.push((octet >>> 14) | 0x80); bytes.push(((octet >>> 7) | 0x80) & 0xFF); bytes.push(octet & 0x7F); } else if (octet < 268435456) { bytes.push((octet >>> 21) | 0x80); bytes.push(((octet >>> 14) | 0x80) & 0xFF); bytes.push(((octet >>> 7) | 0x80) & 0xFF); bytes.push(octet & 0x7F); } else { bytes.push(((octet >>> 28) | 0x80) & 0xFF); bytes.push(((octet >>> 21) | 0x80) & 0xFF); bytes.push(((octet >>> 14) | 0x80) & 0xFF); bytes.push(((octet >>> 7) | 0x80) & 0xFF); bytes.push(octet & 0x7F); } } var tmp = s.split('.'); var bytes = []; bytes.push(parseInt(tmp[0], 10) * 40 + parseInt(tmp[1], 10)); tmp.slice(2).forEach(function (b) { encodeOctet(bytes, parseInt(b, 10)); }); var self = this; this._ensure(2 + bytes.length); this.writeByte(tag); this.writeLength(bytes.length); bytes.forEach(function (b) { self.writeByte(b); }); }; Writer.prototype.writeLength = function (len) { if (typeof (len) !== 'number') throw new TypeError('argument must be a Number'); this._ensure(4); if (len <= 0x7f) { this._buf[this._offset++] = len; } else if (len <= 0xff) { this._buf[this._offset++] = 0x81; this._buf[this._offset++] = len; } else if (len <= 0xffff) { this._buf[this._offset++] = 0x82; this._buf[this._offset++] = len >> 8; this._buf[this._offset++] = len; } else if (len <= 0xffffff) { this._buf[this._offset++] = 0x83; this._buf[this._offset++] = len >> 16; this._buf[this._offset++] = len >> 8; this._buf[this._offset++] = len; } else { throw newInvalidAsn1Error('Length too long (> 4 bytes)'); } }; Writer.prototype.startSequence = function (tag) { if (typeof (tag) !== 'number') tag = ASN1.Sequence | ASN1.Constructor; this.writeByte(tag); this._seq.push(this._offset); this._ensure(3); this._offset += 3; }; Writer.prototype.endSequence = function () { var seq = this._seq.pop(); var start = seq + 3; var len = this._offset - start; if (len <= 0x7f) { this._shift(start, len, -2); this._buf[seq] = len; } else if (len <= 0xff) { this._shift(start, len, -1); this._buf[seq] = 0x81; this._buf[seq + 1] = len; } else if (len <= 0xffff) { this._buf[seq] = 0x82; this._buf[seq + 1] = len >> 8; this._buf[seq + 2] = len; } else if (len <= 0xffffff) { this._shift(start, len, 1); this._buf[seq] = 0x83; this._buf[seq + 1] = len >> 16; this._buf[seq + 2] = len >> 8; this._buf[seq + 3] = len; } else { throw newInvalidAsn1Error('Sequence too long'); } }; Writer.prototype._shift = function (start, len, shift) { assert.ok(start !== undefined); assert.ok(len !== undefined); assert.ok(shift); this._buf.copy(this._buf, start + shift, start, start + len); this._offset += shift; }; Writer.prototype._ensure = function (len) { assert.ok(len); if (this._size - this._offset < len) { var sz = this._size * this._options.growthFactor; if (sz - this._offset < len) sz += len; var buf = Buffer.alloc(sz); this._buf.copy(buf, 0, 0, this._offset); this._buf = buf; this._size = sz; } }; // --- Exported API module.exports = Writer; /***/ }) /******/ });